From 2c998a3c59af5a35cd4096eb275d0e7800be477f Mon Sep 17 00:00:00 2001 From: Ingrid Date: Tue, 1 Jul 2025 07:54:58 -0400 Subject: [PATCH 01/48] header wording --- index.html | 5 +++-- styles/main.css | 6 ++++++ 2 files changed, 9 insertions(+), 2 deletions(-) diff --git a/index.html b/index.html index 1709424..027be83 100644 --- a/index.html +++ b/index.html @@ -8,7 +8,8 @@
-

Welcome To Semillas

+

Semillas

+

Growing Latino Leaders at The Ohio State University

- -
diff --git a/styles/main.css b/styles/main.css index 7016af3..f27f369 100644 --- a/styles/main.css +++ b/styles/main.css @@ -30,7 +30,6 @@ header h1 { color: #4e402b; text-shadow: 1px 1px 4px rgba(0, 0, 0, 0.2); font-size: 1.5rem; - padding: 0.2rem; } footer{ @@ -111,8 +110,8 @@ body { .wrapper { background-color: #E1E2E2; overflow: hidden; - position: relative; width: 90%; + max-width: 960px; display: flex; align-items: center; padding: 0 20px; @@ -272,7 +271,7 @@ main section { font-weight: 100; font-size: 1.2rem; overflow: hidden; - background-color: rgb(208, 247, 214); + background-color: #e8ffe3f0; padding: 0.5em 0; border-top-left-radius: 16px; border-top-right-radius: 16px; @@ -280,7 +279,8 @@ main section { border-bottom: 3px solid #5cad5f;*/ color: #5cad5f; position: relative; - flex-shrink: 0} + flex-shrink: 0; +} .scrolling-content { display: inline-block; From 348062b9c7e838d931d50223613501302c145b63 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 19:02:06 -0400 Subject: [PATCH 29/48] buttons --- styles/main.css | 7 +++---- 1 file changed, 3 insertions(+), 4 deletions(-) diff --git a/styles/main.css b/styles/main.css index f27f369..a57ffe0 100644 --- a/styles/main.css +++ b/styles/main.css @@ -71,10 +71,8 @@ h2 { } nav { - margin-top: 1em; - display: flex; - gap: 1.5em; - justify-content: center; + position: relative; + z-index: 3; } .nav-button { @@ -127,6 +125,7 @@ body { height: 400px; width: 600px; z-index: 2; + pointer-events: none; } .wrapper:after { From 17d13b1ec8f847864ad3d3fc1632c41e75b24541 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 19:23:24 -0400 Subject: [PATCH 30/48] zoom out image caorusel --- styles/main.css | 11 ++++++----- 1 file changed, 6 insertions(+), 5 deletions(-) diff --git a/styles/main.css b/styles/main.css index a57ffe0..2ef279c 100644 --- a/styles/main.css +++ b/styles/main.css @@ -98,7 +98,7 @@ nav { } body { - background-color: rgb(152, 181, 138); + background-color: rgb(152, 181, 138); height: 100vh; display: block; align-items: center; @@ -117,6 +117,7 @@ body { border-radius: 16px; aspect-ratio:16/9; flex-direction: column; + overflow-x: auto; } .wrapper:before, .wrapper:after { @@ -148,14 +149,14 @@ body { .wrapper .logo { flex: 0 0 auto; - height: calc(100%/1); - width: 100%; + height: 100%; + width: 300px; } .wrapper .logo img { height: 100%; - width: 100%; - object-fit: cover; + width: auto; + object-fit: contain; display: block; } From 4c4ac7ffc52e02cdbca5bc7032e8e79636165433 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 19:49:18 -0400 Subject: [PATCH 31/48] image adjustments --- styles/main.css | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/styles/main.css b/styles/main.css index 2ef279c..c4d6231 100644 --- a/styles/main.css +++ b/styles/main.css @@ -149,15 +149,15 @@ body { .wrapper .logo { flex: 0 0 auto; - height: 100%; + height: auto; width: 300px; } .wrapper .logo img { - height: 100%; - width: auto; - object-fit: contain; - display: block; + height: auto; + width: 100%; + object-fit: cover; + object-position: center; } @keyframes scroll { From d7499afb3f119d94b822aa52313b4978398e672b Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 20:02:54 -0400 Subject: [PATCH 32/48] make images fill up the whole carousel --- styles/main.css | 11 ++++++++--- 1 file changed, 8 insertions(+), 3 deletions(-) diff --git a/styles/main.css b/styles/main.css index c4d6231..4165f20 100644 --- a/styles/main.css +++ b/styles/main.css @@ -149,15 +149,20 @@ body { .wrapper .logo { flex: 0 0 auto; - height: auto; + height: 100%; width: 300px; + display: flex; + align-items: center; + justify-content: center; + overflow: hidden; /* Crop any excess */ } .wrapper .logo img { - height: auto; - width: 100%; + min-width: 100%; + min-height: 100%; object-fit: cover; object-position: center; + display: block; } @keyframes scroll { From bb1f6e9b93ac3e81a4b11087db5f020ee936756e Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 20:09:52 -0400 Subject: [PATCH 33/48] adjust image width --- styles/main.css | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/styles/main.css b/styles/main.css index 4165f20..da23138 100644 --- a/styles/main.css +++ b/styles/main.css @@ -148,9 +148,9 @@ body { } .wrapper .logo { - flex: 0 0 auto; + flex: 0 0 100%; height: 100%; - width: 300px; + /* width: 300px; */ display: flex; align-items: center; justify-content: center; From 70c129a380c90fa8652c86778e59362da5d60cd3 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 20:17:25 -0400 Subject: [PATCH 34/48] every pic is 16/9 --- styles/main.css | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/styles/main.css b/styles/main.css index da23138..568ba46 100644 --- a/styles/main.css +++ b/styles/main.css @@ -149,7 +149,8 @@ body { .wrapper .logo { flex: 0 0 100%; - height: 100%; + aspect-ratio: 16/9; + /* height: 100%; */ /* width: 300px; */ display: flex; align-items: center; From a2ec5c1c0131333aaea161f692a1be4b1fc1d923 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 20:19:30 -0400 Subject: [PATCH 35/48] object fit contain for images --- styles/main.css | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/styles/main.css b/styles/main.css index 568ba46..4cc9765 100644 --- a/styles/main.css +++ b/styles/main.css @@ -161,7 +161,7 @@ body { .wrapper .logo img { min-width: 100%; min-height: 100%; - object-fit: cover; + object-fit: contain; object-position: center; display: block; } From 582a3d2189d7bcff0ca40cad9427fb8b70f373d6 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Wed, 2 Jul 2025 20:20:25 -0400 Subject: [PATCH 36/48] scrolling banner background --- styles/main.css | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/styles/main.css b/styles/main.css index 4cc9765..6d6ffa9 100644 --- a/styles/main.css +++ b/styles/main.css @@ -277,7 +277,7 @@ main section { font-weight: 100; font-size: 1.2rem; overflow: hidden; - background-color: #e8ffe3f0; + background-color: white; padding: 0.5em 0; border-top-left-radius: 16px; border-top-right-radius: 16px; From 3e70abd34739e94e970a4e739e62bcd23fd127a7 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 07:44:02 -0400 Subject: [PATCH 37/48] image carousel --- styles/main.css | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/styles/main.css b/styles/main.css index 6d6ffa9..3802df6 100644 --- a/styles/main.css +++ b/styles/main.css @@ -143,7 +143,7 @@ body { .wrapper .track { display: flex; flex-wrap: nowrap; - width: max-content; + width: fit-content; animation: scroll 20s linear infinite; } @@ -159,18 +159,18 @@ body { } .wrapper .logo img { - min-width: 100%; - min-height: 100%; + width: 100%; + height: 100%; object-fit: contain; object-position: center; display: block; } @keyframes scroll { - from { + 0% { transform: translateX(0%); } - to { + 100% { transform: translateX(calc(-50%)); } } From 64045ed7b9ee5d427f1e1e66617cad78dec42a4c Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 07:49:23 -0400 Subject: [PATCH 38/48] color changes --- styles/main.css | 5 +++++ 1 file changed, 5 insertions(+) diff --git a/styles/main.css b/styles/main.css index 3802df6..ad5136b 100644 --- a/styles/main.css +++ b/styles/main.css @@ -68,6 +68,7 @@ h1 { h2 { color: white; + font-size: 2rem; } nav { @@ -247,6 +248,10 @@ main section { border-radius: 16px; /* โ† adds rounded corners */ } +.coordinator h2{ + color: green; +} + .coordinator-content { display: flex; align-items: center; From 708cd4033e2c5106de455d9d59fb8b03e5191afe Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 07:57:30 -0400 Subject: [PATCH 39/48] images --- styles/main.css | 16 ++++++++++++---- 1 file changed, 12 insertions(+), 4 deletions(-) diff --git a/styles/main.css b/styles/main.css index ad5136b..29eb341 100644 --- a/styles/main.css +++ b/styles/main.css @@ -119,6 +119,8 @@ body { aspect-ratio:16/9; flex-direction: column; overflow-x: auto; + -ms-overflow-style: none; + scrollbar-width: none; } .wrapper:before, .wrapper:after { @@ -149,8 +151,8 @@ body { } .wrapper .logo { - flex: 0 0 100%; - aspect-ratio: 16/9; + flex: 0 0 300px; + /* aspect-ratio: 16/9; */ /* height: 100%; */ /* width: 300px; */ display: flex; @@ -162,17 +164,23 @@ body { .wrapper .logo img { width: 100%; height: 100%; - object-fit: contain; + object-fit: cover; object-position: center; display: block; + +} + +.wrapper::-webkit-scrollbar { + display: none; } + @keyframes scroll { 0% { transform: translateX(0%); } 100% { - transform: translateX(calc(-50%)); + transform: translateX(-50%); } } From e25be2067ad17c3dfc765742bbaf6cfa46a9c75b Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 19:51:57 -0400 Subject: [PATCH 40/48] improved visibility --- index.html | 84 +- node_modules/.package-lock.json | 326 + node_modules/connect/HISTORY.md | 2503 +++++ node_modules/connect/LICENSE | 25 + node_modules/connect/README.md | 295 + node_modules/connect/SECURITY.md | 43 + node_modules/connect/index.js | 279 + node_modules/connect/package.json | 48 + node_modules/debug/.coveralls.yml | 1 + node_modules/debug/.eslintrc | 11 + node_modules/debug/.npmignore | 9 + node_modules/debug/.travis.yml | 14 + node_modules/debug/CHANGELOG.md | 362 + node_modules/debug/LICENSE | 19 + node_modules/debug/Makefile | 50 + node_modules/debug/README.md | 312 + node_modules/debug/component.json | 19 + node_modules/debug/karma.conf.js | 70 + node_modules/debug/node.js | 1 + node_modules/debug/package.json | 49 + node_modules/debug/src/browser.js | 185 + node_modules/debug/src/debug.js | 202 + node_modules/debug/src/index.js | 10 + node_modules/debug/src/inspector-log.js | 15 + node_modules/debug/src/node.js | 248 + node_modules/depd/History.md | 103 + node_modules/depd/LICENSE | 22 + node_modules/depd/Readme.md | 280 + node_modules/depd/index.js | 538 + node_modules/depd/lib/browser/index.js | 77 + node_modules/depd/package.json | 45 + node_modules/ee-first/LICENSE | 22 + node_modules/ee-first/README.md | 80 + node_modules/ee-first/index.js | 95 + node_modules/ee-first/package.json | 29 + node_modules/encodeurl/HISTORY.md | 14 + node_modules/encodeurl/LICENSE | 22 + node_modules/encodeurl/README.md | 128 + node_modules/encodeurl/index.js | 60 + node_modules/encodeurl/package.json | 40 + node_modules/escape-html/LICENSE | 24 + node_modules/escape-html/Readme.md | 43 + node_modules/escape-html/index.js | 78 + node_modules/escape-html/package.json | 24 + node_modules/etag/HISTORY.md | 83 + node_modules/etag/LICENSE | 22 + node_modules/etag/README.md | 159 + node_modules/etag/index.js | 131 + node_modules/etag/package.json | 47 + node_modules/finalhandler/HISTORY.md | 187 + node_modules/finalhandler/LICENSE | 22 + node_modules/finalhandler/README.md | 148 + node_modules/finalhandler/index.js | 331 + node_modules/finalhandler/package.json | 45 + node_modules/fresh/HISTORY.md | 80 + node_modules/fresh/LICENSE | 23 + node_modules/fresh/README.md | 117 + node_modules/fresh/index.js | 136 + node_modules/fresh/package.json | 46 + node_modules/http-errors/HISTORY.md | 180 + node_modules/http-errors/LICENSE | 23 + node_modules/http-errors/README.md | 169 + node_modules/http-errors/index.js | 289 + .../node_modules/statuses/HISTORY.md | 82 + .../http-errors/node_modules/statuses/LICENSE | 23 + .../node_modules/statuses/README.md | 136 + .../node_modules/statuses/codes.json | 65 + .../node_modules/statuses/index.js | 146 + .../node_modules/statuses/package.json | 49 + node_modules/http-errors/package.json | 50 + node_modules/inherits/LICENSE | 16 + node_modules/inherits/README.md | 42 + node_modules/inherits/inherits.js | 9 + node_modules/inherits/inherits_browser.js | 27 + node_modules/inherits/package.json | 29 + node_modules/mime-db/HISTORY.md | 541 + node_modules/mime-db/LICENSE | 23 + node_modules/mime-db/README.md | 109 + node_modules/mime-db/db.json | 9342 +++++++++++++++++ node_modules/mime-db/index.js | 12 + node_modules/mime-db/package.json | 56 + node_modules/mime-types/HISTORY.md | 421 + node_modules/mime-types/LICENSE | 23 + node_modules/mime-types/README.md | 126 + node_modules/mime-types/index.js | 211 + node_modules/mime-types/mimeScore.js | 52 + node_modules/mime-types/package.json | 45 + node_modules/ms/index.js | 152 + node_modules/ms/license.md | 21 + node_modules/ms/package.json | 37 + node_modules/ms/readme.md | 51 + node_modules/on-finished/HISTORY.md | 88 + node_modules/on-finished/LICENSE | 23 + node_modules/on-finished/README.md | 154 + node_modules/on-finished/index.js | 196 + node_modules/on-finished/package.json | 31 + node_modules/parseurl/HISTORY.md | 58 + node_modules/parseurl/LICENSE | 24 + node_modules/parseurl/README.md | 133 + node_modules/parseurl/index.js | 158 + node_modules/parseurl/package.json | 40 + node_modules/range-parser/HISTORY.md | 56 + node_modules/range-parser/LICENSE | 23 + node_modules/range-parser/README.md | 84 + node_modules/range-parser/index.js | 162 + node_modules/range-parser/package.json | 44 + node_modules/send/HISTORY.md | 580 + node_modules/send/LICENSE | 23 + node_modules/send/README.md | 317 + node_modules/send/index.js | 997 ++ node_modules/send/node_modules/debug/LICENSE | 20 + .../send/node_modules/debug/README.md | 481 + .../send/node_modules/debug/package.json | 64 + .../send/node_modules/debug/src/browser.js | 272 + .../send/node_modules/debug/src/common.js | 292 + .../send/node_modules/debug/src/index.js | 10 + .../send/node_modules/debug/src/node.js | 263 + .../send/node_modules/encodeurl/LICENSE | 22 + .../send/node_modules/encodeurl/README.md | 109 + .../send/node_modules/encodeurl/index.js | 60 + .../send/node_modules/encodeurl/package.json | 40 + node_modules/send/node_modules/ms/index.js | 162 + node_modules/send/node_modules/ms/license.md | 21 + .../send/node_modules/ms/package.json | 38 + node_modules/send/node_modules/ms/readme.md | 59 + .../send/node_modules/on-finished/HISTORY.md | 98 + .../send/node_modules/on-finished/LICENSE | 23 + .../send/node_modules/on-finished/README.md | 162 + .../send/node_modules/on-finished/index.js | 234 + .../node_modules/on-finished/package.json | 39 + .../send/node_modules/statuses/HISTORY.md | 87 + .../send/node_modules/statuses/LICENSE | 23 + .../send/node_modules/statuses/README.md | 139 + .../send/node_modules/statuses/codes.json | 65 + .../send/node_modules/statuses/index.js | 146 + .../send/node_modules/statuses/package.json | 49 + node_modules/send/package.json | 60 + node_modules/serve-static/HISTORY.md | 516 + node_modules/serve-static/LICENSE | 25 + node_modules/serve-static/README.md | 253 + node_modules/serve-static/index.js | 208 + .../node_modules/encodeurl/LICENSE | 22 + .../node_modules/encodeurl/README.md | 109 + .../node_modules/encodeurl/index.js | 60 + .../node_modules/encodeurl/package.json | 40 + node_modules/serve-static/package.json | 41 + node_modules/setprototypeof/LICENSE | 13 + node_modules/setprototypeof/README.md | 31 + node_modules/setprototypeof/index.d.ts | 2 + node_modules/setprototypeof/index.js | 17 + node_modules/setprototypeof/package.json | 38 + node_modules/setprototypeof/test/index.js | 24 + node_modules/statuses/HISTORY.md | 65 + node_modules/statuses/LICENSE | 23 + node_modules/statuses/README.md | 127 + node_modules/statuses/codes.json | 66 + node_modules/statuses/index.js | 113 + node_modules/statuses/package.json | 48 + node_modules/toidentifier/HISTORY.md | 9 + node_modules/toidentifier/LICENSE | 21 + node_modules/toidentifier/README.md | 61 + node_modules/toidentifier/index.js | 32 + node_modules/toidentifier/package.json | 38 + node_modules/unpipe/HISTORY.md | 4 + node_modules/unpipe/LICENSE | 22 + node_modules/unpipe/README.md | 43 + node_modules/unpipe/index.js | 69 + node_modules/unpipe/package.json | 27 + node_modules/utils-merge/.npmignore | 9 + node_modules/utils-merge/LICENSE | 20 + node_modules/utils-merge/README.md | 34 + node_modules/utils-merge/index.js | 23 + node_modules/utils-merge/package.json | 40 + package-lock.json | 332 + package.json | 6 + server.js | 7 + styles/main.css | 139 +- 177 files changed, 29978 insertions(+), 66 deletions(-) create mode 100644 node_modules/.package-lock.json create mode 100644 node_modules/connect/HISTORY.md create mode 100644 node_modules/connect/LICENSE create mode 100644 node_modules/connect/README.md create mode 100644 node_modules/connect/SECURITY.md create mode 100644 node_modules/connect/index.js create mode 100644 node_modules/connect/package.json create mode 100644 node_modules/debug/.coveralls.yml create mode 100644 node_modules/debug/.eslintrc create mode 100644 node_modules/debug/.npmignore create mode 100644 node_modules/debug/.travis.yml create mode 100644 node_modules/debug/CHANGELOG.md create mode 100644 node_modules/debug/LICENSE create mode 100644 node_modules/debug/Makefile create mode 100644 node_modules/debug/README.md create mode 100644 node_modules/debug/component.json create mode 100644 node_modules/debug/karma.conf.js create mode 100644 node_modules/debug/node.js create mode 100644 node_modules/debug/package.json create mode 100644 node_modules/debug/src/browser.js create mode 100644 node_modules/debug/src/debug.js create mode 100644 node_modules/debug/src/index.js create mode 100644 node_modules/debug/src/inspector-log.js create mode 100644 node_modules/debug/src/node.js create mode 100644 node_modules/depd/History.md create mode 100644 node_modules/depd/LICENSE create mode 100644 node_modules/depd/Readme.md create mode 100644 node_modules/depd/index.js create mode 100644 node_modules/depd/lib/browser/index.js create mode 100644 node_modules/depd/package.json create mode 100644 node_modules/ee-first/LICENSE create mode 100644 node_modules/ee-first/README.md create mode 100644 node_modules/ee-first/index.js create mode 100644 node_modules/ee-first/package.json create mode 100644 node_modules/encodeurl/HISTORY.md create mode 100644 node_modules/encodeurl/LICENSE create mode 100644 node_modules/encodeurl/README.md create mode 100644 node_modules/encodeurl/index.js create mode 100644 node_modules/encodeurl/package.json create mode 100644 node_modules/escape-html/LICENSE create mode 100644 node_modules/escape-html/Readme.md create mode 100644 node_modules/escape-html/index.js create mode 100644 node_modules/escape-html/package.json create mode 100644 node_modules/etag/HISTORY.md create mode 100644 node_modules/etag/LICENSE create mode 100644 node_modules/etag/README.md create mode 100644 node_modules/etag/index.js create mode 100644 node_modules/etag/package.json create mode 100644 node_modules/finalhandler/HISTORY.md create mode 100644 node_modules/finalhandler/LICENSE create mode 100644 node_modules/finalhandler/README.md create mode 100644 node_modules/finalhandler/index.js create mode 100644 node_modules/finalhandler/package.json create mode 100644 node_modules/fresh/HISTORY.md create mode 100644 node_modules/fresh/LICENSE create mode 100644 node_modules/fresh/README.md create mode 100644 node_modules/fresh/index.js create mode 100644 node_modules/fresh/package.json create mode 100644 node_modules/http-errors/HISTORY.md create mode 100644 node_modules/http-errors/LICENSE create mode 100644 node_modules/http-errors/README.md create mode 100644 node_modules/http-errors/index.js create mode 100644 node_modules/http-errors/node_modules/statuses/HISTORY.md create mode 100644 node_modules/http-errors/node_modules/statuses/LICENSE create mode 100644 node_modules/http-errors/node_modules/statuses/README.md create mode 100644 node_modules/http-errors/node_modules/statuses/codes.json create mode 100644 node_modules/http-errors/node_modules/statuses/index.js create mode 100644 node_modules/http-errors/node_modules/statuses/package.json create mode 100644 node_modules/http-errors/package.json create mode 100644 node_modules/inherits/LICENSE create mode 100644 node_modules/inherits/README.md create mode 100644 node_modules/inherits/inherits.js create mode 100644 node_modules/inherits/inherits_browser.js create mode 100644 node_modules/inherits/package.json create mode 100644 node_modules/mime-db/HISTORY.md create mode 100644 node_modules/mime-db/LICENSE create mode 100644 node_modules/mime-db/README.md create mode 100644 node_modules/mime-db/db.json create mode 100644 node_modules/mime-db/index.js create mode 100644 node_modules/mime-db/package.json create mode 100644 node_modules/mime-types/HISTORY.md create mode 100644 node_modules/mime-types/LICENSE create mode 100644 node_modules/mime-types/README.md create mode 100644 node_modules/mime-types/index.js create mode 100644 node_modules/mime-types/mimeScore.js create mode 100644 node_modules/mime-types/package.json create mode 100644 node_modules/ms/index.js create mode 100644 node_modules/ms/license.md create mode 100644 node_modules/ms/package.json create mode 100644 node_modules/ms/readme.md create mode 100644 node_modules/on-finished/HISTORY.md create mode 100644 node_modules/on-finished/LICENSE create mode 100644 node_modules/on-finished/README.md create mode 100644 node_modules/on-finished/index.js create mode 100644 node_modules/on-finished/package.json create mode 100644 node_modules/parseurl/HISTORY.md create mode 100644 node_modules/parseurl/LICENSE create mode 100644 node_modules/parseurl/README.md create mode 100644 node_modules/parseurl/index.js create mode 100644 node_modules/parseurl/package.json create mode 100644 node_modules/range-parser/HISTORY.md create mode 100644 node_modules/range-parser/LICENSE create mode 100644 node_modules/range-parser/README.md create mode 100644 node_modules/range-parser/index.js create mode 100644 node_modules/range-parser/package.json create mode 100644 node_modules/send/HISTORY.md create mode 100644 node_modules/send/LICENSE create mode 100644 node_modules/send/README.md create mode 100644 node_modules/send/index.js create mode 100644 node_modules/send/node_modules/debug/LICENSE create mode 100644 node_modules/send/node_modules/debug/README.md create mode 100644 node_modules/send/node_modules/debug/package.json create mode 100644 node_modules/send/node_modules/debug/src/browser.js create mode 100644 node_modules/send/node_modules/debug/src/common.js create mode 100644 node_modules/send/node_modules/debug/src/index.js create mode 100644 node_modules/send/node_modules/debug/src/node.js create mode 100644 node_modules/send/node_modules/encodeurl/LICENSE create mode 100644 node_modules/send/node_modules/encodeurl/README.md create mode 100644 node_modules/send/node_modules/encodeurl/index.js create mode 100644 node_modules/send/node_modules/encodeurl/package.json create mode 100644 node_modules/send/node_modules/ms/index.js create mode 100644 node_modules/send/node_modules/ms/license.md create mode 100644 node_modules/send/node_modules/ms/package.json create mode 100644 node_modules/send/node_modules/ms/readme.md create mode 100644 node_modules/send/node_modules/on-finished/HISTORY.md create mode 100644 node_modules/send/node_modules/on-finished/LICENSE create mode 100644 node_modules/send/node_modules/on-finished/README.md create mode 100644 node_modules/send/node_modules/on-finished/index.js create mode 100644 node_modules/send/node_modules/on-finished/package.json create mode 100644 node_modules/send/node_modules/statuses/HISTORY.md create mode 100644 node_modules/send/node_modules/statuses/LICENSE create mode 100644 node_modules/send/node_modules/statuses/README.md create mode 100644 node_modules/send/node_modules/statuses/codes.json create mode 100644 node_modules/send/node_modules/statuses/index.js create mode 100644 node_modules/send/node_modules/statuses/package.json create mode 100644 node_modules/send/package.json create mode 100644 node_modules/serve-static/HISTORY.md create mode 100644 node_modules/serve-static/LICENSE create mode 100644 node_modules/serve-static/README.md create mode 100644 node_modules/serve-static/index.js create mode 100644 node_modules/serve-static/node_modules/encodeurl/LICENSE create mode 100644 node_modules/serve-static/node_modules/encodeurl/README.md create mode 100644 node_modules/serve-static/node_modules/encodeurl/index.js create mode 100644 node_modules/serve-static/node_modules/encodeurl/package.json create mode 100644 node_modules/serve-static/package.json create mode 100644 node_modules/setprototypeof/LICENSE create mode 100644 node_modules/setprototypeof/README.md create mode 100644 node_modules/setprototypeof/index.d.ts create mode 100644 node_modules/setprototypeof/index.js create mode 100644 node_modules/setprototypeof/package.json create mode 100644 node_modules/setprototypeof/test/index.js create mode 100644 node_modules/statuses/HISTORY.md create mode 100644 node_modules/statuses/LICENSE create mode 100644 node_modules/statuses/README.md create mode 100644 node_modules/statuses/codes.json create mode 100644 node_modules/statuses/index.js create mode 100644 node_modules/statuses/package.json create mode 100644 node_modules/toidentifier/HISTORY.md create mode 100644 node_modules/toidentifier/LICENSE create mode 100644 node_modules/toidentifier/README.md create mode 100644 node_modules/toidentifier/index.js create mode 100644 node_modules/toidentifier/package.json create mode 100644 node_modules/unpipe/HISTORY.md create mode 100644 node_modules/unpipe/LICENSE create mode 100644 node_modules/unpipe/README.md create mode 100644 node_modules/unpipe/index.js create mode 100644 node_modules/unpipe/package.json create mode 100644 node_modules/utils-merge/.npmignore create mode 100644 node_modules/utils-merge/LICENSE create mode 100644 node_modules/utils-merge/README.md create mode 100644 node_modules/utils-merge/index.js create mode 100644 node_modules/utils-merge/package.json create mode 100644 package-lock.json create mode 100644 package.json create mode 100644 server.js diff --git a/index.html b/index.html index af47f3c..35e9ce4 100644 --- a/index.html +++ b/index.html @@ -10,10 +10,6 @@

Semillas

Growing Latino Leaders at The Ohio State University

-
@@ -22,46 +18,59 @@

Growing Latino Leaders at The Ohio State University

Mentorship Community Guidance Support Mentorship Community Guidance Support
-
- - - - - - +
+
+ + + + + + - - - - - - - + + + + + + + +
+ +
-

Our Mission

-

- Semillas mission is to empower Latino undergraduate students - by fostering a strong, supportive community rooted in shared cultural - identity in the Latine/Hispanic community. Through intentional - mentorship, we provide academic guidance, professional development, and - a supportive community, cultivating students into leaders who are - confident, connected, and prepared to thrive in all aspects of their - collegiate journey and beyond. +

OUR MISSION

+

+ At Semillas, we empower Latino undergraduate students by cultivating a strong, supportive community rooted in shared cultural identity.

+

Through intentional mentorship, we provide + ๐Ÿ“˜ academic guidance, + ๐ŸŒฑ professional development, and + ๐ŸŒ cultural affirmationโ€”nurturing students into leaders who are + ๐Ÿ’ก confident, + ๐Ÿค connected, and + ๐Ÿš€ prepared to thrive throughout college and beyond.

-

Why Join?

+

WHY JOIN?

+

+ Semillas empowers Latino undergraduate students by planting the seeds of + academic success, professional growth, and + cultural pride. +

- Semillas empowers Latino undergraduate students by planting the seeds - of academic success, professional growth, and cultural pride. Rooted - in shared identity and community, we offer intentional mentorship - that helps students grow into confident, connected leadersโ€”ready to - thrive at every stage of their college journey and beyond. + Rooted in shared identity and community, we offer + intentional mentorship that helps students grow into + confident, connected leadersโ€”ready to thrive + in every chapter of their college journey and beyond. +

@@ -70,11 +79,18 @@

Why Join?

Lauren

Lauren Gonzalez

-

Lauren is passionate about community-building and educational outreach...

+

Program Coordinator

+

Bachelor of Arts in Public Management, Leadership, and Policity

+

Minors in Civic Engagement and Latinx Studies

+

Alumni of the Morrill Scholarship Program, Alpha Psi Lambda National Inc., Multicultural Greek Council, Sphinx Senior Honorary, Latine Student Success Center, and Founder of Teal Week

+

Hometown: San Antonio, Texas

+
+

Meet the Coordinators

+
diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json new file mode 100644 index 0000000..ef16495 --- /dev/null +++ b/node_modules/.package-lock.json @@ -0,0 +1,326 @@ +{ + "name": "Semillas_website", + "lockfileVersion": 3, + "requires": true, + "packages": { + "node_modules/connect": { + "version": "3.7.0", + "resolved": "https://registry.npmjs.org/connect/-/connect-3.7.0.tgz", + "integrity": "sha512-ZqRXc+tZukToSNmh5C2iWMSoV3X1YUcPbqEM4DkEG5tNQXrQUZCNVGGv3IuicnkMtPfGf3Xtp8WCXs295iQ1pQ==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "finalhandler": "1.1.2", + "parseurl": "~1.3.3", + "utils-merge": "1.0.1" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==", + "license": "MIT" + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==", + "license": "MIT" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/fresh": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-2.0.0.tgz", + "integrity": "sha512-Rx/WycZ60HOaqLKAi6cHRKKI7zxWbJ31MhntmtwMoaTeF7XFH9hhBp8vITaMidfljRQ6eYWCKkaTK+ykVJHP2A==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "license": "MIT", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/http-errors/node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "license": "ISC" + }, + "node_modules/mime-db": { + "version": "1.54.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.54.0.tgz", + "integrity": "sha512-aU5EJuIN2WDemCcAp2vFBfp/m4EAhWJnUNSSw0ixs7/kXbd6Pg64EmwJkNdFhB8aWt1sH2CTXrLxo/iAGV3oPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-3.0.1.tgz", + "integrity": "sha512-xRc4oEhT6eaBpU1XF7AjpOFD+xQmXNB5OVKwp4tqCuBpHLS/ZbBDrc07mYTDqVMg6PfxUjjNp85O6Cd2Z/5HWA==", + "license": "MIT", + "dependencies": { + "mime-db": "^1.54.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==", + "license": "MIT" + }, + "node_modules/on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha512-ikqdkGAAyf/X/gPhXGvfgAytDZtDbr+bkNUJ0N9h5MI/dmdgCs3l6hoHrcUv41sRKew3jIwrp4qQDXiK99Utww==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/send": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/send/-/send-1.2.0.tgz", + "integrity": "sha512-uaW0WwXKpL9blXE2o0bRhoL2EGXIrZxQ2ZQ4mgcfoBxdFmQold+qWsD2jLrfZ0trjKL6vOw0j//eAwcALFjKSw==", + "license": "MIT", + "dependencies": { + "debug": "^4.3.5", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "etag": "^1.8.1", + "fresh": "^2.0.0", + "http-errors": "^2.0.0", + "mime-types": "^3.0.1", + "ms": "^2.1.3", + "on-finished": "^2.4.1", + "range-parser": "^1.2.1", + "statuses": "^2.0.1" + }, + "engines": { + "node": ">= 18" + } + }, + "node_modules/send/node_modules/debug": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.1.tgz", + "integrity": "sha512-KcKCqiftBJcZr++7ykoDIEwSa3XWowTfNPo92BYxjXiyYEVrUQh2aLyhxBCwww+heortUFxEJYcRzosstTEBYQ==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/send/node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/send/node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/statuses": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.2.tgz", + "integrity": "sha512-DvEy55V3DB7uknRo+4iOGT5fP1slR8wQohVdknigZPMpMstaKJQWhwiYBACJE3Ul2pTnATihhBYnRhZQHGBiRw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/serve-static": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-2.2.0.tgz", + "integrity": "sha512-61g9pCh0Vnh7IutZjtLGGpTA355+OPn2TyDv/6ivP2h/AdAVX9azsoxmg2/M6nZeQZNYBEwIcsne1mJd9oQItQ==", + "license": "MIT", + "dependencies": { + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "parseurl": "^1.3.3", + "send": "^1.2.0" + }, + "engines": { + "node": ">= 18" + } + }, + "node_modules/serve-static/node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==", + "license": "ISC" + }, + "node_modules/statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha512-OpZ3zP+jT1PI7I8nemJX4AKmAX070ZkYPVWV/AaKTJl+tXCTGyVdC1a4SL8RUQYEwk/f34ZX8UTykN68FwrqAA==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "license": "MIT", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "license": "MIT", + "engines": { + "node": ">= 0.4.0" + } + } + } +} diff --git a/node_modules/connect/HISTORY.md b/node_modules/connect/HISTORY.md new file mode 100644 index 0000000..14e77a6 --- /dev/null +++ b/node_modules/connect/HISTORY.md @@ -0,0 +1,2503 @@ +3.7.0 / 2019-05-17 +================== + + * deps: finalhandler@1.1.2 + - Set stricter `Content-Security-Policy` header + - Fix 404 output for bad / missing pathnames + - deps: encodeurl@~1.0.2 + - deps: parseurl@~1.3.3 + - deps: statuses@~1.4.0 + * deps: parseurl@~1.3.3 + * perf: remove substr call from FQDN mapping + +3.6.6 / 2018-02-14 +================== + + * deps: finalhandler@1.1.0 + - Use `res.headersSent` when available + * perf: remove array read-past-end + +3.6.5 / 2017-09-22 +================== + + * deps: debug@2.6.9 + * deps: finalhandler@1.0.6 + - deps: debug@2.6.9 + +3.6.4 / 2017-09-20 +================== + + * deps: finalhandler@1.0.5 + - deps: parseurl@~1.3.2 + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + * deps: utils-merge@1.0.1 + +3.6.3 / 2017-08-03 +================== + + * deps: debug@2.6.8 + * deps: finalhandler@1.0.4 + - deps: debug@2.6.8 + +3.6.2 / 2017-05-16 +================== + + * deps: finalhandler@1.0.3 + - deps: debug@2.6.7 + * deps: debug@2.6.7 + - deps: ms@2.0.0 + +3.6.1 / 2017-04-19 +================== + + * deps: debug@2.6.3 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + * deps: finalhandler@1.0.1 + - Fix missing `` in HTML document + - deps: debug@2.6.3 + +3.6.0 / 2017-02-17 +================== + + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: finalhandler@1.0.0 + - Fix exception when `err` cannot be converted to a string + - Fully URL-encode the pathname in the 404 + - Only include the pathname in the 404 message + - Send complete HTML document + - Set `Content-Security-Policy: default-src 'self'` header + - deps: debug@2.6.1 + +3.5.1 / 2017-02-12 +================== + + * deps: finalhandler@0.5.1 + - Fix exception when `err.headers` is not an object + - deps: statuses@~1.3.1 + - perf: hoist regular expressions + - perf: remove duplicate validation path + +3.5.0 / 2016-09-09 +================== + + * deps: finalhandler@0.5.0 + - Change invalid or non-numeric status code to 500 + - Overwrite status message to match set status code + - Prefer `err.statusCode` if `err.status` is invalid + - Set response headers from `err.headers` object + - Use `statuses` instead of `http` module for status messages + +3.4.1 / 2016-01-23 +================== + + * deps: finalhandler@0.4.1 + - deps: escape-html@~1.0.3 + * deps: parseurl@~1.3.1 + - perf: enable strict mode + +3.4.0 / 2015-06-18 +================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: finalhandler@0.4.0 + - Fix a false-positive when unpiping in Node.js 0.8 + - Support `statusCode` property on `Error` objects + - Use `unpipe` module for unpiping requests + - deps: debug@~2.2.0 + - deps: escape-html@1.0.2 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + * perf: enable strict mode + * perf: remove argument reassignments + +3.3.5 / 2015-03-16 +================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: finalhandler@0.3.4 + - deps: debug@~2.1.3 + +3.3.4 / 2015-01-07 +================== + + * deps: debug@~2.1.1 + * deps: finalhandler@0.3.3 + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + +3.3.3 / 2014-11-09 +================== + + * Correctly invoke async callback asynchronously + +3.3.2 / 2014-10-28 +================== + + * Fix handling of URLs containing `://` in the path + +3.3.1 / 2014-10-22 +================== + + * deps: finalhandler@0.3.2 + - deps: on-finished@~2.1.1 + +3.3.0 / 2014-10-17 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: finalhandler@0.3.1 + - Terminate in progress response only on error + - Use `on-finished` to determine request status + - deps: debug@~2.1.0 + +3.2.0 / 2014-09-08 +================== + + * deps: debug@~2.0.0 + * deps: finalhandler@0.2.0 + - Set `X-Content-Type-Options: nosniff` header + - deps: debug@~2.0.0 + +3.1.1 / 2014-08-10 +================== + + * deps: parseurl@~1.3.0 + +3.1.0 / 2014-07-22 +================== + + * deps: debug@1.0.4 + * deps: finalhandler@0.1.0 + - Respond after request fully read + - deps: debug@1.0.4 + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * perf: reduce executed logic in routing + * perf: refactor location of `try` block + +3.0.2 / 2014-07-10 +================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +3.0.1 / 2014-06-19 +================== + + * use `finalhandler` for final response handling + * deps: debug@1.0.2 + +3.0.0 / 2014-05-29 +================== + + * No changes + +3.0.0-rc.2 / 2014-05-04 +======================= + + * Call error stack even when response has been sent + * Prevent default 404 handler after response sent + * dep: debug@0.8.1 + * encode stack in HTML for default error handler + * remove `proto` export + +3.0.0-rc.1 / 2014-03-06 +======================= + + * move middleware to separate repos + * remove docs + * remove node patches + * remove connect(middleware...) + * remove the old `connect.createServer()` method + * remove various private `connect.utils` functions + * drop node.js 0.8 support + +2.30.2 / 2015-07-31 +=================== + + * deps: body-parser@~1.13.3 + - deps: type-is@~1.6.6 + * deps: compression@~1.5.2 + - deps: accepts@~1.2.12 + - deps: compressible@~2.0.5 + - deps: vary@~1.0.1 + * deps: errorhandler@~1.4.2 + - deps: accepts@~1.2.12 + * deps: method-override@~2.3.5 + - deps: vary@~1.0.1 + - perf: enable strict mode + * deps: serve-index@~1.7.2 + - deps: accepts@~1.2.12 + - deps: mime-types@~2.1.4 + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + * deps: vhost@~3.0.1 + - perf: enable strict mode + +2.30.1 / 2015-07-05 +=================== + + * deps: body-parser@~1.13.2 + - deps: iconv-lite@0.4.11 + - deps: qs@4.0.0 + - deps: raw-body@~2.1.2 + - deps: type-is@~1.6.4 + * deps: compression@~1.5.1 + - deps: accepts@~1.2.10 + - deps: compressible@~2.0.4 + * deps: errorhandler@~1.4.1 + - deps: accepts@~1.2.10 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + * deps: morgan@~1.6.1 + - deps: basic-auth@~1.0.3 + * deps: pause@0.1.0 + - Re-emit events with all original arguments + - Refactor internals + - perf: enable strict mode + * deps: serve-index@~1.7.1 + - deps: accepts@~1.2.10 + - deps: mime-types@~2.1.2 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +2.30.0 / 2015-06-18 +=================== + + * deps: body-parser@~1.13.1 + - Add `statusCode` property on `Error`s, in addition to `status` + - Change `type` default to `application/json` for JSON parser + - Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + - Provide static `require` analysis + - Use the `http-errors` module to generate errors + - deps: bytes@2.1.0 + - deps: iconv-lite@0.4.10 + - deps: on-finished@~2.3.0 + - deps: raw-body@~2.1.1 + - deps: type-is@~1.6.3 + - perf: enable strict mode + - perf: remove argument reassignment + - perf: remove delete call + * deps: bytes@2.1.0 + - Slight optimizations + - Units no longer case sensitive when parsing + * deps: compression@~1.5.0 + - Fix return value from `.end` and `.write` after end + - Improve detection of zero-length body without `Content-Length` + - deps: accepts@~1.2.9 + - deps: bytes@2.1.0 + - deps: compressible@~2.0.3 + - perf: enable strict mode + - perf: remove flush reassignment + - perf: simplify threshold detection + * deps: cookie@0.1.3 + - Slight optimizations + * deps: cookie-parser@~1.3.5 + - deps: cookie@0.1.3 + * deps: csurf@~1.8.3 + - Add `sessionKey` option + - deps: cookie@0.1.3 + - deps: csrf@~3.0.0 + * deps: errorhandler@~1.4.0 + - Add charset to the `Content-Type` header + - Support `statusCode` property on `Error` objects + - deps: accepts@~1.2.9 + - deps: escape-html@1.0.2 + * deps: express-session@~1.11.3 + - Support an array in `secret` option for key rotation + - deps: cookie@0.1.3 + - deps: crc@3.3.0 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: uid-safe@~2.0.0 + * deps: finalhandler@0.4.0 + - Fix a false-positive when unpiping in Node.js 0.8 + - Support `statusCode` property on `Error` objects + - Use `unpipe` module for unpiping requests + - deps: escape-html@1.0.2 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: morgan@~1.6.0 + - Add `morgan.compile(format)` export + - Do not color 1xx status codes in `dev` format + - Fix `response-time` token to not include response latency + - Fix `status` token incorrectly displaying before response in `dev` format + - Fix token return values to be `undefined` or a string + - Improve representation of multiple headers in `req` and `res` tokens + - Use `res.getHeader` in `res` token + - deps: basic-auth@~1.0.2 + - deps: on-finished@~2.3.0 + - pref: enable strict mode + - pref: reduce function closure scopes + - pref: remove dynamic compile on every request for `dev` format + - pref: remove an argument reassignment + - pref: skip function call without `skip` option + * deps: serve-favicon@~2.3.0 + - Send non-chunked response for `OPTIONS` + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - perf: enable strict mode + - perf: remove argument reassignment + - perf: remove bitwise operations + * deps: serve-index@~1.7.0 + - Accept `function` value for `template` option + - Send non-chunked response for `OPTIONS` + - Stat parent directory when necessary + - Use `Date.prototype.toLocaleDateString` to format date + - deps: accepts@~1.2.9 + - deps: escape-html@1.0.2 + - deps: mime-types@~2.1.1 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: serve-static@~1.10.0 + - Add `fallthrough` option + - Fix reading options from options prototype + - Improve the default redirect response headers + - Malformed URLs now `next()` instead of 400 + - deps: escape-html@1.0.2 + - deps: send@0.13.0 + - perf: enable strict mode + - perf: remove argument reassignment + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + +2.29.2 / 2015-05-14 +=================== + + * deps: body-parser@~1.12.4 + - Slight efficiency improvement when not debugging + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: iconv-lite@0.4.8 + - deps: on-finished@~2.2.1 + - deps: qs@2.4.2 + - deps: raw-body@~2.0.1 + - deps: type-is@~1.6.2 + * deps: compression@~1.4.4 + - deps: accepts@~1.2.7 + - deps: debug@~2.2.0 + * deps: connect-timeout@~1.6.2 + - deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: errorhandler@~1.3.6 + - deps: accepts@~1.2.7 + * deps: finalhandler@0.3.6 + - deps: debug@~2.2.0 + - deps: on-finished@~2.2.1 + * deps: method-override@~2.3.3 + - deps: debug@~2.2.0 + * deps: morgan@~1.5.3 + - deps: basic-auth@~1.0.1 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: on-finished@~2.2.1 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: response-time@~2.3.1 + - deps: depd@~1.0.1 + * deps: serve-favicon@~2.2.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + * deps: serve-index@~1.6.4 + - deps: accepts@~1.2.7 + - deps: debug@~2.2.0 + - deps: mime-types@~2.0.11 + * deps: serve-static@~1.9.3 + - deps: send@0.12.3 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +2.29.1 / 2015-03-16 +=================== + + * deps: body-parser@~1.12.2 + - deps: debug@~2.1.3 + - deps: qs@2.4.1 + - deps: type-is@~1.6.1 + * deps: compression@~1.4.3 + - Fix error when code calls `res.end(str, encoding)` + - deps: accepts@~1.2.5 + - deps: debug@~2.1.3 + * deps: connect-timeout@~1.6.1 + - deps: debug@~2.1.3 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: errorhandler@~1.3.5 + - deps: accepts@~1.2.5 + * deps: express-session@~1.10.4 + - deps: debug@~2.1.3 + * deps: finalhandler@0.3.4 + - deps: debug@~2.1.3 + * deps: method-override@~2.3.2 + - deps: debug@~2.1.3 + * deps: morgan@~1.5.2 + - deps: debug@~2.1.3 + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + * deps: serve-index@~1.6.3 + - Properly escape file names in HTML + - deps: accepts@~1.2.5 + - deps: debug@~2.1.3 + - deps: escape-html@1.0.1 + - deps: mime-types@~2.0.10 + * deps: serve-static@~1.9.2 + - deps: send@0.12.2 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +2.29.0 / 2015-02-17 +=================== + + * Use `content-type` to parse `Content-Type` headers + * deps: body-parser@~1.12.0 + - add `debug` messages + - accept a function for the `type` option + - make internal `extended: true` depth limit infinity + - use `content-type` to parse `Content-Type` headers + - deps: iconv-lite@0.4.7 + - deps: raw-body@1.3.3 + - deps: type-is@~1.6.0 + * deps: compression@~1.4.1 + - Prefer `gzip` over `deflate` on the server + - deps: accepts@~1.2.4 + * deps: connect-timeout@~1.6.0 + - deps: http-errors@~1.3.1 + * deps: cookie-parser@~1.3.4 + - deps: cookie-signature@1.0.6 + * deps: cookie-signature@1.0.6 + * deps: csurf@~1.7.0 + - Accept `CSRF-Token` and `XSRF-Token` request headers + - Default `cookie.path` to `'/'`, if using cookies + - deps: cookie-signature@1.0.6 + - deps: csrf@~2.0.6 + - deps: http-errors@~1.3.1 + * deps: errorhandler@~1.3.4 + - deps: accepts@~1.2.4 + * deps: express-session@~1.10.3 + - deps: cookie-signature@1.0.6 + - deps: uid-safe@1.1.0 + * deps: http-errors@~1.3.1 + - Construct errors using defined constructors from `createError` + - Fix error names that are not identifiers + - Set a meaningful `name` property on constructed errors + * deps: response-time@~2.3.0 + - Add function argument to support recording of response time + * deps: serve-index@~1.6.2 + - deps: accepts@~1.2.4 + - deps: http-errors@~1.3.1 + - deps: mime-types@~2.0.9 + * deps: serve-static@~1.9.1 + - deps: send@0.12.1 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +2.28.3 / 2015-01-31 +=================== + + * deps: compression@~1.3.1 + - deps: accepts@~1.2.3 + - deps: compressible@~2.0.2 + * deps: csurf@~1.6.6 + - deps: csrf@~2.0.5 + * deps: errorhandler@~1.3.3 + - deps: accepts@~1.2.3 + * deps: express-session@~1.10.2 + - deps: uid-safe@1.0.3 + * deps: serve-index@~1.6.1 + - deps: accepts@~1.2.3 + - deps: mime-types@~2.0.8 + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +2.28.2 / 2015-01-20 +=================== + + * deps: body-parser@~1.10.2 + - deps: iconv-lite@0.4.6 + - deps: raw-body@1.3.2 + * deps: serve-static@~1.8.1 + - Fix redirect loop in Node.js 0.11.14 + - Fix root path disclosure + - deps: send@0.11.1 + +2.28.1 / 2015-01-08 +=================== + + * deps: csurf@~1.6.5 + - deps: csrf@~2.0.4 + * deps: express-session@~1.10.1 + - deps: uid-safe@~1.0.2 + +2.28.0 / 2015-01-05 +=================== + + * deps: body-parser@~1.10.1 + - Make internal `extended: true` array limit dynamic + - deps: on-finished@~2.2.0 + - deps: type-is@~1.5.5 + * deps: compression@~1.3.0 + - Export the default `filter` function for wrapping + - deps: accepts@~1.2.2 + - deps: debug@~2.1.1 + * deps: connect-timeout@~1.5.0 + - deps: debug@~2.1.1 + - deps: http-errors@~1.2.8 + - deps: ms@0.7.0 + * deps: csurf@~1.6.4 + - deps: csrf@~2.0.3 + - deps: http-errors@~1.2.8 + * deps: debug@~2.1.1 + * deps: errorhandler@~1.3.2 + - Add `log` option + - Fix heading content to not include stack + - deps: accepts@~1.2.2 + * deps: express-session@~1.10.0 + - Add `store.touch` interface for session stores + - Fix `MemoryStore` expiration with `resave: false` + - deps: debug@~2.1.1 + * deps: finalhandler@0.3.3 + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + * deps: method-override@~2.3.1 + - deps: debug@~2.1.1 + - deps: methods@~1.1.1 + * deps: morgan@~1.5.1 + - Add multiple date formats `clf`, `iso`, and `web` + - Deprecate `buffer` option + - Fix date format in `common` and `combined` formats + - Fix token arguments to accept values with `"` + - deps: debug@~2.1.1 + - deps: on-finished@~2.2.0 + * deps: serve-favicon@~2.2.0 + - Support query string in the URL + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + * deps: serve-index@~1.6.0 + - Add link to root directory + - deps: accepts@~1.2.2 + - deps: batch@0.5.2 + - deps: debug@~2.1.1 + - deps: mime-types@~2.0.7 + * deps: serve-static@~1.8.0 + - Fix potential open redirect when mounted at root + - deps: send@0.11.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +2.27.6 / 2014-12-10 +=================== + + * deps: serve-index@~1.5.3 + - deps: accepts@~1.1.4 + - deps: http-errors@~1.2.8 + - deps: mime-types@~2.0.4 + +2.27.5 / 2014-12-10 +=================== + + * deps: compression@~1.2.2 + - Fix `.end` to only proxy to `.end` + - deps: accepts@~1.1.4 + * deps: express-session@~1.9.3 + - Fix error when `req.sessionID` contains a non-string value + * deps: http-errors@~1.2.8 + - Fix stack trace from exported function + - Remove `arguments.callee` usage + * deps: serve-index@~1.5.2 + - Fix icon name background alignment on mobile view + * deps: type-is@~1.5.4 + - deps: mime-types@~2.0.4 + +2.27.4 / 2014-11-23 +=================== + + * deps: body-parser@~1.9.3 + - deps: iconv-lite@0.4.5 + - deps: qs@2.3.3 + - deps: raw-body@1.3.1 + - deps: type-is@~1.5.3 + * deps: compression@~1.2.1 + - deps: accepts@~1.1.3 + * deps: errorhandler@~1.2.3 + - deps: accepts@~1.1.3 + * deps: express-session@~1.9.2 + - deps: crc@3.2.1 + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: serve-favicon@~2.1.7 + - Avoid errors from enumerables on `Object.prototype` + * deps: serve-index@~1.5.1 + - deps: accepts@~1.1.3 + - deps: mime-types@~2.0.3 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +2.27.3 / 2014-11-09 +=================== + + * Correctly invoke async callback asynchronously + * deps: csurf@~1.6.3 + - bump csrf + - bump http-errors + +2.27.2 / 2014-10-28 +=================== + + * Fix handling of URLs containing `://` in the path + * deps: body-parser@~1.9.2 + - deps: qs@2.3.2 + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +2.27.1 / 2014-10-22 +=================== + + * deps: body-parser@~1.9.1 + - deps: on-finished@~2.1.1 + - deps: qs@2.3.0 + - deps: type-is@~1.5.2 + * deps: express-session@~1.9.1 + - Remove unnecessary empty write call + * deps: finalhandler@0.3.2 + - deps: on-finished@~2.1.1 + * deps: morgan@~1.4.1 + - deps: on-finished@~2.1.1 + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: serve-static@~1.7.1 + - deps: send@0.10.1 + +2.27.0 / 2014-10-16 +=================== + + * Use `http-errors` module for creating errors + * Use `utils-merge` module for merging objects + * deps: body-parser@~1.9.0 + - include the charset in "unsupported charset" error message + - include the encoding in "unsupported content encoding" error message + - deps: depd@~1.0.0 + * deps: compression@~1.2.0 + - deps: debug@~2.1.0 + * deps: connect-timeout@~1.4.0 + - Create errors with `http-errors` + - deps: debug@~2.1.0 + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: express-session@~1.9.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + * deps: finalhandler@0.3.1 + - Terminate in progress response only on error + - Use `on-finished` to determine request status + - deps: debug@~2.1.0 + * deps: method-override@~2.3.0 + - deps: debug@~2.1.0 + * deps: morgan@~1.4.0 + - Add `debug` messages + - deps: depd@~1.0.0 + * deps: response-time@~2.2.0 + - Add `header` option for custom header name + - Add `suffix` option + - Change `digits` argument to an `options` argument + - deps: depd@~1.0.0 + * deps: serve-favicon@~2.1.6 + - deps: etag@~1.5.0 + * deps: serve-index@~1.5.0 + - Add `dir` argument to `filter` function + - Add icon for mkv files + - Create errors with `http-errors` + - Fix incorrect 403 on Windows and Node.js 0.11 + - Lookup icon by mime type for greater icon support + - Support using tokens multiple times + - deps: accepts@~1.1.2 + - deps: debug@~2.1.0 + - deps: mime-types@~2.0.2 + * deps: serve-static@~1.7.0 + - deps: send@0.10.0 + +2.26.6 / 2014-10-15 +=================== + + * deps: compression@~1.1.2 + - deps: accepts@~1.1.2 + - deps: compressible@~2.0.1 + * deps: csurf@~1.6.2 + - bump http-errors + - fix cookie name when using `cookie: true` + * deps: errorhandler@~1.2.2 + - deps: accepts@~1.1.2 + +2.26.5 / 2014-10-08 +=================== + + * Fix accepting non-object arguments to `logger` + * deps: serve-static@~1.6.4 + - Fix redirect loop when index file serving disabled + +2.26.4 / 2014-10-02 +=================== + + * deps: morgan@~1.3.2 + - Fix `req.ip` integration when `immediate: false` + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +2.26.3 / 2014-09-24 +=================== + + * deps: body-parser@~1.8.4 + - fix content encoding to be case-insensitive + * deps: serve-favicon@~2.1.5 + - deps: etag@~1.4.0 + * deps: serve-static@~1.6.3 + - deps: send@0.9.3 + +2.26.2 / 2014-09-19 +=================== + + * deps: body-parser@~1.8.3 + - deps: qs@2.2.4 + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +2.26.1 / 2014-09-15 +=================== + + * deps: body-parser@~1.8.2 + - deps: depd@0.4.5 + * deps: depd@0.4.5 + * deps: express-session@~1.8.2 + - Use `crc` instead of `buffer-crc32` for speed + - deps: depd@0.4.5 + * deps: morgan@~1.3.1 + - Remove un-used `bytes` dependency + - deps: depd@0.4.5 + * deps: serve-favicon@~2.1.4 + - Fix content headers being sent in 304 response + - deps: etag@~1.3.1 + * deps: serve-static@~1.6.2 + - deps: send@0.9.2 + +2.26.0 / 2014-09-08 +=================== + + * deps: body-parser@~1.8.1 + - add `parameterLimit` option to `urlencoded` parser + - change `urlencoded` extended array limit to 100 + - make empty-body-handling consistent between chunked requests + - respond with 415 when over `parameterLimit` in `urlencoded` + - deps: media-typer@0.3.0 + - deps: qs@2.2.3 + - deps: type-is@~1.5.1 + * deps: compression@~1.1.0 + - deps: accepts@~1.1.0 + - deps: compressible@~2.0.0 + - deps: debug@~2.0.0 + * deps: connect-timeout@~1.3.0 + - deps: debug@~2.0.0 + * deps: cookie-parser@~1.3.3 + - deps: cookie-signature@1.0.5 + * deps: cookie-signature@1.0.5 + * deps: csurf@~1.6.1 + - add `ignoreMethods` option + - bump cookie-signature + - csrf-tokens -> csrf + - set `code` property on CSRF token errors + * deps: debug@~2.0.0 + * deps: errorhandler@~1.2.0 + - Display error using `util.inspect` if no other representation + - deps: accepts@~1.1.0 + * deps: express-session@~1.8.1 + - Do not resave already-saved session at end of request + - Prevent session prototype methods from being overwritten + - deps: cookie-signature@1.0.5 + - deps: debug@~2.0.0 + * deps: finalhandler@0.2.0 + - Set `X-Content-Type-Options: nosniff` header + - deps: debug@~2.0.0 + * deps: fresh@0.2.4 + * deps: media-typer@0.3.0 + - Throw error when parameter format invalid on parse + * deps: method-override@~2.2.0 + - deps: debug@~2.0.0 + * deps: morgan@~1.3.0 + - Assert if `format` is not a function or string + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: serve-favicon@~2.1.3 + - Accept string for `maxAge` (converted by `ms`) + - Use `etag` to generate `ETag` header + - deps: fresh@0.2.4 + * deps: serve-index@~1.2.1 + - Add `debug` messages + - Resolve relative paths at middleware setup + - deps: accepts@~1.1.0 + * deps: serve-static@~1.6.1 + - Add `lastModified` option + - deps: send@0.9.1 + * deps: type-is@~1.5.1 + - fix `hasbody` to be true for `content-length: 0` + - deps: media-typer@0.3.0 + - deps: mime-types@~2.0.1 + * deps: vhost@~3.0.0 + +2.25.10 / 2014-09-04 +==================== + + * deps: serve-static@~1.5.4 + - deps: send@0.8.5 + +2.25.9 / 2014-08-29 +=================== + + * deps: body-parser@~1.6.7 + - deps: qs@2.2.2 + * deps: qs@2.2.2 + +2.25.8 / 2014-08-27 +=================== + + * deps: body-parser@~1.6.6 + - deps: qs@2.2.0 + * deps: csurf@~1.4.1 + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +2.25.7 / 2014-08-18 +=================== + + * deps: body-parser@~1.6.5 + - deps: on-finished@2.1.0 + * deps: express-session@~1.7.6 + - Fix exception on `res.end(null)` calls + * deps: morgan@~1.2.3 + - deps: on-finished@2.1.0 + * deps: serve-static@~1.5.3 + - deps: send@0.8.3 + +2.25.6 / 2014-08-14 +=================== + + * deps: body-parser@~1.6.4 + - deps: qs@1.2.2 + * deps: qs@1.2.2 + * deps: serve-static@~1.5.2 + - deps: send@0.8.2 + +2.25.5 / 2014-08-11 +=================== + + * Fix backwards compatibility in `logger` + +2.25.4 / 2014-08-10 +=================== + + * Fix `query` middleware breaking with argument + - It never really took one in the first place + * deps: body-parser@~1.6.3 + - deps: qs@1.2.1 + * deps: compression@~1.0.11 + - deps: on-headers@~1.0.0 + - deps: parseurl@~1.3.0 + * deps: connect-timeout@~1.2.2 + - deps: on-headers@~1.0.0 + * deps: express-session@~1.7.5 + - Fix parsing original URL + - deps: on-headers@~1.0.0 + - deps: parseurl@~1.3.0 + * deps: method-override@~2.1.3 + * deps: on-headers@~1.0.0 + * deps: parseurl@~1.3.0 + * deps: qs@1.2.1 + * deps: response-time@~2.0.1 + - deps: on-headers@~1.0.0 + * deps: serve-index@~1.1.6 + - Fix URL parsing + * deps: serve-static@~1.5.1 + - Fix parsing of weird `req.originalUrl` values + - deps: parseurl@~1.3.0 + = deps: utils-merge@1.0.0 + +2.25.3 / 2014-08-07 +=================== + + * deps: multiparty@3.3.2 + - Fix potential double-callback + +2.25.2 / 2014-08-07 +=================== + + * deps: body-parser@~1.6.2 + - deps: qs@1.2.0 + * deps: qs@1.2.0 + - Fix parsing array of objects + +2.25.1 / 2014-08-06 +=================== + + * deps: body-parser@~1.6.1 + - deps: qs@1.1.0 + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +2.25.0 / 2014-08-05 +=================== + + * deps: body-parser@~1.6.0 + - deps: qs@1.0.2 + * deps: compression@~1.0.10 + - Fix upper-case Content-Type characters prevent compression + - deps: compressible@~1.1.1 + * deps: csurf@~1.4.0 + - Support changing `req.session` after `csurf` middleware + - Calling `res.csrfToken()` after `req.session.destroy()` will now work + * deps: express-session@~1.7.4 + - Fix `res.end` patch to call correct upstream `res.write` + - Fix response end delay for non-chunked responses + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + * deps: serve-static@~1.5.0 + - Add `extensions` option + - deps: send@0.8.1 + +2.24.3 / 2014-08-04 +=================== + + * deps: serve-index@~1.1.5 + - Fix Content-Length calculation for multi-byte file names + - deps: accepts@~1.0.7 + * deps: serve-static@~1.4.4 + - Fix incorrect 403 on Windows and Node.js 0.11 + - deps: send@0.7.4 + +2.24.2 / 2014-07-27 +=================== + + * deps: body-parser@~1.5.2 + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + * deps: express-session@~1.7.2 + * deps: morgan@~1.2.2 + * deps: serve-static@~1.4.2 + +2.24.1 / 2014-07-26 +=================== + + * deps: body-parser@~1.5.1 + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + * deps: express-session@~1.7.1 + * deps: morgan@~1.2.1 + * deps: serve-index@~1.1.4 + * deps: serve-static@~1.4.1 + +2.24.0 / 2014-07-22 +=================== + + * deps: body-parser@~1.5.0 + - deps: depd@0.4.2 + - deps: iconv-lite@0.4.4 + - deps: raw-body@1.3.0 + - deps: type-is@~1.3.2 + * deps: compression@~1.0.9 + - Add `debug` messages + - deps: accepts@~1.0.7 + * deps: connect-timeout@~1.2.1 + - Accept string for `time` (converted by `ms`) + - deps: debug@1.0.4 + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: express-session@~1.7.0 + - Improve session-ending error handling + - deps: debug@1.0.4 + - deps: depd@0.4.2 + * deps: finalhandler@0.1.0 + - Respond after request fully read + - deps: debug@1.0.4 + * deps: method-override@~2.1.2 + - deps: debug@1.0.4 + - deps: parseurl@~1.2.0 + * deps: morgan@~1.2.0 + - Add `:remote-user` token + - Add `combined` log format + - Add `common` log format + - Remove non-standard grey color from `dev` format + * deps: multiparty@3.3.1 + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: serve-static@~1.4.0 + - Add `dotfiles` option + - deps: parseurl@~1.2.0 + - deps: send@0.7.0 + +2.23.0 / 2014-07-10 +=================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + * deps: express-session@~1.6.4 + * deps: method-override@~2.1.0 + - add simple debug output + - deps: methods@1.1.0 + - deps: parseurl@~1.1.3 + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + * deps: serve-static@~1.3.1 + - deps: parseurl@~1.1.3 + +2.22.0 / 2014-07-03 +=================== + + * deps: csurf@~1.3.0 + - Fix `cookie.signed` option to actually sign cookie + * deps: express-session@~1.6.1 + - Fix `res.end` patch to return correct value + - Fix `res.end` patch to handle multiple `res.end` calls + - Reject cookies with missing signatures + * deps: multiparty@3.3.0 + - Always emit close after all parts ended + - Fix callback hang in node.js 0.8 on errors + * deps: serve-static@~1.3.0 + - Accept string for `maxAge` (converted by `ms`) + - Add `setHeaders` option + - Include HTML link in redirect response + - deps: send@0.5.0 + +2.21.1 / 2014-06-26 +=================== + + * deps: cookie-parser@1.3.2 + - deps: cookie-signature@1.0.4 + * deps: cookie-signature@1.0.4 + - fix for timing attacks + * deps: express-session@~1.5.2 + - deps: cookie-signature@1.0.4 + * deps: type-is@~1.3.2 + - more mime types + +2.21.0 / 2014-06-20 +=================== + + * deprecate `connect(middleware)` -- use `app.use(middleware)` instead + * deprecate `connect.createServer()` -- use `connect()` instead + * fix `res.setHeader()` patch to work with get -> append -> set pattern + * deps: compression@~1.0.8 + * deps: errorhandler@~1.1.1 + * deps: express-session@~1.5.0 + - Deprecate integration with `cookie-parser` middleware + - Deprecate looking for secret in `req.secret` + - Directly read cookies; `cookie-parser` no longer required + - Directly set cookies; `res.cookie` no longer required + - Generate session IDs with `uid-safe`, faster and even less collisions + * deps: serve-index@~1.1.3 + +2.20.2 / 2014-06-19 +=================== + + * deps: body-parser@1.4.3 + - deps: type-is@1.3.1 + +2.20.1 / 2014-06-19 +=================== + + * deps: type-is@1.3.1 + - fix global variable leak + +2.20.0 / 2014-06-19 +=================== + + * deprecate `verify` option to `json` -- use `body-parser` npm module instead + * deprecate `verify` option to `urlencoded` -- use `body-parser` npm module instead + * deprecate things with `depd` module + * use `finalhandler` for final response handling + * use `media-typer` to parse `content-type` for charset + * deps: body-parser@1.4.2 + - check accepted charset in content-type (accepts utf-8) + - check accepted encoding in content-encoding (accepts identity) + - deprecate `urlencoded()` without provided `extended` option + - lazy-load urlencoded parsers + - support gzip and deflate bodies + - set `inflate: false` to turn off + - deps: raw-body@1.2.2 + - deps: type-is@1.3.0 + - Support all encodings from `iconv-lite` + * deps: connect-timeout@1.1.1 + - deps: debug@1.0.2 + * deps: cookie-parser@1.3.1 + - export parsing functions + - `req.cookies` and `req.signedCookies` are now plain objects + - slightly faster parsing of many cookies + * deps: csurf@1.2.2 + * deps: errorhandler@1.1.0 + - Display error on console formatted like `throw` + - Escape HTML in stack trace + - Escape HTML in title + - Fix up edge cases with error sent in response + - Set `X-Content-Type-Options: nosniff` header + - Use accepts for negotiation + * deps: express-session@1.4.0 + - Add `genid` option to generate custom session IDs + - Add `saveUninitialized` option to control saving uninitialized sessions + - Add `unset` option to control unsetting `req.session` + - Generate session IDs with `rand-token` by default; reduce collisions + - Integrate with express "trust proxy" by default + - deps: buffer-crc32@0.2.3 + - deps: debug@1.0.2 + * deps: multiparty@3.2.9 + * deps: serve-index@1.1.2 + - deps: batch@0.5.1 + * deps: type-is@1.3.0 + - improve type parsing + * deps: vhost@2.0.0 + - Accept `RegExp` object for `hostname` + - Provide `req.vhost` object + - Support IPv6 literal in `Host` header + +2.19.6 / 2014-06-11 +=================== + + * deps: body-parser@1.3.1 + - deps: type-is@1.2.1 + * deps: compression@1.0.7 + - use vary module for better `Vary` behavior + - deps: accepts@1.0.3 + - deps: compressible@1.1.0 + * deps: debug@1.0.2 + * deps: serve-index@1.1.1 + - deps: accepts@1.0.3 + * deps: serve-static@1.2.3 + - Do not throw un-catchable error on file open race condition + - deps: send@0.4.3 + +2.19.5 / 2014-06-09 +=================== + + * deps: csurf@1.2.1 + - refactor to use csrf-tokens@~1.0.2 + * deps: debug@1.0.1 + * deps: serve-static@1.2.2 + - fix "event emitter leak" warnings + - deps: send@0.4.2 + * deps: type-is@1.2.1 + - Switch dependency from `mime` to `mime-types@1.0.0` + +2.19.4 / 2014-06-05 +=================== + + * deps: errorhandler@1.0.2 + - Pass on errors from reading error files + * deps: method-override@2.0.2 + - use vary module for better `Vary` behavior + * deps: serve-favicon@2.0.1 + - Reduce byte size of `ETag` header + +2.19.3 / 2014-06-03 +=================== + + * deps: compression@1.0.6 + - fix listeners for delayed stream creation + - fix regression for certain `stream.pipe(res)` situations + - fix regression when negotiation fails + +2.19.2 / 2014-06-03 +=================== + + * deps: compression@1.0.4 + - fix adding `Vary` when value stored as array + - fix back-pressure behavior + - fix length check for `res.end` + +2.19.1 / 2014-06-02 +=================== + + * fix deprecated `utils.escape` + +2.19.0 / 2014-06-02 +=================== + + * deprecate `methodOverride()` -- use `method-override` npm module instead + * deps: body-parser@1.3.0 + - add `extended` option to urlencoded parser + * deps: method-override@2.0.1 + - set `Vary` header + - deps: methods@1.0.1 + * deps: multiparty@3.2.8 + * deps: response-time@2.0.0 + - add `digits` argument + - do not override existing `X-Response-Time` header + - timer not subject to clock drift + - timer resolution down to nanoseconds + * deps: serve-static@1.2.1 + - send max-age in Cache-Control in correct format + - use `escape-html` for escaping + - deps: send@0.4.1 + +2.18.0 / 2014-05-29 +=================== + + * deps: compression@1.0.3 + * deps: serve-index@1.1.0 + - Fix content negotiation when no `Accept` header + - Properly support all HTTP methods + - Support vanilla node.js http servers + - Treat `ENAMETOOLONG` as code 414 + - Use accepts for negotiation + * deps: serve-static@1.2.0 + - Calculate ETag with md5 for reduced collisions + - Fix wrong behavior when index file matches directory + - Ignore stream errors after request ends + - Skip directories in index file search + - deps: send@0.4.0 + +2.17.3 / 2014-05-27 +=================== + + * deps: express-session@1.2.1 + - Fix `resave` such that `resave: true` works + +2.17.2 / 2014-05-27 +=================== + + * deps: body-parser@1.2.2 + - invoke `next(err)` after request fully read + - deps: raw-body@1.1.6 + * deps: method-override@1.0.2 + - Handle `req.body` key referencing array or object + - Handle multiple HTTP headers + +2.17.1 / 2014-05-21 +=================== + + * fix `res.charset` appending charset when `content-type` has one + +2.17.0 / 2014-05-20 +=================== + + * deps: express-session@1.2.0 + - Add `resave` option to control saving unmodified sessions + * deps: morgan@1.1.1 + - "dev" format will use same tokens as other formats + - `:response-time` token is now empty when immediate used + - `:response-time` token is now monotonic + - `:response-time` token has precision to 1 ฮผs + - fix `:status` + immediate output in node.js 0.8 + - improve `buffer` option to prevent indefinite event loop holding + - simplify method to get remote address + - deps: bytes@1.0.0 + * deps: serve-index@1.0.3 + - Fix error from non-statable files in HTML view + +2.16.2 / 2014-05-18 +=================== + + * fix edge-case in `res.appendHeader` that would append in wrong order + * deps: method-override@1.0.1 + +2.16.1 / 2014-05-17 +=================== + + * remove usages of `res.headerSent` from core + +2.16.0 / 2014-05-17 +=================== + + * deprecate `res.headerSent` -- use `res.headersSent` + * deprecate `res.on("header")` -- use on-headers module instead + * fix `connect.version` to reflect the actual version + * json: use body-parser + - add `type` option + - fix repeated limit parsing with every request + - improve parser speed + * urlencoded: use body-parser + - add `type` option + - fix repeated limit parsing with every request + * dep: bytes@1.0.0 + * add negative support + * dep: cookie-parser@1.1.0 + - deps: cookie@0.1.2 + * dep: csurf@1.2.0 + - add support for double-submit cookie + * dep: express-session@1.1.0 + - Add `name` option; replacement for `key` option + - Use `setImmediate` in MemoryStore for node.js >= 0.10 + +2.15.0 / 2014-05-04 +=================== + + * Add simple `res.cookie` support + * Add `res.appendHeader` + * Call error stack even when response has been sent + * Patch `res.headerSent` to return Boolean + * Patch `res.headersSent` for node.js 0.8 + * Prevent default 404 handler after response sent + * dep: compression@1.0.2 + * support headers given to `res.writeHead` + * deps: bytes@0.3.0 + * deps: negotiator@0.4.3 + * dep: connect-timeout@1.1.0 + * Add `req.timedout` property + * Add `respond` option to constructor + * Clear timer on socket destroy + * deps: debug@0.8.1 + * dep: debug@^0.8.0 + * add `enable()` method + * change from stderr to stdout + * dep: errorhandler@1.0.1 + * Clean up error CSS + * Do not respond after headers sent + * dep: express-session@1.0.4 + * Remove import of `setImmediate` + * Use `res.cookie()` instead of `res.setHeader()` + * deps: cookie@0.1.2 + * deps: debug@0.8.1 + * dep: morgan@1.0.1 + * Make buffer unique per morgan instance + * deps: bytes@0.3.0 + * dep: serve-favicon@2.0.0 + * Accept `Buffer` of icon as first argument + * Non-GET and HEAD requests are denied + * Send valid max-age value + * Support conditional requests + * Support max-age=0 + * Support OPTIONS method + * Throw if `path` argument is directory + * dep: serve-index@1.0.2 + * Add stylesheet option + * deps: negotiator@0.4.3 + +2.14.5 / 2014-04-24 +=================== + + * dep: raw-body@1.1.4 + * allow true as an option + * deps: bytes@0.3.0 + * dep: serve-static@1.1.0 + * Accept options directly to `send` module + * deps: send@0.3.0 + +2.14.4 / 2014-04-07 +=================== + + * dep: bytes@0.3.0 + * added terabyte support + * dep: csurf@1.1.0 + * add constant-time string compare + * dep: serve-static@1.0.4 + * Resolve relative paths at middleware setup + * Use parseurl to parse the URL from request + * fix node.js 0.8 compatibility with memory session + +2.14.3 / 2014-03-18 +=================== + + * dep: static-favicon@1.0.2 + * Fixed content of default icon + +2.14.2 / 2014-03-11 +=================== + + * dep: static-favicon@1.0.1 + * Fixed path to default icon + +2.14.1 / 2014-03-06 +=================== + + * dep: fresh@0.2.2 + * no real changes + * dep: serve-index@1.0.1 + * deps: negotiator@0.4.2 + * dep: serve-static@1.0.2 + * deps: send@0.2.0 + +2.14.0 / 2014-03-05 +=================== + + * basicAuth: use basic-auth-connect + * cookieParser: use cookie-parser + * compress: use compression + * csrf: use csurf + * dep: cookie-signature@1.0.3 + * directory: use serve-index + * errorHandler: use errorhandler + * favicon: use static-favicon + * logger: use morgan + * methodOverride: use method-override + * responseTime: use response-time + * session: use express-session + * static: use serve-static + * timeout: use connect-timeout + * vhost: use vhost + +2.13.1 / 2014-03-05 +=================== + + * cookieSession: compare full value rather than crc32 + * deps: raw-body@1.1.3 + +2.13.0 / 2014-02-14 +=================== + + * fix typo in memory store warning #974 @rvagg + * compress: use compressible + * directory: add template option #990 @gottaloveit @Earl-Brown + * csrf: prevent deprecated warning with old sessions + +2.12.0 / 2013-12-10 +=================== + + * bump qs + * directory: sort folders before files + * directory: add folder icons + * directory: de-duplicate icons, details/mobile views #968 @simov + * errorHandler: end default 404 handler with a newline #972 @rlidwka + * session: remove long cookie expire check #870 @undoZen + +2.11.2 / 2013-12-01 +=================== + + * bump raw-body + +2.11.1 / 2013-11-27 +=================== + + * bump raw-body + * errorHandler: use `res.setHeader()` instead of `res.writeHead()` #949 @lo1tuma + +2.11.0 / 2013-10-29 +=================== + + * update bytes + * update uid2 + * update negotiator + * sessions: add rolling session option #944 @ilmeo + * sessions: property set cookies when given FQDN + * cookieSessions: properly set cookies when given FQDN #948 @bmancini55 + * proto: fix FQDN mounting when multiple handlers #945 @bmancini55 + +2.10.1 / 2013-10-23 +=================== + + * fixed; fixed a bug with static middleware at root and trailing slashes #942 (@dougwilson) + +2.10.0 / 2013-10-22 +=================== + + * fixed: set headers written by writeHead before emitting 'header' + * fixed: mounted path should ignore querystrings on FQDNs #940 (@dougwilson) + * fixed: parsing protocol-relative URLs with @ as pathnames #938 (@dougwilson) + * fixed: fix static directory redirect for mount's root #937 (@dougwilson) + * fixed: setting set-cookie header when mixing arrays and strings #893 (@anuj123) + * bodyParser: optional verify function for urlencoded and json parsers for signing request bodies + * compress: compress checks content-length to check threshold + * compress: expose `res.flush()` for flushing responses + * cookieParser: pass options into node-cookie #803 (@cauldrath) + * errorHandler: replace `\n`s with `
`s in error handler + +2.9.2 / 2013-10-18 +================== + + * warn about multiparty and limit middleware deprecation for v3 + * fix fully qualified domain name mounting. #920 (@dougwilson) + * directory: Fix potential security issue with serving files outside the root. #929 (@dougwilson) + * logger: store IP at beginning in case socket prematurely closes #930 (@dougwilson) + +2.9.1 / 2013-10-15 +================== + + * update multiparty + * compress: Set vary header only if Content-Type passes filter #904 + * directory: Fix directory middleware URI escaping #917 (@dougwilson) + * directory: Fix directory seperators for Windows #914 (@dougwilson) + * directory: Keep query string intact during directory redirect #913 (@dougwilson) + * directory: Fix paths in links #730 (@JacksonTian) + * errorHandler: Don't escape text/plain as HTML #875 (@johan) + * logger: Write '0' instead of '-' when response time is zero #910 (@dougwilson) + * logger: Log even when connections are aborted #760 (@dylanahsmith) + * methodOverride: Check req.body is an object #907 (@kbjr) + * multipart: Add .type back to file parts for backwards compatibility #912 (@dougwilson) + * multipart: Allow passing options to the Multiparty constructor #902 (@niftylettuce) + +2.9.0 / 2013-09-07 +================== + + * multipart: add docs regarding tmpfiles + * multipart: add .name back to file parts + * multipart: use multiparty instead of formidable + +2.8.8 / 2013-09-02 +================== + + * csrf: change to math.random() salt and remove csrfToken() callback + +2.8.7 / 2013-08-28 +================== + + * csrf: prevent salt generation on every request, and add async req.csrfToken(fn) + +2.8.6 / 2013-08-28 +================== + + * csrf: refactor to use HMAC tokens (BREACH attack) + * compress: add compression of SVG and common font files by default. + +2.8.5 / 2013-08-11 +================== + + * add: compress Dart source files by default + * update fresh + +2.8.4 / 2013-07-08 +================== + + * update send + +2.8.3 / 2013-07-04 +================== + + * add a name back to static middleware ("staticMiddleware") + * fix .hasBody() utility to require transfer-encoding or content-length + +2.8.2 / 2013-07-03 +================== + + * update send + * update cookie dep. + * add better debug() for middleware + * add whitelisting of supported methods to methodOverride() + +2.8.1 / 2013-06-27 +================== + + * fix: escape req.method in 404 response + +2.8.0 / 2013-06-26 +================== + + * add `threshold` option to `compress()` to prevent compression of small responses + * add support for vendor JSON mime types in json() + * add X-Forwarded-Proto initial https proxy support + * change static redirect to 303 + * change octal escape sequences for strict mode + * change: replace utils.uid() with uid2 lib + * remove other "static" function name. Fixes #794 + * fix: hasBody() should return false if Content-Length: 0 + +2.7.11 / 2013-06-02 +================== + + * update send + +2.7.10 / 2013-05-21 +================== + + * update qs + * update formidable + * fix: write/end to noop() when request aborted + +2.7.9 / 2013-05-07 +================== + + * update qs + * drop support for node < v0.8 + +2.7.8 / 2013-05-03 +================== + + * update qs + +2.7.7 / 2013-04-29 +================== + + * update qs dependency + * remove "static" function name. Closes #794 + * update node-formidable + * update buffer-crc32 + +2.7.6 / 2013-04-15 +================== + + * revert cookie signature which was creating session race conditions + +2.7.5 / 2013-04-12 +================== + + * update cookie-signature + * limit: do not consume request in node 0.10.x + +2.7.4 / 2013-04-01 +================== + + * session: add long expires check and prevent excess set-cookie + * session: add console.error() of session#save() errors + +2.7.3 / 2013-02-19 +================== + + * add name to compress middleware + * add appending Accept-Encoding to Vary when set but missing + * add tests for csrf middleware + * add 'next' support for connect() server handler + * change utils.uid() to return url-safe chars. Closes #753 + * fix treating '.' as a regexp in vhost() + * fix duplicate bytes dep in package.json. Closes #743 + * fix #733 - parse x-forwarded-proto in a more generally compatibly way + * revert "add support for `next(status[, msg])`"; makes composition hard + +2.7.2 / 2013-01-04 +================== + + * add support for `next(status[, msg])` back + * add utf-8 meta tag to support foreign characters in filenames/directories + * change `timeout()` 408 to 503 + * replace 'node-crc' with 'buffer-crc32', fixes licensing + * fix directory.html IE support + +2.7.1 / 2012-12-05 +================== + + * add directory() tests + * add support for bodyParser to ignore Content-Type if no body is present (jquery primarily does this poorely) + * fix errorHandler signature + +2.7.0 / 2012-11-13 +================== + + * add support for leading JSON whitespace + * add logging of `req.ip` when present + * add basicAuth support for `:`-delimited string + * update cookie module. Closes #688 + +2.6.2 / 2012-11-01 +================== + + * add `debug()` for disconnected session store + * fix session regeneration bug. Closes #681 + +2.6.1 / 2012-10-25 +================== + + * add passing of `connect.timeout()` errors to `next()` + * replace signature utils with cookie-signature module + +2.6.0 / 2012-10-09 +================== + + * add `defer` option to `multipart()` [Blake Miner] + * fix mount path case sensitivity. Closes #663 + * fix default of ascii encoding from `logger()`, now utf8. Closes #293 + +2.5.0 / 2012-09-27 +================== + + * add `err.status = 400` to multipart() errors + * add double-encoding protection to `compress()`. Closes #659 + * add graceful handling cookie parsing errors [shtylman] + * fix typo X-Response-time to X-Response-Time + +2.4.6 / 2012-09-18 +================== + + * update qs + +2.4.5 / 2012-09-03 +================== + + * add session store "connect" / "disconnect" support [louischatriot] + * fix `:url` log token + +2.4.4 / 2012-08-21 +================== + + * fix `static()` pause regression from "send" integration + +2.4.3 / 2012-08-07 +================== + + * fix `.write()` encoding for zlib inconstancy. Closes #561 + +2.4.2 / 2012-07-25 +================== + + * remove limit default from `urlencoded()` + * remove limit default from `json()` + * remove limit default from `multipart()` + * fix `cookieSession()` clear cookie path / domain bug. Closes #636 + +2.4.1 / 2012-07-24 +================== + + * fix `options` mutation in `static()` + +2.4.0 / 2012-07-23 +================== + + * add `connect.timeout()` + * add __GET__ / __HEAD__ check to `directory()`. Closes #634 + * add "pause" util dep + * update send dep for normalization bug + +2.3.9 / 2012-07-16 +================== + + * add more descriptive invalid json error message + * update send dep for root normalization regression + * fix staticCache fresh dep + +2.3.8 / 2012-07-12 +================== + + * fix `connect.static()` 404 regression, pass `next()`. Closes #629 + +2.3.7 / 2012-07-05 +================== + + * add `json()` utf-8 illustration test. Closes #621 + * add "send" dependency + * change `connect.static()` internals to use "send" + * fix `session()` req.session generation with pathname mismatch + * fix `cookieSession()` req.session generation with pathname mismatch + * fix mime export. Closes #618 + +2.3.6 / 2012-07-03 +================== + + * Fixed cookieSession() with cookieParser() secret regression. Closes #602 + * Fixed set-cookie header fields on cookie.path mismatch. Closes #615 + +2.3.5 / 2012-06-28 +================== + + * Remove `logger()` mount check + * Fixed `staticCache()` dont cache responses with set-cookie. Closes #607 + * Fixed `staticCache()` when Cookie is present + +2.3.4 / 2012-06-22 +================== + + * Added `err.buf` to urlencoded() and json() + * Update cookie to 0.0.4. Closes #604 + * Fixed: only send 304 if original response in 2xx or 304 [timkuijsten] + +2.3.3 / 2012-06-11 +================== + + * Added ETags back to `static()` [timkuijsten] + * Replaced `utils.parseRange()` with `range-parser` module + * Replaced `utils.parseBytes()` with `bytes` module + * Replaced `utils.modified()` with `fresh` module + * Fixed `cookieSession()` regression with invalid cookie signing [shtylman] + +2.3.2 / 2012-06-08 +================== + + * expose mime module + * Update crc dep (which bundled nodeunit) + +2.3.1 / 2012-06-06 +================== + + * Added `secret` option to `cookieSession` middleware [shtylman] + * Added `secret` option to `session` middleware [shtylman] + * Added `req.remoteUser` back to `basicAuth()` as alias of `req.user` + * Performance: improve signed cookie parsing + * Update `cookie` dependency [shtylman] + +2.3.0 / 2012-05-20 +================== + + * Added limit option to `json()` + * Added limit option to `urlencoded()` + * Added limit option to `multipart()` + * Fixed: remove socket error event listener on callback + * Fixed __ENOTDIR__ error on `static` middleware + +2.2.2 / 2012-05-07 +================== + + * Added support to csrf middle for pre-flight CORS requests + * Updated `engines` to allow newer version of node + * Removed duplicate repo prop. Closes #560 + +2.2.1 / 2012-04-28 +================== + + * Fixed `static()` redirect when mounted. Closes #554 + +2.2.0 / 2012-04-25 +================== + + * Added `make benchmark` + * Perf: memoize url parsing (~20% increase) + * Fixed `connect(fn, fn2, ...)`. Closes #549 + +2.1.3 / 2012-04-20 +================== + + * Added optional json() `reviver` function to be passed to JSON.parse [jed] + * Fixed: emit drain in compress middleware [nsabovic] + +2.1.2 / 2012-04-11 +================== + + * Fixed cookieParser() `req.cookies` regression + +2.1.1 / 2012-04-11 +================== + + * Fixed `session()` browser-session length cookies & examples + * Fixed: make `query()` "self-aware" [jed] + +2.1.0 / 2012-04-05 +================== + + * Added `debug()` calls to `.use()` (`DEBUG=connect:displatcher`) + * Added `urlencoded()` support for GET + * Added `json()` support for GET. Closes #497 + * Added `strict` option to `json()` + * Changed: `session()` only set-cookie when modified + * Removed `Session#lastAccess` property. Closes #399 + +2.0.3 / 2012-03-20 +================== + + * Added: `cookieSession()` only sets cookie on change. Closes #442 + * Added `connect:dispatcher` debug() probes + +2.0.2 / 2012-03-04 +================== + + * Added test for __ENAMETOOLONG__ now that node is fixed + * Fixed static() index "/" check on windows. Closes #498 + * Fixed Content-Range behaviour to match RFC2616 [matthiasdg / visionmedia] + +2.0.1 / 2012-02-29 +================== + + * Added test coverage for `vhost()` middleware + * Changed `cookieParser()` signed cookie support to use SHA-2 [senotrusov] + * Fixed `static()` Range: respond with 416 when unsatisfiable + * Fixed `vhost()` middleware. Closes #494 + +2.0.0 / 2011-10-05 +================== + + * Added `cookieSession()` middleware for cookie-only sessions + * Added `compress()` middleware for gzip / deflate support + * Added `session()` "proxy" setting to trust `X-Forwarded-Proto` + * Added `json()` middleware to parse "application/json" + * Added `urlencoded()` middleware to parse "application/x-www-form-urlencoded" + * Added `multipart()` middleware to parse "multipart/form-data" + * Added `cookieParser(secret)` support so anything using this middleware may access signed cookies + * Added signed cookie support to `cookieParser()` + * Added support for JSON-serialized cookies to `cookieParser()` + * Added `err.status` support in Connect's default end-point + * Added X-Cache MISS / HIT to `staticCache()` + * Added public `res.headerSent` checking nodes `res._headerSent` until node does + * Changed `basicAuth()` req.remoteUser to req.user + * Changed: default `session()` to a browser-session cookie. Closes #475 + * Changed: no longer lowercase cookie names + * Changed `bodyParser()` to use `json()`, `urlencoded()`, and `multipart()` + * Changed: `errorHandler()` is now a development-only middleware + * Changed middleware to `next()` errors when possible so applications can unify logging / handling + * Removed `http[s].Server` inheritance, now just a function, making it easy to have an app providing both http and https + * Removed `.createServer()` (use `connect()`) + * Removed `secret` option from `session()`, use `cookieParser(secret)` + * Removed `connect.session.ignore` array support + * Removed `router()` middleware. Closes #262 + * Fixed: set-cookie only once for browser-session cookies + * Fixed FQDN support. dont add leading "/" + * Fixed 404 XSS attack vector. Closes #473 + * Fixed __HEAD__ support for 404s and 500s generated by Connect's end-point + +1.8.5 / 2011-12-22 +================== + + * Fixed: actually allow empty body for json + +1.8.4 / 2011-12-22 +================== + + * Changed: allow empty body for json/urlencoded requests. Backport for #443 + +1.8.3 / 2011-12-16 +================== + + * Fixed `static()` _index.html_ support on windows + +1.8.2 / 2011-12-03 +================== + + * Fixed potential security issue, store files in req.files. Closes #431 [reported by dobesv] + +1.8.1 / 2011-11-21 +================== + + * Added nesting support for _multipart/form-data_ [jackyz] + +1.8.0 / 2011-11-17 +================== + + * Added _multipart/form-data_ support to `bodyParser()` using formidable + +1.7.3 / 2011-11-11 +================== + + * Fixed `req.body`, always default to {} + * Fixed HEAD support for 404s and 500s + +1.7.2 / 2011-10-24 +================== + + * "node": ">= 0.4.1 < 0.7.0" + * Added `static()` redirect option. Closes #398 + * Changed `limit()`: respond with 413 when content-length exceeds the limit + * Removed socket error listener in static(). Closes #389 + * Fixed `staticCache()` Age header field + * Fixed race condition causing errors reported in #329. + +1.7.1 / 2011-09-12 +================== + + * Added: make `Store` inherit from `EventEmitter` + * Added session `Store#load(sess, fn)` to fetch a `Session` instance + * Added backpressure support to `staticCache()` + * Changed `res.socket.destroy()` to `req.socket.destroy()` + +1.7.0 / 2011-08-31 +================== + + * Added `staticCache()` middleware, a memory cache for `static()` + * Added public `res.headerSent` checking nodes `res._headerSent` (remove when node adds this) + * Changed: ignore error handling middleware when header is sent + * Changed: dispatcher errors after header is sent destroy the sock + +1.6.4 / 2011-08-26 +================== + + * Revert "Added double-next reporting" + +1.6.3 / 2011-08-26 +================== + + * Added double-`next()` reporting + * Added `immediate` option to `logger()`. Closes #321 + * Dependency `qs >= 0.3.1` + +1.6.2 / 2011-08-11 +================== + + * Fixed `connect.static()` null byte vulnerability + * Fixed `connect.directory()` null byte vulnerability + * Changed: 301 redirect in `static()` to postfix "/" on directory. Closes #289 + +1.6.1 / 2011-08-03 +================== + + * Added: allow retval `== null` from logger callback to ignore line + * Added `getOnly` option to `connect.static.send()` + * Added response "header" event allowing augmentation + * Added `X-CSRF-Token` header field check + * Changed dep `qs >= 0.3.0` + * Changed: persist csrf token. Closes #322 + * Changed: sort directory middleware files alphabetically + +1.6.0 / 2011-07-10 +================== + + * Added :response-time to "dev" logger format + * Added simple `csrf()` middleware. Closes #315 + * Fixed `res._headers` logger regression. Closes #318 + * Removed support for multiple middleware being passed to `.use()` + +1.5.2 / 2011-07-06 +================== + + * Added `filter` function option to `directory()` [David Rio Deiros] + * Changed: re-write of the `logger()` middleware, with extensible tokens and formats + * Changed: `static.send()` ".." in path without root considered malicious + * Fixed quotes in docs. Closes #312 + * Fixed urls when mounting `directory()`, use `originalUrl` [Daniel Dickison] + + +1.5.1 / 2011-06-20 +================== + + * Added malicious path check to `directory()` middleware + * Added `utils.forbidden(res)` + * Added `connect.query()` middleware + +1.5.0 / 2011-06-20 +================== + + * Added `connect.directory()` middleware for serving directory listings + +1.4.6 / 2011-06-18 +================== + + * Fixed `connect.static()` root with `..` + * Fixed `connect.static()` __EBADF__ + +1.4.5 / 2011-06-17 +================== + + * Fixed EBADF in `connect.static()`. Closes #297 + +1.4.4 / 2011-06-16 +================== + + * Changed `connect.static()` to check resolved dirname. Closes #294 + +1.4.3 / 2011-06-06 +================== + + * Fixed fd leak in `connect.static()` when the socket is closed + * Fixed; `bodyParser()` ignoring __GET/HEAD__. Closes #285 + +1.4.2 / 2011-05-27 +================== + + * Changed to `devDependencies` + * Fixed stream creation on `static()` __HEAD__ request. [Andreas Lind Petersen] + * Fixed Win32 support for `static()` + * Fixed monkey-patch issue. Closes #261 + +1.4.1 / 2011-05-08 +================== + + * Added "hidden" option to `static()`. ignores hidden files by default. Closes * Added; expose `connect.static.mime.define()`. Closes #251 + * Fixed `errorHandler` middleware for missing stack traces. [aseemk] +#274 + +1.4.0 / 2011-04-25 +================== + + * Added route-middleware `next('route')` support to jump passed the route itself + * Added Content-Length support to `limit()` + * Added route-specific middleware support (used to be in express) + * Changed; refactored duplicate session logic + * Changed; prevent redefining `store.generate` per request + * Fixed; `static()` does not set Content-Type when explicitly set [nateps] + * Fixed escape `errorHandler()` {error} contents + * NOTE: `router` will be removed in 2.0 + + +1.3.0 / 2011-04-06 +================== + + * Added `router.remove(path[, method])` to remove a route + +1.2.3 / 2011-04-05 +================== + + * Fixed basicAuth realm issue when passing strings. Closes #253 + +1.2.2 / 2011-04-05 +================== + + * Added `basicAuth(username, password)` support + * Added `errorHandler.title` defaulting to "Connect" + * Changed `errorHandler` css + +1.2.1 / 2011-03-30 +================== + + * Fixed `logger()` https `remoteAddress` logging [Alexander Simmerl] + +1.2.0 / 2011-03-30 +================== + + * Added `router.lookup(path[, method])` + * Added `router.match(url[, method])` + * Added basicAuth async support. Closes #223 + +1.1.5 / 2011-03-27 +================== + + * Added; allow `logger()` callback function to return an empty string to ignore logging + * Fixed; utilizing `mime.charsets.lookup()` for `static()`. Closes 245 + +1.1.4 / 2011-03-23 +================== + + * Added `logger()` support for format function + * Fixed `logger()` to support mess of writeHead()/progressive api for node 0.4.x + +1.1.3 / 2011-03-21 +================== + + * Changed; `limit()` now calls `req.destroy()` + +1.1.2 / 2011-03-21 +================== + + * Added request "limit" event to `limit()` middleware + * Changed; `limit()` middleware will `next(err)` on failure + +1.1.1 / 2011-03-18 +================== + + * Fixed session middleware for HTTPS. Closes #241 [reported by mt502] + +1.1.0 / 2011-03-17 +================== + + * Added `Session#reload(fn)` + +1.0.6 / 2011-03-09 +================== + + * Fixed `res.setHeader()` patch, preserve casing + +1.0.5 / 2011-03-09 +================== + + * Fixed; `logger()` using `req.originalUrl` instead of `req.url` + +1.0.4 / 2011-03-09 +================== + + * Added `res.charset` + * Added conditional sessions example + * Added support for `session.ignore` to be replaced. Closes #227 + * Fixed `Cache-Control` delimiters. Closes #228 + +1.0.3 / 2011-03-03 +================== + + * Fixed; `static.send()` invokes callback with connection error + +1.0.2 / 2011-03-02 +================== + + * Fixed exported connect function + * Fixed package.json; node ">= 0.4.1 < 0.5.0" + +1.0.1 / 2011-03-02 +================== + + * Added `Session#save(fn)`. Closes #213 + * Added callback support to `connect.static.send()` for express + * Added `connect.static.send()` "path" option + * Fixed content-type in `static()` for _index.html_ + +1.0.0 / 2011-03-01 +================== + + * Added `stack`, `message`, and `dump` errorHandler option aliases + * Added `req.originalMethod` to methodOverride + * Added `favicon()` maxAge option support + * Added `connect()` alternative to `connect.createServer()` + * Added new [documentation](http://senchalabs.github.com/connect) + * Added Range support to `static()` + * Added HTTPS support + * Rewrote session middleware. The session API now allows for + session-specific cookies, so you may alter each individually. + Click to view the new [session api](http://senchalabs.github.com/connect/middleware-session.html). + * Added middleware self-awareness. This helps prevent + middleware breakage when used within mounted servers. + For example `cookieParser()` will not parse cookies more + than once even when within a mounted server. + * Added new examples in the `./examples` directory + * Added [limit()](http://senchalabs.github.com/connect/middleware-limit.html) middleware + * Added [profiler()](http://senchalabs.github.com/connect/middleware-profiler.html) middleware + * Added [responseTime()](http://senchalabs.github.com/connect/middleware-responseTime.html) middleware + * Renamed `staticProvider` to `static` + * Renamed `bodyDecoder` to `bodyParser` + * Renamed `cookieDecoder` to `cookieParser` + * Fixed ETag quotes. [reported by papandreou] + * Fixed If-None-Match comma-delimited ETag support. [reported by papandreou] + * Fixed; only set req.originalUrl once. Closes #124 + * Fixed symlink support for `static()`. Closes #123 + +0.5.10 / 2011-02-14 +================== + + * Fixed SID space issue. Closes #196 + * Fixed; proxy `res.end()` to commit session data + * Fixed directory traversal attack in `staticProvider`. Closes #198 + +0.5.9 / 2011-02-09 +================== + + * qs >= 0.0.4 + +0.5.8 / 2011-02-04 +================== + + * Added `qs` dependency + * Fixed router race-condition causing possible failure + when `next()`ing to one or more routes with parallel + requests + +0.5.7 / 2011-02-01 +================== + + * Added `onvhost()` call so Express (and others) can know when they are + * Revert "Added stylus support" (use the middleware which ships with stylus) + * Removed custom `Server#listen()` to allow regular `http.Server#listen()` args to work properly + * Fixed long standing router issue (#83) that causes '.' to be disallowed within named placeholders in routes [Andreas Lind Petersen] + * Fixed `utils.uid()` length error [Jxck] +mounted + +0.5.6 / 2011-01-23 +================== + + * Added stylus support to `compiler` + * _favicon.js_ cleanup + * _compiler.js_ cleanup + * _bodyDecoder.js_ cleanup + +0.5.5 / 2011-01-13 +================== + + * Changed; using sha256 HMAC instead of md5. [Paul Querna] + * Changed; generated a longer random UID, without time influence. [Paul Querna] + * Fixed; session middleware throws when secret is not present. [Paul Querna] + +0.5.4 / 2011-01-07 +================== + + * Added; throw when router path or callback is missing + * Fixed; `next(err)` on cookie parse exception instead of ignoring + * Revert "Added utils.pathname(), memoized url.parse(str).pathname" + +0.5.3 / 2011-01-05 +================== + + * Added _docs/api.html_ + * Added `utils.pathname()`, memoized url.parse(str).pathname + * Fixed `session.id` issue. Closes #183 + * Changed; Defaulting `staticProvider` maxAge to 0 not 1 year. Closes #179 + * Removed bad outdated docs, we need something new / automated eventually + +0.5.2 / 2010-12-28 +================== + + * Added default __OPTIONS__ support to _router_ middleware + +0.5.1 / 2010-12-28 +================== + + * Added `req.session.id` mirroring `req.sessionID` + * Refactored router, exposing `connect.router.methods` + * Exclude non-lib files from npm + * Removed imposed headers `X-Powered-By`, `Server`, etc + +0.5.0 / 2010-12-06 +================== + + * Added _./index.js_ + * Added route segment precondition support and example + * Added named capture group support to router + +0.4.0 / 2010-11-29 +================== + + * Added `basicAuth` middleware + * Added more HTTP methods to the `router` middleware + +0.3.0 / 2010-07-21 +================== + + * Added _staticGzip_ middleware + * Added `connect.utils` to expose utils + * Added `connect.session.Session` + * Added `connect.session.Store` + * Added `connect.session.MemoryStore` + * Added `connect.middleware` to expose the middleware getters + * Added `buffer` option to _logger_ for performance increase + * Added _favicon_ middleware for serving your own favicon or the connect default + * Added option support to _staticProvider_, can now pass _root_ and _lifetime_. + * Added; mounted `Server` instances now have the `route` property exposed for reflection + * Added support for callback as first arg to `Server#use()` + * Added support for `next(true)` in _router_ to bypass match attempts + * Added `Server#listen()` _host_ support + * Added `Server#route` when `Server#use()` is called with a route on a `Server` instance + * Added _methodOverride_ X-HTTP-Method-Override support + * Refactored session internals, adds _secret_ option + * Renamed `lifetime` option to `maxAge` in _staticProvider_ + * Removed connect(1), it is now [spark(1)](http://github.com/senchalabs/spark) + * Removed connect(1) dependency on examples, they can all now run with node(1) + * Remove a typo that was leaking a global. + * Removed `Object.prototype` forEach() and map() methods + * Removed a few utils not used + * Removed `connect.createApp()` + * Removed `res.simpleBody()` + * Removed _format_ middleware + * Removed _flash_ middleware + * Removed _redirect_ middleware + * Removed _jsonrpc_ middleware, use [visionmedia/connect-jsonrpc](http://github.com/visionmedia/connect-jsonrpc) + * Removed _pubsub_ middleware + * Removed need for `params.{captures,splat}` in _router_ middleware, `params` is an array + * Changed; _compiler_ no longer 404s + * Changed; _router_ signature now matches connect middleware signature + * Fixed a require in _session_ for default `MemoryStore` + * Fixed nasty request body bug in _router_. Closes #54 + * Fixed _less_ support in _compiler_ + * Fixed bug preventing proper bubbling of exceptions in mounted servers + * Fixed bug in `Server#use()` preventing `Server` instances as the first arg + * Fixed **ENOENT** special case, is now treated as any other exception + * Fixed spark env support + +0.2.1 / 2010-07-09 +================== + + * Added support for _router_ `next()` to continue calling matched routes + * Added mime type for _cache.manifest_ files. + * Changed _compiler_ middleware to use async require + * Changed session api, stores now only require `#get()`, and `#set()` + * Fixed _cacheManifest_ by adding `utils.find()` back + +0.2.0 / 2010-07-01 +================== + + * Added calls to `Session()` casts the given object as a `Session` instance + * Added passing of `next()` to _router_ callbacks. Closes #46 + * Changed; `MemoryStore#destroy()` removes `req.session` + * Changed `res.redirect("back")` to default to "/" when Referr?er is not present + * Fixed _staticProvider_ urlencoded paths issue. Closes #47 + * Fixed _staticProvider_ middleware responding to **GET** requests + * Fixed _jsonrpc_ middleware `Accept` header check. Closes #43 + * Fixed _logger_ format option + * Fixed typo in _compiler_ middleware preventing the _dest_ option from working + +0.1.0 / 2010-06-25 +================== + + * Revamped the api, view the [Connect documentation](http://extjs.github.com/Connect/index.html#Middleware-Authoring) for more info (hover on the right for menu) + * Added [extended api docs](http://extjs.github.com/Connect/api.html) + * Added docs for several more middleware layers + * Added `connect.Server#use()` + * Added _compiler_ middleware which provides arbitrary static compilation + * Added `req.originalUrl` + * Removed _blog_ example + * Removed _sass_ middleware (use _compiler_) + * Removed _less_ middleware (use _compiler_) + * Renamed middleware to be camelcase, _body-decoder_ is now _bodyDecoder_ etc. + * Fixed `req.url` mutation bug when matching `connect.Server#use()` routes + * Fixed `mkdir -p` implementation used in _bin/connect_. Closes #39 + * Fixed bug in _bodyDecoder_ throwing exceptions on request empty bodies + * `make install` installing lib to $LIB_PREFIX aka $HOME/.node_libraries + +0.0.6 / 2010-06-22 +================== + + * Added _static_ middleware usage example + * Added support for regular expressions as paths for _router_ + * Added `util.merge()` + * Increased performance of _static_ by ~ 200 rps + * Renamed the _rest_ middleware to _router_ + * Changed _rest_ api to accept a callback function + * Removed _router_ middleware + * Removed _proto.js_, only `Object#forEach()` remains + +0.0.5 / 2010-06-21 +================== + + * Added Server#use() which contains the Layer normalization logic + * Added documentation for several middleware + * Added several new examples + * Added _less_ middleware + * Added _repl_ middleware + * Added _vhost_ middleware + * Added _flash_ middleware + * Added _cookie_ middleware + * Added _session_ middleware + * Added `utils.htmlEscape()` + * Added `utils.base64Decode()` + * Added `utils.base64Encode()` + * Added `utils.uid()` + * Added bin/connect app path and --config path support for .js suffix, although optional. Closes #26 + * Moved mime code to `utils.mime`, ex `utils.mime.types`, and `utils.mime.type()` + * Renamed req.redirect() to res.redirect(). Closes #29 + * Fixed _sass_ 404 on **ENOENT** + * Fixed +new Date duplication. Closes #24 + +0.0.4 / 2010-06-16 +================== + + * Added workerPidfile() to bin/connect + * Added --workers support to bin/connect stop and status commands + * Added _redirect_ middleware + * Added better --config support to bin/connect. All flags can be utilized + * Added auto-detection of _./config.js_ + * Added config example + * Added `net.Server` support to bin/connect + * Writing worker pids relative to `env.pidfile` + * s/parseQuery/parse/g + * Fixed npm support + +0.0.3 / 2010-06-16 +================== + + * Fixed node dependency in package.json, now _">= 0.1.98-0"_ to support __HEAD__ + +0.0.2 / 2010-06-15 +================== + + * Added `-V, --version` to bin/connect + * Added `utils.parseCookie()` + * Added `utils.serializeCookie()` + * Added `utils.toBoolean()` + * Added _sass_ middleware + * Added _cookie_ middleware + * Added _format_ middleware + * Added _lint_ middleware + * Added _rest_ middleware + * Added _./package.json_ (npm install connect) + * Added `handleError()` support + * Added `process.connectEnv` + * Added custom log format support to _log_ middleware + * Added arbitrary env variable support to bin/connect (ext: --logFormat ":method :url") + * Added -w, --workers to bin/connect + * Added bin/connect support for --user NAME and --group NAME + * Fixed url re-writing support + +0.0.1 / 2010-06-03 +================== + + * Initial release + diff --git a/node_modules/connect/LICENSE b/node_modules/connect/LICENSE new file mode 100644 index 0000000..9c27617 --- /dev/null +++ b/node_modules/connect/LICENSE @@ -0,0 +1,25 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 LearnBoost +Copyright (c) 2011-2014 TJ Holowaychuk +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/connect/README.md b/node_modules/connect/README.md new file mode 100644 index 0000000..3b76991 --- /dev/null +++ b/node_modules/connect/README.md @@ -0,0 +1,295 @@ +
+ +connect logo + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +
+ + Connect is an extensible HTTP server framework for [node](http://nodejs.org) using "plugins" known as _middleware_. + +```js +var connect = require('connect'); +var http = require('http'); + +var app = connect(); + +// gzip/deflate outgoing responses +var compression = require('compression'); +app.use(compression()); + +// store session state in browser cookie +var cookieSession = require('cookie-session'); +app.use(cookieSession({ + keys: ['secret1', 'secret2'] +})); + +// parse urlencoded request bodies into req.body +var bodyParser = require('body-parser'); +app.use(bodyParser.urlencoded({extended: false})); + +// respond to all requests +app.use(function(req, res){ + res.end('Hello from Connect!\n'); +}); + +//create node.js http server and listen on port +http.createServer(app).listen(3000); +``` + +## Getting Started + +Connect is a simple framework to glue together various "middleware" to handle requests. + +### Install Connect + +```sh +$ npm install connect +``` + +### Create an app + +The main component is a Connect "app". This will store all the middleware +added and is, itself, a function. + +```js +var app = connect(); +``` + +### Use middleware + +The core of Connect is "using" middleware. Middleware are added as a "stack" +where incoming requests will execute each middleware one-by-one until a middleware +does not call `next()` within it. + +```js +app.use(function middleware1(req, res, next) { + // middleware 1 + next(); +}); +app.use(function middleware2(req, res, next) { + // middleware 2 + next(); +}); +``` + +### Mount middleware + +The `.use()` method also takes an optional path string that is matched against +the beginning of the incoming request URL. This allows for basic routing. + +```js +app.use('/foo', function fooMiddleware(req, res, next) { + // req.url starts with "/foo" + next(); +}); +app.use('/bar', function barMiddleware(req, res, next) { + // req.url starts with "/bar" + next(); +}); +``` + +### Error middleware + +There are special cases of "error-handling" middleware. There are middleware +where the function takes exactly 4 arguments. When a middleware passes an error +to `next`, the app will proceed to look for the error middleware that was declared +after that middleware and invoke it, skipping any error middleware above that +middleware and any non-error middleware below. + +```js +// regular middleware +app.use(function (req, res, next) { + // i had an error + next(new Error('boom!')); +}); + +// error middleware for errors that occurred in middleware +// declared before this +app.use(function onerror(err, req, res, next) { + // an error occurred! +}); +``` + +### Create a server from the app + +The last step is to actually use the Connect app in a server. The `.listen()` method +is a convenience to start a HTTP server (and is identical to the `http.Server`'s `listen` +method in the version of Node.js you are running). + +```js +var server = app.listen(port); +``` + +The app itself is really just a function with three arguments, so it can also be handed +to `.createServer()` in Node.js. + +```js +var server = http.createServer(app); +``` + +## Middleware + +These middleware and libraries are officially supported by the Connect/Express team: + + - [body-parser](https://www.npmjs.com/package/body-parser) - previous `bodyParser`, `json`, and `urlencoded`. You may also be interested in: + - [body](https://www.npmjs.com/package/body) + - [co-body](https://www.npmjs.com/package/co-body) + - [raw-body](https://www.npmjs.com/package/raw-body) + - [compression](https://www.npmjs.com/package/compression) - previously `compress` + - [connect-timeout](https://www.npmjs.com/package/connect-timeout) - previously `timeout` + - [cookie-parser](https://www.npmjs.com/package/cookie-parser) - previously `cookieParser` + - [cookie-session](https://www.npmjs.com/package/cookie-session) - previously `cookieSession` + - [csurf](https://www.npmjs.com/package/csurf) - previously `csrf` + - [errorhandler](https://www.npmjs.com/package/errorhandler) - previously `error-handler` + - [express-session](https://www.npmjs.com/package/express-session) - previously `session` + - [method-override](https://www.npmjs.com/package/method-override) - previously `method-override` + - [morgan](https://www.npmjs.com/package/morgan) - previously `logger` + - [response-time](https://www.npmjs.com/package/response-time) - previously `response-time` + - [serve-favicon](https://www.npmjs.com/package/serve-favicon) - previously `favicon` + - [serve-index](https://www.npmjs.com/package/serve-index) - previously `directory` + - [serve-static](https://www.npmjs.com/package/serve-static) - previously `static` + - [vhost](https://www.npmjs.com/package/vhost) - previously `vhost` + +Most of these are exact ports of their Connect 2.x equivalents. The primary exception is `cookie-session`. + +Some middleware previously included with Connect are no longer supported by the Connect/Express team, are replaced by an alternative module, or should be superseded by a better module. Use one of these alternatives instead: + + - `cookieParser` + - [cookies](https://www.npmjs.com/package/cookies) and [keygrip](https://www.npmjs.com/package/keygrip) + - `limit` + - [raw-body](https://www.npmjs.com/package/raw-body) + - `multipart` + - [connect-multiparty](https://www.npmjs.com/package/connect-multiparty) + - [connect-busboy](https://www.npmjs.com/package/connect-busboy) + - `query` + - [qs](https://www.npmjs.com/package/qs) + - `staticCache` + - [st](https://www.npmjs.com/package/st) + - [connect-static](https://www.npmjs.com/package/connect-static) + +Checkout [http-framework](https://github.com/Raynos/http-framework/wiki/Modules) for many other compatible middleware! + +## API + +The Connect API is very minimalist, enough to create an app and add a chain +of middleware. + +When the `connect` module is required, a function is returned that will construct +a new app when called. + +```js +// require module +var connect = require('connect') + +// create app +var app = connect() +``` + +### app(req, res[, next]) + +The `app` itself is a function. This is just an alias to `app.handle`. + +### app.handle(req, res[, out]) + +Calling the function will run the middleware stack against the given Node.js +http request (`req`) and response (`res`) objects. An optional function `out` +can be provided that will be called if the request (or error) was not handled +by the middleware stack. + +### app.listen([...]) + +Start the app listening for requests. This method will internally create a Node.js +HTTP server and call `.listen()` on it. + +This is an alias to the `server.listen()` method in the version of Node.js running, +so consult the Node.js documentation for all the different variations. The most +common signature is [`app.listen(port)`](https://nodejs.org/dist/latest-v6.x/docs/api/http.html#http_server_listen_port_hostname_backlog_callback). + +### app.use(fn) + +Use a function on the app, where the function represents a middleware. The function +will be invoked for every request in the order that `app.use` is called. The function +is called with three arguments: + +```js +app.use(function (req, res, next) { + // req is the Node.js http request object + // res is the Node.js http response object + // next is a function to call to invoke the next middleware +}) +``` + +In addition to a plan function, the `fn` argument can also be a Node.js HTTP server +instance or another Connect app instance. + +### app.use(route, fn) + +Use a function on the app, where the function represents a middleware. The function +will be invoked for every request in which the URL (`req.url` property) starts with +the given `route` string in the order that `app.use` is called. The function is +called with three arguments: + +```js +app.use('/foo', function (req, res, next) { + // req is the Node.js http request object + // res is the Node.js http response object + // next is a function to call to invoke the next middleware +}) +``` + +In addition to a plan function, the `fn` argument can also be a Node.js HTTP server +instance or another Connect app instance. + +The `route` is always terminated at a path separator (`/`) or a dot (`.`) character. +This means the given routes `/foo/` and `/foo` are the same and both will match requests +with the URLs `/foo`, `/foo/`, `/foo/bar`, and `/foo.bar`, but not match a request with +the URL `/foobar`. + +The `route` is matched in a case-insensitive manor. + +In order to make middleware easier to write to be agnostic of the `route`, when the +`fn` is invoked, the `req.url` will be altered to remove the `route` part (and the +original will be available as `req.originalUrl`). For example, if `fn` is used at the +route `/foo`, the request for `/foo/bar` will invoke `fn` with `req.url === '/bar'` +and `req.originalUrl === '/foo/bar'`. + +## Running Tests + +```bash +npm install +npm test +``` + +## People + +The Connect project would not be the same without all the people involved. + +The original author of Connect is [TJ Holowaychuk](https://github.com/tj) + +The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson) + +[List of all contributors](https://github.com/senchalabs/connect/graphs/contributors) + +## Node Compatibility + + - Connect `< 1.x` - node `0.2` + - Connect `1.x` - node `0.4` + - Connect `< 2.8` - node `0.6` + - Connect `>= 2.8 < 3` - node `0.8` + - Connect `>= 3` - node `0.10`, `0.12`, `4.x`, `5.x`, `6.x`, `7.x`, `8.x`, `9.x`, `10.x`, `11.x`, `12.x`; io.js `1.x`, `2.x`, `3.x` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/senchalabs/connect/master +[coveralls-url]: https://coveralls.io/r/senchalabs/connect?branch=master +[npm-downloads-image]: https://badgen.net/npm/dm/connect +[npm-url]: https://npmjs.org/package/connect +[npm-version-image]: https://badgen.net/npm/v/connect +[travis-image]: https://badgen.net/travis/senchalabs/connect/master +[travis-url]: https://travis-ci.org/senchalabs/connect diff --git a/node_modules/connect/SECURITY.md b/node_modules/connect/SECURITY.md new file mode 100644 index 0000000..9b672a7 --- /dev/null +++ b/node_modules/connect/SECURITY.md @@ -0,0 +1,43 @@ +# Security Policies and Procedures + +This document outlines security procedures and general policies for the Connect +project. + + * [Reporting a Bug](#reporting-a-bug) + * [Disclosure Policy](#disclosure-policy) + * [Comments on this Policy](#comments-on-this-policy) + +## Reporting a Bug + +The Connect team and community take all security bugs in Connect seriously. +Thank you for improving the security of Connect. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the lead maintainer in the README.md file. + +The lead maintainer will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the security team will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. + +Report security bugs in third-party modules to the person or team maintaining +the module. You can also report a vulnerability through the +[Node Security Project](https://nodesecurity.io/report). + +## Disclosure Policy + +When the security team receives a security bug report, they will assign it to a +primary handler. This person will coordinate the fix and release process, +involving the following steps: + + * Confirm the problem and determine the affected versions. + * Audit code to find any potential similar problems. + * Prepare fixes for all releases still under maintenance. These fixes will be + released as fast as possible to npm. + +## Comments on this Policy + +If you have suggestions on how this process could be improved please submit a +pull request. diff --git a/node_modules/connect/index.js b/node_modules/connect/index.js new file mode 100644 index 0000000..62412c4 --- /dev/null +++ b/node_modules/connect/index.js @@ -0,0 +1,279 @@ +/*! + * connect + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('connect:dispatcher'); +var EventEmitter = require('events').EventEmitter; +var finalhandler = require('finalhandler'); +var http = require('http'); +var merge = require('utils-merge'); +var parseUrl = require('parseurl'); + +/** + * Module exports. + * @public + */ + +module.exports = createServer; + +/** + * Module variables. + * @private + */ + +var env = process.env.NODE_ENV || 'development'; +var proto = {}; + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Create a new connect server. + * + * @return {function} + * @public + */ + +function createServer() { + function app(req, res, next){ app.handle(req, res, next); } + merge(app, proto); + merge(app, EventEmitter.prototype); + app.route = '/'; + app.stack = []; + return app; +} + +/** + * Utilize the given middleware `handle` to the given `route`, + * defaulting to _/_. This "route" is the mount-point for the + * middleware, when given a value other than _/_ the middleware + * is only effective when that segment is present in the request's + * pathname. + * + * For example if we were to mount a function at _/admin_, it would + * be invoked on _/admin_, and _/admin/settings_, however it would + * not be invoked for _/_, or _/posts_. + * + * @param {String|Function|Server} route, callback or server + * @param {Function|Server} callback or server + * @return {Server} for chaining + * @public + */ + +proto.use = function use(route, fn) { + var handle = fn; + var path = route; + + // default route to '/' + if (typeof route !== 'string') { + handle = route; + path = '/'; + } + + // wrap sub-apps + if (typeof handle.handle === 'function') { + var server = handle; + server.route = path; + handle = function (req, res, next) { + server.handle(req, res, next); + }; + } + + // wrap vanilla http.Servers + if (handle instanceof http.Server) { + handle = handle.listeners('request')[0]; + } + + // strip trailing slash + if (path[path.length - 1] === '/') { + path = path.slice(0, -1); + } + + // add the middleware + debug('use %s %s', path || '/', handle.name || 'anonymous'); + this.stack.push({ route: path, handle: handle }); + + return this; +}; + +/** + * Handle server requests, punting them down + * the middleware stack. + * + * @private + */ + +proto.handle = function handle(req, res, out) { + var index = 0; + var protohost = getProtohost(req.url) || ''; + var removed = ''; + var slashAdded = false; + var stack = this.stack; + + // final function handler + var done = out || finalhandler(req, res, { + env: env, + onerror: logerror + }); + + // store the original URL + req.originalUrl = req.originalUrl || req.url; + + function next(err) { + if (slashAdded) { + req.url = req.url.substr(1); + slashAdded = false; + } + + if (removed.length !== 0) { + req.url = protohost + removed + req.url.substr(protohost.length); + removed = ''; + } + + // next callback + var layer = stack[index++]; + + // all done + if (!layer) { + defer(done, err); + return; + } + + // route data + var path = parseUrl(req).pathname || '/'; + var route = layer.route; + + // skip this layer if the route doesn't match + if (path.toLowerCase().substr(0, route.length) !== route.toLowerCase()) { + return next(err); + } + + // skip if route match does not border "/", ".", or end + var c = path.length > route.length && path[route.length]; + if (c && c !== '/' && c !== '.') { + return next(err); + } + + // trim off the part of the url that matches the route + if (route.length !== 0 && route !== '/') { + removed = route; + req.url = protohost + req.url.substr(protohost.length + removed.length); + + // ensure leading slash + if (!protohost && req.url[0] !== '/') { + req.url = '/' + req.url; + slashAdded = true; + } + } + + // call the layer handle + call(layer.handle, route, err, req, res, next); + } + + next(); +}; + +/** + * Listen for connections. + * + * This method takes the same arguments + * as node's `http.Server#listen()`. + * + * HTTP and HTTPS: + * + * If you run your application both as HTTP + * and HTTPS you may wrap them individually, + * since your Connect "server" is really just + * a JavaScript `Function`. + * + * var connect = require('connect') + * , http = require('http') + * , https = require('https'); + * + * var app = connect(); + * + * http.createServer(app).listen(80); + * https.createServer(options, app).listen(443); + * + * @return {http.Server} + * @api public + */ + +proto.listen = function listen() { + var server = http.createServer(this); + return server.listen.apply(server, arguments); +}; + +/** + * Invoke a route handle. + * @private + */ + +function call(handle, route, err, req, res, next) { + var arity = handle.length; + var error = err; + var hasError = Boolean(err); + + debug('%s %s : %s', handle.name || '', route, req.originalUrl); + + try { + if (hasError && arity === 4) { + // error-handling middleware + handle(err, req, res, next); + return; + } else if (!hasError && arity < 4) { + // request-handling middleware + handle(req, res, next); + return; + } + } catch (e) { + // replace the error + error = e; + } + + // continue + next(error); +} + +/** + * Log error using console.error. + * + * @param {Error} err + * @private + */ + +function logerror(err) { + if (env !== 'test') console.error(err.stack || err.toString()); +} + +/** + * Get get protocol + host for a URL. + * + * @param {string} url + * @private + */ + +function getProtohost(url) { + if (url.length === 0 || url[0] === '/') { + return undefined; + } + + var fqdnIndex = url.indexOf('://') + + return fqdnIndex !== -1 && url.lastIndexOf('?', fqdnIndex) === -1 + ? url.substr(0, url.indexOf('/', 3 + fqdnIndex)) + : undefined; +} diff --git a/node_modules/connect/package.json b/node_modules/connect/package.json new file mode 100644 index 0000000..2cf6fa8 --- /dev/null +++ b/node_modules/connect/package.json @@ -0,0 +1,48 @@ +{ + "name": "connect", + "description": "High performance middleware framework", + "version": "3.7.0", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong ", + "Tim Caswell " + ], + "keywords": [ + "framework", + "web", + "middleware", + "connect", + "rack" + ], + "repository": "senchalabs/connect", + "dependencies": { + "debug": "2.6.9", + "finalhandler": "1.1.2", + "parseurl": "~1.3.3", + "utils-merge": "1.0.1" + }, + "devDependencies": { + "eslint": "4.19.1", + "mocha": "6.1.4", + "nyc": "14.1.1", + "supertest": "4.0.2" + }, + "license": "MIT", + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "SECURITY.md", + "index.js" + ], + "engines": { + "node": ">= 0.10.0" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + } +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..8a37ae2 --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..6c6090c --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..eadaa18 --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..584da8b --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..f67be6b --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// โ€ฆelsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 0000000..9de2641 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..dc787ba --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,49 @@ +{ + "name": "debug", + "version": "2.6.9", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk ", + "contributors": [ + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + } +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..7106924 --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..6a5e3fc --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..e12cf4d --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js new file mode 100644 index 0000000..60ea6c0 --- /dev/null +++ b/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..b15109c --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md new file mode 100644 index 0000000..cd9ebaa --- /dev/null +++ b/node_modules/depd/History.md @@ -0,0 +1,103 @@ +2.0.0 / 2018-10-26 +================== + + * Drop support for Node.js 0.6 + * Replace internal `eval` usage with `Function` constructor + * Use instance methods on `process` to check for listeners + +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE new file mode 100644 index 0000000..248de7a --- /dev/null +++ b/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2018 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md new file mode 100644 index 0000000..043d1ca --- /dev/null +++ b/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +โ–ผ โ–ผ โ–ผ โ–ผ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +โ–ฒ โ–ฒ โ–ฒ โ–ฒ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +โ–ฒ โ–ฒ โ–ฒ โ–ฒ โ–ฒ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://badgen.net/npm/node/depd +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/depd +[npm-url]: https://npmjs.org/package/depd +[npm-version-image]: https://badgen.net/npm/v/depd +[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js new file mode 100644 index 0000000..1bf2fcf --- /dev/null +++ b/node_modules/depd/index.js @@ -0,0 +1,538 @@ +/*! + * depd + * Copyright(c) 2014-2018 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + stack[i].toString() + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if event emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.8 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function eehaslisteners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eehaslisteners(process, 'deprecation') + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + stack[i].toString() + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-new-func + var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site', + '"use strict"\n' + + 'return function (' + args + ') {' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '}')(fn, log, this, message, site) + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js new file mode 100644 index 0000000..6be45cc --- /dev/null +++ b/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json new file mode 100644 index 0000000..3857e19 --- /dev/null +++ b/node_modules/depd/package.json @@ -0,0 +1,45 @@ +{ + "name": "depd", + "description": "Deprecate all the things", + "version": "2.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "keywords": [ + "deprecate", + "deprecated" + ], + "repository": "dougwilson/nodejs-depd", + "browser": "lib/browser/index.js", + "devDependencies": { + "benchmark": "2.1.4", + "beautify-benchmark": "0.2.4", + "eslint": "5.7.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "5.2.0", + "safe-buffer": "5.1.2", + "uid-safe": "2.1.5" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary", + "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary" + } +} diff --git a/node_modules/ee-first/LICENSE b/node_modules/ee-first/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/ee-first/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/ee-first/README.md b/node_modules/ee-first/README.md new file mode 100644 index 0000000..cbd2478 --- /dev/null +++ b/node_modules/ee-first/README.md @@ -0,0 +1,80 @@ +# EE First + +[![NPM version][npm-image]][npm-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] +[![License][license-image]][license-url] +[![Downloads][downloads-image]][downloads-url] +[![Gittip][gittip-image]][gittip-url] + +Get the first event in a set of event emitters and event pairs, +then clean up after itself. + +## Install + +```sh +$ npm install ee-first +``` + +## API + +```js +var first = require('ee-first') +``` + +### first(arr, listener) + +Invoke `listener` on the first event from the list specified in `arr`. `arr` is +an array of arrays, with each array in the format `[ee, ...event]`. `listener` +will be called only once, the first time any of the given events are emitted. If +`error` is one of the listened events, then if that fires first, the `listener` +will be given the `err` argument. + +The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the +first argument emitted from an `error` event, if applicable; `ee` is the event +emitter that fired; `event` is the string event name that fired; and `args` is an +array of the arguments that were emitted on the event. + +```js +var ee1 = new EventEmitter() +var ee2 = new EventEmitter() + +first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) +``` + +#### .cancel() + +The group of listeners can be cancelled before being invoked and have all the event +listeners removed from the underlying event emitters. + +```js +var thunk = first([ + [ee1, 'close', 'end', 'error'], + [ee2, 'error'] +], function (err, ee, event, args) { + // listener invoked +}) + +// cancel and clean up +thunk.cancel() +``` + +[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square +[npm-url]: https://npmjs.org/package/ee-first +[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square +[github-url]: https://github.com/jonathanong/ee-first/tags +[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square +[travis-url]: https://travis-ci.org/jonathanong/ee-first +[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square +[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master +[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square +[license-url]: LICENSE.md +[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square +[downloads-url]: https://npmjs.org/package/ee-first +[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square +[gittip-url]: https://www.gittip.com/jonathanong/ diff --git a/node_modules/ee-first/index.js b/node_modules/ee-first/index.js new file mode 100644 index 0000000..501287c --- /dev/null +++ b/node_modules/ee-first/index.js @@ -0,0 +1,95 @@ +/*! + * ee-first + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = first + +/** + * Get the first event in a set of event emitters and event pairs. + * + * @param {array} stuff + * @param {function} done + * @public + */ + +function first(stuff, done) { + if (!Array.isArray(stuff)) + throw new TypeError('arg must be an array of [ee, events...] arrays') + + var cleanups = [] + + for (var i = 0; i < stuff.length; i++) { + var arr = stuff[i] + + if (!Array.isArray(arr) || arr.length < 2) + throw new TypeError('each array member must be [ee, events...]') + + var ee = arr[0] + + for (var j = 1; j < arr.length; j++) { + var event = arr[j] + var fn = listener(event, callback) + + // listen to the event + ee.on(event, fn) + // push this listener to the list of cleanups + cleanups.push({ + ee: ee, + event: event, + fn: fn, + }) + } + } + + function callback() { + cleanup() + done.apply(null, arguments) + } + + function cleanup() { + var x + for (var i = 0; i < cleanups.length; i++) { + x = cleanups[i] + x.ee.removeListener(x.event, x.fn) + } + } + + function thunk(fn) { + done = fn + } + + thunk.cancel = cleanup + + return thunk +} + +/** + * Create the event listener. + * @private + */ + +function listener(event, done) { + return function onevent(arg1) { + var args = new Array(arguments.length) + var ee = this + var err = event === 'error' + ? arg1 + : null + + // copy args to prevent arguments escaping scope + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + done(err, ee, event, args) + } +} diff --git a/node_modules/ee-first/package.json b/node_modules/ee-first/package.json new file mode 100644 index 0000000..b6d0b7d --- /dev/null +++ b/node_modules/ee-first/package.json @@ -0,0 +1,29 @@ +{ + "name": "ee-first", + "description": "return the first event in a set of ee/event pairs", + "version": "1.1.1", + "author": { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com", + "twitter": "https://twitter.com/jongleberry" + }, + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "jonathanong/ee-first", + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "files": [ + "index.js", + "LICENSE" + ], + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/encodeurl/HISTORY.md b/node_modules/encodeurl/HISTORY.md new file mode 100644 index 0000000..41313b2 --- /dev/null +++ b/node_modules/encodeurl/HISTORY.md @@ -0,0 +1,14 @@ +1.0.2 / 2018-01-21 +================== + + * Fix encoding `%` as last character + +1.0.1 / 2016-06-09 +================== + + * Fix encoding unpaired surrogates at start/end of string + +1.0.0 / 2016-06-08 +================== + + * Initial release diff --git a/node_modules/encodeurl/LICENSE b/node_modules/encodeurl/LICENSE new file mode 100644 index 0000000..8812229 --- /dev/null +++ b/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/encodeurl/README.md b/node_modules/encodeurl/README.md new file mode 100644 index 0000000..127c5a0 --- /dev/null +++ b/node_modules/encodeurl/README.md @@ -0,0 +1,128 @@ +# encodeurl + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Encode a URL to a percent-encoded form, excluding already-encoded sequences + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function will take an already-encoded URL and encode all the non-URL +code points (as UTF-8 byte sequences). This function will not encode the +"%" character unless it is not part of a valid sequence (`%20` will be +left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as +hard as it can to properly encode the given URL, including replacing any raw, +unpaired surrogate pairs with the Unicode replacement character prior to +encoding. + +This function is _similar_ to the intrinsic function `encodeURI`, except it +will not encode the `%` character if that is part of a valid sequence, will +not encode `[` and `]` (for IPv6 hostnames) and will replace raw, unpaired +surrogate pairs with the Unicode replacement character (instead of throwing). + +## Examples + +### Encode a URL containing user-controled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '

Location ' + escapeHtml(url) + ' not found

' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '

Redirecting to new site: ' + escapeHtml(location) + '

' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/encodeurl.svg +[npm-url]: https://npmjs.org/package/encodeurl +[node-version-image]: https://img.shields.io/node/v/encodeurl.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/encodeurl.svg +[travis-url]: https://travis-ci.org/pillarjs/encodeurl +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/encodeurl.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/encodeurl?branch=master +[downloads-image]: https://img.shields.io/npm/dm/encodeurl.svg +[downloads-url]: https://npmjs.org/package/encodeurl diff --git a/node_modules/encodeurl/index.js b/node_modules/encodeurl/index.js new file mode 100644 index 0000000..fc4906c --- /dev/null +++ b/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x25\x26-\x3B\x3D\x3F-\x5B\x5D\x5F\x61-\x7A\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/node_modules/encodeurl/package.json b/node_modules/encodeurl/package.json new file mode 100644 index 0000000..b9f25ef --- /dev/null +++ b/node_modules/encodeurl/package.json @@ -0,0 +1,40 @@ +{ + "name": "encodeurl", + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "version": "1.0.2", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "repository": "pillarjs/encodeurl", + "devDependencies": { + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.8.0", + "eslint-plugin-node": "5.2.1", + "eslint-plugin-promise": "3.6.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/escape-html/LICENSE b/node_modules/escape-html/LICENSE new file mode 100644 index 0000000..2e70de9 --- /dev/null +++ b/node_modules/escape-html/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2013 TJ Holowaychuk +Copyright (c) 2015 Andreas Lubbe +Copyright (c) 2015 Tiancheng "Timothy" Gu + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/escape-html/Readme.md b/node_modules/escape-html/Readme.md new file mode 100644 index 0000000..653d9ea --- /dev/null +++ b/node_modules/escape-html/Readme.md @@ -0,0 +1,43 @@ + +# escape-html + + Escape string for use in HTML + +## Example + +```js +var escape = require('escape-html'); +var html = escape('foo & bar'); +// -> foo & bar +``` + +## Benchmark + +``` +$ npm run-script bench + +> escape-html@1.0.3 bench nodejs-escape-html +> node benchmark/index.js + + + http_parser@1.0 + node@0.10.33 + v8@3.14.5.9 + ares@1.9.0-DEV + uv@0.10.29 + zlib@1.2.3 + modules@11 + openssl@1.0.1j + + 1 test completed. + 2 tests completed. + 3 tests completed. + + no special characters x 19,435,271 ops/sec ยฑ0.85% (187 runs sampled) + single special character x 6,132,421 ops/sec ยฑ0.67% (194 runs sampled) + many special characters x 3,175,826 ops/sec ยฑ0.65% (193 runs sampled) +``` + +## License + + MIT \ No newline at end of file diff --git a/node_modules/escape-html/index.js b/node_modules/escape-html/index.js new file mode 100644 index 0000000..bf9e226 --- /dev/null +++ b/node_modules/escape-html/index.js @@ -0,0 +1,78 @@ +/*! + * escape-html + * Copyright(c) 2012-2013 TJ Holowaychuk + * Copyright(c) 2015 Andreas Lubbe + * Copyright(c) 2015 Tiancheng "Timothy" Gu + * MIT Licensed + */ + +'use strict'; + +/** + * Module variables. + * @private + */ + +var matchHtmlRegExp = /["'&<>]/; + +/** + * Module exports. + * @public + */ + +module.exports = escapeHtml; + +/** + * Escape special characters in the given string of html. + * + * @param {string} string The string to escape for inserting into HTML + * @return {string} + * @public + */ + +function escapeHtml(string) { + var str = '' + string; + var match = matchHtmlRegExp.exec(str); + + if (!match) { + return str; + } + + var escape; + var html = ''; + var index = 0; + var lastIndex = 0; + + for (index = match.index; index < str.length; index++) { + switch (str.charCodeAt(index)) { + case 34: // " + escape = '"'; + break; + case 38: // & + escape = '&'; + break; + case 39: // ' + escape = '''; + break; + case 60: // < + escape = '<'; + break; + case 62: // > + escape = '>'; + break; + default: + continue; + } + + if (lastIndex !== index) { + html += str.substring(lastIndex, index); + } + + lastIndex = index + 1; + html += escape; + } + + return lastIndex !== index + ? html + str.substring(lastIndex, index) + : html; +} diff --git a/node_modules/escape-html/package.json b/node_modules/escape-html/package.json new file mode 100644 index 0000000..57ec7bd --- /dev/null +++ b/node_modules/escape-html/package.json @@ -0,0 +1,24 @@ +{ + "name": "escape-html", + "description": "Escape string for use in HTML", + "version": "1.0.3", + "license": "MIT", + "keywords": [ + "escape", + "html", + "utility" + ], + "repository": "component/escape-html", + "devDependencies": { + "benchmark": "1.0.0", + "beautify-benchmark": "0.2.4" + }, + "files": [ + "LICENSE", + "Readme.md", + "index.js" + ], + "scripts": { + "bench": "node benchmark/index.js" + } +} diff --git a/node_modules/etag/HISTORY.md b/node_modules/etag/HISTORY.md new file mode 100644 index 0000000..222b293 --- /dev/null +++ b/node_modules/etag/HISTORY.md @@ -0,0 +1,83 @@ +1.8.1 / 2017-09-12 +================== + + * perf: replace regular expression with substring + +1.8.0 / 2017-02-18 +================== + + * Use SHA1 instead of MD5 for ETag hashing + - Improves performance for larger entities + - Works with FIPS 140-2 OpenSSL configuration + +1.7.0 / 2015-06-08 +================== + + * Always include entity length in ETags for hash length extensions + * Generate non-Stats ETags using MD5 only (no longer CRC32) + * Improve stat performance by removing hashing + * Remove base64 padding in ETags to shorten + * Use MD5 instead of MD4 in weak ETags over 1KB + +1.6.0 / 2015-05-10 +================== + + * Improve support for JXcore + * Remove requirement of `atime` in the stats object + * Support "fake" stats objects in environments without `fs` + +1.5.1 / 2014-11-19 +================== + + * deps: crc@3.2.1 + - Minor fixes + +1.5.0 / 2014-10-14 +================== + + * Improve string performance + * Slightly improve speed for weak ETags over 1KB + +1.4.0 / 2014-09-21 +================== + + * Support "fake" stats objects + * Support Node.js 0.6 + +1.3.1 / 2014-09-14 +================== + + * Use the (new and improved) `crc` for crc32 + +1.3.0 / 2014-08-29 +================== + + * Default strings to strong ETags + * Improve speed for weak ETags over 1KB + +1.2.1 / 2014-08-29 +================== + + * Use the (much faster) `buffer-crc32` for crc32 + +1.2.0 / 2014-08-24 +================== + + * Add support for file stat objects + +1.1.0 / 2014-08-24 +================== + + * Add fast-path for empty entity + * Add weak ETag generation + * Shrink size of generated ETags + +1.0.1 / 2014-08-24 +================== + + * Fix behavior of string containing Unicode + +1.0.0 / 2014-05-18 +================== + + * Initial release diff --git a/node_modules/etag/LICENSE b/node_modules/etag/LICENSE new file mode 100644 index 0000000..cab251c --- /dev/null +++ b/node_modules/etag/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/etag/README.md b/node_modules/etag/README.md new file mode 100644 index 0000000..09c2169 --- /dev/null +++ b/node_modules/etag/README.md @@ -0,0 +1,159 @@ +# etag + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create simple HTTP ETags + +This module generates HTTP ETags (as defined in RFC 7232) for use in +HTTP responses. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install etag +``` + +## API + + + +```js +var etag = require('etag') +``` + +### etag(entity, [options]) + +Generate a strong ETag for the given entity. This should be the complete +body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By +default, a strong ETag is generated except for `fs.Stats`, which will +generate a weak ETag (this can be overwritten by `options.weak`). + + + +```js +res.setHeader('ETag', etag(body)) +``` + +#### Options + +`etag` accepts these properties in the options object. + +##### weak + +Specifies if the generated ETag will include the weak validator mark (that +is, the leading `W/`). The actual entity tag is the same. The default value +is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`. + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +```bash +$ npm run-script bench + +> etag@1.8.1 bench nodejs-etag +> node benchmark/index.js + + http_parser@2.7.0 + node@6.11.1 + v8@5.1.281.103 + uv@1.11.0 + zlib@1.2.11 + ares@1.10.1-DEV + icu@58.2 + modules@48 + openssl@1.0.2k + +> node benchmark/body0-100b.js + + 100B body + + 4 tests completed. + + buffer - strong x 258,647 ops/sec ยฑ1.07% (180 runs sampled) + buffer - weak x 263,812 ops/sec ยฑ0.61% (184 runs sampled) + string - strong x 259,955 ops/sec ยฑ1.19% (185 runs sampled) + string - weak x 264,356 ops/sec ยฑ1.09% (184 runs sampled) + +> node benchmark/body1-1kb.js + + 1KB body + + 4 tests completed. + + buffer - strong x 189,018 ops/sec ยฑ1.12% (182 runs sampled) + buffer - weak x 190,586 ops/sec ยฑ0.81% (186 runs sampled) + string - strong x 144,272 ops/sec ยฑ0.96% (188 runs sampled) + string - weak x 145,380 ops/sec ยฑ1.43% (187 runs sampled) + +> node benchmark/body2-5kb.js + + 5KB body + + 4 tests completed. + + buffer - strong x 92,435 ops/sec ยฑ0.42% (188 runs sampled) + buffer - weak x 92,373 ops/sec ยฑ0.58% (189 runs sampled) + string - strong x 48,850 ops/sec ยฑ0.56% (186 runs sampled) + string - weak x 49,380 ops/sec ยฑ0.56% (190 runs sampled) + +> node benchmark/body3-10kb.js + + 10KB body + + 4 tests completed. + + buffer - strong x 55,989 ops/sec ยฑ0.93% (188 runs sampled) + buffer - weak x 56,148 ops/sec ยฑ0.55% (190 runs sampled) + string - strong x 27,345 ops/sec ยฑ0.43% (188 runs sampled) + string - weak x 27,496 ops/sec ยฑ0.45% (190 runs sampled) + +> node benchmark/body4-100kb.js + + 100KB body + + 4 tests completed. + + buffer - strong x 7,083 ops/sec ยฑ0.22% (190 runs sampled) + buffer - weak x 7,115 ops/sec ยฑ0.26% (191 runs sampled) + string - strong x 3,068 ops/sec ยฑ0.34% (190 runs sampled) + string - weak x 3,096 ops/sec ยฑ0.35% (190 runs sampled) + +> node benchmark/stats.js + + stat + + 4 tests completed. + + real - strong x 871,642 ops/sec ยฑ0.34% (189 runs sampled) + real - weak x 867,613 ops/sec ยฑ0.39% (190 runs sampled) + fake - strong x 401,051 ops/sec ยฑ0.40% (189 runs sampled) + fake - weak x 400,100 ops/sec ยฑ0.47% (188 runs sampled) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/etag.svg +[npm-url]: https://npmjs.org/package/etag +[node-version-image]: https://img.shields.io/node/v/etag.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg +[travis-url]: https://travis-ci.org/jshttp/etag +[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master +[downloads-image]: https://img.shields.io/npm/dm/etag.svg +[downloads-url]: https://npmjs.org/package/etag diff --git a/node_modules/etag/index.js b/node_modules/etag/index.js new file mode 100644 index 0000000..2a585c9 --- /dev/null +++ b/node_modules/etag/index.js @@ -0,0 +1,131 @@ +/*! + * etag + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = etag + +/** + * Module dependencies. + * @private + */ + +var crypto = require('crypto') +var Stats = require('fs').Stats + +/** + * Module variables. + * @private + */ + +var toString = Object.prototype.toString + +/** + * Generate an entity tag. + * + * @param {Buffer|string} entity + * @return {string} + * @private + */ + +function entitytag (entity) { + if (entity.length === 0) { + // fast-path empty + return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"' + } + + // compute hash of entity + var hash = crypto + .createHash('sha1') + .update(entity, 'utf8') + .digest('base64') + .substring(0, 27) + + // compute length of entity + var len = typeof entity === 'string' + ? Buffer.byteLength(entity, 'utf8') + : entity.length + + return '"' + len.toString(16) + '-' + hash + '"' +} + +/** + * Create a simple ETag. + * + * @param {string|Buffer|Stats} entity + * @param {object} [options] + * @param {boolean} [options.weak] + * @return {String} + * @public + */ + +function etag (entity, options) { + if (entity == null) { + throw new TypeError('argument entity is required') + } + + // support fs.Stats object + var isStats = isstats(entity) + var weak = options && typeof options.weak === 'boolean' + ? options.weak + : isStats + + // validate argument + if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) { + throw new TypeError('argument entity must be string, Buffer, or fs.Stats') + } + + // generate entity tag + var tag = isStats + ? stattag(entity) + : entitytag(entity) + + return weak + ? 'W/' + tag + : tag +} + +/** + * Determine if object is a Stats object. + * + * @param {object} obj + * @return {boolean} + * @api private + */ + +function isstats (obj) { + // genuine fs.Stats + if (typeof Stats === 'function' && obj instanceof Stats) { + return true + } + + // quack quack + return obj && typeof obj === 'object' && + 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' && + 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' && + 'ino' in obj && typeof obj.ino === 'number' && + 'size' in obj && typeof obj.size === 'number' +} + +/** + * Generate a tag for a stat. + * + * @param {object} stat + * @return {string} + * @private + */ + +function stattag (stat) { + var mtime = stat.mtime.getTime().toString(16) + var size = stat.size.toString(16) + + return '"' + size + '-' + mtime + '"' +} diff --git a/node_modules/etag/package.json b/node_modules/etag/package.json new file mode 100644 index 0000000..b06ab80 --- /dev/null +++ b/node_modules/etag/package.json @@ -0,0 +1,47 @@ +{ + "name": "etag", + "description": "Create simple HTTP ETags", + "version": "1.8.1", + "contributors": [ + "Douglas Christopher Wilson ", + "David Bjรถrklund " + ], + "license": "MIT", + "keywords": [ + "etag", + "http", + "res" + ], + "repository": "jshttp/etag", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "safe-buffer": "5.1.1", + "seedrandom": "2.4.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/finalhandler/HISTORY.md b/node_modules/finalhandler/HISTORY.md new file mode 100644 index 0000000..920c35e --- /dev/null +++ b/node_modules/finalhandler/HISTORY.md @@ -0,0 +1,187 @@ +1.1.2 / 2019-05-09 +================== + + * Set stricter `Content-Security-Policy` header + * deps: parseurl@~1.3.3 + * deps: statuses@~1.5.0 + +1.1.1 / 2018-03-06 +================== + + * Fix 404 output for bad / missing pathnames + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: statuses@~1.4.0 + +1.1.0 / 2017-09-24 +================== + + * Use `res.headersSent` when available + +1.0.6 / 2017-09-22 +================== + + * deps: debug@2.6.9 + +1.0.5 / 2017-09-15 +================== + + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + +1.0.4 / 2017-08-03 +================== + + * deps: debug@2.6.8 + +1.0.3 / 2017-05-16 +================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + +1.0.2 / 2017-04-22 +================== + + * deps: debug@2.6.4 + - deps: ms@0.7.3 + +1.0.1 / 2017-03-21 +================== + + * Fix missing `` in HTML document + * deps: debug@2.6.3 + - Fix: `DEBUG_MAX_ARRAY_LENGTH` + +1.0.0 / 2017-02-15 +================== + + * Fix exception when `err` cannot be converted to a string + * Fully URL-encode the pathname in the 404 message + * Only include the pathname in the 404 message + * Send complete HTML document + * Set `Content-Security-Policy: default-src 'self'` header + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + +0.5.1 / 2016-11-12 +================== + + * Fix exception when `err.headers` is not an object + * deps: statuses@~1.3.1 + * perf: hoist regular expressions + * perf: remove duplicate validation path + +0.5.0 / 2016-06-15 +================== + + * Change invalid or non-numeric status code to 500 + * Overwrite status message to match set status code + * Prefer `err.statusCode` if `err.status` is invalid + * Set response headers from `err.headers` object + * Use `statuses` instead of `http` module for status messages + - Includes all defined status messages + +0.4.1 / 2015-12-02 +================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + +0.4.0 / 2015-06-14 +================== + + * Fix a false-positive when unpiping in Node.js 0.8 + * Support `statusCode` property on `Error` objects + * Use `unpipe` module for unpiping requests + * deps: escape-html@1.0.2 + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove argument reassignment + +0.3.6 / 2015-05-11 +================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + +0.3.5 / 2015-04-22 +================== + + * deps: on-finished@~2.2.1 + - Fix `isFinished(req)` when data buffered + +0.3.4 / 2015-03-15 +================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.3.3 / 2015-01-01 +================== + + * deps: debug@~2.1.1 + * deps: on-finished@~2.2.0 + +0.3.2 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.3.1 / 2014-10-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + +0.3.0 / 2014-09-17 +================== + + * Terminate in progress response only on error + * Use `on-finished` to determine request status + +0.2.0 / 2014-09-03 +================== + + * Set `X-Content-Type-Options: nosniff` header + * deps: debug@~2.0.0 + +0.1.0 / 2014-07-16 +================== + + * Respond after request fully read + - prevents hung responses and socket hang ups + * deps: debug@1.0.4 + +0.0.3 / 2014-07-11 +================== + + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.0.2 / 2014-06-19 +================== + + * Handle invalid status codes + +0.0.1 / 2014-06-05 +================== + + * deps: debug@1.0.2 + +0.0.0 / 2014-06-05 +================== + + * Extracted from connect/express diff --git a/node_modules/finalhandler/LICENSE b/node_modules/finalhandler/LICENSE new file mode 100644 index 0000000..fb30982 --- /dev/null +++ b/node_modules/finalhandler/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/finalhandler/README.md b/node_modules/finalhandler/README.md new file mode 100644 index 0000000..96327f0 --- /dev/null +++ b/node_modules/finalhandler/README.md @@ -0,0 +1,148 @@ +# finalhandler + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js function to invoke as the final step to respond to HTTP request. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install finalhandler +``` + +## API + + + +```js +var finalhandler = require('finalhandler') +``` + +### finalhandler(req, res, [options]) + +Returns function to be invoked as the final step for the given `req` and `res`. +This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will +write out a 404 response to the `res`. If it is truthy, an error response will +be written out to the `res`. + +When an error is written, the following information is added to the response: + + * The `res.statusCode` is set from `err.status` (or `err.statusCode`). If + this value is outside the 4xx or 5xx range, it will be set to 500. + * The `res.statusMessage` is set according to the status code. + * The body will be the HTML of the status code message if `env` is + `'production'`, otherwise will be `err.stack`. + * Any headers specified in an `err.headers` object. + +The final handler will also unpipe anything from `req` when it is invoked. + +#### options.env + +By default, the environment is determined by `NODE_ENV` variable, but it can be +overridden by this option. + +#### options.onerror + +Provide a function to be called with the `err` when it exists. Can be used for +writing errors to a central location without excessive function generation. Called +as `onerror(err, req, res)`. + +## Examples + +### always 404 + +```js +var finalhandler = require('finalhandler') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + done() +}) + +server.listen(3000) +``` + +### perform simple action + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) +``` + +### use with middleware-style functions + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +var serve = serveStatic('public') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res) + serve(req, res, done) +}) + +server.listen(3000) +``` + +### keep log of all errors + +```js +var finalhandler = require('finalhandler') +var fs = require('fs') +var http = require('http') + +var server = http.createServer(function (req, res) { + var done = finalhandler(req, res, { onerror: logerror }) + + fs.readFile('index.html', function (err, buf) { + if (err) return done(err) + res.setHeader('Content-Type', 'text/html') + res.end(buf) + }) +}) + +server.listen(3000) + +function logerror (err) { + console.error(err.stack || err.toString()) +} +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/finalhandler.svg +[npm-url]: https://npmjs.org/package/finalhandler +[node-image]: https://img.shields.io/node/v/finalhandler.svg +[node-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg +[travis-url]: https://travis-ci.org/pillarjs/finalhandler +[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg +[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master +[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg +[downloads-url]: https://npmjs.org/package/finalhandler diff --git a/node_modules/finalhandler/index.js b/node_modules/finalhandler/index.js new file mode 100644 index 0000000..5673507 --- /dev/null +++ b/node_modules/finalhandler/index.js @@ -0,0 +1,331 @@ +/*! + * finalhandler + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var debug = require('debug')('finalhandler') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var onFinished = require('on-finished') +var parseUrl = require('parseurl') +var statuses = require('statuses') +var unpipe = require('unpipe') + +/** + * Module variables. + * @private + */ + +var DOUBLE_SPACE_REGEXP = /\x20{2}/g +var NEWLINE_REGEXP = /\n/g + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) } +var isFinished = onFinished.isFinished + +/** + * Create a minimal HTML document. + * + * @param {string} message + * @private + */ + +function createHtmlDocument (message) { + var body = escapeHtml(message) + .replace(NEWLINE_REGEXP, '
') + .replace(DOUBLE_SPACE_REGEXP, '  ') + + return '\n' + + '\n' + + '\n' + + '\n' + + 'Error\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' + + '\n' +} + +/** + * Module exports. + * @public + */ + +module.exports = finalhandler + +/** + * Create a function to handle the final response. + * + * @param {Request} req + * @param {Response} res + * @param {Object} [options] + * @return {Function} + * @public + */ + +function finalhandler (req, res, options) { + var opts = options || {} + + // get environment + var env = opts.env || process.env.NODE_ENV || 'development' + + // get error callback + var onerror = opts.onerror + + return function (err) { + var headers + var msg + var status + + // ignore 404 on in-flight response + if (!err && headersSent(res)) { + debug('cannot 404 after headers sent') + return + } + + // unhandled error + if (err) { + // respect status code from error + status = getErrorStatusCode(err) + + if (status === undefined) { + // fallback to status code on response + status = getResponseStatusCode(res) + } else { + // respect headers from error + headers = getErrorHeaders(err) + } + + // get error message + msg = getErrorMessage(err, status, env) + } else { + // not found + status = 404 + msg = 'Cannot ' + req.method + ' ' + encodeUrl(getResourceName(req)) + } + + debug('default %s', status) + + // schedule onerror callback + if (err && onerror) { + defer(onerror, err, req, res) + } + + // cannot actually respond + if (headersSent(res)) { + debug('cannot %d after headers sent', status) + req.socket.destroy() + return + } + + // send response + send(req, res, status, headers, msg) + } +} + +/** + * Get headers from Error object. + * + * @param {Error} err + * @return {object} + * @private + */ + +function getErrorHeaders (err) { + if (!err.headers || typeof err.headers !== 'object') { + return undefined + } + + var headers = Object.create(null) + var keys = Object.keys(err.headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + headers[key] = err.headers[key] + } + + return headers +} + +/** + * Get message from Error object, fallback to status message. + * + * @param {Error} err + * @param {number} status + * @param {string} env + * @return {string} + * @private + */ + +function getErrorMessage (err, status, env) { + var msg + + if (env !== 'production') { + // use err.stack, which typically includes err.message + msg = err.stack + + // fallback to err.toString() when possible + if (!msg && typeof err.toString === 'function') { + msg = err.toString() + } + } + + return msg || statuses[status] +} + +/** + * Get status code from Error object. + * + * @param {Error} err + * @return {number} + * @private + */ + +function getErrorStatusCode (err) { + // check err.status + if (typeof err.status === 'number' && err.status >= 400 && err.status < 600) { + return err.status + } + + // check err.statusCode + if (typeof err.statusCode === 'number' && err.statusCode >= 400 && err.statusCode < 600) { + return err.statusCode + } + + return undefined +} + +/** + * Get resource name for the request. + * + * This is typically just the original pathname of the request + * but will fallback to "resource" is that cannot be determined. + * + * @param {IncomingMessage} req + * @return {string} + * @private + */ + +function getResourceName (req) { + try { + return parseUrl.original(req).pathname + } catch (e) { + return 'resource' + } +} + +/** + * Get status code from response. + * + * @param {OutgoingMessage} res + * @return {number} + * @private + */ + +function getResponseStatusCode (res) { + var status = res.statusCode + + // default status code to 500 if outside valid range + if (typeof status !== 'number' || status < 400 || status > 599) { + status = 500 + } + + return status +} + +/** + * Determine if the response headers have been sent. + * + * @param {object} res + * @returns {boolean} + * @private + */ + +function headersSent (res) { + return typeof res.headersSent !== 'boolean' + ? Boolean(res._header) + : res.headersSent +} + +/** + * Send response. + * + * @param {IncomingMessage} req + * @param {OutgoingMessage} res + * @param {number} status + * @param {object} headers + * @param {string} message + * @private + */ + +function send (req, res, status, headers, message) { + function write () { + // response body + var body = createHtmlDocument(message) + + // response status + res.statusCode = status + res.statusMessage = statuses[status] + + // response headers + setHeaders(res, headers) + + // security headers + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + + // standard headers + res.setHeader('Content-Type', 'text/html; charset=utf-8') + res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8')) + + if (req.method === 'HEAD') { + res.end() + return + } + + res.end(body, 'utf8') + } + + if (isFinished(req)) { + write() + return + } + + // unpipe everything from the request + unpipe(req) + + // flush the request + onFinished(req, write) + req.resume() +} + +/** + * Set response headers from an object. + * + * @param {OutgoingMessage} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + if (!headers) { + return + } + + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/finalhandler/package.json b/node_modules/finalhandler/package.json new file mode 100644 index 0000000..79c8f3e --- /dev/null +++ b/node_modules/finalhandler/package.json @@ -0,0 +1,45 @@ +{ + "name": "finalhandler", + "description": "Node.js final http responder", + "version": "1.1.2", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "repository": "pillarjs/finalhandler", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "devDependencies": { + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.1.4", + "readable-stream": "2.3.6", + "safe-buffer": "5.1.2", + "supertest": "4.0.2" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/" + } +} diff --git a/node_modules/fresh/HISTORY.md b/node_modules/fresh/HISTORY.md new file mode 100644 index 0000000..fd3888a --- /dev/null +++ b/node_modules/fresh/HISTORY.md @@ -0,0 +1,80 @@ +2.0.0 - 2024-09-04 +========== + * Drop support for Node.js <18 + +1.0.0 - 2024-09-04 +========== + + * Drop support for Node.js below 0.8 + * Fix: Ignore `If-Modified-Since` in the presence of `If-None-Match`, according to [spec](https://www.rfc-editor.org/rfc/rfc9110.html#section-13.1.3-5). Fixes [#35](https://github.com/jshttp/fresh/issues/35) + +0.5.2 / 2017-09-13 +================== + + * Fix regression matching multiple ETags in `If-None-Match` + * perf: improve `If-None-Match` token parsing + +0.5.1 / 2017-09-11 +================== + + * Fix handling of modified headers with invalid dates + * perf: improve ETag match loop + +0.5.0 / 2017-02-21 +================== + + * Fix incorrect result when `If-None-Match` has both `*` and ETags + * Fix weak `ETag` matching to match spec + * perf: delay reading header values until needed + * perf: skip checking modified time if ETag check failed + * perf: skip parsing `If-None-Match` when no `ETag` header + * perf: use `Date.parse` instead of `new Date` + +0.4.0 / 2017-02-05 +================== + + * Fix false detection of `no-cache` request directive + * perf: enable strict mode + * perf: hoist regular expressions + * perf: remove duplicate conditional + * perf: remove unnecessary boolean coercions + +0.3.0 / 2015-05-12 +================== + + * Add weak `ETag` matching support + +0.2.4 / 2014-09-07 +================== + + * Support Node.js 0.6 + +0.2.3 / 2014-09-07 +================== + + * Move repository to jshttp + +0.2.2 / 2014-02-19 +================== + + * Revert "Fix for blank page on Safari reload" + +0.2.1 / 2014-01-29 +================== + + * Fix for blank page on Safari reload + +0.2.0 / 2013-08-11 +================== + + * Return stale for `Cache-Control: no-cache` + +0.1.0 / 2012-06-15 +================== + + * Add `If-None-Match: *` support + +0.0.1 / 2012-06-10 +================== + + * Initial release diff --git a/node_modules/fresh/LICENSE b/node_modules/fresh/LICENSE new file mode 100644 index 0000000..1434ade --- /dev/null +++ b/node_modules/fresh/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2016-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/fresh/README.md b/node_modules/fresh/README.md new file mode 100644 index 0000000..fd79c5b --- /dev/null +++ b/node_modules/fresh/README.md @@ -0,0 +1,117 @@ +# fresh + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP response freshness testing + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +``` +$ npm install fresh +``` + +## API + +```js +var fresh = require('fresh') +``` + +### fresh(reqHeaders, resHeaders) + +Check freshness of the response using request and response headers. + +When the response is still "fresh" in the client's cache `true` is +returned, otherwise `false` is returned to indicate that the client +cache is now stale and the full response should be sent. + +When a client sends the `Cache-Control: no-cache` request header to +indicate an end-to-end reload request, this module will return `false` +to make handling these requests transparent. + +## Known Issues + +This module is designed to only follow the HTTP specifications, not +to work-around all kinda of client bugs (especially since this module +typically does not receive enough information to understand what the +client actually is). + +There is a known issue that in certain versions of Safari, Safari +will incorrectly make a request that allows this module to validate +freshness of the resource even when Safari does not have a +representation of the resource in the cache. The module +[jumanji](https://www.npmjs.com/package/jumanji) can be used in +an Express application to work-around this issue and also provides +links to further reading on this Safari bug. + +## Example + +### API usage + + + +```js +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { etag: '"bar"' } +fresh(reqHeaders, resHeaders) +// => false + +var reqHeaders = { 'if-none-match': '"foo"' } +var resHeaders = { etag: '"foo"' } +fresh(reqHeaders, resHeaders) +// => true +``` + +### Using with Node.js http server + +```js +var fresh = require('fresh') +var http = require('http') + +var server = http.createServer(function (req, res) { + // perform server logic + // ... including adding ETag / Last-Modified response headers + + if (isFresh(req, res)) { + // client has a fresh copy of resource + res.statusCode = 304 + res.end() + return + } + + // send the resource + res.statusCode = 200 + res.end('hello, world!') +}) + +function isFresh (req, res) { + return fresh(req.headers, { + etag: res.getHeader('ETag'), + 'last-modified': res.getHeader('Last-Modified') + }) +} + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://img.shields.io/github/workflow/status/jshttp/fresh/ci/master?label=ci +[ci-url]: https://github.com/jshttp/fresh/actions/workflows/ci.yml +[npm-image]: https://img.shields.io/npm/v/fresh.svg +[npm-url]: https://npmjs.org/package/fresh +[node-version-image]: https://img.shields.io/node/v/fresh.svg +[node-version-url]: https://nodejs.org/en/ +[coveralls-image]: https://img.shields.io/coveralls/jshttp/fresh/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/fresh?branch=master +[downloads-image]: https://img.shields.io/npm/dm/fresh.svg +[downloads-url]: https://npmjs.org/package/fresh diff --git a/node_modules/fresh/index.js b/node_modules/fresh/index.js new file mode 100644 index 0000000..fc3dea7 --- /dev/null +++ b/node_modules/fresh/index.js @@ -0,0 +1,136 @@ +/*! + * fresh + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2016-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * RegExp to check for no-cache token in Cache-Control. + * @private + */ + +var CACHE_CONTROL_NO_CACHE_REGEXP = /(?:^|,)\s*?no-cache\s*?(?:,|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = fresh + +/** + * Check freshness of the response using request and response headers. + * + * @param {Object} reqHeaders + * @param {Object} resHeaders + * @return {Boolean} + * @public + */ + +function fresh (reqHeaders, resHeaders) { + // fields + var modifiedSince = reqHeaders['if-modified-since'] + var noneMatch = reqHeaders['if-none-match'] + + // unconditional request + if (!modifiedSince && !noneMatch) { + return false + } + + // Always return stale when Cache-Control: no-cache + // to support end-to-end reload requests + // https://tools.ietf.org/html/rfc2616#section-14.9.4 + var cacheControl = reqHeaders['cache-control'] + if (cacheControl && CACHE_CONTROL_NO_CACHE_REGEXP.test(cacheControl)) { + return false + } + + // if-none-match takes precedent over if-modified-since + if (noneMatch) { + if (noneMatch === '*') { + return true + } + var etag = resHeaders.etag + + if (!etag) { + return false + } + + var matches = parseTokenList(noneMatch) + for (var i = 0; i < matches.length; i++) { + var match = matches[i] + if (match === etag || match === 'W/' + etag || 'W/' + match === etag) { + return true + } + } + + return false + } + + // if-modified-since + if (modifiedSince) { + var lastModified = resHeaders['last-modified'] + var modifiedStale = !lastModified || !(parseHttpDate(lastModified) <= parseHttpDate(modifiedSince)) + + if (modifiedStale) { + return false + } + } + + return true +} + +/** + * Parse an HTTP Date into a number. + * + * @param {string} date + * @private + */ + +function parseHttpDate (date) { + var timestamp = date && Date.parse(date) + + // istanbul ignore next: guard against date.js Date.parse patching + return typeof timestamp === 'number' + ? timestamp + : NaN +} + +/** + * Parse a HTTP token list. + * + * @param {string} str + * @private + */ + +function parseTokenList (str) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = str.length; i < len; i++) { + switch (str.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + list.push(str.substring(start, end)) + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + list.push(str.substring(start, end)) + + return list +} diff --git a/node_modules/fresh/package.json b/node_modules/fresh/package.json new file mode 100644 index 0000000..5d7e215 --- /dev/null +++ b/node_modules/fresh/package.json @@ -0,0 +1,46 @@ +{ + "name": "fresh", + "description": "HTTP response freshness testing", + "version": "2.0.0", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "keywords": [ + "fresh", + "http", + "conditional", + "cache" + ], + "repository": "jshttp/fresh", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "8.12.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.0.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/node_modules/http-errors/HISTORY.md b/node_modules/http-errors/HISTORY.md new file mode 100644 index 0000000..7228684 --- /dev/null +++ b/node_modules/http-errors/HISTORY.md @@ -0,0 +1,180 @@ +2.0.0 / 2021-12-17 +================== + + * Drop support for Node.js 0.6 + * Remove `I'mateapot` export; use `ImATeapot` instead + * Remove support for status being non-first argument + * Rename `UnorderedCollection` constructor to `TooEarly` + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: statuses@2.0.1 + - Fix messaging casing of `418 I'm a Teapot` + - Remove code 306 + - Rename `425 Unordered Collection` to standard `425 Too Early` + +2021-11-14 / 1.8.1 +================== + + * deps: toidentifier@1.0.1 + +2020-06-29 / 1.8.0 +================== + + * Add `isHttpError` export to determine if value is an HTTP error + * deps: setprototypeof@1.2.0 + +2019-06-24 / 1.7.3 +================== + + * deps: inherits@2.0.4 + +2019-02-18 / 1.7.2 +================== + + * deps: setprototypeof@1.1.1 + +2018-09-08 / 1.7.1 +================== + + * Fix error creating objects in some environments + +2018-07-30 / 1.7.0 +================== + + * Set constructor name when possible + * Use `toidentifier` module to make class names + * deps: statuses@'>= 1.5.0 < 2' + +2018-03-29 / 1.6.3 +================== + + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: setprototypeof@1.1.0 + * deps: statuses@'>= 1.4.0 < 2' + +2017-08-04 / 1.6.2 +================== + + * deps: depd@1.1.1 + - Remove unnecessary `Buffer` loading + +2017-02-20 / 1.6.1 +================== + + * deps: setprototypeof@1.0.3 + - Fix shim for old browsers + +2017-02-14 / 1.6.0 +================== + + * Accept custom 4xx and 5xx status codes in factory + * Add deprecation message to `"I'mateapot"` export + * Deprecate passing status code as anything except first argument in factory + * Deprecate using non-error status codes + * Make `message` property enumerable for `HttpError`s + +2016-11-16 / 1.5.1 +================== + + * deps: inherits@2.0.3 + - Fix issue loading in browser + * deps: setprototypeof@1.0.2 + * deps: statuses@'>= 1.3.1 < 2' + +2016-05-18 / 1.5.0 +================== + + * Support new code `421 Misdirected Request` + * Use `setprototypeof` module to replace `__proto__` setting + * deps: statuses@'>= 1.3.0 < 2' + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: enable strict mode + +2016-01-28 / 1.4.0 +================== + + * Add `HttpError` export, for `err instanceof createError.HttpError` + * deps: inherits@2.0.1 + * deps: statuses@'>= 1.2.1 < 2' + - Fix message for status 451 + - Remove incorrect nginx status code + +2015-02-02 / 1.3.1 +================== + + * Fix regression where status can be overwritten in `createError` `props` + +2015-02-01 / 1.3.0 +================== + + * Construct errors using defined constructors from `createError` + * Fix error names that are not identifiers + - `createError["I'mateapot"]` is now `createError.ImATeapot` + * Set a meaningful `name` property on constructed errors + +2014-12-09 / 1.2.8 +================== + + * Fix stack trace from exported function + * Remove `arguments.callee` usage + +2014-10-14 / 1.2.7 +================== + + * Remove duplicate line + +2014-10-02 / 1.2.6 +================== + + * Fix `expose` to be `true` for `ClientError` constructor + +2014-09-28 / 1.2.5 +================== + + * deps: statuses@1 + +2014-09-21 / 1.2.4 +================== + + * Fix dependency version to work with old `npm`s + +2014-09-21 / 1.2.3 +================== + + * deps: statuses@~1.1.0 + +2014-09-21 / 1.2.2 +================== + + * Fix publish error + +2014-09-21 / 1.2.1 +================== + + * Support Node.js 0.6 + * Use `inherits` instead of `util` + +2014-09-09 / 1.2.0 +================== + + * Fix the way inheriting functions + * Support `expose` being provided in properties argument + +2014-09-08 / 1.1.0 +================== + + * Default status to 500 + * Support provided `error` to extend + +2014-09-08 / 1.0.1 +================== + + * Fix accepting string message + +2014-09-08 / 1.0.0 +================== + + * Initial release diff --git a/node_modules/http-errors/LICENSE b/node_modules/http-errors/LICENSE new file mode 100644 index 0000000..82af4df --- /dev/null +++ b/node_modules/http-errors/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com +Copyright (c) 2016 Douglas Christopher Wilson doug@somethingdoug.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/http-errors/README.md b/node_modules/http-errors/README.md new file mode 100644 index 0000000..a8b7330 --- /dev/null +++ b/node_modules/http-errors/README.md @@ -0,0 +1,169 @@ +# http-errors + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][node-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Create HTTP errors for Express, Koa, Connect, etc. with ease. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```console +$ npm install http-errors +``` + +## Example + +```js +var createError = require('http-errors') +var express = require('express') +var app = express() + +app.use(function (req, res, next) { + if (!req.user) return next(createError(401, 'Please login to view this page.')) + next() +}) +``` + +## API + +This is the current API, currently extracted from Koa and subject to change. + +### Error Properties + +- `expose` - can be used to signal if `message` should be sent to the client, + defaulting to `false` when `status` >= 500 +- `headers` - can be an object of header names to values to be sent to the + client, defaulting to `undefined`. When defined, the key names should all + be lower-cased +- `message` - the traditional error message, which should be kept short and all + single line +- `status` - the status code of the error, mirroring `statusCode` for general + compatibility +- `statusCode` - the status code of the error, defaulting to `500` + +### createError([status], [message], [properties]) + +Create a new error object with the given message `msg`. +The error object inherits from `createError.HttpError`. + +```js +var err = createError(404, 'This video does not exist!') +``` + +- `status: 500` - the status code as a number +- `message` - the message of the error, defaulting to node's text for that status code. +- `properties` - custom properties to attach to the object + +### createError([status], [error], [properties]) + +Extend the given `error` object with `createError.HttpError` +properties. This will not alter the inheritance of the given +`error` object, and the modified `error` object is the +return value. + + + +```js +fs.readFile('foo.txt', function (err, buf) { + if (err) { + if (err.code === 'ENOENT') { + var httpError = createError(404, err, { expose: false }) + } else { + var httpError = createError(500, err) + } + } +}) +``` + +- `status` - the status code as a number +- `error` - the error object to extend +- `properties` - custom properties to attach to the object + +### createError.isHttpError(val) + +Determine if the provided `val` is an `HttpError`. This will return `true` +if the error inherits from the `HttpError` constructor of this module or +matches the "duck type" for an error this module creates. All outputs from +the `createError` factory will return `true` for this function, including +if an non-`HttpError` was passed into the factory. + +### new createError\[code || name\](\[msg]\)) + +Create a new error object with the given message `msg`. +The error object inherits from `createError.HttpError`. + +```js +var err = new createError.NotFound() +``` + +- `code` - the status code as a number +- `name` - the name of the error as a "bumpy case", i.e. `NotFound` or `InternalServerError`. + +#### List of all constructors + +|Status Code|Constructor Name | +|-----------|-----------------------------| +|400 |BadRequest | +|401 |Unauthorized | +|402 |PaymentRequired | +|403 |Forbidden | +|404 |NotFound | +|405 |MethodNotAllowed | +|406 |NotAcceptable | +|407 |ProxyAuthenticationRequired | +|408 |RequestTimeout | +|409 |Conflict | +|410 |Gone | +|411 |LengthRequired | +|412 |PreconditionFailed | +|413 |PayloadTooLarge | +|414 |URITooLong | +|415 |UnsupportedMediaType | +|416 |RangeNotSatisfiable | +|417 |ExpectationFailed | +|418 |ImATeapot | +|421 |MisdirectedRequest | +|422 |UnprocessableEntity | +|423 |Locked | +|424 |FailedDependency | +|425 |TooEarly | +|426 |UpgradeRequired | +|428 |PreconditionRequired | +|429 |TooManyRequests | +|431 |RequestHeaderFieldsTooLarge | +|451 |UnavailableForLegalReasons | +|500 |InternalServerError | +|501 |NotImplemented | +|502 |BadGateway | +|503 |ServiceUnavailable | +|504 |GatewayTimeout | +|505 |HTTPVersionNotSupported | +|506 |VariantAlsoNegotiates | +|507 |InsufficientStorage | +|508 |LoopDetected | +|509 |BandwidthLimitExceeded | +|510 |NotExtended | +|511 |NetworkAuthenticationRequired| + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/http-errors/master?label=ci +[ci-url]: https://github.com/jshttp/http-errors/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/http-errors/master +[coveralls-url]: https://coveralls.io/r/jshttp/http-errors?branch=master +[node-image]: https://badgen.net/npm/node/http-errors +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/http-errors +[npm-url]: https://npmjs.org/package/http-errors +[npm-version-image]: https://badgen.net/npm/v/http-errors +[travis-image]: https://badgen.net/travis/jshttp/http-errors/master +[travis-url]: https://travis-ci.org/jshttp/http-errors diff --git a/node_modules/http-errors/index.js b/node_modules/http-errors/index.js new file mode 100644 index 0000000..c425f1e --- /dev/null +++ b/node_modules/http-errors/index.js @@ -0,0 +1,289 @@ +/*! + * http-errors + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('http-errors') +var setPrototypeOf = require('setprototypeof') +var statuses = require('statuses') +var inherits = require('inherits') +var toIdentifier = require('toidentifier') + +/** + * Module exports. + * @public + */ + +module.exports = createError +module.exports.HttpError = createHttpErrorConstructor() +module.exports.isHttpError = createIsHttpErrorFunction(module.exports.HttpError) + +// Populate exports for all constructors +populateConstructorExports(module.exports, statuses.codes, module.exports.HttpError) + +/** + * Get the code class of a status code. + * @private + */ + +function codeClass (status) { + return Number(String(status).charAt(0) + '00') +} + +/** + * Create a new HTTP Error. + * + * @returns {Error} + * @public + */ + +function createError () { + // so much arity going on ~_~ + var err + var msg + var status = 500 + var props = {} + for (var i = 0; i < arguments.length; i++) { + var arg = arguments[i] + var type = typeof arg + if (type === 'object' && arg instanceof Error) { + err = arg + status = err.status || err.statusCode || status + } else if (type === 'number' && i === 0) { + status = arg + } else if (type === 'string') { + msg = arg + } else if (type === 'object') { + props = arg + } else { + throw new TypeError('argument #' + (i + 1) + ' unsupported type ' + type) + } + } + + if (typeof status === 'number' && (status < 400 || status >= 600)) { + deprecate('non-error status code; use only 4xx or 5xx status codes') + } + + if (typeof status !== 'number' || + (!statuses.message[status] && (status < 400 || status >= 600))) { + status = 500 + } + + // constructor + var HttpError = createError[status] || createError[codeClass(status)] + + if (!err) { + // create error + err = HttpError + ? new HttpError(msg) + : new Error(msg || statuses.message[status]) + Error.captureStackTrace(err, createError) + } + + if (!HttpError || !(err instanceof HttpError) || err.status !== status) { + // add properties to generic error + err.expose = status < 500 + err.status = err.statusCode = status + } + + for (var key in props) { + if (key !== 'status' && key !== 'statusCode') { + err[key] = props[key] + } + } + + return err +} + +/** + * Create HTTP error abstract base class. + * @private + */ + +function createHttpErrorConstructor () { + function HttpError () { + throw new TypeError('cannot construct abstract class') + } + + inherits(HttpError, Error) + + return HttpError +} + +/** + * Create a constructor for a client error. + * @private + */ + +function createClientErrorConstructor (HttpError, name, code) { + var className = toClassName(name) + + function ClientError (message) { + // create the error object + var msg = message != null ? message : statuses.message[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ClientError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ClientError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ClientError, HttpError) + nameFunc(ClientError, className) + + ClientError.prototype.status = code + ClientError.prototype.statusCode = code + ClientError.prototype.expose = true + + return ClientError +} + +/** + * Create function to test is a value is a HttpError. + * @private + */ + +function createIsHttpErrorFunction (HttpError) { + return function isHttpError (val) { + if (!val || typeof val !== 'object') { + return false + } + + if (val instanceof HttpError) { + return true + } + + return val instanceof Error && + typeof val.expose === 'boolean' && + typeof val.statusCode === 'number' && val.status === val.statusCode + } +} + +/** + * Create a constructor for a server error. + * @private + */ + +function createServerErrorConstructor (HttpError, name, code) { + var className = toClassName(name) + + function ServerError (message) { + // create the error object + var msg = message != null ? message : statuses.message[code] + var err = new Error(msg) + + // capture a stack trace to the construction point + Error.captureStackTrace(err, ServerError) + + // adjust the [[Prototype]] + setPrototypeOf(err, ServerError.prototype) + + // redefine the error message + Object.defineProperty(err, 'message', { + enumerable: true, + configurable: true, + value: msg, + writable: true + }) + + // redefine the error name + Object.defineProperty(err, 'name', { + enumerable: false, + configurable: true, + value: className, + writable: true + }) + + return err + } + + inherits(ServerError, HttpError) + nameFunc(ServerError, className) + + ServerError.prototype.status = code + ServerError.prototype.statusCode = code + ServerError.prototype.expose = false + + return ServerError +} + +/** + * Set the name of a function, if possible. + * @private + */ + +function nameFunc (func, name) { + var desc = Object.getOwnPropertyDescriptor(func, 'name') + + if (desc && desc.configurable) { + desc.value = name + Object.defineProperty(func, 'name', desc) + } +} + +/** + * Populate the exports object with constructors for every error class. + * @private + */ + +function populateConstructorExports (exports, codes, HttpError) { + codes.forEach(function forEachCode (code) { + var CodeError + var name = toIdentifier(statuses.message[code]) + + switch (codeClass(code)) { + case 400: + CodeError = createClientErrorConstructor(HttpError, name, code) + break + case 500: + CodeError = createServerErrorConstructor(HttpError, name, code) + break + } + + if (CodeError) { + // export the constructor + exports[code] = CodeError + exports[name] = CodeError + } + }) +} + +/** + * Get a class name from a name identifier. + * @private + */ + +function toClassName (name) { + return name.substr(-5) !== 'Error' + ? name + 'Error' + : name +} diff --git a/node_modules/http-errors/node_modules/statuses/HISTORY.md b/node_modules/http-errors/node_modules/statuses/HISTORY.md new file mode 100644 index 0000000..fa4556e --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/HISTORY.md @@ -0,0 +1,82 @@ +2.0.1 / 2021-01-03 +================== + + * Fix returning values from `Object.prototype` + +2.0.0 / 2020-04-19 +================== + + * Drop support for Node.js 0.6 + * Fix messaging casing of `418 I'm a Teapot` + * Remove code 306 + * Remove `status[code]` exports; use `status.message[code]` + * Remove `status[msg]` exports; use `status.code[msg]` + * Rename `425 Unordered Collection` to standard `425 Too Early` + * Rename `STATUS_CODES` export to `message` + * Return status message for `statuses(code)` when given code + +1.5.0 / 2018-03-27 +================== + + * Add `103 Early Hints` + +1.4.0 / 2017-10-20 +================== + + * Add `STATUS_CODES` export + +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/node_modules/http-errors/node_modules/statuses/LICENSE b/node_modules/http-errors/node_modules/statuses/LICENSE new file mode 100644 index 0000000..28a3161 --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/http-errors/node_modules/statuses/README.md b/node_modules/http-errors/node_modules/statuses/README.md new file mode 100644 index 0000000..57967e6 --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/README.md @@ -0,0 +1,136 @@ +# statuses + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP status utility for node. + +This module provides a list of status codes and messages sourced from +a few different projects: + + * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml) + * The [Node.js project](https://nodejs.org/) + * The [NGINX project](https://www.nginx.com/) + * The [Apache HTTP Server project](https://httpd.apache.org/) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install statuses +``` + +## API + + + +```js +var status = require('statuses') +``` + +### status(code) + +Returns the status message string for a known HTTP status code. The code +may be a number or a string. An error is thrown for an unknown status code. + + + +```js +status(403) // => 'Forbidden' +status('403') // => 'Forbidden' +status(306) // throws +``` + +### status(msg) + +Returns the numeric status code for a known HTTP status message. The message +is case-insensitive. An error is thrown for an unknown status message. + + + +```js +status('forbidden') // => 403 +status('Forbidden') // => 403 +status('foo') // throws +``` + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### status.code[msg] + +Returns the numeric status code for a known status message (in lower-case), +otherwise `undefined`. + + + +```js +status['not found'] // => 404 +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + + + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.message[code] + +Returns the string message for a known numeric status code, otherwise +`undefined`. This object is the same format as the +[Node.js http module `http.STATUS_CODES`](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes). + + + +```js +status.message[404] // => 'Not Found' +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + + + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + + + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/statuses/master?label=ci +[ci-url]: https://github.com/jshttp/statuses/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/statuses/master +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[node-version-image]: https://badgen.net/npm/node/statuses +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/statuses +[npm-url]: https://npmjs.org/package/statuses +[npm-version-image]: https://badgen.net/npm/v/statuses diff --git a/node_modules/http-errors/node_modules/statuses/codes.json b/node_modules/http-errors/node_modules/statuses/codes.json new file mode 100644 index 0000000..1333ed1 --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/codes.json @@ -0,0 +1,65 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "103": "Early Hints", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a Teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Too Early", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} diff --git a/node_modules/http-errors/node_modules/statuses/index.js b/node_modules/http-errors/node_modules/statuses/index.js new file mode 100644 index 0000000..ea351c5 --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/index.js @@ -0,0 +1,146 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// status code to message map +status.message = codes + +// status message (lower-case) to code map +status.code = createMessageToStatusCodeMap(codes) + +// array of status codes +status.codes = createStatusCodeList(codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Create a map of message to status code. + * @private + */ + +function createMessageToStatusCodeMap (codes) { + var map = {} + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // populate map + map[message.toLowerCase()] = status + }) + + return map +} + +/** + * Create a list of all status codes. + * @private + */ + +function createStatusCodeList (codes) { + return Object.keys(codes).map(function mapCode (code) { + return Number(code) + }) +} + +/** + * Get the status code for given message. + * @private + */ + +function getStatusCode (message) { + var msg = message.toLowerCase() + + if (!Object.prototype.hasOwnProperty.call(status.code, msg)) { + throw new Error('invalid status message: "' + message + '"') + } + + return status.code[msg] +} + +/** + * Get the status message for given code. + * @private + */ + +function getStatusMessage (code) { + if (!Object.prototype.hasOwnProperty.call(status.message, code)) { + throw new Error('invalid status code: ' + code) + } + + return status.message[code] +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + return getStatusMessage(code) + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + return getStatusMessage(n) + } + + return getStatusCode(code) +} diff --git a/node_modules/http-errors/node_modules/statuses/package.json b/node_modules/http-errors/node_modules/statuses/package.json new file mode 100644 index 0000000..8c3e719 --- /dev/null +++ b/node_modules/http-errors/node_modules/statuses/package.json @@ -0,0 +1,49 @@ +{ + "name": "statuses", + "description": "HTTP status utility", + "version": "2.0.1", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "repository": "jshttp/statuses", + "license": "MIT", + "keywords": [ + "http", + "status", + "code" + ], + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "devDependencies": { + "csv-parse": "4.14.2", + "eslint": "7.17.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.22.1", + "eslint-plugin-markdown": "1.0.2", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.2.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "8.2.1", + "nyc": "15.1.0", + "raw-body": "2.4.1", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update": "npm run fetch && npm run build", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/http-errors/package.json b/node_modules/http-errors/package.json new file mode 100644 index 0000000..4cb6d7e --- /dev/null +++ b/node_modules/http-errors/package.json @@ -0,0 +1,50 @@ +{ + "name": "http-errors", + "description": "Create HTTP error objects", + "version": "2.0.0", + "author": "Jonathan Ong (http://jongleberry.com)", + "contributors": [ + "Alan Plum ", + "Douglas Christopher Wilson " + ], + "license": "MIT", + "repository": "jshttp/http-errors", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.1.3", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint . && node ./scripts/lint-readme-list.js", + "test": "mocha --reporter spec --bail", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "keywords": [ + "http", + "error" + ], + "files": [ + "index.js", + "HISTORY.md", + "LICENSE", + "README.md" + ] +} diff --git a/node_modules/inherits/LICENSE b/node_modules/inherits/LICENSE new file mode 100644 index 0000000..dea3013 --- /dev/null +++ b/node_modules/inherits/LICENSE @@ -0,0 +1,16 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. + diff --git a/node_modules/inherits/README.md b/node_modules/inherits/README.md new file mode 100644 index 0000000..b1c5665 --- /dev/null +++ b/node_modules/inherits/README.md @@ -0,0 +1,42 @@ +Browser-friendly inheritance fully compatible with standard node.js +[inherits](http://nodejs.org/api/util.html#util_util_inherits_constructor_superconstructor). + +This package exports standard `inherits` from node.js `util` module in +node environment, but also provides alternative browser-friendly +implementation through [browser +field](https://gist.github.com/shtylman/4339901). Alternative +implementation is a literal copy of standard one located in standalone +module to avoid requiring of `util`. It also has a shim for old +browsers with no `Object.create` support. + +While keeping you sure you are using standard `inherits` +implementation in node.js environment, it allows bundlers such as +[browserify](https://github.com/substack/node-browserify) to not +include full `util` package to your client code if all you need is +just `inherits` function. It worth, because browser shim for `util` +package is large and `inherits` is often the single function you need +from it. + +It's recommended to use this package instead of +`require('util').inherits` for any code that has chances to be used +not only in node.js but in browser too. + +## usage + +```js +var inherits = require('inherits'); +// then use exactly as the standard one +``` + +## note on version ~1.0 + +Version ~1.0 had completely different motivation and is not compatible +neither with 2.0 nor with standard node.js `inherits`. + +If you are using version ~1.0 and planning to switch to ~2.0, be +careful: + +* new version uses `super_` instead of `super` for referencing + superclass +* new version overwrites current prototype while old one preserves any + existing fields on it diff --git a/node_modules/inherits/inherits.js b/node_modules/inherits/inherits.js new file mode 100644 index 0000000..f71f2d9 --- /dev/null +++ b/node_modules/inherits/inherits.js @@ -0,0 +1,9 @@ +try { + var util = require('util'); + /* istanbul ignore next */ + if (typeof util.inherits !== 'function') throw ''; + module.exports = util.inherits; +} catch (e) { + /* istanbul ignore next */ + module.exports = require('./inherits_browser.js'); +} diff --git a/node_modules/inherits/inherits_browser.js b/node_modules/inherits/inherits_browser.js new file mode 100644 index 0000000..86bbb3d --- /dev/null +++ b/node_modules/inherits/inherits_browser.js @@ -0,0 +1,27 @@ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + if (superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }) + } + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + if (superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } + } +} diff --git a/node_modules/inherits/package.json b/node_modules/inherits/package.json new file mode 100644 index 0000000..37b4366 --- /dev/null +++ b/node_modules/inherits/package.json @@ -0,0 +1,29 @@ +{ + "name": "inherits", + "description": "Browser-friendly inheritance fully compatible with standard node.js inherits()", + "version": "2.0.4", + "keywords": [ + "inheritance", + "class", + "klass", + "oop", + "object-oriented", + "inherits", + "browser", + "browserify" + ], + "main": "./inherits.js", + "browser": "./inherits_browser.js", + "repository": "git://github.com/isaacs/inherits", + "license": "ISC", + "scripts": { + "test": "tap" + }, + "devDependencies": { + "tap": "^14.2.4" + }, + "files": [ + "inherits.js", + "inherits_browser.js" + ] +} diff --git a/node_modules/mime-db/HISTORY.md b/node_modules/mime-db/HISTORY.md new file mode 100644 index 0000000..fb35bec --- /dev/null +++ b/node_modules/mime-db/HISTORY.md @@ -0,0 +1,541 @@ +1.54.0 / 2025-03-17 +=================== + + * Update mime type for DCM format (#362) + * mark application/octet-stream as compressible (#163) + * Fix typo in application/x-zip-compressed mimetype (#359) + * Add mime-type for Jupyter notebooks (#282) + * Add Google Drive MIME types (#311) + * Add .blend file type (#338) + * Add support for the FBX file extension (#342) + * Add Adobe DNG file (#340) + * Add Procreate Brush and Brush Set file Types (#339) + * Add support for Procreate Dreams (#341) + * replace got with undici (#352) + * Added extensions list for model/step (#293) + * Add m4b as a type of audio/mp4 (#357) + * windows 11 application/x-zip-compressed (#346) + * add dotLottie mime type (#351) + * Add some MS-related extensions and types (#336) + +1.53.0 / 2024-07-12 +=================== + + * Add extension `.sql` to `application/sql` + * Add extensions `.aac` and `.adts` to `audio/aac` + * Add extensions `.js` and `.mjs` to `text/javascript` + * Add extensions for `application/mp4` from IANA + * Add extensions from IANA for more MIME types + * Add Microsoft app installer types and extensions + * Add new upstream MIME types + * Fix extensions for `text/markdown` to match IANA + * Remove extension `.mjs` from `application/javascript` + * Remove obsolete MIME types from IANA data + +1.52.0 / 2022-02-21 +=================== + + * Add extensions from IANA for more `image/*` types + * Add extension `.asc` to `application/pgp-keys` + * Add extensions to various XML types + * Add new upstream MIME types + +1.51.0 / 2021-11-08 +=================== + + * Add new upstream MIME types + * Mark `image/vnd.microsoft.icon` as compressible + * Mark `image/vnd.ms-dds` as compressible + +1.50.0 / 2021-09-15 +=================== + + * Add deprecated iWorks mime types and extensions + * Add new upstream MIME types + +1.49.0 / 2021-07-26 +=================== + + * Add extension `.trig` to `application/trig` + * Add new upstream MIME types + +1.48.0 / 2021-05-30 +=================== + + * Add extension `.mvt` to `application/vnd.mapbox-vector-tile` + * Add new upstream MIME types + * Mark `text/yaml` as compressible + +1.47.0 / 2021-04-01 +=================== + + * Add new upstream MIME types + * Remove ambiguous extensions from IANA for `application/*+xml` types + * Update primary extension to `.es` for `application/ecmascript` + +1.46.0 / 2021-02-13 +=================== + + * Add extension `.amr` to `audio/amr` + * Add extension `.m4s` to `video/iso.segment` + * Add extension `.opus` to `audio/ogg` + * Add new upstream MIME types + +1.45.0 / 2020-09-22 +=================== + + * Add `application/ubjson` with extension `.ubj` + * Add `image/avif` with extension `.avif` + * Add `image/ktx2` with extension `.ktx2` + * Add extension `.dbf` to `application/vnd.dbf` + * Add extension `.rar` to `application/vnd.rar` + * Add extension `.td` to `application/urc-targetdesc+xml` + * Add new upstream MIME types + * Fix extension of `application/vnd.apple.keynote` to be `.key` + +1.44.0 / 2020-04-22 +=================== + + * Add charsets from IANA + * Add extension `.cjs` to `application/node` + * Add new upstream MIME types + +1.43.0 / 2020-01-05 +=================== + + * Add `application/x-keepass2` with extension `.kdbx` + * Add extension `.mxmf` to `audio/mobile-xmf` + * Add extensions from IANA for `application/*+xml` types + * Add new upstream MIME types + +1.42.0 / 2019-09-25 +=================== + + * Add `image/vnd.ms-dds` with extension `.dds` + * Add new upstream MIME types + * Remove compressible from `multipart/mixed` + +1.41.0 / 2019-08-30 +=================== + + * Add new upstream MIME types + * Add `application/toml` with extension `.toml` + * Mark `font/ttf` as compressible + +1.40.0 / 2019-04-20 +=================== + + * Add extensions from IANA for `model/*` types + * Add `text/mdx` with extension `.mdx` + +1.39.0 / 2019-04-04 +=================== + + * Add extensions `.siv` and `.sieve` to `application/sieve` + * Add new upstream MIME types + +1.38.0 / 2019-02-04 +=================== + + * Add extension `.nq` to `application/n-quads` + * Add extension `.nt` to `application/n-triples` + * Add new upstream MIME types + * Mark `text/less` as compressible + +1.37.0 / 2018-10-19 +=================== + + * Add extensions to HEIC image types + * Add new upstream MIME types + +1.36.0 / 2018-08-20 +=================== + + * Add Apple file extensions from IANA + * Add extensions from IANA for `image/*` types + * Add new upstream MIME types + +1.35.0 / 2018-07-15 +=================== + + * Add extension `.owl` to `application/rdf+xml` + * Add new upstream MIME types + - Removes extension `.woff` from `application/font-woff` + +1.34.0 / 2018-06-03 +=================== + + * Add extension `.csl` to `application/vnd.citationstyles.style+xml` + * Add extension `.es` to `application/ecmascript` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/turtle` + * Mark all XML-derived types as compressible + +1.33.0 / 2018-02-15 +=================== + + * Add extensions from IANA for `message/*` types + * Add new upstream MIME types + * Fix some incorrect OOXML types + * Remove `application/font-woff2` + +1.32.0 / 2017-11-29 +=================== + + * Add new upstream MIME types + * Update `text/hjson` to registered `application/hjson` + * Add `text/shex` with extension `.shex` + +1.31.0 / 2017-10-25 +=================== + + * Add `application/raml+yaml` with extension `.raml` + * Add `application/wasm` with extension `.wasm` + * Add new `font` type from IANA + * Add new upstream font extensions + * Add new upstream MIME types + * Add extensions for JPEG-2000 images + +1.30.0 / 2017-08-27 +=================== + + * Add `application/vnd.ms-outlook` + * Add `application/x-arj` + * Add extension `.mjs` to `application/javascript` + * Add glTF types and extensions + * Add new upstream MIME types + * Add `text/x-org` + * Add VirtualBox MIME types + * Fix `source` records for `video/*` types that are IANA + * Update `font/opentype` to registered `font/otf` + +1.29.0 / 2017-07-10 +=================== + + * Add `application/fido.trusted-apps+json` + * Add extension `.wadl` to `application/vnd.sun.wadl+xml` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/css` + +1.28.0 / 2017-05-14 +=================== + + * Add new upstream MIME types + * Add extension `.gz` to `application/gzip` + * Update extensions `.md` and `.markdown` to be `text/markdown` + +1.27.0 / 2017-03-16 +=================== + + * Add new upstream MIME types + * Add `image/apng` with extension `.apng` + +1.26.0 / 2017-01-14 +=================== + + * Add new upstream MIME types + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add new upstream MIME types + +1.24.0 / 2016-09-18 +=================== + + * Add `audio/mp3` + * Add new upstream MIME types + +1.23.0 / 2016-05-01 +=================== + + * Add new upstream MIME types + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Add new upstream MIME types + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add Google document types + * Add new upstream MIME types + +1.20.0 / 2015-11-10 +=================== + + * Add `text/x-suse-ymp` + * Add new upstream MIME types + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.apple.pkpass` + * Add new upstream MIME types + +1.18.0 / 2015-09-03 +=================== + + * Add new upstream MIME types + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/node_modules/mime-db/LICENSE b/node_modules/mime-db/LICENSE new file mode 100644 index 0000000..0751cb1 --- /dev/null +++ b/node_modules/mime-db/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015-2022 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mime-db/README.md b/node_modules/mime-db/README.md new file mode 100644 index 0000000..ee93fa0 --- /dev/null +++ b/node_modules/mime-db/README.md @@ -0,0 +1,109 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a large database of mime types and information about them. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- https://www.iana.org/assignments/media-types/media-types.xhtml +- https://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- https://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you intend to use this in a web browser, you can conveniently access the JSON file via [jsDelivr](https://www.jsdelivr.com/), a popular CDN (Content Delivery Network). To ensure stability and compatibility, it is advisable to specify [a release tag](https://github.com/jshttp/mime-db/tags) instead of using the 'master' branch. This is because the JSON file's format might change in future updates, and relying on a specific release tag will prevent potential issues arising from these changes. + +``` +https://cdn.jsdelivr.net/gh/jshttp/mime-db@master/db.json +``` + +## Usage + +```js +var db = require('mime-db') + +// grab data on .js files +var data = db['application/javascript'] +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](https://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](https://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](https://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Note on MIME Type Data and Semver + +This package considers the programmatic api as the semver compatibility. This means the MIME type resolution is *not* considered +in the semver bumps. This means that if you want to pin your `mime-db` data you will need to do it in your application. While +this expectation was not set in docs until now, it is how the pacakge operated, so we do not feel this is a breaking change. + +## Contributing + +The primary way to contribute to this database is by updating the data in +one of the upstream sources. The database is updated from the upstreams +periodically and will pull in any changes. + +### Registering Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](https://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +### Direct Inclusion + +If that is not possible / feasible, they can be added directly here as a +"custom" type. To do this, it is required to have a primary source that +definitively lists the media type. If an extension is going to be listed as +associated with this media type, the source must definitively link the +media type and extension as well. + +To edit the database, only make PRs against `src/custom-types.json` or +`src/custom-suffix.json`. + +The `src/custom-types.json` file is a JSON object with the MIME type as the +keys and the values being an object with the following keys: + +- `compressible` - leave out if you don't know, otherwise `true`/`false` to + indicate whether the data represented by the type is typically compressible. +- `extensions` - include an array of file extensions that are associated with + the type. +- `notes` - human-readable notes about the type, typically what the type is. +- `sources` - include an array of URLs of where the MIME type and the associated + extensions are sourced from. This needs to be a [primary source](https://en.wikipedia.org/wiki/Primary_source); + links to type aggregating sites and Wikipedia are _not acceptable_. + +To update the build, run `npm run build`. + +[ci-image]: https://badgen.net/github/checks/jshttp/mime-db/master?label=ci +[ci-url]: https://github.com/jshttp/mime-db/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-db/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://badgen.net/npm/node/mime-db +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-db +[npm-url]: https://npmjs.org/package/mime-db +[npm-version-image]: https://badgen.net/npm/v/mime-db diff --git a/node_modules/mime-db/db.json b/node_modules/mime-db/db.json new file mode 100644 index 0000000..7e74733 --- /dev/null +++ b/node_modules/mime-db/db.json @@ -0,0 +1,9342 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/3gpp-ims+xml": { + "source": "iana", + "compressible": true + }, + "application/3gpphal+json": { + "source": "iana", + "compressible": true + }, + "application/3gpphalforms+json": { + "source": "iana", + "compressible": true + }, + "application/a2l": { + "source": "iana" + }, + "application/ace+cbor": { + "source": "iana" + }, + "application/ace+json": { + "source": "iana", + "compressible": true + }, + "application/ace-groupcomm+cbor": { + "source": "iana" + }, + "application/ace-trl+cbor": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/activity+json": { + "source": "iana", + "compressible": true + }, + "application/aif+cbor": { + "source": "iana" + }, + "application/aif+json": { + "source": "iana", + "compressible": true + }, + "application/alto-cdni+json": { + "source": "iana", + "compressible": true + }, + "application/alto-cdnifilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-propmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-propmapparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-tips+json": { + "source": "iana", + "compressible": true + }, + "application/alto-tipsparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-updatestreamcontrol+json": { + "source": "iana", + "compressible": true + }, + "application/alto-updatestreamparams+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/appinstaller": { + "compressible": false, + "extensions": ["appinstaller"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/appx": { + "compressible": false, + "extensions": ["appx"] + }, + "application/appxbundle": { + "compressible": false, + "extensions": ["appxbundle"] + }, + "application/at+jwt": { + "source": "iana" + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomdeleted"] + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomsvc"] + }, + "application/atsc-dwd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dwd"] + }, + "application/atsc-dynamic-event-message": { + "source": "iana" + }, + "application/atsc-held+xml": { + "source": "iana", + "compressible": true, + "extensions": ["held"] + }, + "application/atsc-rdt+json": { + "source": "iana", + "compressible": true + }, + "application/atsc-rsat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rsat"] + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana", + "compressible": true + }, + "application/automationml-aml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["aml"] + }, + "application/automationml-amlx+zip": { + "source": "iana", + "compressible": false, + "extensions": ["amlx"] + }, + "application/bacnet-xdd+zip": { + "source": "iana", + "compressible": false + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/bufr": { + "source": "iana" + }, + "application/c2pa": { + "source": "iana" + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xcs"] + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/captive+json": { + "source": "iana", + "compressible": true + }, + "application/cbor": { + "source": "iana" + }, + "application/cbor-seq": { + "source": "iana" + }, + "application/cccex": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana", + "compressible": true + }, + "application/ccxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ccxml"] + }, + "application/cda+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/cdfx+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdfx"] + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/ce+cbor": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana", + "compressible": true + }, + "application/cellml+xml": { + "source": "iana", + "compressible": true + }, + "application/cfw": { + "source": "iana" + }, + "application/cid-edhoc+cbor-seq": { + "source": "iana" + }, + "application/city+json": { + "source": "iana", + "compressible": true + }, + "application/city+json-seq": { + "source": "iana" + }, + "application/clr": { + "source": "iana" + }, + "application/clue+xml": { + "source": "iana", + "compressible": true + }, + "application/clue_info+xml": { + "source": "iana", + "compressible": true + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana", + "compressible": true + }, + "application/coap-eap": { + "source": "iana" + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/concise-problem-details+cbor": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cose-x509": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cpl"] + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana", + "compressible": true + }, + "application/cstadata+xml": { + "source": "iana", + "compressible": true + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cwl": { + "source": "iana", + "extensions": ["cwl"] + }, + "application/cwl+json": { + "source": "iana", + "compressible": true + }, + "application/cwl+yaml": { + "source": "iana" + }, + "application/cwt": { + "source": "iana" + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpd"] + }, + "application/dash-patch+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpp"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "compressible": true, + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana", + "compressible": true + }, + "application/dicom": { + "source": "iana", + "extensions": ["dcm"] + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana", + "compressible": true + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/dns+json": { + "source": "iana", + "compressible": true + }, + "application/dns-message": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dbk"] + }, + "application/dots+cbor": { + "source": "iana" + }, + "application/dpop+jwt": { + "source": "iana" + }, + "application/dskpp+xml": { + "source": "iana", + "compressible": true + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/eat+cwt": { + "source": "iana" + }, + "application/eat+jwt": { + "source": "iana" + }, + "application/eat-bun+cbor": { + "source": "iana" + }, + "application/eat-bun+json": { + "source": "iana", + "compressible": true + }, + "application/eat-ucs+cbor": { + "source": "iana" + }, + "application/eat-ucs+json": { + "source": "iana", + "compressible": true + }, + "application/ecmascript": { + "source": "apache", + "compressible": true, + "extensions": ["ecma"] + }, + "application/edhoc+cbor-seq": { + "source": "iana" + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/elm+json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/elm+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.cap+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/emergencycalldata.comment+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.control+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.ecall.msd": { + "source": "iana" + }, + "application/emergencycalldata.legacyesn+json": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.veds+xml": { + "source": "iana", + "compressible": true + }, + "application/emma+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emotionml"] + }, + "application/encaprtp": { + "source": "iana" + }, + "application/entity-statement+jwt": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana", + "compressible": true + }, + "application/epub+zip": { + "source": "iana", + "compressible": false, + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/expect-ct-report+json": { + "source": "iana", + "compressible": true + }, + "application/express": { + "source": "iana", + "extensions": ["exp"] + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/fdt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["fdt"] + }, + "application/fhir+json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/fhir+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/fido.trusted-apps+json": { + "compressible": true + }, + "application/fits": { + "source": "iana" + }, + "application/flexfec": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false + }, + "application/framework-attributes+xml": { + "source": "iana", + "compressible": true + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/geo+json-seq": { + "source": "iana" + }, + "application/geopackage+sqlite3": { + "source": "iana" + }, + "application/geopose+json": { + "source": "iana", + "compressible": true + }, + "application/geoxacml+json": { + "source": "iana", + "compressible": true + }, + "application/geoxacml+xml": { + "source": "iana", + "compressible": true + }, + "application/gltf-buffer": { + "source": "iana" + }, + "application/gml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["gml"] + }, + "application/gnap-binding-jws": { + "source": "iana" + }, + "application/gnap-binding-jwsd": { + "source": "iana" + }, + "application/gnap-binding-rotation-jws": { + "source": "iana" + }, + "application/gnap-binding-rotation-jwsd": { + "source": "iana" + }, + "application/gpx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["gpx"] + }, + "application/grib": { + "source": "iana" + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false, + "extensions": ["gz"] + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana", + "compressible": true + }, + "application/hjson": { + "extensions": ["hjson"] + }, + "application/hl7v2+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pkg-reply+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana", + "compressible": true, + "extensions": ["its"] + }, + "application/java-archive": { + "source": "iana", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "apache", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js"] + }, + "application/jf2feed+json": { + "source": "iana", + "compressible": true + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/jscalendar+json": { + "source": "iana", + "compressible": true + }, + "application/jscontact+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jsonpath": { + "source": "iana" + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+jwt": { + "source": "iana" + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana", + "compressible": true + }, + "application/kpml-response+xml": { + "source": "iana", + "compressible": true + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lgr"] + }, + "application/link-format": { + "source": "iana" + }, + "application/linkset": { + "source": "iana" + }, + "application/linkset+json": { + "source": "iana", + "compressible": true + }, + "application/load-control+xml": { + "source": "iana", + "compressible": true + }, + "application/logout+jwt": { + "source": "iana" + }, + "application/lost+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana", + "compressible": true + }, + "application/lpf+zip": { + "source": "iana", + "compressible": false + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mads"] + }, + "application/manifest+json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana", + "compressible": true + }, + "application/mathml-presentation+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-deregister+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-envelope+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-protection-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-reception-report+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-schedule+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-user-service-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpf"] + }, + "application/media_control+xml": { + "source": "iana", + "compressible": true + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "compressible": true, + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "compressible": true, + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mipc": { + "source": "iana" + }, + "application/missing-blocks+cbor-seq": { + "source": "iana" + }, + "application/mmt-aei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["maei"] + }, + "application/mmt-usd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musd"] + }, + "application/mods+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4","mpg4","mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana", + "compressible": true + }, + "application/mrb-publish+xml": { + "source": "iana", + "compressible": true + }, + "application/msc-ivr+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/msc-mixer+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/msix": { + "compressible": false, + "extensions": ["msix"] + }, + "application/msixbundle": { + "compressible": false, + "extensions": ["msixbundle"] + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/multipart-core": { + "source": "iana" + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/n-quads": { + "source": "iana", + "extensions": ["nq"] + }, + "application/n-triples": { + "source": "iana", + "extensions": ["nt"] + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana", + "charset": "US-ASCII" + }, + "application/news-groupinfo": { + "source": "iana", + "charset": "US-ASCII" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana", + "compressible": true + }, + "application/node": { + "source": "iana", + "extensions": ["cjs"] + }, + "application/nss": { + "source": "iana" + }, + "application/oauth-authz-req+jwt": { + "source": "iana" + }, + "application/oblivious-dns-message": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": true, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odm+xml": { + "source": "iana", + "compressible": true + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/ohttp-keys": { + "source": "iana" + }, + "application/omdoc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg","one","onea"] + }, + "application/opc-nodeset+xml": { + "source": "iana", + "compressible": true + }, + "application/oscore": { + "source": "iana" + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p21": { + "source": "iana" + }, + "application/p21+zip": { + "source": "iana", + "compressible": false + }, + "application/p2p-overlay+xml": { + "source": "iana", + "compressible": true, + "extensions": ["relo"] + }, + "application/parityfec": { + "source": "iana" + }, + "application/passport": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pem-certificate-chain": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana", + "extensions": ["asc"] + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["sig","asc"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/pidf-diff+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkcs8-encrypted": { + "source": "iana" + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/private-token-issuer-directory": { + "source": "iana" + }, + "application/private-token-request": { + "source": "iana" + }, + "application/private-token-response": { + "source": "iana" + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana", + "compressible": true + }, + "application/provenance+xml": { + "source": "iana", + "compressible": true, + "extensions": ["provx"] + }, + "application/provided-claims+jwt": { + "source": "iana" + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.cyn": { + "source": "iana", + "charset": "7-BIT" + }, + "application/prs.hpub+zip": { + "source": "iana", + "compressible": false + }, + "application/prs.implied-document+xml": { + "source": "iana", + "compressible": true + }, + "application/prs.implied-executable": { + "source": "iana" + }, + "application/prs.implied-object+json": { + "source": "iana", + "compressible": true + }, + "application/prs.implied-object+json-seq": { + "source": "iana" + }, + "application/prs.implied-object+yaml": { + "source": "iana" + }, + "application/prs.implied-structure": { + "source": "iana" + }, + "application/prs.mayfile": { + "source": "iana" + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.vcfbzip2": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xsf"] + }, + "application/pskc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pskcxml"] + }, + "application/pvd+json": { + "source": "iana", + "compressible": true + }, + "application/qsig": { + "source": "iana" + }, + "application/raml+yaml": { + "compressible": true, + "extensions": ["raml"] + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf","owl"] + }, + "application/reginfo+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "apache" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resolve-response+jwt": { + "source": "iana" + }, + "application/resource-lists+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana", + "compressible": true + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana", + "compressible": true + }, + "application/rls-services+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rs"] + }, + "application/route-apd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rapd"] + }, + "application/route-s-tsid+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sls"] + }, + "application/route-usd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rusd"] + }, + "application/rpki-checklist": { + "source": "iana" + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-publication": { + "source": "iana" + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-signed-tal": { + "source": "iana" + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana", + "compressible": true + }, + "application/samlmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/sarif+json": { + "source": "iana", + "compressible": true + }, + "application/sarif-external-properties+json": { + "source": "iana", + "compressible": true + }, + "application/sbe": { + "source": "iana" + }, + "application/sbml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana", + "compressible": true + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/secevent+jwt": { + "source": "iana" + }, + "application/senml+cbor": { + "source": "iana" + }, + "application/senml+json": { + "source": "iana", + "compressible": true + }, + "application/senml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["senmlx"] + }, + "application/senml-etch+cbor": { + "source": "iana" + }, + "application/senml-etch+json": { + "source": "iana", + "compressible": true + }, + "application/senml-exi": { + "source": "iana" + }, + "application/sensml+cbor": { + "source": "iana" + }, + "application/sensml+json": { + "source": "iana", + "compressible": true + }, + "application/sensml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sensmlx"] + }, + "application/sensml-exi": { + "source": "iana" + }, + "application/sep+xml": { + "source": "iana", + "compressible": true + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana", + "extensions": ["siv","sieve"] + }, + "application/simple-filter+xml": { + "source": "iana", + "compressible": true + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/sipc": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "apache" + }, + "application/smil+xml": { + "source": "iana", + "compressible": true, + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "compressible": true, + "extensions": ["srx"] + }, + "application/spdx+json": { + "source": "iana", + "compressible": true + }, + "application/spirits-event+xml": { + "source": "iana", + "compressible": true + }, + "application/sql": { + "source": "iana", + "extensions": ["sql"] + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ssdl"] + }, + "application/sslkeylogfile": { + "source": "iana" + }, + "application/ssml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ssml"] + }, + "application/st2110-41": { + "source": "iana" + }, + "application/stix+json": { + "source": "iana", + "compressible": true + }, + "application/stratum": { + "source": "iana" + }, + "application/swid+cbor": { + "source": "iana" + }, + "application/swid+xml": { + "source": "iana", + "compressible": true, + "extensions": ["swidtag"] + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/taxii+json": { + "source": "iana", + "compressible": true + }, + "application/td+json": { + "source": "iana", + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tei","teicorpus"] + }, + "application/tetra_isi": { + "source": "iana" + }, + "application/thraud+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/tlsrpt+gzip": { + "source": "iana" + }, + "application/tlsrpt+json": { + "source": "iana", + "compressible": true + }, + "application/tm+json": { + "source": "iana", + "compressible": true + }, + "application/tnauthlist": { + "source": "iana" + }, + "application/toc+cbor": { + "source": "iana" + }, + "application/token-introspection+jwt": { + "source": "iana" + }, + "application/toml": { + "source": "iana", + "compressible": true, + "extensions": ["toml"] + }, + "application/trickle-ice-sdpfrag": { + "source": "iana" + }, + "application/trig": { + "source": "iana", + "extensions": ["trig"] + }, + "application/trust-chain+json": { + "source": "iana", + "compressible": true + }, + "application/trust-mark+jwt": { + "source": "iana" + }, + "application/trust-mark-delegation+jwt": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ttml"] + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/tzif": { + "source": "iana" + }, + "application/tzif-leap": { + "source": "iana" + }, + "application/ubjson": { + "compressible": false, + "extensions": ["ubj"] + }, + "application/uccs+cbor": { + "source": "iana" + }, + "application/ujcs+json": { + "source": "iana", + "compressible": true + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-ressheet+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rsheet"] + }, + "application/urc-targetdesc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["td"] + }, + "application/urc-uisocketdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/vc": { + "source": "iana" + }, + "application/vc+cose": { + "source": "iana" + }, + "application/vc+jwt": { + "source": "iana" + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana", + "compressible": true + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.1000minds.decision-model+xml": { + "source": "iana", + "compressible": true, + "extensions": ["1km"] + }, + "application/vnd.1ob": { + "source": "iana" + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3a+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3ach+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc8+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-v2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.5gnas": { + "source": "iana" + }, + "application/vnd.3gpp.5gsa2x": { + "source": "iana" + }, + "application/vnd.3gpp.5gsa2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.5gsv2x": { + "source": "iana" + }, + "application/vnd.3gpp.5gsv2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.crs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.current-location-discovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.gmop+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.gtpc": { + "source": "iana" + }, + "application/vnd.3gpp.interworking-data": { + "source": "iana" + }, + "application/vnd.3gpp.lpp": { + "source": "iana" + }, + "application/vnd.3gpp.mc-signalling-ear": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-msgstore-ctrl-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-payload": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-regroup+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-signalling": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-floor-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-regroup+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-signed+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-init-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-regroup+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-transmission-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.ngap": { + "source": "iana" + }, + "application/vnd.3gpp.pfcp": { + "source": "iana" + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.pinapp-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.s1ap": { + "source": "iana" + }, + "application/vnd.3gpp.seal-group-doc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-network-qos-management-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-ue-config-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-unicast-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.seal-user-profile-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.v2x": { + "source": "iana" + }, + "application/vnd.3gpp.vae-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acm.addressxfer+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.acm.chatbot+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "compressible": false, + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "apache", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata-pagedef": { + "source": "iana" + }, + "application/vnd.afpc.cmoca-cmresource": { + "source": "iana" + }, + "application/vnd.afpc.foca-charset": { + "source": "iana" + }, + "application/vnd.afpc.foca-codedfont": { + "source": "iana" + }, + "application/vnd.afpc.foca-codepage": { + "source": "iana" + }, + "application/vnd.afpc.modca": { + "source": "iana" + }, + "application/vnd.afpc.modca-cmtable": { + "source": "iana" + }, + "application/vnd.afpc.modca-formdef": { + "source": "iana" + }, + "application/vnd.afpc.modca-mediummap": { + "source": "iana" + }, + "application/vnd.afpc.modca-objectcontainer": { + "source": "iana" + }, + "application/vnd.afpc.modca-overlay": { + "source": "iana" + }, + "application/vnd.afpc.modca-pagesegment": { + "source": "iana" + }, + "application/vnd.age": { + "source": "iana", + "extensions": ["age"] + }, + "application/vnd.ah-barcode": { + "source": "apache" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amadeus+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.android.ota": { + "source": "iana" + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.arrow.file": { + "source": "iana" + }, + "application/vnd.apache.arrow.stream": { + "source": "iana" + }, + "application/vnd.apache.parquet": { + "source": "iana" + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.apexlang": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.aplextor.warrp+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apothekende.reservation+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpkg"] + }, + "application/vnd.apple.keynote": { + "source": "iana", + "extensions": ["key"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.numbers": { + "source": "iana", + "extensions": ["numbers"] + }, + "application/vnd.apple.pages": { + "source": "iana", + "extensions": ["pages"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "apache" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artisan+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autodesk.fbx": { + "extensions": ["fbx"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avalon+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.avistar+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["bmml"] + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.banana-accounting": { + "source": "iana" + }, + "application/vnd.bbf.usp.error": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.belightsoft.lhzd+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.belightsoft.lhzl+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.bint.med-content": { + "source": "iana" + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.blink-idb-value-wrapper": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.bpf": { + "source": "iana" + }, + "application/vnd.bpf3": { + "source": "iana" + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.byu.uapi+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bzip3": { + "source": "iana" + }, + "application/vnd.c3voc.schedule+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.capasystems-pg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.ciedi": { + "source": "iana" + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana", + "compressible": true, + "extensions": ["csl"] + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.cncf.helm.chart.content.v1.tar+gzip": { + "source": "iana" + }, + "application/vnd.cncf.helm.chart.provenance.v1.prov": { + "source": "iana" + }, + "application/vnd.cncf.helm.config.v1+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet-template": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.comicbook-rar": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wbs"] + }, + "application/vnd.cryptii.pipe+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.crypto-shade-file": { + "source": "iana" + }, + "application/vnd.cryptomator.encrypted": { + "source": "iana" + }, + "application/vnd.cryptomator.vault": { + "source": "iana" + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.cyclonedx+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cyclonedx+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.d3m-dataset": { + "source": "iana" + }, + "application/vnd.d3m-problem": { + "source": "iana" + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.datalog": { + "source": "iana" + }, + "application/vnd.datapackage+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dbf": { + "source": "iana", + "extensions": ["dbf"] + }, + "application/vnd.dcmp+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dcmp"] + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume.movie": { + "source": "iana" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbisl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecip.rlp": { + "source": "iana" + }, + "application/vnd.eclipse.ditto+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.efi.img": { + "source": "iana" + }, + "application/vnd.efi.iso": { + "source": "iana" + }, + "application/vnd.eln+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.erofs": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "compressible": true, + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.cug+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.sci+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eu.kasparian.car+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.evolv.ecig.profile": { + "source": "iana" + }, + "application/vnd.evolv.ecig.settings": { + "source": "iana" + }, + "application/vnd.evolv.ecig.theme": { + "source": "iana" + }, + "application/vnd.exstream-empower+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.exstream-package": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.familysearch.gedcom+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "apache", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.fdsn.stationxml+xml": { + "source": "iana", + "charset": "XML-BASED", + "compressible": true + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.ficlab.flb+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.freelog.comic": { + "source": "iana" + }, + "application/vnd.frogans.fnc": { + "source": "apache", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "apache", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujifilm.fb.docuworks": { + "source": "iana" + }, + "application/vnd.fujifilm.fb.docuworks.binder": { + "source": "iana" + }, + "application/vnd.fujifilm.fb.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujifilm.fb.jfi+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.futoin+cbor": { + "source": "iana" + }, + "application/vnd.futoin+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.ga4gh.passport+jwt": { + "source": "iana" + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.genozip": { + "source": "iana" + }, + "application/vnd.gentics.grd+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.gentoo.catmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.gentoo.ebuild": { + "source": "iana" + }, + "application/vnd.gentoo.eclass": { + "source": "iana" + }, + "application/vnd.gentoo.gpkg": { + "source": "iana" + }, + "application/vnd.gentoo.manifest": { + "source": "iana" + }, + "application/vnd.gentoo.pkgmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.gentoo.xpak": { + "source": "iana" + }, + "application/vnd.geo+json": { + "source": "apache", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.pinboard": { + "source": "iana" + }, + "application/vnd.geogebra.slides": { + "source": "iana", + "extensions": ["ggs"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.gnu.taler.exchange+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.gnu.taler.merchant+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.google-apps.audio": {}, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.drawing": { + "compressible": false, + "extensions": ["gdraw"] + }, + "application/vnd.google-apps.drive-sdk": { + "compressible": false + }, + "application/vnd.google-apps.file": {}, + "application/vnd.google-apps.folder": { + "compressible": false + }, + "application/vnd.google-apps.form": { + "compressible": false, + "extensions": ["gform"] + }, + "application/vnd.google-apps.fusiontable": {}, + "application/vnd.google-apps.jam": { + "compressible": false, + "extensions": ["gjam"] + }, + "application/vnd.google-apps.mail-layout": {}, + "application/vnd.google-apps.map": { + "compressible": false, + "extensions": ["gmap"] + }, + "application/vnd.google-apps.photo": {}, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.script": { + "compressible": false, + "extensions": ["gscript"] + }, + "application/vnd.google-apps.shortcut": {}, + "application/vnd.google-apps.site": { + "compressible": false, + "extensions": ["gsite"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-apps.unknown": {}, + "application/vnd.google-apps.video": {}, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdcf"] + }, + "application/vnd.gpxsee.map+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "compressible": true, + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.hsl": { + "source": "iana" + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyper+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyper-item+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "apache" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "apache", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.imagemeter.folder+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.imagemeter.image+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.informix-visionary": { + "source": "apache" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.ipfs.ipns-record": { + "source": "iana" + }, + "application/vnd.ipld.car": { + "source": "iana" + }, + "application/vnd.ipld.dag-cbor": { + "source": "iana" + }, + "application/vnd.ipld.dag-json": { + "source": "iana" + }, + "application/vnd.ipld.raw": { + "source": "iana" + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.iso11783-10+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kdl": { + "source": "iana" + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.keyman.kmp+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.keyman.kmx": { + "source": "iana" + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las": { + "source": "iana" + }, + "application/vnd.las.las+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.las.las+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lasxml"] + }, + "application/vnd.laszip": { + "source": "iana" + }, + "application/vnd.ldev.productlicensing": { + "source": "iana" + }, + "application/vnd.leap+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.liberty-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lbe"] + }, + "application/vnd.logipipe.circuit+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.loom": { + "source": "iana" + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana", + "extensions": ["mvt"] + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxar.archive.3tz+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.mdl": { + "source": "iana" + }, + "application/vnd.mdl-mbsdf": { + "source": "iana" + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.medicalholodeck.recordxr": { + "source": "iana" + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mermaid": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.microsoft.windows.thumbnail-cache": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.modl": { + "source": "iana" + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-outlook": { + "compressible": false, + "extensions": ["msg"] + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-visio.viewer": { + "extensions": ["vdx"] + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msgpack": { + "source": "iana" + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.nacamar.ybrid+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nato.bindingdataobject+cbor": { + "source": "iana" + }, + "application/vnd.nato.bindingdataobject+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nato.bindingdataobject+xml": { + "source": "iana", + "compressible": true, + "extensions": ["bdo"] + }, + "application/vnd.nato.openxmlformats-package.iepd+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nebumind.line": { + "source": "iana" + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nimn": { + "source": "iana" + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ac"] + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "apache", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oai.workflows": { + "source": "iana" + }, + "application/vnd.oai.workflows+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oai.workflows+yaml": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.base": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "apache", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-master-template": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.ocf+cbor": { + "source": "iana" + }, + "application/vnd.oci.image.manifest.v1+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+cbor": { + "source": "iana" + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-email+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omads-file+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omads-folder+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.onepagertamp": { + "source": "iana" + }, + "application/vnd.onepagertamx": { + "source": "iana" + }, + "application/vnd.onepagertat": { + "source": "iana" + }, + "application/vnd.onepagertatp": { + "source": "iana" + }, + "application/vnd.onepagertatx": { + "source": "iana" + }, + "application/vnd.onvif.metadata": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana", + "compressible": true, + "extensions": ["obgx"] + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osm"] + }, + "application/vnd.opentimestamps.ots": { + "source": "iana" + }, + "application/vnd.openvpi.dspx+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "iana", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "iana", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "iana", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "iana" + }, + "application/vnd.patentdive": { + "source": "iana" + }, + "application/vnd.patientecommsdoc": { + "source": "iana" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.procrate.brushset": { + "extensions": ["brushset"] + }, + "application/vnd.procreate.brush": { + "extensions": ["brush"] + }, + "application/vnd.procreate.dream": { + "extensions": ["drm"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.psfs": { + "source": "iana" + }, + "application/vnd.pt.mundusmundi": { + "source": "iana" + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtm"] + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana", + "extensions": ["rar"] + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musicxml"] + }, + "application/vnd.relpipe": { + "source": "iana" + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.resilient.logic": { + "source": "iana" + }, + "application/vnd.restful+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "compressible": true, + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sar": { + "source": "iana" + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.seis+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shade-save-file": { + "source": "iana" + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.shootproof+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.shopkick+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.shp": { + "source": "iana" + }, + "application/vnd.shx": { + "source": "iana" + }, + "application/vnd.sigrok.session": { + "source": "iana" + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.sketchometry": { + "source": "iana" + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.smintio.portals.archive": { + "source": "iana" + }, + "application/vnd.snesdev-page-table": { + "source": "iana" + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana", + "compressible": true, + "extensions": ["fo"] + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sqlite3": { + "source": "iana" + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wadl"] + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.sybyl.mol2": { + "source": "iana" + }, + "application/vnd.sycle+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.syft+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["ddf"] + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.think-cell.ppttc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uic.osdm+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uoml","uo"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.veraison.tsm-report+cbor": { + "source": "iana" + }, + "application/vnd.veraison.tsm-report+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.veritone.aion+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.veryant.thin": { + "source": "iana" + }, + "application/vnd.ves.encrypted": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw","vsdx","vtx"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vocalshaper.vsp4": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.wasmflow.wafl": { + "source": "iana" + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.dpp": { + "source": "iana" + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordlift": { + "source": "iana" + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.wv.ssp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xarin.cpj": { + "source": "iana" + }, + "application/vnd.xecrets-encrypted": { + "source": "iana" + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["vxml"] + }, + "application/voucher-cms+json": { + "source": "iana", + "compressible": true + }, + "application/voucher-jws+json": { + "source": "iana", + "compressible": true + }, + "application/vp": { + "source": "iana" + }, + "application/vp+cose": { + "source": "iana" + }, + "application/vp+jwt": { + "source": "iana" + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/wasm": { + "source": "iana", + "compressible": true, + "extensions": ["wasm"] + }, + "application/watcherinfo+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wif"] + }, + "application/webpush-options+json": { + "source": "iana", + "compressible": true + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-arj": { + "compressible": false, + "extensions": ["arj"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blender": { + "extensions": ["blend"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-compressed": { + "extensions": ["rar"] + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "compressible": true, + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-ipynb+json": { + "compressible": true, + "extensions": ["ipynb"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-iwork-keynote-sffkey": { + "extensions": ["key"] + }, + "application/x-iwork-numbers-sffnumbers": { + "extensions": ["numbers"] + }, + "application/x-iwork-pages-sffpages": { + "extensions": ["pages"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-keepass2": { + "extensions": ["kdbx"] + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-pki-message": { + "source": "iana" + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-virtualbox-hdd": { + "compressible": true, + "extensions": ["hdd"] + }, + "application/x-virtualbox-ova": { + "compressible": true, + "extensions": ["ova"] + }, + "application/x-virtualbox-ovf": { + "compressible": true, + "extensions": ["ovf"] + }, + "application/x-virtualbox-vbox": { + "compressible": true, + "extensions": ["vbox"] + }, + "application/x-virtualbox-vbox-extpack": { + "compressible": false, + "extensions": ["vbox-extpack"] + }, + "application/x-virtualbox-vdi": { + "compressible": true, + "extensions": ["vdi"] + }, + "application/x-virtualbox-vhd": { + "compressible": true, + "extensions": ["vhd"] + }, + "application/x-virtualbox-vmdk": { + "compressible": true, + "extensions": ["vmdk"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "iana", + "extensions": ["der","crt","pem"] + }, + "application/x-x509-ca-ra-cert": { + "source": "iana" + }, + "application/x-x509-next-ca-cert": { + "source": "iana" + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zip-compressed": { + "extensions": ["zip"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana", + "compressible": true + }, + "application/xaml+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xav"] + }, + "application/xcap-caps+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xca"] + }, + "application/xcap-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xel"] + }, + "application/xcap-error+xml": { + "source": "iana", + "compressible": true + }, + "application/xcap-ns+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xns"] + }, + "application/xcon-conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/xenc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xenc"] + }, + "application/xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache", + "compressible": true + }, + "application/xliff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xlf"] + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/xmpp+xml": { + "source": "iana", + "compressible": true + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xsl","xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yaml": { + "source": "iana" + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+cbor": { + "source": "iana" + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/yang-sid+json": { + "source": "iana", + "compressible": true + }, + "application/yin+xml": { + "source": "iana", + "compressible": true, + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zip+dotlottie": { + "extensions": ["lottie"] + }, + "application/zlib": { + "source": "iana" + }, + "application/zstd": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/aac": { + "source": "iana", + "extensions": ["adts","aac"] + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana", + "extensions": ["amr"] + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/flac": { + "source": "iana" + }, + "audio/flexfec": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/matroska": { + "source": "iana" + }, + "audio/melp": { + "source": "iana" + }, + "audio/melp1200": { + "source": "iana" + }, + "audio/melp2400": { + "source": "iana" + }, + "audio/melp600": { + "source": "iana" + }, + "audio/mhas": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/midi-clip": { + "source": "iana" + }, + "audio/mobile-xmf": { + "source": "iana", + "extensions": ["mxmf"] + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a","m4b"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx","opus"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/scip": { + "source": "iana" + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sofa": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tetra_acelp": { + "source": "iana" + }, + "audio/tetra_acelp_bb": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/tsvcis": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/usac": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dts.uhd": { + "source": "iana" + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.presonus.multitrack": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "apache" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/collection": { + "source": "iana", + "extensions": ["ttc"] + }, + "font/otf": { + "source": "iana", + "compressible": true, + "extensions": ["otf"] + }, + "font/sfnt": { + "source": "iana" + }, + "font/ttf": { + "source": "iana", + "compressible": true, + "extensions": ["ttf"] + }, + "font/woff": { + "source": "iana", + "extensions": ["woff"] + }, + "font/woff2": { + "source": "iana", + "extensions": ["woff2"] + }, + "image/aces": { + "source": "iana", + "extensions": ["exr"] + }, + "image/apng": { + "source": "iana", + "compressible": false, + "extensions": ["apng"] + }, + "image/avci": { + "source": "iana", + "extensions": ["avci"] + }, + "image/avcs": { + "source": "iana", + "extensions": ["avcs"] + }, + "image/avif": { + "source": "iana", + "compressible": false, + "extensions": ["avif"] + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp","dib"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana", + "extensions": ["drle"] + }, + "image/dpx": { + "source": "iana", + "extensions": ["dpx"] + }, + "image/emf": { + "source": "iana", + "extensions": ["emf"] + }, + "image/fits": { + "source": "iana", + "extensions": ["fits"] + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/heic": { + "source": "iana", + "extensions": ["heic"] + }, + "image/heic-sequence": { + "source": "iana", + "extensions": ["heics"] + }, + "image/heif": { + "source": "iana", + "extensions": ["heif"] + }, + "image/heif-sequence": { + "source": "iana", + "extensions": ["heifs"] + }, + "image/hej2k": { + "source": "iana", + "extensions": ["hej2"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/j2c": { + "source": "iana" + }, + "image/jaii": { + "source": "iana", + "extensions": ["jaii"] + }, + "image/jais": { + "source": "iana", + "extensions": ["jais"] + }, + "image/jls": { + "source": "iana", + "extensions": ["jls"] + }, + "image/jp2": { + "source": "iana", + "compressible": false, + "extensions": ["jp2","jpg2"] + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpg","jpeg","jpe"] + }, + "image/jph": { + "source": "iana", + "extensions": ["jph"] + }, + "image/jphc": { + "source": "iana", + "extensions": ["jhc"] + }, + "image/jpm": { + "source": "iana", + "compressible": false, + "extensions": ["jpm","jpgm"] + }, + "image/jpx": { + "source": "iana", + "compressible": false, + "extensions": ["jpx","jpf"] + }, + "image/jxl": { + "source": "iana", + "extensions": ["jxl"] + }, + "image/jxr": { + "source": "iana", + "extensions": ["jxr"] + }, + "image/jxra": { + "source": "iana", + "extensions": ["jxra"] + }, + "image/jxrs": { + "source": "iana", + "extensions": ["jxrs"] + }, + "image/jxs": { + "source": "iana", + "extensions": ["jxs"] + }, + "image/jxsc": { + "source": "iana", + "extensions": ["jxsc"] + }, + "image/jxsi": { + "source": "iana", + "extensions": ["jxsi"] + }, + "image/jxss": { + "source": "iana", + "extensions": ["jxss"] + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/ktx2": { + "source": "iana", + "extensions": ["ktx2"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false, + "extensions": ["jfif"] + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif","btf"] + }, + "image/prs.pti": { + "source": "iana", + "extensions": ["pti"] + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana", + "extensions": ["t38"] + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tif","tiff"] + }, + "image/tiff-fx": { + "source": "iana", + "extensions": ["tfx"] + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana", + "extensions": ["azv"] + }, + "image/vnd.clip": { + "source": "iana" + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana", + "compressible": true, + "extensions": ["ico"] + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-dds": { + "compressible": true, + "extensions": ["dds"] + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.pco.b16": { + "source": "iana", + "extensions": ["b16"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana", + "extensions": ["tap"] + }, + "image/vnd.valve.source.texture": { + "source": "iana", + "extensions": ["vtf"] + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana", + "extensions": ["pcx"] + }, + "image/webp": { + "source": "iana", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana", + "extensions": ["wmf"] + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-adobe-dng": { + "extensions": ["dng"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-emf": { + "source": "iana" + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-wmf": { + "source": "iana" + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/bhttp": { + "source": "iana" + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana", + "extensions": [ + "disposition-notification" + ] + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana", + "extensions": ["u8msg"] + }, + "message/global-delivery-status": { + "source": "iana", + "extensions": ["u8dsn"] + }, + "message/global-disposition-notification": { + "source": "iana", + "extensions": ["u8mdn"] + }, + "message/global-headers": { + "source": "iana", + "extensions": ["u8hdr"] + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/mls": { + "source": "iana" + }, + "message/news": { + "source": "apache" + }, + "message/ohttp-req": { + "source": "iana" + }, + "message/ohttp-res": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime","mht","mhtml"] + }, + "message/s-http": { + "source": "apache" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "apache" + }, + "message/vnd.wfa.wsc": { + "source": "iana", + "extensions": ["wsc"] + }, + "model/3mf": { + "source": "iana", + "extensions": ["3mf"] + }, + "model/e57": { + "source": "iana" + }, + "model/gltf+json": { + "source": "iana", + "compressible": true, + "extensions": ["gltf"] + }, + "model/gltf-binary": { + "source": "iana", + "compressible": true, + "extensions": ["glb"] + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/jt": { + "source": "iana", + "extensions": ["jt"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/mtl": { + "source": "iana", + "extensions": ["mtl"] + }, + "model/obj": { + "source": "iana", + "extensions": ["obj"] + }, + "model/prc": { + "source": "iana", + "extensions": ["prc"] + }, + "model/step": { + "source": "iana", + "extensions": ["step","stp","stpnc","p21","210"] + }, + "model/step+xml": { + "source": "iana", + "compressible": true, + "extensions": ["stpx"] + }, + "model/step+zip": { + "source": "iana", + "compressible": false, + "extensions": ["stpz"] + }, + "model/step-xml+zip": { + "source": "iana", + "compressible": false, + "extensions": ["stpxz"] + }, + "model/stl": { + "source": "iana", + "extensions": ["stl"] + }, + "model/u3d": { + "source": "iana", + "extensions": ["u3d"] + }, + "model/vnd.bary": { + "source": "iana", + "extensions": ["bary"] + }, + "model/vnd.cld": { + "source": "iana", + "extensions": ["cld"] + }, + "model/vnd.collada+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana", + "compressible": true + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana", + "extensions": ["ogex"] + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana", + "extensions": ["x_b"] + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana", + "extensions": ["x_t"] + }, + "model/vnd.pytha.pyox": { + "source": "iana", + "extensions": ["pyo","pyox"] + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.sap.vds": { + "source": "iana", + "extensions": ["vds"] + }, + "model/vnd.usda": { + "source": "iana", + "extensions": ["usda"] + }, + "model/vnd.usdz+zip": { + "source": "iana", + "compressible": false, + "extensions": ["usdz"] + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana", + "extensions": ["bsp"] + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana", + "extensions": ["x3db"] + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana", + "extensions": ["x3dv"] + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana" + }, + "multipart/multilingual": { + "source": "iana" + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/vnd.bint.med-plus": { + "source": "iana" + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/cql": { + "source": "iana" + }, + "text/cql-expression": { + "source": "iana" + }, + "text/cql-identifier": { + "source": "iana" + }, + "text/css": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "apache" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/fhirpath": { + "source": "iana" + }, + "text/flexfec": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/gff3": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/hl7v2": { + "source": "iana" + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js","mjs"] + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "compressible": true, + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana", + "compressible": true, + "extensions": ["md","markdown"] + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mdx": { + "compressible": true, + "extensions": ["mdx"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana", + "charset": "UTF-8" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana", + "charset": "UTF-8" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/prs.texi": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/shaclc": { + "source": "iana" + }, + "text/shex": { + "source": "iana", + "extensions": ["shex"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/spdx": { + "source": "iana", + "extensions": ["spdx"] + }, + "text/strings": { + "source": "iana" + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.exchangeable": { + "source": "iana" + }, + "text/vnd.familysearch.gedcom": { + "source": "iana", + "extensions": ["ged"] + }, + "text/vnd.ficlab.flt": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.gml": { + "source": "iana" + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.hans": { + "source": "iana" + }, + "text/vnd.hgl": { + "source": "iana" + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.senx.warpscript": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "apache" + }, + "text/vnd.sosi": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.vcf": { + "source": "iana" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vnd.zoo.kcl": { + "source": "iana" + }, + "text/vtt": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/wgsl": { + "source": "iana", + "extensions": ["wgsl"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-org": { + "compressible": true, + "extensions": ["org"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "compressible": true, + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "iana" + }, + "video/3gpp": { + "source": "iana", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "iana" + }, + "video/3gpp2": { + "source": "iana", + "extensions": ["3g2"] + }, + "video/av1": { + "source": "iana" + }, + "video/bmpeg": { + "source": "iana" + }, + "video/bt656": { + "source": "iana" + }, + "video/celb": { + "source": "iana" + }, + "video/dv": { + "source": "iana" + }, + "video/encaprtp": { + "source": "iana" + }, + "video/evc": { + "source": "iana" + }, + "video/ffv1": { + "source": "iana" + }, + "video/flexfec": { + "source": "iana" + }, + "video/h261": { + "source": "iana", + "extensions": ["h261"] + }, + "video/h263": { + "source": "iana", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "iana" + }, + "video/h263-2000": { + "source": "iana" + }, + "video/h264": { + "source": "iana", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "iana" + }, + "video/h264-svc": { + "source": "iana" + }, + "video/h265": { + "source": "iana" + }, + "video/h266": { + "source": "iana" + }, + "video/iso.segment": { + "source": "iana", + "extensions": ["m4s"] + }, + "video/jpeg": { + "source": "iana", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "iana" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/jxsv": { + "source": "iana" + }, + "video/lottie+json": { + "source": "iana", + "compressible": true + }, + "video/matroska": { + "source": "iana" + }, + "video/matroska-3d": { + "source": "iana" + }, + "video/mj2": { + "source": "iana", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "iana" + }, + "video/mp2p": { + "source": "iana" + }, + "video/mp2t": { + "source": "iana", + "extensions": ["ts","m2t","m2ts","mts"] + }, + "video/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "iana" + }, + "video/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "iana" + }, + "video/mpv": { + "source": "iana" + }, + "video/nv": { + "source": "iana" + }, + "video/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "iana" + }, + "video/pointer": { + "source": "iana" + }, + "video/quicktime": { + "source": "iana", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "iana" + }, + "video/raw": { + "source": "iana" + }, + "video/rtp-enc-aescm128": { + "source": "iana" + }, + "video/rtploopback": { + "source": "iana" + }, + "video/rtx": { + "source": "iana" + }, + "video/scip": { + "source": "iana" + }, + "video/smpte291": { + "source": "iana" + }, + "video/smpte292m": { + "source": "iana" + }, + "video/ulpfec": { + "source": "iana" + }, + "video/vc1": { + "source": "iana" + }, + "video/vc2": { + "source": "iana" + }, + "video/vnd.cctv": { + "source": "iana" + }, + "video/vnd.dece.hd": { + "source": "iana", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "iana", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "iana" + }, + "video/vnd.dece.pd": { + "source": "iana", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "iana", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "iana", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "iana" + }, + "video/vnd.directv.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dvb.file": { + "source": "iana", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "iana", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "iana" + }, + "video/vnd.motorola.video": { + "source": "iana" + }, + "video/vnd.motorola.videop": { + "source": "iana" + }, + "video/vnd.mpegurl": { + "source": "iana", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "iana", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "iana" + }, + "video/vnd.nokia.mp4vr": { + "source": "iana" + }, + "video/vnd.nokia.videovoip": { + "source": "iana" + }, + "video/vnd.objectvideo": { + "source": "iana" + }, + "video/vnd.planar": { + "source": "iana" + }, + "video/vnd.radgamettools.bink": { + "source": "iana" + }, + "video/vnd.radgamettools.smacker": { + "source": "apache" + }, + "video/vnd.sealed.mpeg1": { + "source": "iana" + }, + "video/vnd.sealed.mpeg4": { + "source": "iana" + }, + "video/vnd.sealed.swf": { + "source": "iana" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "iana" + }, + "video/vnd.uvvu.mp4": { + "source": "iana", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "iana", + "extensions": ["viv"] + }, + "video/vnd.youtube.yt": { + "source": "iana" + }, + "video/vp8": { + "source": "iana" + }, + "video/vp9": { + "source": "iana" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/node_modules/mime-db/index.js b/node_modules/mime-db/index.js new file mode 100644 index 0000000..ec2be30 --- /dev/null +++ b/node_modules/mime-db/index.js @@ -0,0 +1,12 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/node_modules/mime-db/package.json b/node_modules/mime-db/package.json new file mode 100644 index 0000000..289a370 --- /dev/null +++ b/node_modules/mime-db/package.json @@ -0,0 +1,56 @@ +{ + "name": "mime-db", + "description": "Media Type Database", + "version": "1.54.0", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)", + "Robert Kieffer (http://github.com/broofa)" + ], + "license": "MIT", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "repository": "jshttp/mime-db", + "devDependencies": { + "csv-parse": "4.16.3", + "eslint": "8.32.0", + "eslint-config-standard": "15.0.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "media-typer": "1.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0", + "stream-to-array": "2.3.0", + "undici": "7.1.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "node scripts/fetch-apache && node scripts/fetch-iana && node scripts/fetch-nginx", + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update": "npm run fetch && npm run build", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/mime-types/HISTORY.md b/node_modules/mime-types/HISTORY.md new file mode 100644 index 0000000..18473e4 --- /dev/null +++ b/node_modules/mime-types/HISTORY.md @@ -0,0 +1,421 @@ +3.0.1 / 2025-03-26 +=================== + +* deps: mime-db@1.54.0 + +3.0.0 / 2024-08-31 +=================== + +* Drop support for node <18 +* deps: mime-db@1.53.0 +* resolve extension conflicts with mime-score (#119) + * asc -> application/pgp-signature is now application/pgp-keys + * mpp -> application/vnd.ms-project is now application/dash-patch+xml + * ac -> application/vnd.nokia.n-gage.ac+xml is now application/pkix-attr-cert + * bdoc -> application/x-bdoc is now application/bdoc + * wmz -> application/x-msmetafile is now application/x-ms-wmz + * xsl -> application/xslt+xml is now application/xml + * wav -> audio/wave is now audio/wav + * rtf -> text/rtf is now application/rtf + * xml -> text/xml is now application/xml + * mp4 -> video/mp4 is now application/mp4 + * mpg4 -> video/mp4 is now application/mp4 + + +2.1.35 / 2022-03-12 +=================== + + * deps: mime-db@1.52.0 + - Add extensions from IANA for more `image/*` types + - Add extension `.asc` to `application/pgp-keys` + - Add extensions to various XML types + - Add new upstream MIME types + +2.1.34 / 2021-11-08 +=================== + + * deps: mime-db@1.51.0 + - Add new upstream MIME types + +2.1.33 / 2021-10-01 +=================== + + * deps: mime-db@1.50.0 + - Add deprecated iWorks mime types and extensions + - Add new upstream MIME types + +2.1.32 / 2021-07-27 +=================== + + * deps: mime-db@1.49.0 + - Add extension `.trig` to `application/trig` + - Add new upstream MIME types + +2.1.31 / 2021-06-01 +=================== + + * deps: mime-db@1.48.0 + - Add extension `.mvt` to `application/vnd.mapbox-vector-tile` + - Add new upstream MIME types + +2.1.30 / 2021-04-02 +=================== + + * deps: mime-db@1.47.0 + - Add extension `.amr` to `audio/amr` + - Remove ambigious extensions from IANA for `application/*+xml` types + - Update primary extension to `.es` for `application/ecmascript` + +2.1.29 / 2021-02-17 +=================== + + * deps: mime-db@1.46.0 + - Add extension `.amr` to `audio/amr` + - Add extension `.m4s` to `video/iso.segment` + - Add extension `.opus` to `audio/ogg` + - Add new upstream MIME types + +2.1.28 / 2021-01-01 +=================== + + * deps: mime-db@1.45.0 + - Add `application/ubjson` with extension `.ubj` + - Add `image/avif` with extension `.avif` + - Add `image/ktx2` with extension `.ktx2` + - Add extension `.dbf` to `application/vnd.dbf` + - Add extension `.rar` to `application/vnd.rar` + - Add extension `.td` to `application/urc-targetdesc+xml` + - Add new upstream MIME types + - Fix extension of `application/vnd.apple.keynote` to be `.key` + +2.1.27 / 2020-04-23 +=================== + + * deps: mime-db@1.44.0 + - Add charsets from IANA + - Add extension `.cjs` to `application/node` + - Add new upstream MIME types + +2.1.26 / 2020-01-05 +=================== + + * deps: mime-db@1.43.0 + - Add `application/x-keepass2` with extension `.kdbx` + - Add extension `.mxmf` to `audio/mobile-xmf` + - Add extensions from IANA for `application/*+xml` types + - Add new upstream MIME types + +2.1.25 / 2019-11-12 +=================== + + * deps: mime-db@1.42.0 + - Add new upstream MIME types + - Add `application/toml` with extension `.toml` + - Add `image/vnd.ms-dds` with extension `.dds` + +2.1.24 / 2019-04-20 +=================== + + * deps: mime-db@1.40.0 + - Add extensions from IANA for `model/*` types + - Add `text/mdx` with extension `.mdx` + +2.1.23 / 2019-04-17 +=================== + + * deps: mime-db@~1.39.0 + - Add extensions `.siv` and `.sieve` to `application/sieve` + - Add new upstream MIME types + +2.1.22 / 2019-02-14 +=================== + + * deps: mime-db@~1.38.0 + - Add extension `.nq` to `application/n-quads` + - Add extension `.nt` to `application/n-triples` + - Add new upstream MIME types + +2.1.21 / 2018-10-19 +=================== + + * deps: mime-db@~1.37.0 + - Add extensions to HEIC image types + - Add new upstream MIME types + +2.1.20 / 2018-08-26 +=================== + + * deps: mime-db@~1.36.0 + - Add Apple file extensions from IANA + - Add extensions from IANA for `image/*` types + - Add new upstream MIME types + +2.1.19 / 2018-07-17 +=================== + + * deps: mime-db@~1.35.0 + - Add extension `.csl` to `application/vnd.citationstyles.style+xml` + - Add extension `.es` to `application/ecmascript` + - Add extension `.owl` to `application/rdf+xml` + - Add new upstream MIME types + - Add UTF-8 as default charset for `text/turtle` + +2.1.18 / 2018-02-16 +=================== + + * deps: mime-db@~1.33.0 + - Add `application/raml+yaml` with extension `.raml` + - Add `application/wasm` with extension `.wasm` + - Add `text/shex` with extension `.shex` + - Add extensions for JPEG-2000 images + - Add extensions from IANA for `message/*` types + - Add new upstream MIME types + - Update font MIME types + - Update `text/hjson` to registered `application/hjson` + +2.1.17 / 2017-09-01 +=================== + + * deps: mime-db@~1.30.0 + - Add `application/vnd.ms-outlook` + - Add `application/x-arj` + - Add extension `.mjs` to `application/javascript` + - Add glTF types and extensions + - Add new upstream MIME types + - Add `text/x-org` + - Add VirtualBox MIME types + - Fix `source` records for `video/*` types that are IANA + - Update `font/opentype` to registered `font/otf` + +2.1.16 / 2017-07-24 +=================== + + * deps: mime-db@~1.29.0 + - Add `application/fido.trusted-apps+json` + - Add extension `.wadl` to `application/vnd.sun.wadl+xml` + - Add extension `.gz` to `application/gzip` + - Add new upstream MIME types + - Update extensions `.md` and `.markdown` to be `text/markdown` + +2.1.15 / 2017-03-23 +=================== + + * deps: mime-db@~1.27.0 + - Add new mime types + - Add `image/apng` + +2.1.14 / 2017-01-14 +=================== + + * deps: mime-db@~1.26.0 + - Add new mime types + +2.1.13 / 2016-11-18 +=================== + + * deps: mime-db@~1.25.0 + - Add new mime types + +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + +2.1.11 / 2016-05-01 +=================== + + * deps: mime-db@~1.23.0 + - Add new mime types + +2.1.10 / 2016-02-15 +=================== + + * deps: mime-db@~1.22.0 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +2.1.9 / 2016-01-06 +================== + + * deps: mime-db@~1.21.0 + - Add new mime types + +2.1.8 / 2015-11-30 +================== + + * deps: mime-db@~1.20.0 + - Add new mime types + +2.1.7 / 2015-09-20 +================== + + * deps: mime-db@~1.19.0 + - Add new mime types + +2.1.6 / 2015-09-03 +================== + + * deps: mime-db@~1.18.0 + - Add new mime types + +2.1.5 / 2015-08-20 +================== + + * deps: mime-db@~1.17.0 + - Add new mime types + +2.1.4 / 2015-07-30 +================== + + * deps: mime-db@~1.16.0 + - Add new mime types + +2.1.3 / 2015-07-13 +================== + + * deps: mime-db@~1.15.0 + - Add new mime types + +2.1.2 / 2015-06-25 +================== + + * deps: mime-db@~1.14.0 + - Add new mime types + +2.1.1 / 2015-06-08 +================== + + * perf: fix deopt during mapping + +2.1.0 / 2015-06-07 +================== + + * Fix incorrectly treating extension-less file name as extension + - i.e. `'path/to/json'` will no longer return `application/json` + * Fix `.charset(type)` to accept parameters + * Fix `.charset(type)` to match case-insensitive + * Improve generation of extension to MIME mapping + * Refactor internals for readability and no argument reassignment + * Prefer `application/*` MIME types from the same source + * Prefer any type over `application/octet-stream` + * deps: mime-db@~1.13.0 + - Add nginx as a source + - Add new mime types + +2.0.14 / 2015-06-06 +=================== + + * deps: mime-db@~1.12.0 + - Add new mime types + +2.0.13 / 2015-05-31 +=================== + + * deps: mime-db@~1.11.0 + - Add new mime types + +2.0.12 / 2015-05-19 +=================== + + * deps: mime-db@~1.10.0 + - Add new mime types + +2.0.11 / 2015-05-05 +=================== + + * deps: mime-db@~1.9.1 + - Add new mime types + +2.0.10 / 2015-03-13 +=================== + + * deps: mime-db@~1.8.0 + - Add new mime types + +2.0.9 / 2015-02-09 +================== + + * deps: mime-db@~1.7.0 + - Add new mime types + - Community extensions ownership transferred from `node-mime` + +2.0.8 / 2015-01-29 +================== + + * deps: mime-db@~1.6.0 + - Add new mime types + +2.0.7 / 2014-12-30 +================== + + * deps: mime-db@~1.5.0 + - Add new mime types + - Fix various invalid MIME type entries + +2.0.6 / 2014-12-30 +================== + + * deps: mime-db@~1.4.0 + - Add new mime types + - Fix various invalid MIME type entries + - Remove example template MIME types + +2.0.5 / 2014-12-29 +================== + + * deps: mime-db@~1.3.1 + - Fix missing extensions + +2.0.4 / 2014-12-10 +================== + + * deps: mime-db@~1.3.0 + - Add new mime types + +2.0.3 / 2014-11-09 +================== + + * deps: mime-db@~1.2.0 + - Add new mime types + +2.0.2 / 2014-09-28 +================== + + * deps: mime-db@~1.1.0 + - Add new mime types + - Update charsets + +2.0.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + +2.0.0 / 2014-09-02 +================== + + * Use `mime-db` + * Remove `.define()` + +1.0.2 / 2014-08-04 +================== + + * Set charset=utf-8 for `text/javascript` + +1.0.1 / 2014-06-24 +================== + + * Add `text/jsx` type + +1.0.0 / 2014-05-12 +================== + + * Return `false` for unknown types + * Set charset=utf-8 for `application/json` + +0.1.0 / 2014-05-02 +================== + + * Initial release diff --git a/node_modules/mime-types/LICENSE b/node_modules/mime-types/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/mime-types/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mime-types/README.md b/node_modules/mime-types/README.md new file mode 100644 index 0000000..222d2b5 --- /dev/null +++ b/node_modules/mime-types/README.md @@ -0,0 +1,126 @@ +# mime-types + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +The ultimate javascript content-type utility. + +Similar to [the `mime@1.x` module](https://www.npmjs.com/package/mime), except: + +- __No fallbacks.__ Instead of naively returning the first available type, + `mime-types` simply returns `false`, so do + `var type = mime.lookup('unrecognized') || 'application/octet-stream'`. +- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`. +- No `.define()` functionality +- Bug fixes for `.lookup(path)` + +Otherwise, the API is compatible with `mime` 1.x. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install mime-types +``` + +## Note on MIME Type Data and Semver + +This package considers the programmatic api as the semver compatibility. Additionally, the package which provides the MIME data +for this package (`mime-db`) *also* considers it's programmatic api as the semver contract. This means the MIME type resolution is *not* considered +in the semver bumps. + +In the past the version of `mime-db` was pinned to give two decision points when adopting MIME data changes. This is no longer true. We still update the +`mime-db` package here as a `minor` release when necessary, but will use a `^` range going forward. This means that if you want to pin your `mime-db` data +you will need to do it in your application. While this expectation was not set in docs until now, it is how the pacakge operated, so we do not feel this is +a breaking change. + +If you wish to pin your `mime-db` version you can do that with overrides via your package manager of choice. See their documentation for how to correctly configure that. + +## Adding Types + +All mime types are based on [mime-db](https://www.npmjs.com/package/mime-db), +so open a PR there if you'd like to add mime types. + +## API + +```js +var mime = require('mime-types') +``` + +All functions return `false` if input is invalid or not found. + +### mime.lookup(path) + +Lookup the content-type associated with a file. + +```js +mime.lookup('json') // 'application/json' +mime.lookup('.md') // 'text/markdown' +mime.lookup('file.html') // 'text/html' +mime.lookup('folder/file.js') // 'application/javascript' +mime.lookup('folder/.htaccess') // false + +mime.lookup('cats') // false +``` + +### mime.contentType(type) + +Create a full content-type header given a content-type or extension. +When given an extension, `mime.lookup` is used to get the matching +content-type, otherwise the given content-type is used. Then if the +content-type does not already have a `charset` parameter, `mime.charset` +is used to get the default charset and add to the returned content-type. + +```js +mime.contentType('markdown') // 'text/x-markdown; charset=utf-8' +mime.contentType('file.json') // 'application/json; charset=utf-8' +mime.contentType('text/html') // 'text/html; charset=utf-8' +mime.contentType('text/html; charset=iso-8859-1') // 'text/html; charset=iso-8859-1' + +// from a full path +mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8' +``` + +### mime.extension(type) + +Get the default extension for a content-type. + +```js +mime.extension('application/octet-stream') // 'bin' +``` + +### mime.charset(type) + +Lookup the implied default charset of a content-type. + +```js +mime.charset('text/markdown') // 'UTF-8' +``` + +### var type = mime.types[extension] + +A map of content-types by extension. + +### [extensions...] = mime.extensions[type] + +A map of extensions by content-type. + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/mime-types/master?label=ci +[ci-url]: https://github.com/jshttp/mime-types/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-types/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-types?branch=master +[node-version-image]: https://badgen.net/npm/node/mime-types +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-types +[npm-url]: https://npmjs.org/package/mime-types +[npm-version-image]: https://badgen.net/npm/v/mime-types diff --git a/node_modules/mime-types/index.js b/node_modules/mime-types/index.js new file mode 100644 index 0000000..c348cb6 --- /dev/null +++ b/node_modules/mime-types/index.js @@ -0,0 +1,211 @@ +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') +var extname = require('path').extname +var mimeScore = require('./mimeScore') + +/** + * Module variables. + * @private + */ + +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ +var TEXT_TYPE_REGEXP = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) +exports._extensionConflicts = [] + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && TEXT_TYPE_REGEXP.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 ? exports.lookup(str) : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .slice(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + types[extension] = _preferredType(extension, types[extension], type) + + // DELETE (eventually): Capture extension->type maps that change as a + // result of switching to mime-score. This is just to help make reviewing + // PR #119 easier, and can be removed once that PR is approved. + const legacyType = _preferredTypeLegacy( + extension, + types[extension], + type + ) + if (legacyType !== types[extension]) { + exports._extensionConflicts.push([extension, legacyType, types[extension]]) + } + } + }) +} + +// Resolve type conflict using mime-score +function _preferredType (ext, type0, type1) { + var score0 = type0 ? mimeScore(type0, db[type0].source) : 0 + var score1 = type1 ? mimeScore(type1, db[type1].source) : 0 + + return score0 > score1 ? type0 : type1 +} + +// Resolve type conflict using pre-mime-score logic +function _preferredTypeLegacy (ext, type0, type1) { + var SOURCE_RANK = ['nginx', 'apache', undefined, 'iana'] + + var score0 = type0 ? SOURCE_RANK.indexOf(db[type0].source) : 0 + var score1 = type1 ? SOURCE_RANK.indexOf(db[type1].source) : 0 + + if ( + exports.types[extension] !== 'application/octet-stream' && + (score0 > score1 || + (score0 === score1 && + exports.types[extension]?.slice(0, 12) === 'application/')) + ) { + return type0 + } + + return score0 > score1 ? type0 : type1 +} diff --git a/node_modules/mime-types/mimeScore.js b/node_modules/mime-types/mimeScore.js new file mode 100644 index 0000000..e2ecc66 --- /dev/null +++ b/node_modules/mime-types/mimeScore.js @@ -0,0 +1,52 @@ +// 'mime-score' back-ported to CommonJS + +// Score RFC facets (see https://tools.ietf.org/html/rfc6838#section-3) +var FACET_SCORES = { + 'prs.': 100, + 'x-': 200, + 'x.': 300, + 'vnd.': 400, + default: 900 +} + +// Score mime source (Logic originally from `jshttp/mime-types` module) +var SOURCE_SCORES = { + nginx: 10, + apache: 20, + iana: 40, + default: 30 // definitions added by `jshttp/mime-db` project? +} + +var TYPE_SCORES = { + // prefer application/xml over text/xml + // prefer application/rtf over text/rtf + application: 1, + + // prefer font/woff over application/font-woff + font: 2, + + default: 0 +} + +/** + * Get each component of the score for a mime type. The sum of these is the + * total score. The higher the score, the more "official" the type. + */ +module.exports = function mimeScore (mimeType, source = 'default') { + if (mimeType === 'application/octet-stream') { + return 0 + } + + const [type, subtype] = mimeType.split('/') + + const facet = subtype.replace(/(\.|x-).*/, '$1') + + const facetScore = FACET_SCORES[facet] || FACET_SCORES.default + const sourceScore = SOURCE_SCORES[source] || SOURCE_SCORES.default + const typeScore = TYPE_SCORES[type] || TYPE_SCORES.default + + // All else being equal prefer shorter types + const lengthScore = 1 - mimeType.length / 100 + + return facetScore + sourceScore + typeScore + lengthScore +} diff --git a/node_modules/mime-types/package.json b/node_modules/mime-types/package.json new file mode 100644 index 0000000..79481ae --- /dev/null +++ b/node_modules/mime-types/package.json @@ -0,0 +1,45 @@ +{ + "name": "mime-types", + "description": "The ultimate javascript content-type utility.", + "version": "3.0.1", + "contributors": [ + "Douglas Christopher Wilson ", + "Jeremiah Senkpiel (https://searchbeam.jit.su)", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "keywords": [ + "mime", + "types" + ], + "repository": "jshttp/mime-types", + "dependencies": { + "mime-db": "^1.54.0" + }, + "devDependencies": { + "eslint": "8.33.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.27.5", + "eslint-plugin-markdown": "3.0.0", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "6.1.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "10.2.0", + "nyc": "15.1.0" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js", + "mimeScore.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec test/test.js", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/node_modules/ms/index.js b/node_modules/ms/index.js new file mode 100644 index 0000000..6a522b1 --- /dev/null +++ b/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ms/license.md b/node_modules/ms/license.md new file mode 100644 index 0000000..69b6125 --- /dev/null +++ b/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ms/package.json b/node_modules/ms/package.json new file mode 100644 index 0000000..6a31c81 --- /dev/null +++ b/node_modules/ms/package.json @@ -0,0 +1,37 @@ +{ + "name": "ms", + "version": "2.0.0", + "description": "Tiny milisecond conversion utility", + "repository": "zeit/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + } +} diff --git a/node_modules/ms/readme.md b/node_modules/ms/readme.md new file mode 100644 index 0000000..84a9974 --- /dev/null +++ b/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Slack Channel](http://zeit-slackin.now.sh/badge.svg)](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/on-finished/HISTORY.md b/node_modules/on-finished/HISTORY.md new file mode 100644 index 0000000..98ff0e9 --- /dev/null +++ b/node_modules/on-finished/HISTORY.md @@ -0,0 +1,88 @@ +2.3.0 / 2015-05-26 +================== + + * Add defined behavior for HTTP `CONNECT` requests + * Add defined behavior for HTTP `Upgrade` requests + * deps: ee-first@1.1.1 + +2.2.1 / 2015-04-22 +================== + + * Fix `isFinished(req)` when data buffered + +2.2.0 / 2014-12-22 +================== + + * Add message object to callback arguments + +2.1.1 / 2014-10-22 +================== + + * Fix handling of pipelined requests + +2.1.0 / 2014-08-16 +================== + + * Check if `socket` is detached + * Return `undefined` for `isFinished` if state unknown + +2.0.0 / 2014-08-16 +================== + + * Add `isFinished` function + * Move to `jshttp` organization + * Remove support for plain socket argument + * Rename to `on-finished` + * Support both `req` and `res` as arguments + * deps: ee-first@1.0.5 + +1.2.2 / 2014-06-10 +================== + + * Reduce listeners added to emitters + - avoids "event emitter leak" warnings when used multiple times on same request + +1.2.1 / 2014-06-08 +================== + + * Fix returned value when already finished + +1.2.0 / 2014-06-05 +================== + + * Call callback when called on already-finished socket + +1.1.4 / 2014-05-27 +================== + + * Support node.js 0.8 + +1.1.3 / 2014-04-30 +================== + + * Make sure errors passed as instanceof `Error` + +1.1.2 / 2014-04-18 +================== + + * Default the `socket` to passed-in object + +1.1.1 / 2014-01-16 +================== + + * Rename module to `finished` + +1.1.0 / 2013-12-25 +================== + + * Call callback when called on already-errored socket + +1.0.1 / 2013-12-20 +================== + + * Actually pass the error to the callback + +1.0.0 / 2013-12-20 +================== + + * Initial release diff --git a/node_modules/on-finished/LICENSE b/node_modules/on-finished/LICENSE new file mode 100644 index 0000000..5931fd2 --- /dev/null +++ b/node_modules/on-finished/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/on-finished/README.md b/node_modules/on-finished/README.md new file mode 100644 index 0000000..a0e1157 --- /dev/null +++ b/node_modules/on-finished/README.md @@ -0,0 +1,154 @@ +# on-finished + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a callback when a HTTP request closes, finishes, or errors. + +## Install + +```sh +$ npm install on-finished +``` + +## API + +```js +var onFinished = require('on-finished') +``` + +### onFinished(res, listener) + +Attach a listener to listen for the response to finish. The listener will +be invoked only once when the response finished. If the response finished +to an error, the first argument will contain the error. If the response +has already finished, the listener will be invoked. + +Listening to the end of a response would be used to close things associated +with the response, like open files. + +Listener is invoked as `listener(err, res)`. + +```js +onFinished(res, function (err, res) { + // clean up open fds, etc. + // err contains the error is request error'd +}) +``` + +### onFinished(req, listener) + +Attach a listener to listen for the request to finish. The listener will +be invoked only once when the request finished. If the request finished +to an error, the first argument will contain the error. If the request +has already finished, the listener will be invoked. + +Listening to the end of a request would be used to know when to continue +after reading the data. + +Listener is invoked as `listener(err, req)`. + +```js +var data = '' + +req.setEncoding('utf8') +res.on('data', function (str) { + data += str +}) + +onFinished(req, function (err, req) { + // data is read unless there is err +}) +``` + +### onFinished.isFinished(res) + +Determine if `res` is already finished. This would be useful to check and +not even start certain operations if the response has already finished. + +### onFinished.isFinished(req) + +Determine if `req` is already finished. This would be useful to check and +not even start certain operations if the request has already finished. + +## Special Node.js requests + +### HTTP CONNECT method + +The meaning of the `CONNECT` method from RFC 7231, section 4.3.6: + +> The CONNECT method requests that the recipient establish a tunnel to +> the destination origin server identified by the request-target and, +> if successful, thereafter restrict its behavior to blind forwarding +> of packets, in both directions, until the tunnel is closed. Tunnels +> are commonly used to create an end-to-end virtual connection, through +> one or more proxies, which can then be secured using TLS (Transport +> Layer Security, [RFC5246]). + +In Node.js, these request objects come from the `'connect'` event on +the HTTP server. + +When this module is used on a HTTP `CONNECT` request, the request is +considered "finished" immediately, **due to limitations in the Node.js +interface**. This means if the `CONNECT` request contains a request entity, +the request will be considered "finished" even before it has been read. + +There is no such thing as a response object to a `CONNECT` request in +Node.js, so there is no support for for one. + +### HTTP Upgrade request + +The meaning of the `Upgrade` header from RFC 7230, section 6.1: + +> The "Upgrade" header field is intended to provide a simple mechanism +> for transitioning from HTTP/1.1 to some other protocol on the same +> connection. + +In Node.js, these request objects come from the `'upgrade'` event on +the HTTP server. + +When this module is used on a HTTP request with an `Upgrade` header, the +request is considered "finished" immediately, **due to limitations in the +Node.js interface**. This means if the `Upgrade` request contains a request +entity, the request will be considered "finished" even before it has been +read. + +There is no such thing as a response object to a `Upgrade` request in +Node.js, so there is no support for for one. + +## Example + +The following code ensures that file descriptors are always closed +once the response finishes. + +```js +var destroy = require('destroy') +var http = require('http') +var onFinished = require('on-finished') + +http.createServer(function onRequest(req, res) { + var stream = fs.createReadStream('package.json') + stream.pipe(res) + onFinished(res, function (err) { + destroy(stream) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/on-finished.svg +[npm-url]: https://npmjs.org/package/on-finished +[node-version-image]: https://img.shields.io/node/v/on-finished.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/jshttp/on-finished/master.svg +[travis-url]: https://travis-ci.org/jshttp/on-finished +[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master +[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg +[downloads-url]: https://npmjs.org/package/on-finished diff --git a/node_modules/on-finished/index.js b/node_modules/on-finished/index.js new file mode 100644 index 0000000..9abd98f --- /dev/null +++ b/node_modules/on-finished/index.js @@ -0,0 +1,196 @@ +/*! + * on-finished + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onFinished +module.exports.isFinished = isFinished + +/** + * Module dependencies. + * @private + */ + +var first = require('ee-first') + +/** + * Variables. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Invoke callback when the response has finished, useful for + * cleaning up resources afterwards. + * + * @param {object} msg + * @param {function} listener + * @return {object} + * @public + */ + +function onFinished(msg, listener) { + if (isFinished(msg) !== false) { + defer(listener, null, msg) + return msg + } + + // attach the listener to the message + attachListener(msg, listener) + + return msg +} + +/** + * Determine if message is already finished. + * + * @param {object} msg + * @return {boolean} + * @public + */ + +function isFinished(msg) { + var socket = msg.socket + + if (typeof msg.finished === 'boolean') { + // OutgoingMessage + return Boolean(msg.finished || (socket && !socket.writable)) + } + + if (typeof msg.complete === 'boolean') { + // IncomingMessage + return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable)) + } + + // don't know + return undefined +} + +/** + * Attach a finished listener to the message. + * + * @param {object} msg + * @param {function} callback + * @private + */ + +function attachFinishedListener(msg, callback) { + var eeMsg + var eeSocket + var finished = false + + function onFinish(error) { + eeMsg.cancel() + eeSocket.cancel() + + finished = true + callback(error) + } + + // finished on first message event + eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish) + + function onSocket(socket) { + // remove listener + msg.removeListener('socket', onSocket) + + if (finished) return + if (eeMsg !== eeSocket) return + + // finished on first socket event + eeSocket = first([[socket, 'error', 'close']], onFinish) + } + + if (msg.socket) { + // socket already assigned + onSocket(msg.socket) + return + } + + // wait for socket to be assigned + msg.on('socket', onSocket) + + if (msg.socket === undefined) { + // node.js 0.8 patch + patchAssignSocket(msg, onSocket) + } +} + +/** + * Attach the listener to the message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function attachListener(msg, listener) { + var attached = msg.__onFinished + + // create a private single listener with queue + if (!attached || !attached.queue) { + attached = msg.__onFinished = createListener(msg) + attachFinishedListener(msg, attached) + } + + attached.queue.push(listener) +} + +/** + * Create listener on message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function createListener(msg) { + function listener(err) { + if (msg.__onFinished === listener) msg.__onFinished = null + if (!listener.queue) return + + var queue = listener.queue + listener.queue = null + + for (var i = 0; i < queue.length; i++) { + queue[i](err, msg) + } + } + + listener.queue = [] + + return listener +} + +/** + * Patch ServerResponse.prototype.assignSocket for node.js 0.8. + * + * @param {ServerResponse} res + * @param {function} callback + * @private + */ + +function patchAssignSocket(res, callback) { + var assignSocket = res.assignSocket + + if (typeof assignSocket !== 'function') return + + // res.on('socket', callback) is broken in 0.8 + res.assignSocket = function _assignSocket(socket) { + assignSocket.call(this, socket) + callback(socket) + } +} diff --git a/node_modules/on-finished/package.json b/node_modules/on-finished/package.json new file mode 100644 index 0000000..b9df1bd --- /dev/null +++ b/node_modules/on-finished/package.json @@ -0,0 +1,31 @@ +{ + "name": "on-finished", + "description": "Execute a callback when a request closes, finishes, or errors", + "version": "2.3.0", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/on-finished", + "dependencies": { + "ee-first": "1.1.1" + }, + "devDependencies": { + "istanbul": "0.3.9", + "mocha": "2.2.5" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/parseurl/HISTORY.md b/node_modules/parseurl/HISTORY.md new file mode 100644 index 0000000..8e40954 --- /dev/null +++ b/node_modules/parseurl/HISTORY.md @@ -0,0 +1,58 @@ +1.3.3 / 2019-04-15 +================== + + * Fix Node.js 0.8 return value inconsistencies + +1.3.2 / 2017-09-09 +================== + + * perf: reduce overhead for full URLs + * perf: unroll the "fast-path" `RegExp` + +1.3.1 / 2016-01-17 +================== + + * perf: enable strict mode + +1.3.0 / 2014-08-09 +================== + + * Add `parseurl.original` for parsing `req.originalUrl` with fallback + * Return `undefined` if `req.url` is `undefined` + +1.2.0 / 2014-07-21 +================== + + * Cache URLs based on original value + * Remove no-longer-needed URL mis-parse work-around + * Simplify the "fast-path" `RegExp` + +1.1.3 / 2014-07-08 +================== + + * Fix typo + +1.1.2 / 2014-07-08 +================== + + * Seriously fix Node.js 0.8 compatibility + +1.1.1 / 2014-07-08 +================== + + * Fix Node.js 0.8 compatibility + +1.1.0 / 2014-07-08 +================== + + * Incorporate URL href-only parse fast-path + +1.0.1 / 2014-03-08 +================== + + * Add missing `require` + +1.0.0 / 2014-03-08 +================== + + * Genesis from `connect` diff --git a/node_modules/parseurl/LICENSE b/node_modules/parseurl/LICENSE new file mode 100644 index 0000000..27653d3 --- /dev/null +++ b/node_modules/parseurl/LICENSE @@ -0,0 +1,24 @@ + +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/parseurl/README.md b/node_modules/parseurl/README.md new file mode 100644 index 0000000..443e716 --- /dev/null +++ b/node_modules/parseurl/README.md @@ -0,0 +1,133 @@ +# parseurl + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Parse a URL with memoization. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install parseurl +``` + +## API + +```js +var parseurl = require('parseurl') +``` + +### parseurl(req) + +Parse the URL of the given request object (looks at the `req.url` property) +and return the result. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.url` does +not change will return a cached parsed object, rather than parsing again. + +### parseurl.original(req) + +Parse the original URL of the given request object and return the result. +This works by trying to parse `req.originalUrl` if it is a string, otherwise +parses `req.url`. The result is the same as `url.parse` in Node.js core. +Calling this function multiple times on the same `req` where `req.originalUrl` +does not change will return a cached parsed object, rather than parsing again. + +## Benchmark + +```bash +$ npm run-script bench + +> parseurl@1.3.3 bench nodejs-parseurl +> node benchmark/index.js + + http_parser@2.8.0 + node@10.6.0 + v8@6.7.288.46-node.13 + uv@1.21.0 + zlib@1.2.11 + ares@1.14.0 + modules@64 + nghttp2@1.32.0 + napi@3 + openssl@1.1.0h + icu@61.1 + unicode@10.0 + cldr@33.0 + tz@2018c + +> node benchmark/fullurl.js + + Parsing URL "http://localhost:8888/foo/bar?user=tj&pet=fluffy" + + 4 tests completed. + + fasturl x 2,207,842 ops/sec ยฑ3.76% (184 runs sampled) + nativeurl - legacy x 507,180 ops/sec ยฑ0.82% (191 runs sampled) + nativeurl - whatwg x 290,044 ops/sec ยฑ1.96% (189 runs sampled) + parseurl x 488,907 ops/sec ยฑ2.13% (192 runs sampled) + +> node benchmark/pathquery.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" + + 4 tests completed. + + fasturl x 3,812,564 ops/sec ยฑ3.15% (188 runs sampled) + nativeurl - legacy x 2,651,631 ops/sec ยฑ1.68% (189 runs sampled) + nativeurl - whatwg x 161,837 ops/sec ยฑ2.26% (189 runs sampled) + parseurl x 4,166,338 ops/sec ยฑ2.23% (184 runs sampled) + +> node benchmark/samerequest.js + + Parsing URL "/foo/bar?user=tj&pet=fluffy" on same request object + + 4 tests completed. + + fasturl x 3,821,651 ops/sec ยฑ2.42% (185 runs sampled) + nativeurl - legacy x 2,651,162 ops/sec ยฑ1.90% (187 runs sampled) + nativeurl - whatwg x 175,166 ops/sec ยฑ1.44% (188 runs sampled) + parseurl x 14,912,606 ops/sec ยฑ3.59% (183 runs sampled) + +> node benchmark/simplepath.js + + Parsing URL "/foo/bar" + + 4 tests completed. + + fasturl x 12,421,765 ops/sec ยฑ2.04% (191 runs sampled) + nativeurl - legacy x 7,546,036 ops/sec ยฑ1.41% (188 runs sampled) + nativeurl - whatwg x 198,843 ops/sec ยฑ1.83% (189 runs sampled) + parseurl x 24,244,006 ops/sec ยฑ0.51% (194 runs sampled) + +> node benchmark/slash.js + + Parsing URL "/" + + 4 tests completed. + + fasturl x 17,159,456 ops/sec ยฑ3.25% (188 runs sampled) + nativeurl - legacy x 11,635,097 ops/sec ยฑ3.79% (184 runs sampled) + nativeurl - whatwg x 240,693 ops/sec ยฑ0.83% (189 runs sampled) + parseurl x 42,279,067 ops/sec ยฑ0.55% (190 runs sampled) +``` + +## License + + [MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/pillarjs/parseurl/master +[coveralls-url]: https://coveralls.io/r/pillarjs/parseurl?branch=master +[node-image]: https://badgen.net/npm/node/parseurl +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/parseurl +[npm-url]: https://npmjs.org/package/parseurl +[npm-version-image]: https://badgen.net/npm/v/parseurl +[travis-image]: https://badgen.net/travis/pillarjs/parseurl/master +[travis-url]: https://travis-ci.org/pillarjs/parseurl diff --git a/node_modules/parseurl/index.js b/node_modules/parseurl/index.js new file mode 100644 index 0000000..ece7223 --- /dev/null +++ b/node_modules/parseurl/index.js @@ -0,0 +1,158 @@ +/*! + * parseurl + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var url = require('url') +var parse = url.parse +var Url = url.Url + +/** + * Module exports. + * @public + */ + +module.exports = parseurl +module.exports.original = originalurl + +/** + * Parse the `req` url with memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @public + */ + +function parseurl (req) { + var url = req.url + + if (url === undefined) { + // URL is undefined + return undefined + } + + var parsed = req._parsedUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return (req._parsedUrl = parsed) +}; + +/** + * Parse the `req` original url with fallback and memoization. + * + * @param {ServerRequest} req + * @return {Object} + * @public + */ + +function originalurl (req) { + var url = req.originalUrl + + if (typeof url !== 'string') { + // Fallback + return parseurl(req) + } + + var parsed = req._parsedOriginalUrl + + if (fresh(url, parsed)) { + // Return cached URL parse + return parsed + } + + // Parse the URL + parsed = fastparse(url) + parsed._raw = url + + return (req._parsedOriginalUrl = parsed) +}; + +/** + * Parse the `str` url with fast-path short-cut. + * + * @param {string} str + * @return {Object} + * @private + */ + +function fastparse (str) { + if (typeof str !== 'string' || str.charCodeAt(0) !== 0x2f /* / */) { + return parse(str) + } + + var pathname = str + var query = null + var search = null + + // This takes the regexp from https://github.com/joyent/node/pull/7878 + // Which is /^(\/[^?#\s]*)(\?[^#\s]*)?$/ + // And unrolls it into a for loop + for (var i = 1; i < str.length; i++) { + switch (str.charCodeAt(i)) { + case 0x3f: /* ? */ + if (search === null) { + pathname = str.substring(0, i) + query = str.substring(i + 1) + search = str.substring(i) + } + break + case 0x09: /* \t */ + case 0x0a: /* \n */ + case 0x0c: /* \f */ + case 0x0d: /* \r */ + case 0x20: /* */ + case 0x23: /* # */ + case 0xa0: + case 0xfeff: + return parse(str) + } + } + + var url = Url !== undefined + ? new Url() + : {} + + url.path = str + url.href = str + url.pathname = pathname + + if (search !== null) { + url.query = query + url.search = search + } + + return url +} + +/** + * Determine if parsed is still fresh for url. + * + * @param {string} url + * @param {object} parsedUrl + * @return {boolean} + * @private + */ + +function fresh (url, parsedUrl) { + return typeof parsedUrl === 'object' && + parsedUrl !== null && + (Url === undefined || parsedUrl instanceof Url) && + parsedUrl._raw === url +} diff --git a/node_modules/parseurl/package.json b/node_modules/parseurl/package.json new file mode 100644 index 0000000..6b443ca --- /dev/null +++ b/node_modules/parseurl/package.json @@ -0,0 +1,40 @@ +{ + "name": "parseurl", + "description": "parse a url with memoization", + "version": "1.3.3", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "repository": "pillarjs/parseurl", + "license": "MIT", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.1", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "fast-url-parser": "1.1.3", + "istanbul": "0.4.5", + "mocha": "6.1.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --check-leaks --bail --reporter spec test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/" + } +} diff --git a/node_modules/range-parser/HISTORY.md b/node_modules/range-parser/HISTORY.md new file mode 100644 index 0000000..70a973d --- /dev/null +++ b/node_modules/range-parser/HISTORY.md @@ -0,0 +1,56 @@ +1.2.1 / 2019-05-10 +================== + + * Improve error when `str` is not a string + +1.2.0 / 2016-06-01 +================== + + * Add `combine` option to combine overlapping ranges + +1.1.0 / 2016-05-13 +================== + + * Fix incorrectly returning -1 when there is at least one valid range + * perf: remove internal function + +1.0.3 / 2015-10-29 +================== + + * perf: enable strict mode + +1.0.2 / 2014-09-08 +================== + + * Support Node.js 0.6 + +1.0.1 / 2014-09-07 +================== + + * Move repository to jshttp + +1.0.0 / 2013-12-11 +================== + + * Add repository to package.json + * Add MIT license + +0.0.4 / 2012-06-17 +================== + + * Change ret -1 for unsatisfiable and -2 when invalid + +0.0.3 / 2012-06-17 +================== + + * Fix last-byte-pos default to len - 1 + +0.0.2 / 2012-06-14 +================== + + * Add `.type` + +0.0.1 / 2012-06-11 +================== + + * Initial release diff --git a/node_modules/range-parser/LICENSE b/node_modules/range-parser/LICENSE new file mode 100644 index 0000000..3599954 --- /dev/null +++ b/node_modules/range-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015-2016 Douglas Christopher Wilson + +```js +var parseRange = require('range-parser') +``` + +### parseRange(size, header, options) + +Parse the given `header` string where `size` is the maximum size of the resource. +An array of ranges will be returned or negative numbers indicating an error parsing. + + * `-2` signals a malformed header string + * `-1` signals an unsatisfiable range + + + +```js +// parse header from request +var range = parseRange(size, req.headers.range) + +// the type of the range +if (range.type === 'bytes') { + // the ranges + range.forEach(function (r) { + // do something with r.start and r.end + }) +} +``` + +#### Options + +These properties are accepted in the options object. + +##### combine + +Specifies if overlapping & adjacent ranges should be combined, defaults to `false`. +When `true`, ranges will be combined and returned as if they were specified that +way in the header. + + + +```js +parseRange(100, 'bytes=50-55,0-10,5-10,56-60', { combine: true }) +// => [ +// { start: 0, end: 10 }, +// { start: 50, end: 60 } +// ] +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/range-parser/master +[coveralls-url]: https://coveralls.io/r/jshttp/range-parser?branch=master +[node-image]: https://badgen.net/npm/node/range-parser +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/range-parser +[npm-url]: https://npmjs.org/package/range-parser +[npm-version-image]: https://badgen.net/npm/v/range-parser +[travis-image]: https://badgen.net/travis/jshttp/range-parser/master +[travis-url]: https://travis-ci.org/jshttp/range-parser diff --git a/node_modules/range-parser/index.js b/node_modules/range-parser/index.js new file mode 100644 index 0000000..b7dc5c0 --- /dev/null +++ b/node_modules/range-parser/index.js @@ -0,0 +1,162 @@ +/*! + * range-parser + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = rangeParser + +/** + * Parse "Range" header `str` relative to the given file `size`. + * + * @param {Number} size + * @param {String} str + * @param {Object} [options] + * @return {Array} + * @public + */ + +function rangeParser (size, str, options) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string') + } + + var index = str.indexOf('=') + + if (index === -1) { + return -2 + } + + // split the range string + var arr = str.slice(index + 1).split(',') + var ranges = [] + + // add ranges type + ranges.type = str.slice(0, index) + + // parse all ranges + for (var i = 0; i < arr.length; i++) { + var range = arr[i].split('-') + var start = parseInt(range[0], 10) + var end = parseInt(range[1], 10) + + // -nnn + if (isNaN(start)) { + start = size - end + end = size - 1 + // nnn- + } else if (isNaN(end)) { + end = size - 1 + } + + // limit last-byte-pos to current length + if (end > size - 1) { + end = size - 1 + } + + // invalid or unsatisifiable + if (isNaN(start) || isNaN(end) || start > end || start < 0) { + continue + } + + // add range + ranges.push({ + start: start, + end: end + }) + } + + if (ranges.length < 1) { + // unsatisifiable + return -1 + } + + return options && options.combine + ? combineRanges(ranges) + : ranges +} + +/** + * Combine overlapping & adjacent ranges. + * @private + */ + +function combineRanges (ranges) { + var ordered = ranges.map(mapWithIndex).sort(sortByRangeStart) + + for (var j = 0, i = 1; i < ordered.length; i++) { + var range = ordered[i] + var current = ordered[j] + + if (range.start > current.end + 1) { + // next range + ordered[++j] = range + } else if (range.end > current.end) { + // extend range + current.end = range.end + current.index = Math.min(current.index, range.index) + } + } + + // trim ordered array + ordered.length = j + 1 + + // generate combined range + var combined = ordered.sort(sortByRangeIndex).map(mapWithoutIndex) + + // copy ranges type + combined.type = ranges.type + + return combined +} + +/** + * Map function to add index value to ranges. + * @private + */ + +function mapWithIndex (range, index) { + return { + start: range.start, + end: range.end, + index: index + } +} + +/** + * Map function to remove index value from ranges. + * @private + */ + +function mapWithoutIndex (range) { + return { + start: range.start, + end: range.end + } +} + +/** + * Sort function to sort ranges by index. + * @private + */ + +function sortByRangeIndex (a, b) { + return a.index - b.index +} + +/** + * Sort function to sort ranges by start position. + * @private + */ + +function sortByRangeStart (a, b) { + return a.start - b.start +} diff --git a/node_modules/range-parser/package.json b/node_modules/range-parser/package.json new file mode 100644 index 0000000..abea6d8 --- /dev/null +++ b/node_modules/range-parser/package.json @@ -0,0 +1,44 @@ +{ + "name": "range-parser", + "author": "TJ Holowaychuk (http://tjholowaychuk.com)", + "description": "Range header field string parser", + "version": "1.2.1", + "contributors": [ + "Douglas Christopher Wilson ", + "James Wyatt Cready ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "keywords": [ + "range", + "parser", + "http" + ], + "repository": "jshttp/range-parser", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.1.1" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + } +} diff --git a/node_modules/send/HISTORY.md b/node_modules/send/HISTORY.md new file mode 100644 index 0000000..958b934 --- /dev/null +++ b/node_modules/send/HISTORY.md @@ -0,0 +1,580 @@ +1.2.0 / 2025-03-27 +================== + + * deps: + * `mime-types@^3.0.1` + * `fresh@^2.0.0` + * removed `destroy` + * remove `getHeaderNames()` polyfill and refactor `clearHeaders()` + +1.1.0 / 2024-09-10 +================== + +* Changes from 0.19.0 + +1.0.0 / 2024-07-25 +================== + + * Drop support for Node.js <18.0 + * `statuses@^2.0.1` + * `range-parser@^1.2.1` + * `on-finished@^2.4.1` + * `ms@^2.1.3` + * `mime-types@^2.1.35` + * `http-errors@^2.0.0` + * `fresh@^0.5.2` + * `etag@^1.8.1` + * `escape-html@^1.0.3` + * `encodeurl@^2.0.0` + * `destroy@^1.2.0` + * `debug@^4.3.5` + +1.0.0-beta.2 / 2024-03-04 +========================= + + * Changes from 0.18.0 + +1.0.0-beta.1 / 2022-02-04 +========================= + + * Drop support for Node.js 0.8 + * Remove `hidden` option -- use `dotfiles` option + * Remove `from` alias to `root` -- use `root` directly + * Remove `send.etag()` -- use `etag` in `options` + * Remove `send.index()` -- use `index` in `options` + * Remove `send.maxage()` -- use `maxAge` in `options` + * Remove `send.root()` -- use `root` in `options` + * Use `mime-types` for file to content type mapping -- removed `send.mime` + * deps: debug@3.1.0 + - Add `DEBUG_HIDE_DATE` environment variable + - Change timer to per-namespace instead of global + - Change non-TTY date format + - Remove `DEBUG_FD` environment variable support + - Support 256 namespace colors + +0.19.0 / 2024-09-10 +=================== + +* Remove link renderization in html while redirecting + +0.18.0 / 2022-03-23 +=================== + + * Fix emitted 416 error missing headers property + * Limit the headers removed for 304 response + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: destroy@1.2.0 + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: statuses@2.0.1 + +0.17.2 / 2021-12-11 +=================== + + * pref: ignore empty http tokens + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: ms@2.1.3 + +0.17.1 / 2019-05-10 +=================== + + * Set stricter CSP header in redirect & error responses + * deps: range-parser@~1.2.1 + +0.17.0 / 2019-05-03 +=================== + + * deps: http-errors@~1.7.2 + - Set constructor name when possible + - Use `toidentifier` module to make class names + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: mime@1.6.0 + - Add extensions for JPEG-2000 images + - Add new `font/*` types from IANA + - Add WASM mapping + - Update `.bdoc` to `application/bdoc` + - Update `.bmp` to `image/bmp` + - Update `.m4a` to `audio/mp4` + - Update `.rtf` to `application/rtf` + - Update `.wav` to `audio/wav` + - Update `.xml` to `application/xml` + - Update generic extensions to `application/octet-stream`: + `.deb`, `.dll`, `.dmg`, `.exe`, `.iso`, `.msi` + - Use mime-score module to resolve extension conflicts + * deps: ms@2.1.1 + - Add `week`/`w` support + - Fix negative number handling + * deps: statuses@~1.5.0 + * perf: remove redundant `path.normalize` call + +0.16.2 / 2018-02-07 +=================== + + * Fix incorrect end tag in default error & redirects + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: statuses@~1.4.0 + +0.16.1 / 2017-09-29 +=================== + + * Fix regression in edge-case behavior for empty `path` + +0.16.0 / 2017-09-27 +=================== + + * Add `immutable` option + * Fix missing `` in default error & redirects + * Use instance methods on steam to check for listeners + * deps: mime@1.4.1 + - Add 70 new types for file extensions + - Set charset as "UTF-8" for .js and .json + * perf: improve path validation speed + +0.15.6 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: improve `If-Match` token parsing + +0.15.5 / 2017-09-20 +=================== + + * deps: etag@~1.8.1 + - perf: replace regular expression with substring + * deps: fresh@0.5.2 + - Fix handling of modified headers with invalid dates + - perf: improve ETag match loop + - perf: improve `If-None-Match` token parsing + +0.15.4 / 2017-08-05 +=================== + + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + +0.15.3 / 2017-05-16 +=================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + * deps: ms@2.0.0 + +0.15.2 / 2017-04-26 +=================== + + * deps: debug@2.6.4 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@0.7.3 + * deps: ms@1.0.0 + +0.15.1 / 2017-03-04 +=================== + + * Fix issue when `Date.parse` does not return `NaN` on invalid date + * Fix strict violation in broken environments + +0.15.0 / 2017-02-25 +=================== + + * Support `If-Match` and `If-Unmodified-Since` headers + * Add `res` and `path` arguments to `directory` event + * Remove usage of `res._headers` private field + - Improves compatibility with Node.js 8 nightly + * Send complete HTML document in redirect & error responses + * Set default CSP header in redirect & error responses + * Use `res.getHeaderNames()` when available + * Use `res.headersSent` when available + * deps: debug@2.6.1 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: etag@~1.8.0 + * deps: fresh@0.5.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - perf: delay reading header values until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove duplicate conditional + - perf: remove unnecessary boolean coercions + - perf: skip checking modified time if ETag check failed + - perf: skip parsing `If-None-Match` when no `ETag` header + - perf: use `Date.parse` instead of `new Date` + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + +0.14.2 / 2017-01-23 +=================== + + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: ms@0.7.2 + * deps: statuses@~1.3.1 + +0.14.1 / 2016-06-09 +=================== + + * Fix redirect error when `path` contains raw non-URL characters + * Fix redirect when `path` starts with multiple forward slashes + +0.14.0 / 2016-06-06 +=================== + + * Add `acceptRanges` option + * Add `cacheControl` option + * Attempt to combine multiple ranges into single range + * Correctly inherit from `Stream` class + * Fix `Content-Range` header in 416 responses when using `start`/`end` options + * Fix `Content-Range` header missing from default 416 responses + * Ignore non-byte `Range` headers + * deps: http-errors@~1.5.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - Support new code `421 Misdirected Request` + - Use `setprototypeof` module to replace `__proto__` setting + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: range-parser@~1.2.0 + - Fix incorrectly returning -1 when there is at least one valid range + - perf: remove internal function + * deps: statuses@~1.3.0 + - Add `421 Misdirected Request` + - perf: enable strict mode + * perf: remove argument reassignment + +0.13.2 / 2016-03-05 +=================== + + * Fix invalid `Content-Type` header when `send.mime.default_type` unset + +0.13.1 / 2016-01-16 +=================== + + * deps: depd@~1.1.0 + - Support web browser loading + - perf: enable strict mode + * deps: destroy@~1.0.4 + - perf: enable strict mode + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: range-parser@~1.0.3 + - perf: enable strict mode + +0.13.0 / 2015-06-16 +=================== + + * Allow Node.js HTTP server to set `Date` response header + * Fix incorrectly removing `Content-Location` on 304 response + * Improve the default redirect response headers + * Send appropriate headers on default error response + * Use `http-errors` for standard emitted errors + * Use `statuses` instead of `http` module for status messages + * deps: escape-html@1.0.2 + * deps: etag@~1.7.0 + - Improve stat performance by removing hashing + * deps: fresh@0.3.0 + - Add weak `ETag` matching support + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * perf: enable strict mode + * perf: remove unnecessary array allocations + +0.12.3 / 2015-05-13 +=================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: depd@~1.0.1 + * deps: etag@~1.6.0 + - Improve support for JXcore + - Support "fake" stats objects in environments without `fs` + * deps: ms@0.7.1 + - Prevent extraordinarily long inputs + * deps: on-finished@~2.2.1 + +0.12.2 / 2015-03-13 +=================== + + * Throw errors early for invalid `extensions` or `index` options + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +0.12.1 / 2015-02-17 +=================== + + * Fix regression sending zero-length files + +0.12.0 / 2015-02-16 +=================== + + * Always read the stat size from the file + * Fix mutating passed-in `options` + * deps: mime@1.3.4 + +0.11.1 / 2015-01-20 +=================== + + * Fix `root` path disclosure + +0.11.0 / 2015-01-05 +=================== + + * deps: debug@~2.1.1 + * deps: etag@~1.5.1 + - deps: crc@3.2.1 + * deps: ms@0.7.0 + - Add `milliseconds` + - Add `msecs` + - Add `secs` + - Add `mins` + - Add `hrs` + - Add `yrs` + * deps: on-finished@~2.2.0 + +0.10.1 / 2014-10-22 +=================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + +0.10.0 / 2014-10-15 +=================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + * deps: etag@~1.5.0 + - Improve string performance + - Slightly improve speed for weak ETags over 1KB + +0.9.3 / 2014-09-24 +================== + + * deps: etag@~1.4.0 + - Support "fake" stats objects + +0.9.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + * deps: etag@~1.3.1 + * deps: range-parser@~1.0.2 + +0.9.1 / 2014-09-07 +================== + + * deps: fresh@0.2.4 + +0.9.0 / 2014-09-07 +================== + + * Add `lastModified` option + * Use `etag` to generate `ETag` header + * deps: debug@~2.0.0 + +0.8.5 / 2014-09-04 +================== + + * Fix malicious path detection for empty string path + +0.8.4 / 2014-09-04 +================== + + * Fix a path traversal issue when using `root` + +0.8.3 / 2014-08-16 +================== + + * deps: destroy@1.0.3 + - renamed from dethroy + * deps: on-finished@2.1.0 + +0.8.2 / 2014-08-14 +================== + + * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + * deps: dethroy@1.0.2 + +0.8.1 / 2014-08-05 +================== + + * Fix `extensions` behavior when file already has extension + +0.8.0 / 2014-08-05 +================== + + * Add `extensions` option + +0.7.4 / 2014-08-04 +================== + + * Fix serving index files without root dir + +0.7.3 / 2014-07-29 +================== + + * Fix incorrect 403 on Windows and Node.js 0.11 + +0.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +0.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +0.7.0 / 2014-07-20 +================== + + * Deprecate `hidden` option; use `dotfiles` option + * Add `dotfiles` option + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + +0.6.0 / 2014-07-11 +================== + + * Deprecate `from` option; use `root` option + * Deprecate `send.etag()` -- use `etag` in `options` + * Deprecate `send.hidden()` -- use `hidden` in `options` + * Deprecate `send.index()` -- use `index` in `options` + * Deprecate `send.maxage()` -- use `maxAge` in `options` + * Deprecate `send.root()` -- use `root` in `options` + * Cap `maxAge` value to 1 year + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +0.5.0 / 2014-06-28 +================== + + * Accept string for `maxAge` (converted by `ms`) + * Add `headers` event + * Include link in default redirect response + * Use `EventEmitter.listenerCount` to count listeners + +0.4.3 / 2014-06-11 +================== + + * Do not throw un-catchable error on file open race condition + * Use `escape-html` for HTML escaping + * deps: debug@1.0.2 + - fix some debugging output colors on node.js 0.8 + * deps: finished@1.2.2 + * deps: fresh@0.2.2 + +0.4.2 / 2014-06-09 +================== + + * fix "event emitter leak" warnings + * deps: debug@1.0.1 + * deps: finished@1.2.1 + +0.4.1 / 2014-06-02 +================== + + * Send `max-age` in `Cache-Control` in correct format + +0.4.0 / 2014-05-27 +================== + + * Calculate ETag with md5 for reduced collisions + * Fix wrong behavior when index file matches directory + * Ignore stream errors after request ends + - Goodbye `EBADF, read` + * Skip directories in index file search + * deps: debug@0.8.1 + +0.3.0 / 2014-04-24 +================== + + * Fix sending files with dots without root set + * Coerce option types + * Accept API options in options object + * Set etags to "weak" + * Include file path in etag + * Make "Can't set headers after they are sent." catchable + * Send full entity-body for multi range requests + * Default directory access to 403 when index disabled + * Support multiple index paths + * Support "If-Range" header + * Control whether to generate etags + * deps: mime@1.2.11 + +0.2.0 / 2014-01-29 +================== + + * update range-parser and fresh + +0.1.4 / 2013-08-11 +================== + + * update fresh + +0.1.3 / 2013-07-08 +================== + + * Revert "Fix fd leak" + +0.1.2 / 2013-07-03 +================== + + * Fix fd leak + +0.1.0 / 2012-08-25 +================== + + * add options parameter to send() that is passed to fs.createReadStream() [kanongil] + +0.0.4 / 2012-08-16 +================== + + * allow custom "Accept-Ranges" definition + +0.0.3 / 2012-07-16 +================== + + * fix normalization of the root directory. Closes #3 + +0.0.2 / 2012-07-09 +================== + + * add passing of req explicitly for now (YUCK) + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/send/LICENSE b/node_modules/send/LICENSE new file mode 100644 index 0000000..b6ea1c1 --- /dev/null +++ b/node_modules/send/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012 TJ Holowaychuk +Copyright (c) 2014-2022 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/README.md b/node_modules/send/README.md new file mode 100644 index 0000000..350fccd --- /dev/null +++ b/node_modules/send/README.md @@ -0,0 +1,317 @@ +# send + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![CI][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Send is a library for streaming files from the file system as a http response +supporting partial responses (Ranges), conditional-GET negotiation (If-Match, +If-Unmodified-Since, If-None-Match, If-Modified-Since), high test coverage, +and granular events which may be leveraged to take appropriate actions in your +application or framework. + +Looking to serve up entire folders mapped to URLs? Try [serve-static](https://www.npmjs.org/package/serve-static). + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install send +``` + +## API + +```js +var send = require('send') +``` + +### send(req, path, [options]) + +Create a new `SendStream` for the given path to send to a `res`. The `req` is +the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded, +not the actual file-system path). + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `immutable` and `maxAge` options. + +##### dotfiles + +Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Send a 403 for any request for a dotfile. + - `'ignore'` Pretend like the dotfile does not exist and 404. + +The default value is _similar_ to `'ignore'`, with the exception that +this default will not ignore the files within a directory that begins +with a dot, for backward-compatibility. + +##### end + +Byte offset at which the stream ends, defaults to the length of the file +minus 1. The end is inclusive in the stream, meaning `end: 3` will include +the 4th byte in the stream. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +If a given file doesn't exist, try appending one of the given extensions, +in the given order. By default, this is disabled (set to `false`). An +example value that will serve extension-less HTML files: `['html', 'htm']`. +This is skipped if the requested file already has an extension. + +##### immutable + +Enable or disable the `immutable` directive in the `Cache-Control` response +header, defaults to `false`. If set to `true`, the `maxAge` option should +also be specified to enable caching. The `immutable` directive will prevent +supported clients from making conditional requests during the life of the +`maxAge` option to check if the file has changed. + +##### index + +By default send supports "index.html" files, to disable this +set `false` or to supply a new index pass a string or an array +in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. +This can also be a string accepted by the +[ms](https://www.npmjs.org/package/ms#readme) module. + +##### root + +Serve files relative to `path`. + +##### start + +Byte offset at which the stream starts, defaults to 0. The start is inclusive, +meaning `start: 2` will include the 3rd byte in the stream. + +#### Events + +The `SendStream` is an event emitter and will emit the following events: + + - `error` an error occurred `(err)` + - `directory` a directory was requested `(res, path)` + - `file` a file was requested `(path, stat)` + - `headers` the headers are about to be set on a file `(res, path, stat)` + - `stream` file streaming has started `(stream)` + - `end` streaming has completed + +#### .pipe + +The `pipe` method is used to pipe the response into the Node.js HTTP response +object, typically `send(req, path, options).pipe(res)`. + +## Error-handling + +By default when no `error` listeners are present an automatic response will be +made, otherwise you have full control over the response, aka you may show a 5xx +page etc. + +## Caching + +It does _not_ perform internal caching, you should use a reverse proxy cache +such as Varnish for this, or those fancy things called CDNs. If your +application is small enough that it would benefit from single-node memory +caching, it's small enough that it does not need caching at all ;). + +## Debugging + +To enable `debug()` instrumentation output export __DEBUG__: + +``` +$ DEBUG=send node app +``` + +## Running tests + +``` +$ npm install +$ npm test +``` + +## Examples + +### Serve a specific file + +This simple example will send a specific file to all requests. + +```js +var http = require('http') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, '/path/to/index.html') + .pipe(res) +}) + +server.listen(3000) +``` + +### Serve all files from a directory + +This simple example will just serve up all the files in a +given directory as the top-level. For example, a request +`GET /foo.txt` will send back `/www/public/foo.txt`. + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .pipe(res) +}) + +server.listen(3000) +``` + +### Custom file types + +```js +var extname = require('path').extname +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .on('headers', function (res, path) { + switch (extname(path)) { + case '.x-mt': + case '.x-mtt': + // custom type for these extensions + res.setHeader('Content-Type', 'application/x-my-type') + break + } + }) + .pipe(res) +}) + +server.listen(3000) +``` + +### Custom directory index view + +This is an example of serving up a structure of directories with a +custom function to render a listing of a directory. + +```js +var http = require('http') +var fs = require('fs') +var parseUrl = require('parseurl') +var send = require('send') + +// Transfer arbitrary files from within /www/example.com/public/* +// with a custom handler for directory listing +var server = http.createServer(function onRequest (req, res) { + send(req, parseUrl(req).pathname, { index: false, root: '/www/public' }) + .once('directory', directory) + .pipe(res) +}) + +server.listen(3000) + +// Custom directory handler +function directory (res, path) { + var stream = this + + // redirect to trailing slash for consistent url + if (!stream.hasTrailingSlash()) { + return stream.redirect(path) + } + + // get directory list + fs.readdir(path, function onReaddir (err, list) { + if (err) return stream.error(err) + + // render an index for the directory + res.setHeader('Content-Type', 'text/plain; charset=UTF-8') + res.end(list.join('\n') + '\n') + }) +} +``` + +### Serving from a root directory with custom error-handling + +```js +var http = require('http') +var parseUrl = require('parseurl') +var send = require('send') + +var server = http.createServer(function onRequest (req, res) { + // your custom error-handling logic: + function error (err) { + res.statusCode = err.status || 500 + res.end(err.message) + } + + // your custom headers + function headers (res, path, stat) { + // serve all files for download + res.setHeader('Content-Disposition', 'attachment') + } + + // your custom directory handling logic: + function redirect () { + res.statusCode = 301 + res.setHeader('Location', req.url + '/') + res.end('Redirecting to ' + req.url + '/') + } + + // transfer arbitrary files from within + // /www/example.com/public/* + send(req, parseUrl(req).pathname, { root: '/www/public' }) + .on('error', error) + .on('directory', redirect) + .on('headers', headers) + .pipe(res) +}) + +server.listen(3000) +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/pillarjs/send/master +[coveralls-url]: https://coveralls.io/r/pillarjs/send?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/pillarjs/send/master?label=linux +[github-actions-ci-url]: https://github.com/pillarjs/send/actions/workflows/ci.yml +[node-image]: https://badgen.net/npm/node/send +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/send +[npm-url]: https://npmjs.org/package/send +[npm-version-image]: https://badgen.net/npm/v/send diff --git a/node_modules/send/index.js b/node_modules/send/index.js new file mode 100644 index 0000000..1655053 --- /dev/null +++ b/node_modules/send/index.js @@ -0,0 +1,997 @@ +/*! + * send + * Copyright(c) 2012 TJ Holowaychuk + * Copyright(c) 2014-2022 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var debug = require('debug')('send') +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var etag = require('etag') +var fresh = require('fresh') +var fs = require('fs') +var mime = require('mime-types') +var ms = require('ms') +var onFinished = require('on-finished') +var parseRange = require('range-parser') +var path = require('path') +var statuses = require('statuses') +var Stream = require('stream') +var util = require('util') + +/** + * Path function references. + * @private + */ + +var extname = path.extname +var join = path.join +var normalize = path.normalize +var resolve = path.resolve +var sep = path.sep + +/** + * Regular expression for identifying a bytes Range header. + * @private + */ + +var BYTES_RANGE_REGEXP = /^ *bytes=/ + +/** + * Maximum value allowed for the max age. + * @private + */ + +var MAX_MAXAGE = 60 * 60 * 24 * 365 * 1000 // 1 year + +/** + * Regular expression to match a path with a directory up component. + * @private + */ + +var UP_PATH_REGEXP = /(?:^|[\\/])\.\.(?:[\\/]|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = send + +/** + * Return a `SendStream` for `req` and `path`. + * + * @param {object} req + * @param {string} path + * @param {object} [options] + * @return {SendStream} + * @public + */ + +function send (req, path, options) { + return new SendStream(req, path, options) +} + +/** + * Initialize a `SendStream` with the given `path`. + * + * @param {Request} req + * @param {String} path + * @param {object} [options] + * @private + */ + +function SendStream (req, path, options) { + Stream.call(this) + + var opts = options || {} + + this.options = opts + this.path = path + this.req = req + + this._acceptRanges = opts.acceptRanges !== undefined + ? Boolean(opts.acceptRanges) + : true + + this._cacheControl = opts.cacheControl !== undefined + ? Boolean(opts.cacheControl) + : true + + this._etag = opts.etag !== undefined + ? Boolean(opts.etag) + : true + + this._dotfiles = opts.dotfiles !== undefined + ? opts.dotfiles + : 'ignore' + + if (this._dotfiles !== 'ignore' && this._dotfiles !== 'allow' && this._dotfiles !== 'deny') { + throw new TypeError('dotfiles option must be "allow", "deny", or "ignore"') + } + + this._extensions = opts.extensions !== undefined + ? normalizeList(opts.extensions, 'extensions option') + : [] + + this._immutable = opts.immutable !== undefined + ? Boolean(opts.immutable) + : false + + this._index = opts.index !== undefined + ? normalizeList(opts.index, 'index option') + : ['index.html'] + + this._lastModified = opts.lastModified !== undefined + ? Boolean(opts.lastModified) + : true + + this._maxage = opts.maxAge || opts.maxage + this._maxage = typeof this._maxage === 'string' + ? ms(this._maxage) + : Number(this._maxage) + this._maxage = !isNaN(this._maxage) + ? Math.min(Math.max(0, this._maxage), MAX_MAXAGE) + : 0 + + this._root = opts.root + ? resolve(opts.root) + : null +} + +/** + * Inherits from `Stream`. + */ + +util.inherits(SendStream, Stream) + +/** + * Emit error with `status`. + * + * @param {number} status + * @param {Error} [err] + * @private + */ + +SendStream.prototype.error = function error (status, err) { + // emit if listeners instead of responding + if (hasListeners(this, 'error')) { + return this.emit('error', createHttpError(status, err)) + } + + var res = this.res + var msg = statuses.message[status] || String(status) + var doc = createHtmlDocument('Error', escapeHtml(msg)) + + // clear existing headers + clearHeaders(res) + + // add error headers + if (err && err.headers) { + setHeaders(res, err.headers) + } + + // send basic response + res.statusCode = status + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.end(doc) +} + +/** + * Check if the pathname ends with "/". + * + * @return {boolean} + * @private + */ + +SendStream.prototype.hasTrailingSlash = function hasTrailingSlash () { + return this.path[this.path.length - 1] === '/' +} + +/** + * Check if this is a conditional GET request. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isConditionalGET = function isConditionalGET () { + return this.req.headers['if-match'] || + this.req.headers['if-unmodified-since'] || + this.req.headers['if-none-match'] || + this.req.headers['if-modified-since'] +} + +/** + * Check if the request preconditions failed. + * + * @return {boolean} + * @private + */ + +SendStream.prototype.isPreconditionFailure = function isPreconditionFailure () { + var req = this.req + var res = this.res + + // if-match + var match = req.headers['if-match'] + if (match) { + var etag = res.getHeader('ETag') + return !etag || (match !== '*' && parseTokenList(match).every(function (match) { + return match !== etag && match !== 'W/' + etag && 'W/' + match !== etag + })) + } + + // if-unmodified-since + var unmodifiedSince = parseHttpDate(req.headers['if-unmodified-since']) + if (!isNaN(unmodifiedSince)) { + var lastModified = parseHttpDate(res.getHeader('Last-Modified')) + return isNaN(lastModified) || lastModified > unmodifiedSince + } + + return false +} + +/** + * Strip various content header fields for a change in entity. + * + * @private + */ + +SendStream.prototype.removeContentHeaderFields = function removeContentHeaderFields () { + var res = this.res + + res.removeHeader('Content-Encoding') + res.removeHeader('Content-Language') + res.removeHeader('Content-Length') + res.removeHeader('Content-Range') + res.removeHeader('Content-Type') +} + +/** + * Respond with 304 not modified. + * + * @api private + */ + +SendStream.prototype.notModified = function notModified () { + var res = this.res + debug('not modified') + this.removeContentHeaderFields() + res.statusCode = 304 + res.end() +} + +/** + * Raise error that headers already sent. + * + * @api private + */ + +SendStream.prototype.headersAlreadySent = function headersAlreadySent () { + var err = new Error('Can\'t set headers after they are sent.') + debug('headers already sent') + this.error(500, err) +} + +/** + * Check if the request is cacheable, aka + * responded with 2xx or 304 (see RFC 2616 section 14.2{5,6}). + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isCachable = function isCachable () { + var statusCode = this.res.statusCode + return (statusCode >= 200 && statusCode < 300) || + statusCode === 304 +} + +/** + * Handle stat() error. + * + * @param {Error} error + * @private + */ + +SendStream.prototype.onStatError = function onStatError (error) { + switch (error.code) { + case 'ENAMETOOLONG': + case 'ENOENT': + case 'ENOTDIR': + this.error(404, error) + break + default: + this.error(500, error) + break + } +} + +/** + * Check if the cache is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isFresh = function isFresh () { + return fresh(this.req.headers, { + etag: this.res.getHeader('ETag'), + 'last-modified': this.res.getHeader('Last-Modified') + }) +} + +/** + * Check if the range is fresh. + * + * @return {Boolean} + * @api private + */ + +SendStream.prototype.isRangeFresh = function isRangeFresh () { + var ifRange = this.req.headers['if-range'] + + if (!ifRange) { + return true + } + + // if-range as etag + if (ifRange.indexOf('"') !== -1) { + var etag = this.res.getHeader('ETag') + return Boolean(etag && ifRange.indexOf(etag) !== -1) + } + + // if-range as modified date + var lastModified = this.res.getHeader('Last-Modified') + return parseHttpDate(lastModified) <= parseHttpDate(ifRange) +} + +/** + * Redirect to path. + * + * @param {string} path + * @private + */ + +SendStream.prototype.redirect = function redirect (path) { + var res = this.res + + if (hasListeners(this, 'directory')) { + this.emit('directory', res, path) + return + } + + if (this.hasTrailingSlash()) { + this.error(403) + return + } + + var loc = encodeUrl(collapseLeadingSlashes(this.path + '/')) + var doc = createHtmlDocument('Redirecting', 'Redirecting to ' + escapeHtml(loc)) + + // redirect + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) +} + +/** + * Pipe to `res. + * + * @param {Stream} res + * @return {Stream} res + * @api public + */ + +SendStream.prototype.pipe = function pipe (res) { + // root path + var root = this._root + + // references + this.res = res + + // decode the path + var path = decode(this.path) + if (path === -1) { + this.error(400) + return res + } + + // null byte(s) + if (~path.indexOf('\0')) { + this.error(400) + return res + } + + var parts + if (root !== null) { + // normalize + if (path) { + path = normalize('.' + sep + path) + } + + // malicious path + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = path.split(sep) + + // join / normalize from optional root dir + path = normalize(join(root, path)) + } else { + // ".." is malicious without "root" + if (UP_PATH_REGEXP.test(path)) { + debug('malicious path "%s"', path) + this.error(403) + return res + } + + // explode path parts + parts = normalize(path).split(sep) + + // resolve the path + path = resolve(path) + } + + // dotfile handling + if (containsDotFile(parts)) { + debug('%s dotfile "%s"', this._dotfiles, path) + switch (this._dotfiles) { + case 'allow': + break + case 'deny': + this.error(403) + return res + case 'ignore': + default: + this.error(404) + return res + } + } + + // index file support + if (this._index.length && this.hasTrailingSlash()) { + this.sendIndex(path) + return res + } + + this.sendFile(path) + return res +} + +/** + * Transfer `path`. + * + * @param {String} path + * @api public + */ + +SendStream.prototype.send = function send (path, stat) { + var len = stat.size + var options = this.options + var opts = {} + var res = this.res + var req = this.req + var ranges = req.headers.range + var offset = options.start || 0 + + if (res.headersSent) { + // impossible to send now + this.headersAlreadySent() + return + } + + debug('pipe "%s"', path) + + // set header fields + this.setHeader(path, stat) + + // set content-type + this.type(path) + + // conditional GET support + if (this.isConditionalGET()) { + if (this.isPreconditionFailure()) { + this.error(412) + return + } + + if (this.isCachable() && this.isFresh()) { + this.notModified() + return + } + } + + // adjust len to start/end options + len = Math.max(0, len - offset) + if (options.end !== undefined) { + var bytes = options.end - offset + 1 + if (len > bytes) len = bytes + } + + // Range support + if (this._acceptRanges && BYTES_RANGE_REGEXP.test(ranges)) { + // parse + ranges = parseRange(len, ranges, { + combine: true + }) + + // If-Range support + if (!this.isRangeFresh()) { + debug('range stale') + ranges = -2 + } + + // unsatisfiable + if (ranges === -1) { + debug('range unsatisfiable') + + // Content-Range + res.setHeader('Content-Range', contentRange('bytes', len)) + + // 416 Requested Range Not Satisfiable + return this.error(416, { + headers: { 'Content-Range': res.getHeader('Content-Range') } + }) + } + + // valid (syntactically invalid/multiple ranges are treated as a regular response) + if (ranges !== -2 && ranges.length === 1) { + debug('range %j', ranges) + + // Content-Range + res.statusCode = 206 + res.setHeader('Content-Range', contentRange('bytes', len, ranges[0])) + + // adjust for requested range + offset += ranges[0].start + len = ranges[0].end - ranges[0].start + 1 + } + } + + // clone options + for (var prop in options) { + opts[prop] = options[prop] + } + + // set read options + opts.start = offset + opts.end = Math.max(offset, offset + len - 1) + + // content-length + res.setHeader('Content-Length', len) + + // HEAD support + if (req.method === 'HEAD') { + res.end() + return + } + + this.stream(path, opts) +} + +/** + * Transfer file for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendFile = function sendFile (path) { + var i = 0 + var self = this + + debug('stat "%s"', path) + fs.stat(path, function onstat (err, stat) { + var pathEndsWithSep = path[path.length - 1] === sep + if (err && err.code === 'ENOENT' && !extname(path) && !pathEndsWithSep) { + // not found, check extensions + return next(err) + } + if (err) return self.onStatError(err) + if (stat.isDirectory()) return self.redirect(path) + if (pathEndsWithSep) return self.error(404) + self.emit('file', path, stat) + self.send(path, stat) + }) + + function next (err) { + if (self._extensions.length <= i) { + return err + ? self.onStatError(err) + : self.error(404) + } + + var p = path + '.' + self._extensions[i++] + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } +} + +/** + * Transfer index for `path`. + * + * @param {String} path + * @api private + */ +SendStream.prototype.sendIndex = function sendIndex (path) { + var i = -1 + var self = this + + function next (err) { + if (++i >= self._index.length) { + if (err) return self.onStatError(err) + return self.error(404) + } + + var p = join(path, self._index[i]) + + debug('stat "%s"', p) + fs.stat(p, function (err, stat) { + if (err) return next(err) + if (stat.isDirectory()) return next() + self.emit('file', p, stat) + self.send(p, stat) + }) + } + + next() +} + +/** + * Stream `path` to the response. + * + * @param {String} path + * @param {Object} options + * @api private + */ + +SendStream.prototype.stream = function stream (path, options) { + var self = this + var res = this.res + + // pipe + var stream = fs.createReadStream(path, options) + this.emit('stream', stream) + stream.pipe(res) + + // cleanup + function cleanup () { + stream.destroy() + } + + // response finished, cleanup + onFinished(res, cleanup) + + // error handling + stream.on('error', function onerror (err) { + // clean up stream early + cleanup() + + // error + self.onStatError(err) + }) + + // end + stream.on('end', function onend () { + self.emit('end') + }) +} + +/** + * Set content-type based on `path` + * if it hasn't been explicitly set. + * + * @param {String} path + * @api private + */ + +SendStream.prototype.type = function type (path) { + var res = this.res + + if (res.getHeader('Content-Type')) return + + var ext = extname(path) + var type = mime.contentType(ext) || 'application/octet-stream' + + debug('content-type %s', type) + res.setHeader('Content-Type', type) +} + +/** + * Set response header fields, most + * fields may be pre-defined. + * + * @param {String} path + * @param {Object} stat + * @api private + */ + +SendStream.prototype.setHeader = function setHeader (path, stat) { + var res = this.res + + this.emit('headers', res, path, stat) + + if (this._acceptRanges && !res.getHeader('Accept-Ranges')) { + debug('accept ranges') + res.setHeader('Accept-Ranges', 'bytes') + } + + if (this._cacheControl && !res.getHeader('Cache-Control')) { + var cacheControl = 'public, max-age=' + Math.floor(this._maxage / 1000) + + if (this._immutable) { + cacheControl += ', immutable' + } + + debug('cache-control %s', cacheControl) + res.setHeader('Cache-Control', cacheControl) + } + + if (this._lastModified && !res.getHeader('Last-Modified')) { + var modified = stat.mtime.toUTCString() + debug('modified %s', modified) + res.setHeader('Last-Modified', modified) + } + + if (this._etag && !res.getHeader('ETag')) { + var val = etag(stat) + debug('etag %s', val) + res.setHeader('ETag', val) + } +} + +/** + * Clear all headers from a response. + * + * @param {object} res + * @private + */ + +function clearHeaders (res) { + for (const header of res.getHeaderNames()) { + res.removeHeader(header) + } +} + +/** + * Collapse all leading slashes into a single slash + * + * @param {string} str + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str[i] !== '/') { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Determine if path parts contain a dotfile. + * + * @api private + */ + +function containsDotFile (parts) { + for (var i = 0; i < parts.length; i++) { + var part = parts[i] + if (part.length > 1 && part[0] === '.') { + return true + } + } + + return false +} + +/** + * Create a Content-Range header. + * + * @param {string} type + * @param {number} size + * @param {array} [range] + */ + +function contentRange (type, size, range) { + return type + ' ' + (range ? range.start + '-' + range.end : '*') + '/' + size +} + +/** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '\n' + + '\n' + + '\n' + + '\n' + + '' + title + '\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' + + '\n' +} + +/** + * Create a HttpError object from simple arguments. + * + * @param {number} status + * @param {Error|object} err + * @private + */ + +function createHttpError (status, err) { + if (!err) { + return createError(status) + } + + return err instanceof Error + ? createError(status, err, { expose: false }) + : createError(status, err) +} + +/** + * decodeURIComponent. + * + * Allows V8 to only deoptimize this fn instead of all + * of send(). + * + * @param {String} path + * @api private + */ + +function decode (path) { + try { + return decodeURIComponent(path) + } catch (err) { + return -1 + } +} + +/** + * Determine if emitter has listeners of a given type. + * + * The way to do this check is done three different ways in Node.js >= 0.10 + * so this consolidates them into a minimal set using instance methods. + * + * @param {EventEmitter} emitter + * @param {string} type + * @returns {boolean} + * @private + */ + +function hasListeners (emitter, type) { + var count = typeof emitter.listenerCount !== 'function' + ? emitter.listeners(type).length + : emitter.listenerCount(type) + + return count > 0 +} + +/** + * Normalize the index option into an array. + * + * @param {boolean|string|array} val + * @param {string} name + * @private + */ + +function normalizeList (val, name) { + var list = [].concat(val || []) + + for (var i = 0; i < list.length; i++) { + if (typeof list[i] !== 'string') { + throw new TypeError(name + ' must be array of strings or false') + } + } + + return list +} + +/** + * Parse an HTTP Date into a number. + * + * @param {string} date + * @private + */ + +function parseHttpDate (date) { + var timestamp = date && Date.parse(date) + + return typeof timestamp === 'number' + ? timestamp + : NaN +} + +/** + * Parse a HTTP token list. + * + * @param {string} str + * @private + */ + +function parseTokenList (str) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = str.length; i < len; i++) { + switch (str.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + if (start !== end) { + list.push(str.substring(start, end)) + } + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + if (start !== end) { + list.push(str.substring(start, end)) + } + + return list +} + +/** + * Set an object of headers on a response. + * + * @param {object} res + * @param {object} headers + * @private + */ + +function setHeaders (res, headers) { + var keys = Object.keys(headers) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + res.setHeader(key, headers[key]) + } +} diff --git a/node_modules/send/node_modules/debug/LICENSE b/node_modules/send/node_modules/debug/LICENSE new file mode 100644 index 0000000..1a9820e --- /dev/null +++ b/node_modules/send/node_modules/debug/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/send/node_modules/debug/README.md b/node_modules/send/node_modules/debug/README.md new file mode 100644 index 0000000..9ebdfbf --- /dev/null +++ b/node_modules/send/node_modules/debug/README.md @@ -0,0 +1,481 @@ +# debug +[![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// โ€ฆelsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console willโ€”by defaultโ€”only show messages logged by `debug` if the "Verbose" log level is _enabled_. + + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + +## Usage in child processes + +Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. +For example: + +```javascript +worker = fork(WORKER_WRAP_PATH, [workerPath], { + stdio: [ + /* stdin: */ 0, + /* stdout: */ 'pipe', + /* stderr: */ 'pipe', + 'ipc', + ], + env: Object.assign({}, process.env, { + DEBUG_COLORS: 1 // without this settings, colors won't be shown + }), +}); + +worker.stderr.pipe(process.stderr, { end: false }); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + - Josh Junon + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/node_modules/debug/package.json b/node_modules/send/node_modules/debug/package.json new file mode 100644 index 0000000..afc2f8b --- /dev/null +++ b/node_modules/send/node_modules/debug/package.json @@ -0,0 +1,64 @@ +{ + "name": "debug", + "version": "4.4.1", + "repository": { + "type": "git", + "url": "git://github.com/debug-js/debug.git" + }, + "description": "Lightweight debugging utility for Node.js and the browser", + "keywords": [ + "debug", + "log", + "debugger" + ], + "files": [ + "src", + "LICENSE", + "README.md" + ], + "author": "Josh Junon (https://github.com/qix-)", + "contributors": [ + "TJ Holowaychuk ", + "Nathan Rajlich (http://n8.io)", + "Andrew Rhyne " + ], + "license": "MIT", + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:node": "mocha test.js test.node.js", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls" + }, + "dependencies": { + "ms": "^2.1.3" + }, + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "sinon": "^14.0.0", + "xo": "^0.23.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "engines": { + "node": ">=6.0" + }, + "xo": { + "rules": { + "import/extensions": "off" + } + } +} diff --git a/node_modules/send/node_modules/debug/src/browser.js b/node_modules/send/node_modules/debug/src/browser.js new file mode 100644 index 0000000..5993451 --- /dev/null +++ b/node_modules/send/node_modules/debug/src/browser.js @@ -0,0 +1,272 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + let m; + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + // eslint-disable-next-line no-return-assign + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && (m = navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)) && parseInt(m[1], 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug') || exports.storage.getItem('DEBUG') ; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/node_modules/send/node_modules/debug/src/common.js b/node_modules/send/node_modules/debug/src/common.js new file mode 100644 index 0000000..141cb57 --- /dev/null +++ b/node_modules/send/node_modules/debug/src/common.js @@ -0,0 +1,292 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + let namespacesCache; + let enabledCache; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => { + if (enableOverride !== null) { + return enableOverride; + } + if (namespacesCache !== createDebug.namespaces) { + namespacesCache = createDebug.namespaces; + enabledCache = createDebug.enabled(namespace); + } + + return enabledCache; + }, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.namespaces = namespaces; + + createDebug.names = []; + createDebug.skips = []; + + const split = (typeof namespaces === 'string' ? namespaces : '') + .trim() + .replace(/\s+/g, ',') + .split(',') + .filter(Boolean); + + for (const ns of split) { + if (ns[0] === '-') { + createDebug.skips.push(ns.slice(1)); + } else { + createDebug.names.push(ns); + } + } + } + + /** + * Checks if the given string matches a namespace template, honoring + * asterisks as wildcards. + * + * @param {String} search + * @param {String} template + * @return {Boolean} + */ + function matchesTemplate(search, template) { + let searchIndex = 0; + let templateIndex = 0; + let starIndex = -1; + let matchIndex = 0; + + while (searchIndex < search.length) { + if (templateIndex < template.length && (template[templateIndex] === search[searchIndex] || template[templateIndex] === '*')) { + // Match character or proceed with wildcard + if (template[templateIndex] === '*') { + starIndex = templateIndex; + matchIndex = searchIndex; + templateIndex++; // Skip the '*' + } else { + searchIndex++; + templateIndex++; + } + } else if (starIndex !== -1) { // eslint-disable-line no-negated-condition + // Backtrack to the last '*' and try to match more characters + templateIndex = starIndex + 1; + matchIndex++; + searchIndex = matchIndex; + } else { + return false; // No match + } + } + + // Handle trailing '*' in template + while (templateIndex < template.length && template[templateIndex] === '*') { + templateIndex++; + } + + return templateIndex === template.length; + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names, + ...createDebug.skips.map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + for (const skip of createDebug.skips) { + if (matchesTemplate(name, skip)) { + return false; + } + } + + for (const ns of createDebug.names) { + if (matchesTemplate(name, ns)) { + return true; + } + } + + return false; + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/node_modules/send/node_modules/debug/src/index.js b/node_modules/send/node_modules/debug/src/index.js new file mode 100644 index 0000000..bf4c57f --- /dev/null +++ b/node_modules/send/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/send/node_modules/debug/src/node.js b/node_modules/send/node_modules/debug/src/node.js new file mode 100644 index 0000000..715560a --- /dev/null +++ b/node_modules/send/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.formatWithOptions()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.formatWithOptions(exports.inspectOpts, ...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/node_modules/send/node_modules/encodeurl/LICENSE b/node_modules/send/node_modules/encodeurl/LICENSE new file mode 100644 index 0000000..8812229 --- /dev/null +++ b/node_modules/send/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/node_modules/encodeurl/README.md b/node_modules/send/node_modules/encodeurl/README.md new file mode 100644 index 0000000..3842493 --- /dev/null +++ b/node_modules/send/node_modules/encodeurl/README.md @@ -0,0 +1,109 @@ +# Encode URL + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +## Installation + +```sh +npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function accepts a URL and encodes all the non-URL code points (as UTF-8 byte sequences). It will not encode the "%" character unless it is not part of a valid sequence (`%20` will be left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as hard as it can to properly encode the given URL, including replacing any raw, unpaired surrogate pairs with the Unicode replacement character prior to encoding. + +## Examples + +### Encode a URL containing user-controlled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '

Location ' + escapeHtml(url) + ' not found

' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '

Redirecting to new site: ' + escapeHtml(location) + '

' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Similarities + +This function is _similar_ to the intrinsic function `encodeURI`. However, it will not encode: + +* The `\`, `^`, or `|` characters +* The `%` character when it's part of a valid sequence +* `[` and `]` (for IPv6 hostnames) +* Replaces raw, unpaired surrogate pairs with the Unicode replacement character + +As a result, the encoding aligns closely with the behavior in the [WHATWG URL specification][whatwg-url]. However, this package only encodes strings and does not do any URL parsing or formatting. + +It is expected that any output from `new URL(url)` will not change when used with this package, as the output has already been encoded. Additionally, if we were to encode before `new URL(url)`, we do not expect the before and after encoded formats to be parsed any differently. + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) diff --git a/node_modules/send/node_modules/encodeurl/index.js b/node_modules/send/node_modules/encodeurl/index.js new file mode 100644 index 0000000..a49ee5a --- /dev/null +++ b/node_modules/send/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x23-\x3B\x3D\x3F-\x5F\x61-\x7A\x7C\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/node_modules/send/node_modules/encodeurl/package.json b/node_modules/send/node_modules/encodeurl/package.json new file mode 100644 index 0000000..3133822 --- /dev/null +++ b/node_modules/send/node_modules/encodeurl/package.json @@ -0,0 +1,40 @@ +{ + "name": "encodeurl", + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "version": "2.0.0", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "repository": "pillarjs/encodeurl", + "devDependencies": { + "eslint": "5.11.1", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "2.5.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/send/node_modules/ms/index.js b/node_modules/send/node_modules/ms/index.js new file mode 100644 index 0000000..ea734fb --- /dev/null +++ b/node_modules/send/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function (val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/node_modules/send/node_modules/ms/license.md b/node_modules/send/node_modules/ms/license.md new file mode 100644 index 0000000..fa5d39b --- /dev/null +++ b/node_modules/send/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2020 Vercel, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/send/node_modules/ms/package.json b/node_modules/send/node_modules/ms/package.json new file mode 100644 index 0000000..4997189 --- /dev/null +++ b/node_modules/send/node_modules/ms/package.json @@ -0,0 +1,38 @@ +{ + "name": "ms", + "version": "2.1.3", + "description": "Tiny millisecond conversion utility", + "repository": "vercel/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "4.18.2", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1", + "prettier": "2.0.5" + } +} diff --git a/node_modules/send/node_modules/ms/readme.md b/node_modules/send/node_modules/ms/readme.md new file mode 100644 index 0000000..0fc1abb --- /dev/null +++ b/node_modules/send/node_modules/ms/readme.md @@ -0,0 +1,59 @@ +# ms + +![CI](https://github.com/vercel/ms/workflows/CI/badge.svg) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/send/node_modules/on-finished/HISTORY.md b/node_modules/send/node_modules/on-finished/HISTORY.md new file mode 100644 index 0000000..1917595 --- /dev/null +++ b/node_modules/send/node_modules/on-finished/HISTORY.md @@ -0,0 +1,98 @@ +2.4.1 / 2022-02-22 +================== + + * Fix error on early async hooks implementations + +2.4.0 / 2022-02-21 +================== + + * Prevent loss of async hooks context + +2.3.0 / 2015-05-26 +================== + + * Add defined behavior for HTTP `CONNECT` requests + * Add defined behavior for HTTP `Upgrade` requests + * deps: ee-first@1.1.1 + +2.2.1 / 2015-04-22 +================== + + * Fix `isFinished(req)` when data buffered + +2.2.0 / 2014-12-22 +================== + + * Add message object to callback arguments + +2.1.1 / 2014-10-22 +================== + + * Fix handling of pipelined requests + +2.1.0 / 2014-08-16 +================== + + * Check if `socket` is detached + * Return `undefined` for `isFinished` if state unknown + +2.0.0 / 2014-08-16 +================== + + * Add `isFinished` function + * Move to `jshttp` organization + * Remove support for plain socket argument + * Rename to `on-finished` + * Support both `req` and `res` as arguments + * deps: ee-first@1.0.5 + +1.2.2 / 2014-06-10 +================== + + * Reduce listeners added to emitters + - avoids "event emitter leak" warnings when used multiple times on same request + +1.2.1 / 2014-06-08 +================== + + * Fix returned value when already finished + +1.2.0 / 2014-06-05 +================== + + * Call callback when called on already-finished socket + +1.1.4 / 2014-05-27 +================== + + * Support node.js 0.8 + +1.1.3 / 2014-04-30 +================== + + * Make sure errors passed as instanceof `Error` + +1.1.2 / 2014-04-18 +================== + + * Default the `socket` to passed-in object + +1.1.1 / 2014-01-16 +================== + + * Rename module to `finished` + +1.1.0 / 2013-12-25 +================== + + * Call callback when called on already-errored socket + +1.0.1 / 2013-12-20 +================== + + * Actually pass the error to the callback + +1.0.0 / 2013-12-20 +================== + + * Initial release diff --git a/node_modules/send/node_modules/on-finished/LICENSE b/node_modules/send/node_modules/on-finished/LICENSE new file mode 100644 index 0000000..5931fd2 --- /dev/null +++ b/node_modules/send/node_modules/on-finished/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/send/node_modules/on-finished/README.md b/node_modules/send/node_modules/on-finished/README.md new file mode 100644 index 0000000..8973cde --- /dev/null +++ b/node_modules/send/node_modules/on-finished/README.md @@ -0,0 +1,162 @@ +# on-finished + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Execute a callback when a HTTP request closes, finishes, or errors. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install on-finished +``` + +## API + +```js +var onFinished = require('on-finished') +``` + +### onFinished(res, listener) + +Attach a listener to listen for the response to finish. The listener will +be invoked only once when the response finished. If the response finished +to an error, the first argument will contain the error. If the response +has already finished, the listener will be invoked. + +Listening to the end of a response would be used to close things associated +with the response, like open files. + +Listener is invoked as `listener(err, res)`. + + + +```js +onFinished(res, function (err, res) { + // clean up open fds, etc. + // err contains the error if request error'd +}) +``` + +### onFinished(req, listener) + +Attach a listener to listen for the request to finish. The listener will +be invoked only once when the request finished. If the request finished +to an error, the first argument will contain the error. If the request +has already finished, the listener will be invoked. + +Listening to the end of a request would be used to know when to continue +after reading the data. + +Listener is invoked as `listener(err, req)`. + + + +```js +var data = '' + +req.setEncoding('utf8') +req.on('data', function (str) { + data += str +}) + +onFinished(req, function (err, req) { + // data is read unless there is err +}) +``` + +### onFinished.isFinished(res) + +Determine if `res` is already finished. This would be useful to check and +not even start certain operations if the response has already finished. + +### onFinished.isFinished(req) + +Determine if `req` is already finished. This would be useful to check and +not even start certain operations if the request has already finished. + +## Special Node.js requests + +### HTTP CONNECT method + +The meaning of the `CONNECT` method from RFC 7231, section 4.3.6: + +> The CONNECT method requests that the recipient establish a tunnel to +> the destination origin server identified by the request-target and, +> if successful, thereafter restrict its behavior to blind forwarding +> of packets, in both directions, until the tunnel is closed. Tunnels +> are commonly used to create an end-to-end virtual connection, through +> one or more proxies, which can then be secured using TLS (Transport +> Layer Security, [RFC5246]). + +In Node.js, these request objects come from the `'connect'` event on +the HTTP server. + +When this module is used on a HTTP `CONNECT` request, the request is +considered "finished" immediately, **due to limitations in the Node.js +interface**. This means if the `CONNECT` request contains a request entity, +the request will be considered "finished" even before it has been read. + +There is no such thing as a response object to a `CONNECT` request in +Node.js, so there is no support for one. + +### HTTP Upgrade request + +The meaning of the `Upgrade` header from RFC 7230, section 6.1: + +> The "Upgrade" header field is intended to provide a simple mechanism +> for transitioning from HTTP/1.1 to some other protocol on the same +> connection. + +In Node.js, these request objects come from the `'upgrade'` event on +the HTTP server. + +When this module is used on a HTTP request with an `Upgrade` header, the +request is considered "finished" immediately, **due to limitations in the +Node.js interface**. This means if the `Upgrade` request contains a request +entity, the request will be considered "finished" even before it has been +read. + +There is no such thing as a response object to a `Upgrade` request in +Node.js, so there is no support for one. + +## Example + +The following code ensures that file descriptors are always closed +once the response finishes. + +```js +var destroy = require('destroy') +var fs = require('fs') +var http = require('http') +var onFinished = require('on-finished') + +http.createServer(function onRequest (req, res) { + var stream = fs.createReadStream('package.json') + stream.pipe(res) + onFinished(res, function () { + destroy(stream) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/on-finished/master?label=ci +[ci-url]: https://github.com/jshttp/on-finished/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/on-finished/master +[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master +[node-image]: https://badgen.net/npm/node/on-finished +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/on-finished +[npm-url]: https://npmjs.org/package/on-finished +[npm-version-image]: https://badgen.net/npm/v/on-finished diff --git a/node_modules/send/node_modules/on-finished/index.js b/node_modules/send/node_modules/on-finished/index.js new file mode 100644 index 0000000..e68df7b --- /dev/null +++ b/node_modules/send/node_modules/on-finished/index.js @@ -0,0 +1,234 @@ +/*! + * on-finished + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onFinished +module.exports.isFinished = isFinished + +/** + * Module dependencies. + * @private + */ + +var asyncHooks = tryRequireAsyncHooks() +var first = require('ee-first') + +/** + * Variables. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function (fn) { process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Invoke callback when the response has finished, useful for + * cleaning up resources afterwards. + * + * @param {object} msg + * @param {function} listener + * @return {object} + * @public + */ + +function onFinished (msg, listener) { + if (isFinished(msg) !== false) { + defer(listener, null, msg) + return msg + } + + // attach the listener to the message + attachListener(msg, wrap(listener)) + + return msg +} + +/** + * Determine if message is already finished. + * + * @param {object} msg + * @return {boolean} + * @public + */ + +function isFinished (msg) { + var socket = msg.socket + + if (typeof msg.finished === 'boolean') { + // OutgoingMessage + return Boolean(msg.finished || (socket && !socket.writable)) + } + + if (typeof msg.complete === 'boolean') { + // IncomingMessage + return Boolean(msg.upgrade || !socket || !socket.readable || (msg.complete && !msg.readable)) + } + + // don't know + return undefined +} + +/** + * Attach a finished listener to the message. + * + * @param {object} msg + * @param {function} callback + * @private + */ + +function attachFinishedListener (msg, callback) { + var eeMsg + var eeSocket + var finished = false + + function onFinish (error) { + eeMsg.cancel() + eeSocket.cancel() + + finished = true + callback(error) + } + + // finished on first message event + eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish) + + function onSocket (socket) { + // remove listener + msg.removeListener('socket', onSocket) + + if (finished) return + if (eeMsg !== eeSocket) return + + // finished on first socket event + eeSocket = first([[socket, 'error', 'close']], onFinish) + } + + if (msg.socket) { + // socket already assigned + onSocket(msg.socket) + return + } + + // wait for socket to be assigned + msg.on('socket', onSocket) + + if (msg.socket === undefined) { + // istanbul ignore next: node.js 0.8 patch + patchAssignSocket(msg, onSocket) + } +} + +/** + * Attach the listener to the message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function attachListener (msg, listener) { + var attached = msg.__onFinished + + // create a private single listener with queue + if (!attached || !attached.queue) { + attached = msg.__onFinished = createListener(msg) + attachFinishedListener(msg, attached) + } + + attached.queue.push(listener) +} + +/** + * Create listener on message. + * + * @param {object} msg + * @return {function} + * @private + */ + +function createListener (msg) { + function listener (err) { + if (msg.__onFinished === listener) msg.__onFinished = null + if (!listener.queue) return + + var queue = listener.queue + listener.queue = null + + for (var i = 0; i < queue.length; i++) { + queue[i](err, msg) + } + } + + listener.queue = [] + + return listener +} + +/** + * Patch ServerResponse.prototype.assignSocket for node.js 0.8. + * + * @param {ServerResponse} res + * @param {function} callback + * @private + */ + +// istanbul ignore next: node.js 0.8 patch +function patchAssignSocket (res, callback) { + var assignSocket = res.assignSocket + + if (typeof assignSocket !== 'function') return + + // res.on('socket', callback) is broken in 0.8 + res.assignSocket = function _assignSocket (socket) { + assignSocket.call(this, socket) + callback(socket) + } +} + +/** + * Try to require async_hooks + * @private + */ + +function tryRequireAsyncHooks () { + try { + return require('async_hooks') + } catch (e) { + return {} + } +} + +/** + * Wrap function with async resource, if possible. + * AsyncResource.bind static method backported. + * @private + */ + +function wrap (fn) { + var res + + // create anonymous resource + if (asyncHooks.AsyncResource) { + res = new asyncHooks.AsyncResource(fn.name || 'bound-anonymous-fn') + } + + // incompatible node.js + if (!res || !res.runInAsyncScope) { + return fn + } + + // return bound function + return res.runInAsyncScope.bind(res, fn, null) +} diff --git a/node_modules/send/node_modules/on-finished/package.json b/node_modules/send/node_modules/on-finished/package.json new file mode 100644 index 0000000..644cd81 --- /dev/null +++ b/node_modules/send/node_modules/on-finished/package.json @@ -0,0 +1,39 @@ +{ + "name": "on-finished", + "description": "Execute a callback when a request closes, finishes, or errors", + "version": "2.4.1", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "jshttp/on-finished", + "dependencies": { + "ee-first": "1.1.1" + }, + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.1", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + } +} diff --git a/node_modules/send/node_modules/statuses/HISTORY.md b/node_modules/send/node_modules/statuses/HISTORY.md new file mode 100644 index 0000000..dc549b8 --- /dev/null +++ b/node_modules/send/node_modules/statuses/HISTORY.md @@ -0,0 +1,87 @@ +2.0.2 / 2025-06-06 +================== + + * Migrate to `String.prototype.slice()` + +2.0.1 / 2021-01-03 +================== + + * Fix returning values from `Object.prototype` + +2.0.0 / 2020-04-19 +================== + + * Drop support for Node.js 0.6 + * Fix messaging casing of `418 I'm a Teapot` + * Remove code 306 + * Remove `status[code]` exports; use `status.message[code]` + * Remove `status[msg]` exports; use `status.code[msg]` + * Rename `425 Unordered Collection` to standard `425 Too Early` + * Rename `STATUS_CODES` export to `message` + * Return status message for `statuses(code)` when given code + +1.5.0 / 2018-03-27 +================== + + * Add `103 Early Hints` + +1.4.0 / 2017-10-20 +================== + + * Add `STATUS_CODES` export + +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/node_modules/send/node_modules/statuses/LICENSE b/node_modules/send/node_modules/statuses/LICENSE new file mode 100644 index 0000000..28a3161 --- /dev/null +++ b/node_modules/send/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/send/node_modules/statuses/README.md b/node_modules/send/node_modules/statuses/README.md new file mode 100644 index 0000000..89d542f --- /dev/null +++ b/node_modules/send/node_modules/statuses/README.md @@ -0,0 +1,139 @@ +# statuses + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] +[![OpenSSF Scorecard Badge][ossf-scorecard-badge]][ossf-scorecard-visualizer] + +HTTP status utility for node. + +This module provides a list of status codes and messages sourced from +a few different projects: + + * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml) + * The [Node.js project](https://nodejs.org/) + * The [NGINX project](https://www.nginx.com/) + * The [Apache HTTP Server project](https://httpd.apache.org/) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install statuses +``` + +## API + + + +```js +var status = require('statuses') +``` + +### status(code) + +Returns the status message string for a known HTTP status code. The code +may be a number or a string. An error is thrown for an unknown status code. + + + +```js +status(403) // => 'Forbidden' +status('403') // => 'Forbidden' +status(306) // throws +``` + +### status(msg) + +Returns the numeric status code for a known HTTP status message. The message +is case-insensitive. An error is thrown for an unknown status message. + + + +```js +status('forbidden') // => 403 +status('Forbidden') // => 403 +status('foo') // throws +``` + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### status.code[msg] + +Returns the numeric status code for a known status message (in lower-case), +otherwise `undefined`. + + + +```js +status['not found'] // => 404 +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + + + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.message[code] + +Returns the string message for a known numeric status code, otherwise +`undefined`. This object is the same format as the +[Node.js http module `http.STATUS_CODES`](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes). + + + +```js +status.message[404] // => 'Not Found' +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + + + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + + + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/statuses/master?label=ci +[ci-url]: https://github.com/jshttp/statuses/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/statuses/master +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[node-version-image]: https://badgen.net/npm/node/statuses +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/statuses +[npm-url]: https://npmjs.org/package/statuses +[npm-version-image]: https://badgen.net/npm/v/statuses +[ossf-scorecard-badge]: https://api.securityscorecards.dev/projects/github.com/jshttp/statuses/badge +[ossf-scorecard-visualizer]: https://kooltheba.github.io/openssf-scorecard-api-visualizer/#/projects/github.com/jshttp/statuses diff --git a/node_modules/send/node_modules/statuses/codes.json b/node_modules/send/node_modules/statuses/codes.json new file mode 100644 index 0000000..1333ed1 --- /dev/null +++ b/node_modules/send/node_modules/statuses/codes.json @@ -0,0 +1,65 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "103": "Early Hints", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a Teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Too Early", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} diff --git a/node_modules/send/node_modules/statuses/index.js b/node_modules/send/node_modules/statuses/index.js new file mode 100644 index 0000000..ea351c5 --- /dev/null +++ b/node_modules/send/node_modules/statuses/index.js @@ -0,0 +1,146 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// status code to message map +status.message = codes + +// status message (lower-case) to code map +status.code = createMessageToStatusCodeMap(codes) + +// array of status codes +status.codes = createStatusCodeList(codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Create a map of message to status code. + * @private + */ + +function createMessageToStatusCodeMap (codes) { + var map = {} + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // populate map + map[message.toLowerCase()] = status + }) + + return map +} + +/** + * Create a list of all status codes. + * @private + */ + +function createStatusCodeList (codes) { + return Object.keys(codes).map(function mapCode (code) { + return Number(code) + }) +} + +/** + * Get the status code for given message. + * @private + */ + +function getStatusCode (message) { + var msg = message.toLowerCase() + + if (!Object.prototype.hasOwnProperty.call(status.code, msg)) { + throw new Error('invalid status message: "' + message + '"') + } + + return status.code[msg] +} + +/** + * Get the status message for given code. + * @private + */ + +function getStatusMessage (code) { + if (!Object.prototype.hasOwnProperty.call(status.message, code)) { + throw new Error('invalid status code: ' + code) + } + + return status.message[code] +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + return getStatusMessage(code) + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + return getStatusMessage(n) + } + + return getStatusCode(code) +} diff --git a/node_modules/send/node_modules/statuses/package.json b/node_modules/send/node_modules/statuses/package.json new file mode 100644 index 0000000..b5d016e --- /dev/null +++ b/node_modules/send/node_modules/statuses/package.json @@ -0,0 +1,49 @@ +{ + "name": "statuses", + "description": "HTTP status utility", + "version": "2.0.2", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "repository": "jshttp/statuses", + "license": "MIT", + "keywords": [ + "http", + "status", + "code" + ], + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "devDependencies": { + "csv-parse": "4.16.3", + "eslint": "7.19.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.31.0", + "eslint-plugin-markdown": "1.0.2", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "8.4.0", + "nyc": "15.1.0", + "raw-body": "2.5.2", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update": "npm run fetch && npm run build", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/send/package.json b/node_modules/send/package.json new file mode 100644 index 0000000..d6a969a --- /dev/null +++ b/node_modules/send/package.json @@ -0,0 +1,60 @@ +{ + "name": "send", + "description": "Better streaming static file server with Range and conditional-GET support", + "version": "1.2.0", + "author": "TJ Holowaychuk ", + "contributors": [ + "Douglas Christopher Wilson ", + "James Wyatt Cready ", + "Jesรบs Leganรฉs Combarro " + ], + "license": "MIT", + "repository": "pillarjs/send", + "keywords": [ + "static", + "file", + "server" + ], + "dependencies": { + "debug": "^4.3.5", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "etag": "^1.8.1", + "fresh": "^2.0.0", + "http-errors": "^2.0.0", + "mime-types": "^3.0.1", + "ms": "^2.1.3", + "on-finished": "^2.4.1", + "range-parser": "^1.2.1", + "statuses": "^2.0.1" + }, + "devDependencies": { + "after": "^0.8.2", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "^10.7.0", + "nyc": "^17.0.0", + "supertest": "6.2.2" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 18" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcovonly --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/serve-static/HISTORY.md b/node_modules/serve-static/HISTORY.md new file mode 100644 index 0000000..a3f174e --- /dev/null +++ b/node_modules/serve-static/HISTORY.md @@ -0,0 +1,516 @@ +2.2.0 / 2025-03-27 +================== + +* deps: send@^1.2.0 + +2.1.0 / 2024-09-10 +=================== + +* Changes from 1.16.0 +* deps: send@^1.2.0 + +2.0.0 / 2024-08-23 +================== + +* deps: + * parseurl@^1.3.3 + * excape-html@^1.0.3 + * encodeurl@^2.0.0 + * supertest@^6.3.4 + * safe-buffer@^5.2.1 + * nyc@^17.0.0 + * mocha@^10.7.0 +* Changes from 1.x + +2.0.0-beta.2 / 2024-03-20 +========================= + + * deps: send@1.0.0-beta.2 + +2.0.0-beta.1 / 2022-02-05 +========================= + + * Change `dotfiles` option default to `'ignore'` + * Drop support for Node.js 0.8 + * Remove `hidden` option; use `dotfiles` option instead + * Remove `mime` export; use `mime-types` package instead + * deps: send@1.0.0-beta.1 + - Use `mime-types` for file to content type mapping + - deps: debug@3.1.0 + +1.16.0 / 2024-09-10 +=================== + +* Remove link renderization in html while redirecting + +1.15.0 / 2022-03-24 +=================== + + * deps: send@0.18.0 + - Fix emitted 416 error missing headers property + - Limit the headers removed for 304 response + - deps: depd@2.0.0 + - deps: destroy@1.2.0 + - deps: http-errors@2.0.0 + - deps: on-finished@2.4.1 + - deps: statuses@2.0.1 + +1.14.2 / 2021-12-15 +=================== + + * deps: send@0.17.2 + - deps: http-errors@1.8.1 + - deps: ms@2.1.3 + - pref: ignore empty http tokens + +1.14.1 / 2019-05-10 +=================== + + * Set stricter CSP header in redirect response + * deps: send@0.17.1 + - deps: range-parser@~1.2.1 + +1.14.0 / 2019-05-07 +=================== + + * deps: parseurl@~1.3.3 + * deps: send@0.17.0 + - deps: http-errors@~1.7.2 + - deps: mime@1.6.0 + - deps: ms@2.1.1 + - deps: statuses@~1.5.0 + - perf: remove redundant `path.normalize` call + +1.13.2 / 2018-02-07 +=================== + + * Fix incorrect end tag in redirects + * deps: encodeurl@~1.0.2 + - Fix encoding `%` as last character + * deps: send@0.16.2 + - deps: depd@~1.1.2 + - deps: encodeurl@~1.0.2 + - deps: statuses@~1.4.0 + +1.13.1 / 2017-09-29 +=================== + + * Fix regression when `root` is incorrectly set to a file + * deps: send@0.16.1 + +1.13.0 / 2017-09-27 +=================== + + * deps: send@0.16.0 + - Add 70 new types for file extensions + - Add `immutable` option + - Fix missing `` in default error & redirects + - Set charset as "UTF-8" for .js and .json + - Use instance methods on steam to check for listeners + - deps: mime@1.4.1 + - perf: improve path validation speed + +1.12.6 / 2017-09-22 +=================== + + * deps: send@0.15.6 + - deps: debug@2.6.9 + - perf: improve `If-Match` token parsing + * perf: improve slash collapsing + +1.12.5 / 2017-09-21 +=================== + + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + * deps: send@0.15.5 + - Fix handling of modified headers with invalid dates + - deps: etag@~1.8.1 + - deps: fresh@0.5.2 + +1.12.4 / 2017-08-05 +=================== + + * deps: send@0.15.4 + - deps: debug@2.6.8 + - deps: depd@~1.1.1 + - deps: http-errors@~1.6.2 + +1.12.3 / 2017-05-16 +=================== + + * deps: send@0.15.3 + - deps: debug@2.6.7 + +1.12.2 / 2017-04-26 +=================== + + * deps: send@0.15.2 + - deps: debug@2.6.4 + +1.12.1 / 2017-03-04 +=================== + + * deps: send@0.15.1 + - Fix issue when `Date.parse` does not return `NaN` on invalid date + - Fix strict violation in broken environments + +1.12.0 / 2017-02-25 +=================== + + * Send complete HTML document in redirect response + * Set default CSP header in redirect response + * deps: send@0.15.0 + - Fix false detection of `no-cache` request directive + - Fix incorrect result when `If-None-Match` has both `*` and ETags + - Fix weak `ETag` matching to match spec + - Remove usage of `res._headers` private field + - Support `If-Match` and `If-Unmodified-Since` headers + - Use `res.getHeaderNames()` when available + - Use `res.headersSent` when available + - deps: debug@2.6.1 + - deps: etag@~1.8.0 + - deps: fresh@0.5.0 + - deps: http-errors@~1.6.1 + +1.11.2 / 2017-01-23 +=================== + + * deps: send@0.14.2 + - deps: http-errors@~1.5.1 + - deps: ms@0.7.2 + - deps: statuses@~1.3.1 + +1.11.1 / 2016-06-10 +=================== + + * Fix redirect error when `req.url` contains raw non-URL characters + * deps: send@0.14.1 + +1.11.0 / 2016-06-07 +=================== + + * Use status code 301 for redirects + * deps: send@0.14.0 + - Add `acceptRanges` option + - Add `cacheControl` option + - Attempt to combine multiple ranges into single range + - Correctly inherit from `Stream` class + - Fix `Content-Range` header in 416 responses when using `start`/`end` options + - Fix `Content-Range` header missing from default 416 responses + - Ignore non-byte `Range` headers + - deps: http-errors@~1.5.0 + - deps: range-parser@~1.2.0 + - deps: statuses@~1.3.0 + - perf: remove argument reassignment + +1.10.3 / 2016-05-30 +=================== + + * deps: send@0.13.2 + - Fix invalid `Content-Type` header when `send.mime.default_type` unset + +1.10.2 / 2016-01-19 +=================== + + * deps: parseurl@~1.3.1 + - perf: enable strict mode + +1.10.1 / 2016-01-16 +=================== + + * deps: escape-html@~1.0.3 + - perf: enable strict mode + - perf: optimize string replacement + - perf: use faster string coercion + * deps: send@0.13.1 + - deps: depd@~1.1.0 + - deps: destroy@~1.0.4 + - deps: escape-html@~1.0.3 + - deps: range-parser@~1.0.3 + +1.10.0 / 2015-06-17 +=================== + + * Add `fallthrough` option + - Allows declaring this middleware is the final destination + - Provides better integration with Express patterns + * Fix reading options from options prototype + * Improve the default redirect response headers + * deps: escape-html@1.0.2 + * deps: send@0.13.0 + - Allow Node.js HTTP server to set `Date` response header + - Fix incorrectly removing `Content-Location` on 304 response + - Improve the default redirect response headers + - Send appropriate headers on default error response + - Use `http-errors` for standard emitted errors + - Use `statuses` instead of `http` module for status messages + - deps: escape-html@1.0.2 + - deps: etag@~1.7.0 + - deps: fresh@0.3.0 + - deps: on-finished@~2.3.0 + - perf: enable strict mode + - perf: remove unnecessary array allocations + * perf: enable strict mode + * perf: remove argument reassignment + +1.9.3 / 2015-05-14 +================== + + * deps: send@0.12.3 + - deps: debug@~2.2.0 + - deps: depd@~1.0.1 + - deps: etag@~1.6.0 + - deps: ms@0.7.1 + - deps: on-finished@~2.2.1 + +1.9.2 / 2015-03-14 +================== + + * deps: send@0.12.2 + - Throw errors early for invalid `extensions` or `index` options + - deps: debug@~2.1.3 + +1.9.1 / 2015-02-17 +================== + + * deps: send@0.12.1 + - Fix regression sending zero-length files + +1.9.0 / 2015-02-16 +================== + + * deps: send@0.12.0 + - Always read the stat size from the file + - Fix mutating passed-in `options` + - deps: mime@1.3.4 + +1.8.1 / 2015-01-20 +================== + + * Fix redirect loop in Node.js 0.11.14 + * deps: send@0.11.1 + - Fix root path disclosure + +1.8.0 / 2015-01-05 +================== + + * deps: send@0.11.0 + - deps: debug@~2.1.1 + - deps: etag@~1.5.1 + - deps: ms@0.7.0 + - deps: on-finished@~2.2.0 + +1.7.2 / 2015-01-02 +================== + + * Fix potential open redirect when mounted at root + +1.7.1 / 2014-10-22 +================== + + * deps: send@0.10.1 + - deps: on-finished@~2.1.1 + +1.7.0 / 2014-10-15 +================== + + * deps: send@0.10.0 + - deps: debug@~2.1.0 + - deps: depd@~1.0.0 + - deps: etag@~1.5.0 + +1.6.5 / 2015-02-04 +================== + + * Fix potential open redirect when mounted at root + - Back-ported from v1.7.2 + +1.6.4 / 2014-10-08 +================== + + * Fix redirect loop when index file serving disabled + +1.6.3 / 2014-09-24 +================== + + * deps: send@0.9.3 + - deps: etag@~1.4.0 + +1.6.2 / 2014-09-15 +================== + + * deps: send@0.9.2 + - deps: depd@0.4.5 + - deps: etag@~1.3.1 + - deps: range-parser@~1.0.2 + +1.6.1 / 2014-09-07 +================== + + * deps: send@0.9.1 + - deps: fresh@0.2.4 + +1.6.0 / 2014-09-07 +================== + + * deps: send@0.9.0 + - Add `lastModified` option + - Use `etag` to generate `ETag` header + - deps: debug@~2.0.0 + +1.5.4 / 2014-09-04 +================== + + * deps: send@0.8.5 + - Fix a path traversal issue when using `root` + - Fix malicious path detection for empty string path + +1.5.3 / 2014-08-17 +================== + + * deps: send@0.8.3 + +1.5.2 / 2014-08-14 +================== + + * deps: send@0.8.2 + - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream` + +1.5.1 / 2014-08-09 +================== + + * Fix parsing of weird `req.originalUrl` values + * deps: parseurl@~1.3.0 + * deps: utils-merge@1.0.0 + +1.5.0 / 2014-08-05 +================== + + * deps: send@0.8.1 + - Add `extensions` option + +1.4.4 / 2014-08-04 +================== + + * deps: send@0.7.4 + - Fix serving index files without root dir + +1.4.3 / 2014-07-29 +================== + + * deps: send@0.7.3 + - Fix incorrect 403 on Windows and Node.js 0.11 + +1.4.2 / 2014-07-27 +================== + + * deps: send@0.7.2 + - deps: depd@0.4.4 + +1.4.1 / 2014-07-26 +================== + + * deps: send@0.7.1 + - deps: depd@0.4.3 + +1.4.0 / 2014-07-21 +================== + + * deps: parseurl@~1.2.0 + - Cache URLs based on original value + - Remove no-longer-needed URL mis-parse work-around + - Simplify the "fast-path" `RegExp` + * deps: send@0.7.0 + - Add `dotfiles` option + - deps: debug@1.0.4 + - deps: depd@0.4.2 + +1.3.2 / 2014-07-11 +================== + + * deps: send@0.6.0 + - Cap `maxAge` value to 1 year + - deps: debug@1.0.3 + +1.3.1 / 2014-07-09 +================== + + * deps: parseurl@~1.1.3 + - faster parsing of href-only URLs + +1.3.0 / 2014-06-28 +================== + + * Add `setHeaders` option + * Include HTML link in redirect response + * deps: send@0.5.0 + - Accept string for `maxAge` (converted by `ms`) + +1.2.3 / 2014-06-11 +================== + + * deps: send@0.4.3 + - Do not throw un-catchable error on file open race condition + - Use `escape-html` for HTML escaping + - deps: debug@1.0.2 + - deps: finished@1.2.2 + - deps: fresh@0.2.2 + +1.2.2 / 2014-06-09 +================== + + * deps: send@0.4.2 + - fix "event emitter leak" warnings + - deps: debug@1.0.1 + - deps: finished@1.2.1 + +1.2.1 / 2014-06-02 +================== + + * use `escape-html` for escaping + * deps: send@0.4.1 + - Send `max-age` in `Cache-Control` in correct format + +1.2.0 / 2014-05-29 +================== + + * deps: send@0.4.0 + - Calculate ETag with md5 for reduced collisions + - Fix wrong behavior when index file matches directory + - Ignore stream errors after request ends + - Skip directories in index file search + - deps: debug@0.8.1 + +1.1.0 / 2014-04-24 +================== + + * Accept options directly to `send` module + * deps: send@0.3.0 + +1.0.4 / 2014-04-07 +================== + + * Resolve relative paths at middleware setup + * Use parseurl to parse the URL from request + +1.0.3 / 2014-03-20 +================== + + * Do not rely on connect-like environments + +1.0.2 / 2014-03-06 +================== + + * deps: send@0.2.0 + +1.0.1 / 2014-03-05 +================== + + * Add mime export for back-compat + +1.0.0 / 2014-03-05 +================== + + * Genesis from `connect` diff --git a/node_modules/serve-static/LICENSE b/node_modules/serve-static/LICENSE new file mode 100644 index 0000000..cbe62e8 --- /dev/null +++ b/node_modules/serve-static/LICENSE @@ -0,0 +1,25 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 LearnBoost +Copyright (c) 2011 TJ Holowaychuk +Copyright (c) 2014-2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/serve-static/README.md b/node_modules/serve-static/README.md new file mode 100644 index 0000000..70f01c3 --- /dev/null +++ b/node_modules/serve-static/README.md @@ -0,0 +1,253 @@ +# serve-static + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![CI][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install serve-static +``` + +## API + +```js +var serveStatic = require('serve-static') +``` + +### serveStatic(root, options) + +Create a new middleware function to serve files from within a given root +directory. The file to serve will be determined by combining `req.url` +with the provided root directory. When a file is not found, instead of +sending a 404 response, this module will instead call `next()` to move on +to the next middleware, allowing for stacking and fall-backs. + +#### Options + +##### acceptRanges + +Enable or disable accepting ranged requests, defaults to true. +Disabling this will not send `Accept-Ranges` and ignore the contents +of the `Range` request header. + +##### cacheControl + +Enable or disable setting `Cache-Control` response header, defaults to +true. Disabling this will ignore the `immutable` and `maxAge` options. + +##### dotfiles + +Set how "dotfiles" are treated when encountered. A dotfile is a file +or directory that begins with a dot ("."). Note this check is done on +the path itself without checking if the path actually exists on the +disk. If `root` is specified, only the dotfiles above the root are +checked (i.e. the root itself can be within a dotfile when set +to "deny"). + + - `'allow'` No special treatment for dotfiles. + - `'deny'` Deny a request for a dotfile and 403/`next()`. + - `'ignore'` Pretend like the dotfile does not exist and 404/`next()`. + +The default value is `'ignore'`. + +##### etag + +Enable or disable etag generation, defaults to true. + +##### extensions + +Set file extension fallbacks. When set, if a file is not found, the given +extensions will be added to the file name and search for. The first that +exists will be served. Example: `['html', 'htm']`. + +The default value is `false`. + +##### fallthrough + +Set the middleware to have client errors fall-through as just unhandled +requests, otherwise forward a client error. The difference is that client +errors like a bad request or a request to a non-existent file will cause +this middleware to simply `next()` to your next middleware when this value +is `true`. When this value is `false`, these errors (even 404s), will invoke +`next(err)`. + +Typically `true` is desired such that multiple physical directories can be +mapped to the same web address or for routes to fill in non-existent files. + +The value `false` can be used if this middleware is mounted at a path that +is designed to be strictly a single file system directory, which allows for +short-circuiting 404s for less overhead. This middleware will also reply to +all methods. + +The default value is `true`. + +##### immutable + +Enable or disable the `immutable` directive in the `Cache-Control` response +header, defaults to `false`. If set to `true`, the `maxAge` option should +also be specified to enable caching. The `immutable` directive will prevent +supported clients from making conditional requests during the life of the +`maxAge` option to check if the file has changed. + +##### index + +By default this module will send "index.html" files in response to a request +on a directory. To disable this set `false` or to supply a new index pass a +string or an array in preferred order. + +##### lastModified + +Enable or disable `Last-Modified` header, defaults to true. Uses the file +system's last modified value. + +##### maxAge + +Provide a max-age in milliseconds for http caching, defaults to 0. This +can also be a string accepted by the [ms](https://www.npmjs.org/package/ms#readme) +module. + +##### redirect + +Redirect to trailing "/" when the pathname is a dir. Defaults to `true`. + +##### setHeaders + +Function to set custom headers on response. Alterations to the headers need to +occur synchronously. The function is called as `fn(res, path, stat)`, where +the arguments are: + + - `res` the response object + - `path` the file path that is being sent + - `stat` the stat object of the file that is being sent + +## Examples + +### Serve files with vanilla node.js http server + +```js +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { index: ['index.html', 'index.htm'] }) + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serve all files as downloads + +```js +var contentDisposition = require('content-disposition') +var finalhandler = require('finalhandler') +var http = require('http') +var serveStatic = require('serve-static') + +// Serve up public/ftp folder +var serve = serveStatic('public/ftp', { + index: false, + setHeaders: setHeaders +}) + +// Set header to force download +function setHeaders (res, path) { + res.setHeader('Content-Disposition', contentDisposition(path)) +} + +// Create server +var server = http.createServer(function onRequest (req, res) { + serve(req, res, finalhandler(req, res)) +}) + +// Listen +server.listen(3000) +``` + +### Serving using express + +#### Simple + +This is a simple example of using Express. + +```js +var express = require('express') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic('public/ftp', { index: ['default.html', 'default.htm'] })) +app.listen(3000) +``` + +#### Multiple roots + +This example shows a simple way to search through multiple directories. +Files are searched for in `public-optimized/` first, then `public/` second +as a fallback. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public-optimized'))) +app.use(serveStatic(path.join(__dirname, 'public'))) +app.listen(3000) +``` + +#### Different settings for paths + +This example shows how to set a different max age depending on the served +file. In this example, HTML files are not cached, while everything else +is for 1 day. + +```js +var express = require('express') +var path = require('path') +var serveStatic = require('serve-static') + +var app = express() + +app.use(serveStatic(path.join(__dirname, 'public'), { + maxAge: '1d', + setHeaders: setCustomCacheControl +})) + +app.listen(3000) + +function setCustomCacheControl (res, file) { + if (path.extname(file) === '.html') { + // Custom Cache-Control for HTML files + res.setHeader('Cache-Control', 'public, max-age=0') + } +} +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/serve-static/master +[coveralls-url]: https://coveralls.io/r/expressjs/serve-static?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/expressjs/serve-static/master?label=linux +[github-actions-ci-url]: https://github.com/expressjs/serve-static/actions/workflows/ci.yml +[node-image]: https://badgen.net/npm/node/serve-static +[node-url]: https://nodejs.org/en/download/ +[npm-downloads-image]: https://badgen.net/npm/dm/serve-static +[npm-url]: https://npmjs.org/package/serve-static +[npm-version-image]: https://badgen.net/npm/v/serve-static diff --git a/node_modules/serve-static/index.js b/node_modules/serve-static/index.js new file mode 100644 index 0000000..1bee463 --- /dev/null +++ b/node_modules/serve-static/index.js @@ -0,0 +1,208 @@ +/*! + * serve-static + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014-2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var parseUrl = require('parseurl') +var resolve = require('path').resolve +var send = require('send') +var url = require('url') + +/** + * Module exports. + * @public + */ + +module.exports = serveStatic + +/** + * @param {string} root + * @param {object} [options] + * @return {function} + * @public + */ + +function serveStatic (root, options) { + if (!root) { + throw new TypeError('root path required') + } + + if (typeof root !== 'string') { + throw new TypeError('root path must be a string') + } + + // copy options object + var opts = Object.create(options || null) + + // fall-though + var fallthrough = opts.fallthrough !== false + + // default redirect + var redirect = opts.redirect !== false + + // headers listener + var setHeaders = opts.setHeaders + + if (setHeaders && typeof setHeaders !== 'function') { + throw new TypeError('option setHeaders must be function') + } + + // setup options for send + opts.maxage = opts.maxage || opts.maxAge || 0 + opts.root = resolve(root) + + // construct directory listener + var onDirectory = redirect + ? createRedirectDirectoryListener() + : createNotFoundDirectoryListener() + + return function serveStatic (req, res, next) { + if (req.method !== 'GET' && req.method !== 'HEAD') { + if (fallthrough) { + return next() + } + + // method not allowed + res.statusCode = 405 + res.setHeader('Allow', 'GET, HEAD') + res.setHeader('Content-Length', '0') + res.end() + return + } + + var forwardError = !fallthrough + var originalUrl = parseUrl.original(req) + var path = parseUrl(req).pathname + + // make sure redirect occurs at mount + if (path === '/' && originalUrl.pathname.substr(-1) !== '/') { + path = '' + } + + // create send stream + var stream = send(req, path, opts) + + // add directory handler + stream.on('directory', onDirectory) + + // add headers listener + if (setHeaders) { + stream.on('headers', setHeaders) + } + + // add file listener for fallthrough + if (fallthrough) { + stream.on('file', function onFile () { + // once file is determined, always forward error + forwardError = true + }) + } + + // forward errors + stream.on('error', function error (err) { + if (forwardError || !(err.statusCode < 500)) { + next(err) + return + } + + next() + }) + + // pipe + stream.pipe(res) + } +} + +/** + * Collapse all leading slashes into a single slash + * @private + */ +function collapseLeadingSlashes (str) { + for (var i = 0; i < str.length; i++) { + if (str.charCodeAt(i) !== 0x2f /* / */) { + break + } + } + + return i > 1 + ? '/' + str.substr(i) + : str +} + +/** + * Create a minimal HTML document. + * + * @param {string} title + * @param {string} body + * @private + */ + +function createHtmlDocument (title, body) { + return '\n' + + '\n' + + '\n' + + '\n' + + '' + title + '\n' + + '\n' + + '\n' + + '
' + body + '
\n' + + '\n' + + '\n' +} + +/** + * Create a directory listener that just 404s. + * @private + */ + +function createNotFoundDirectoryListener () { + return function notFound () { + this.error(404) + } +} + +/** + * Create a directory listener that performs a redirect. + * @private + */ + +function createRedirectDirectoryListener () { + return function redirect (res) { + if (this.hasTrailingSlash()) { + this.error(404) + return + } + + // get original URL + var originalUrl = parseUrl.original(this.req) + + // append trailing slash + originalUrl.path = null + originalUrl.pathname = collapseLeadingSlashes(originalUrl.pathname + '/') + + // reformat the URL + var loc = encodeUrl(url.format(originalUrl)) + var doc = createHtmlDocument('Redirecting', 'Redirecting to ' + escapeHtml(loc)) + + // send redirect response + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', Buffer.byteLength(doc)) + res.setHeader('Content-Security-Policy', "default-src 'none'") + res.setHeader('X-Content-Type-Options', 'nosniff') + res.setHeader('Location', loc) + res.end(doc) + } +} diff --git a/node_modules/serve-static/node_modules/encodeurl/LICENSE b/node_modules/serve-static/node_modules/encodeurl/LICENSE new file mode 100644 index 0000000..8812229 --- /dev/null +++ b/node_modules/serve-static/node_modules/encodeurl/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/serve-static/node_modules/encodeurl/README.md b/node_modules/serve-static/node_modules/encodeurl/README.md new file mode 100644 index 0000000..3842493 --- /dev/null +++ b/node_modules/serve-static/node_modules/encodeurl/README.md @@ -0,0 +1,109 @@ +# Encode URL + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +## Installation + +```sh +npm install encodeurl +``` + +## API + +```js +var encodeUrl = require('encodeurl') +``` + +### encodeUrl(url) + +Encode a URL to a percent-encoded form, excluding already-encoded sequences. + +This function accepts a URL and encodes all the non-URL code points (as UTF-8 byte sequences). It will not encode the "%" character unless it is not part of a valid sequence (`%20` will be left as-is, but `%foo` will be encoded as `%25foo`). + +This encode is meant to be "safe" and does not throw errors. It will try as hard as it can to properly encode the given URL, including replacing any raw, unpaired surrogate pairs with the Unicode replacement character prior to encoding. + +## Examples + +### Encode a URL containing user-controlled data + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') + +http.createServer(function onRequest (req, res) { + // get encoded form of inbound url + var url = encodeUrl(req.url) + + // create html message + var body = '

Location ' + escapeHtml(url) + ' not found

' + + // send a 404 + res.statusCode = 404 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.end(body, 'utf-8') +}) +``` + +### Encode a URL for use in a header field + +```js +var encodeUrl = require('encodeurl') +var escapeHtml = require('escape-html') +var url = require('url') + +http.createServer(function onRequest (req, res) { + // parse inbound url + var href = url.parse(req) + + // set new host for redirect + href.host = 'localhost' + href.protocol = 'https:' + href.slashes = true + + // create location header + var location = encodeUrl(url.format(href)) + + // create html message + var body = '

Redirecting to new site: ' + escapeHtml(location) + '

' + + // send a 301 + res.statusCode = 301 + res.setHeader('Content-Type', 'text/html; charset=UTF-8') + res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8'))) + res.setHeader('Location', location) + res.end(body, 'utf-8') +}) +``` + +## Similarities + +This function is _similar_ to the intrinsic function `encodeURI`. However, it will not encode: + +* The `\`, `^`, or `|` characters +* The `%` character when it's part of a valid sequence +* `[` and `]` (for IPv6 hostnames) +* Replaces raw, unpaired surrogate pairs with the Unicode replacement character + +As a result, the encoding aligns closely with the behavior in the [WHATWG URL specification][whatwg-url]. However, this package only encodes strings and does not do any URL parsing or formatting. + +It is expected that any output from `new URL(url)` will not change when used with this package, as the output has already been encoded. Additionally, if we were to encode before `new URL(url)`, we do not expect the before and after encoded formats to be parsed any differently. + +## Testing + +```sh +$ npm test +$ npm run lint +``` + +## References + +- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986] +- [WHATWG URL Living Standard][whatwg-url] + +[rfc-3986]: https://tools.ietf.org/html/rfc3986 +[whatwg-url]: https://url.spec.whatwg.org/ + +## License + +[MIT](LICENSE) diff --git a/node_modules/serve-static/node_modules/encodeurl/index.js b/node_modules/serve-static/node_modules/encodeurl/index.js new file mode 100644 index 0000000..a49ee5a --- /dev/null +++ b/node_modules/serve-static/node_modules/encodeurl/index.js @@ -0,0 +1,60 @@ +/*! + * encodeurl + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = encodeUrl + +/** + * RegExp to match non-URL code points, *after* encoding (i.e. not including "%") + * and including invalid escape sequences. + * @private + */ + +var ENCODE_CHARS_REGEXP = /(?:[^\x21\x23-\x3B\x3D\x3F-\x5F\x61-\x7A\x7C\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g + +/** + * RegExp to match unmatched surrogate pair. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g + +/** + * String to replace unmatched surrogate pair with. + * @private + */ + +var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2' + +/** + * Encode a URL to a percent-encoded form, excluding already-encoded sequences. + * + * This function will take an already-encoded URL and encode all the non-URL + * code points. This function will not encode the "%" character unless it is + * not part of a valid sequence (`%20` will be left as-is, but `%foo` will + * be encoded as `%25foo`). + * + * This encode is meant to be "safe" and does not throw errors. It will try as + * hard as it can to properly encode the given URL, including replacing any raw, + * unpaired surrogate pairs with the Unicode replacement character prior to + * encoding. + * + * @param {string} url + * @return {string} + * @public + */ + +function encodeUrl (url) { + return String(url) + .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE) + .replace(ENCODE_CHARS_REGEXP, encodeURI) +} diff --git a/node_modules/serve-static/node_modules/encodeurl/package.json b/node_modules/serve-static/node_modules/encodeurl/package.json new file mode 100644 index 0000000..3133822 --- /dev/null +++ b/node_modules/serve-static/node_modules/encodeurl/package.json @@ -0,0 +1,40 @@ +{ + "name": "encodeurl", + "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences", + "version": "2.0.0", + "contributors": [ + "Douglas Christopher Wilson " + ], + "license": "MIT", + "keywords": [ + "encode", + "encodeurl", + "url" + ], + "repository": "pillarjs/encodeurl", + "devDependencies": { + "eslint": "5.11.1", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.14.0", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "2.5.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/serve-static/package.json b/node_modules/serve-static/package.json new file mode 100644 index 0000000..38d3365 --- /dev/null +++ b/node_modules/serve-static/package.json @@ -0,0 +1,41 @@ +{ + "name": "serve-static", + "description": "Serve static files", + "version": "2.2.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "repository": "expressjs/serve-static", + "dependencies": { + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "parseurl": "^1.3.3", + "send": "^1.2.0" + }, + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "mocha": "^10.7.0", + "nyc": "^17.0.0", + "supertest": "^6.3.4" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 18" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/setprototypeof/LICENSE b/node_modules/setprototypeof/LICENSE new file mode 100644 index 0000000..61afa2f --- /dev/null +++ b/node_modules/setprototypeof/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2015, Wes Todd + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY +SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION +OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN +CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/setprototypeof/README.md b/node_modules/setprototypeof/README.md new file mode 100644 index 0000000..791eeff --- /dev/null +++ b/node_modules/setprototypeof/README.md @@ -0,0 +1,31 @@ +# Polyfill for `Object.setPrototypeOf` + +[![NPM Version](https://img.shields.io/npm/v/setprototypeof.svg)](https://npmjs.org/package/setprototypeof) +[![NPM Downloads](https://img.shields.io/npm/dm/setprototypeof.svg)](https://npmjs.org/package/setprototypeof) +[![js-standard-style](https://img.shields.io/badge/code%20style-standard-brightgreen.svg)](https://github.com/standard/standard) + +A simple cross platform implementation to set the prototype of an instianted object. Supports all modern browsers and at least back to IE8. + +## Usage: + +``` +$ npm install --save setprototypeof +``` + +```javascript +var setPrototypeOf = require('setprototypeof') + +var obj = {} +setPrototypeOf(obj, { + foo: function () { + return 'bar' + } +}) +obj.foo() // bar +``` + +TypeScript is also supported: + +```typescript +import setPrototypeOf from 'setprototypeof' +``` diff --git a/node_modules/setprototypeof/index.d.ts b/node_modules/setprototypeof/index.d.ts new file mode 100644 index 0000000..f108ecd --- /dev/null +++ b/node_modules/setprototypeof/index.d.ts @@ -0,0 +1,2 @@ +declare function setPrototypeOf(o: any, proto: object | null): any; +export = setPrototypeOf; diff --git a/node_modules/setprototypeof/index.js b/node_modules/setprototypeof/index.js new file mode 100644 index 0000000..c527055 --- /dev/null +++ b/node_modules/setprototypeof/index.js @@ -0,0 +1,17 @@ +'use strict' +/* eslint no-proto: 0 */ +module.exports = Object.setPrototypeOf || ({ __proto__: [] } instanceof Array ? setProtoOf : mixinProperties) + +function setProtoOf (obj, proto) { + obj.__proto__ = proto + return obj +} + +function mixinProperties (obj, proto) { + for (var prop in proto) { + if (!Object.prototype.hasOwnProperty.call(obj, prop)) { + obj[prop] = proto[prop] + } + } + return obj +} diff --git a/node_modules/setprototypeof/package.json b/node_modules/setprototypeof/package.json new file mode 100644 index 0000000..f20915b --- /dev/null +++ b/node_modules/setprototypeof/package.json @@ -0,0 +1,38 @@ +{ + "name": "setprototypeof", + "version": "1.2.0", + "description": "A small polyfill for Object.setprototypeof", + "main": "index.js", + "typings": "index.d.ts", + "scripts": { + "test": "standard && mocha", + "testallversions": "npm run node010 && npm run node4 && npm run node6 && npm run node9 && npm run node11", + "testversion": "docker run -it --rm -v $(PWD):/usr/src/app -w /usr/src/app node:${NODE_VER} npm install mocha@${MOCHA_VER:-latest} && npm t", + "node010": "NODE_VER=0.10 MOCHA_VER=3 npm run testversion", + "node4": "NODE_VER=4 npm run testversion", + "node6": "NODE_VER=6 npm run testversion", + "node9": "NODE_VER=9 npm run testversion", + "node11": "NODE_VER=11 npm run testversion", + "prepublishOnly": "npm t", + "postpublish": "git push origin && git push origin --tags" + }, + "repository": { + "type": "git", + "url": "https://github.com/wesleytodd/setprototypeof.git" + }, + "keywords": [ + "polyfill", + "object", + "setprototypeof" + ], + "author": "Wes Todd", + "license": "ISC", + "bugs": { + "url": "https://github.com/wesleytodd/setprototypeof/issues" + }, + "homepage": "https://github.com/wesleytodd/setprototypeof", + "devDependencies": { + "mocha": "^6.1.4", + "standard": "^13.0.2" + } +} diff --git a/node_modules/setprototypeof/test/index.js b/node_modules/setprototypeof/test/index.js new file mode 100644 index 0000000..afeb4dd --- /dev/null +++ b/node_modules/setprototypeof/test/index.js @@ -0,0 +1,24 @@ +'use strict' +/* eslint-env mocha */ +/* eslint no-proto: 0 */ +var assert = require('assert') +var setPrototypeOf = require('..') + +describe('setProtoOf(obj, proto)', function () { + it('should merge objects', function () { + var obj = { a: 1, b: 2 } + var proto = { b: 3, c: 4 } + var mergeObj = setPrototypeOf(obj, proto) + + if (Object.getPrototypeOf) { + assert.strictEqual(Object.getPrototypeOf(obj), proto) + } else if ({ __proto__: [] } instanceof Array) { + assert.strictEqual(obj.__proto__, proto) + } else { + assert.strictEqual(obj.a, 1) + assert.strictEqual(obj.b, 2) + assert.strictEqual(obj.c, 4) + } + assert.strictEqual(mergeObj, obj) + }) +}) diff --git a/node_modules/statuses/HISTORY.md b/node_modules/statuses/HISTORY.md new file mode 100644 index 0000000..a1977b2 --- /dev/null +++ b/node_modules/statuses/HISTORY.md @@ -0,0 +1,65 @@ +1.5.0 / 2018-03-27 +================== + + * Add `103 Early Hints` + +1.4.0 / 2017-10-20 +================== + + * Add `STATUS_CODES` export + +1.3.1 / 2016-11-11 +================== + + * Fix return type in JSDoc + +1.3.0 / 2016-05-17 +================== + + * Add `421 Misdirected Request` + * perf: enable strict mode + +1.2.1 / 2015-02-01 +================== + + * Fix message for status 451 + - `451 Unavailable For Legal Reasons` + +1.2.0 / 2014-09-28 +================== + + * Add `208 Already Repored` + * Add `226 IM Used` + * Add `306 (Unused)` + * Add `415 Unable For Legal Reasons` + * Add `508 Loop Detected` + +1.1.1 / 2014-09-24 +================== + + * Add missing 308 to `codes.json` + +1.1.0 / 2014-09-21 +================== + + * Add `codes.json` for universal support + +1.0.4 / 2014-08-20 +================== + + * Package cleanup + +1.0.3 / 2014-06-08 +================== + + * Add 308 to `.redirect` category + +1.0.2 / 2014-03-13 +================== + + * Add `.retry` category + +1.0.1 / 2014-03-12 +================== + + * Initial release diff --git a/node_modules/statuses/LICENSE b/node_modules/statuses/LICENSE new file mode 100644 index 0000000..28a3161 --- /dev/null +++ b/node_modules/statuses/LICENSE @@ -0,0 +1,23 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/statuses/README.md b/node_modules/statuses/README.md new file mode 100644 index 0000000..0fe5720 --- /dev/null +++ b/node_modules/statuses/README.md @@ -0,0 +1,127 @@ +# Statuses + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +HTTP status utility for node. + +This module provides a list of status codes and messages sourced from +a few different projects: + + * The [IANA Status Code Registry](https://www.iana.org/assignments/http-status-codes/http-status-codes.xhtml) + * The [Node.js project](https://nodejs.org/) + * The [NGINX project](https://www.nginx.com/) + * The [Apache HTTP Server project](https://httpd.apache.org/) + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install statuses +``` + +## API + + + +```js +var status = require('statuses') +``` + +### var code = status(Integer || String) + +If `Integer` or `String` is a valid HTTP code or status message, then the +appropriate `code` will be returned. Otherwise, an error will be thrown. + + + +```js +status(403) // => 403 +status('403') // => 403 +status('forbidden') // => 403 +status('Forbidden') // => 403 +status(306) // throws, as it's not supported by node.js +``` + +### status.STATUS_CODES + +Returns an object which maps status codes to status messages, in +the same format as the +[Node.js http module](https://nodejs.org/dist/latest/docs/api/http.html#http_http_status_codes). + +### status.codes + +Returns an array of all the status codes as `Integer`s. + +### var msg = status[code] + +Map of `code` to `status message`. `undefined` for invalid `code`s. + + + +```js +status[404] // => 'Not Found' +``` + +### var code = status[msg] + +Map of `status message` to `code`. `msg` can either be title-cased or +lower-cased. `undefined` for invalid `status message`s. + + + +```js +status['not found'] // => 404 +status['Not Found'] // => 404 +``` + +### status.redirect[code] + +Returns `true` if a status code is a valid redirect status. + + + +```js +status.redirect[200] // => undefined +status.redirect[301] // => true +``` + +### status.empty[code] + +Returns `true` if a status code expects an empty body. + + + +```js +status.empty[200] // => undefined +status.empty[204] // => true +status.empty[304] // => true +``` + +### status.retry[code] + +Returns `true` if you should retry the rest. + + + +```js +status.retry[501] // => undefined +status.retry[503] // => true +``` + +[npm-image]: https://img.shields.io/npm/v/statuses.svg +[npm-url]: https://npmjs.org/package/statuses +[node-version-image]: https://img.shields.io/node/v/statuses.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/statuses.svg +[travis-url]: https://travis-ci.org/jshttp/statuses +[coveralls-image]: https://img.shields.io/coveralls/jshttp/statuses.svg +[coveralls-url]: https://coveralls.io/r/jshttp/statuses?branch=master +[downloads-image]: https://img.shields.io/npm/dm/statuses.svg +[downloads-url]: https://npmjs.org/package/statuses diff --git a/node_modules/statuses/codes.json b/node_modules/statuses/codes.json new file mode 100644 index 0000000..a09283a --- /dev/null +++ b/node_modules/statuses/codes.json @@ -0,0 +1,66 @@ +{ + "100": "Continue", + "101": "Switching Protocols", + "102": "Processing", + "103": "Early Hints", + "200": "OK", + "201": "Created", + "202": "Accepted", + "203": "Non-Authoritative Information", + "204": "No Content", + "205": "Reset Content", + "206": "Partial Content", + "207": "Multi-Status", + "208": "Already Reported", + "226": "IM Used", + "300": "Multiple Choices", + "301": "Moved Permanently", + "302": "Found", + "303": "See Other", + "304": "Not Modified", + "305": "Use Proxy", + "306": "(Unused)", + "307": "Temporary Redirect", + "308": "Permanent Redirect", + "400": "Bad Request", + "401": "Unauthorized", + "402": "Payment Required", + "403": "Forbidden", + "404": "Not Found", + "405": "Method Not Allowed", + "406": "Not Acceptable", + "407": "Proxy Authentication Required", + "408": "Request Timeout", + "409": "Conflict", + "410": "Gone", + "411": "Length Required", + "412": "Precondition Failed", + "413": "Payload Too Large", + "414": "URI Too Long", + "415": "Unsupported Media Type", + "416": "Range Not Satisfiable", + "417": "Expectation Failed", + "418": "I'm a teapot", + "421": "Misdirected Request", + "422": "Unprocessable Entity", + "423": "Locked", + "424": "Failed Dependency", + "425": "Unordered Collection", + "426": "Upgrade Required", + "428": "Precondition Required", + "429": "Too Many Requests", + "431": "Request Header Fields Too Large", + "451": "Unavailable For Legal Reasons", + "500": "Internal Server Error", + "501": "Not Implemented", + "502": "Bad Gateway", + "503": "Service Unavailable", + "504": "Gateway Timeout", + "505": "HTTP Version Not Supported", + "506": "Variant Also Negotiates", + "507": "Insufficient Storage", + "508": "Loop Detected", + "509": "Bandwidth Limit Exceeded", + "510": "Not Extended", + "511": "Network Authentication Required" +} diff --git a/node_modules/statuses/index.js b/node_modules/statuses/index.js new file mode 100644 index 0000000..4df469a --- /dev/null +++ b/node_modules/statuses/index.js @@ -0,0 +1,113 @@ +/*! + * statuses + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var codes = require('./codes.json') + +/** + * Module exports. + * @public + */ + +module.exports = status + +// status code to message map +status.STATUS_CODES = codes + +// array of status codes +status.codes = populateStatusesMap(status, codes) + +// status codes for redirects +status.redirect = { + 300: true, + 301: true, + 302: true, + 303: true, + 305: true, + 307: true, + 308: true +} + +// status codes for empty bodies +status.empty = { + 204: true, + 205: true, + 304: true +} + +// status codes for when you should retry the request +status.retry = { + 502: true, + 503: true, + 504: true +} + +/** + * Populate the statuses map for given codes. + * @private + */ + +function populateStatusesMap (statuses, codes) { + var arr = [] + + Object.keys(codes).forEach(function forEachCode (code) { + var message = codes[code] + var status = Number(code) + + // Populate properties + statuses[status] = message + statuses[message] = status + statuses[message.toLowerCase()] = status + + // Add to array + arr.push(status) + }) + + return arr +} + +/** + * Get the status code. + * + * Given a number, this will throw if it is not a known status + * code, otherwise the code will be returned. Given a string, + * the string will be parsed for a number and return the code + * if valid, otherwise will lookup the code assuming this is + * the status message. + * + * @param {string|number} code + * @returns {number} + * @public + */ + +function status (code) { + if (typeof code === 'number') { + if (!status[code]) throw new Error('invalid status code: ' + code) + return code + } + + if (typeof code !== 'string') { + throw new TypeError('code must be a number or string') + } + + // '403' + var n = parseInt(code, 10) + if (!isNaN(n)) { + if (!status[n]) throw new Error('invalid status code: ' + n) + return n + } + + n = status[code.toLowerCase()] + if (!n) throw new Error('invalid status message: "' + code + '"') + return n +} diff --git a/node_modules/statuses/package.json b/node_modules/statuses/package.json new file mode 100644 index 0000000..7595e2b --- /dev/null +++ b/node_modules/statuses/package.json @@ -0,0 +1,48 @@ +{ + "name": "statuses", + "description": "HTTP status utility", + "version": "1.5.0", + "contributors": [ + "Douglas Christopher Wilson ", + "Jonathan Ong (http://jongleberry.com)" + ], + "repository": "jshttp/statuses", + "license": "MIT", + "keywords": [ + "http", + "status", + "code" + ], + "files": [ + "HISTORY.md", + "index.js", + "codes.json", + "LICENSE" + ], + "devDependencies": { + "csv-parse": "1.2.4", + "eslint": "4.19.1", + "eslint-config-standard": "11.0.0", + "eslint-plugin-import": "2.9.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "6.0.1", + "eslint-plugin-promise": "3.7.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "1.21.5", + "raw-body": "2.3.2", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "build": "node scripts/build.js", + "fetch": "node scripts/fetch-apache.js && node scripts/fetch-iana.js && node scripts/fetch-nginx.js && node scripts/fetch-node.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "update": "npm run fetch && npm run build" + } +} diff --git a/node_modules/toidentifier/HISTORY.md b/node_modules/toidentifier/HISTORY.md new file mode 100644 index 0000000..cb7cc89 --- /dev/null +++ b/node_modules/toidentifier/HISTORY.md @@ -0,0 +1,9 @@ +1.0.1 / 2021-11-14 +================== + + * pref: enable strict mode + +1.0.0 / 2018-07-09 +================== + + * Initial release diff --git a/node_modules/toidentifier/LICENSE b/node_modules/toidentifier/LICENSE new file mode 100644 index 0000000..de22d15 --- /dev/null +++ b/node_modules/toidentifier/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2016 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/toidentifier/README.md b/node_modules/toidentifier/README.md new file mode 100644 index 0000000..57e8a78 --- /dev/null +++ b/node_modules/toidentifier/README.md @@ -0,0 +1,61 @@ +# toidentifier + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][codecov-image]][codecov-url] + +> Convert a string of words to a JavaScript identifier + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install toidentifier +``` + +## Example + +```js +var toIdentifier = require('toidentifier') + +console.log(toIdentifier('Bad Request')) +// => "BadRequest" +``` + +## API + +This CommonJS module exports a single default function: `toIdentifier`. + +### toIdentifier(string) + +Given a string as the argument, it will be transformed according to +the following rules and the new string will be returned: + +1. Split into words separated by space characters (`0x20`). +2. Upper case the first character of each word. +3. Join the words together with no separator. +4. Remove all non-word (`[0-9a-z_]`) characters. + +## License + +[MIT](LICENSE) + +[codecov-image]: https://img.shields.io/codecov/c/github/component/toidentifier.svg +[codecov-url]: https://codecov.io/gh/component/toidentifier +[downloads-image]: https://img.shields.io/npm/dm/toidentifier.svg +[downloads-url]: https://npmjs.org/package/toidentifier +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/component/toidentifier/ci/master?label=ci +[github-actions-ci-url]: https://github.com/component/toidentifier?query=workflow%3Aci +[npm-image]: https://img.shields.io/npm/v/toidentifier.svg +[npm-url]: https://npmjs.org/package/toidentifier + + +## + +[npm]: https://www.npmjs.com/ + +[yarn]: https://yarnpkg.com/ diff --git a/node_modules/toidentifier/index.js b/node_modules/toidentifier/index.js new file mode 100644 index 0000000..9295d02 --- /dev/null +++ b/node_modules/toidentifier/index.js @@ -0,0 +1,32 @@ +/*! + * toidentifier + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = toIdentifier + +/** + * Trasform the given string into a JavaScript identifier + * + * @param {string} str + * @returns {string} + * @public + */ + +function toIdentifier (str) { + return str + .split(' ') + .map(function (token) { + return token.slice(0, 1).toUpperCase() + token.slice(1) + }) + .join('') + .replace(/[^ _0-9a-z]/gi, '') +} diff --git a/node_modules/toidentifier/package.json b/node_modules/toidentifier/package.json new file mode 100644 index 0000000..42db1a6 --- /dev/null +++ b/node_modules/toidentifier/package.json @@ -0,0 +1,38 @@ +{ + "name": "toidentifier", + "description": "Convert a string of words to a JavaScript identifier", + "version": "1.0.1", + "author": "Douglas Christopher Wilson ", + "contributors": [ + "Douglas Christopher Wilson ", + "Nick Baugh (http://niftylettuce.com/)" + ], + "repository": "component/toidentifier", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.3", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.1.3", + "nyc": "15.1.0" + }, + "engines": { + "node": ">=0.6" + }, + "license": "MIT", + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/unpipe/HISTORY.md b/node_modules/unpipe/HISTORY.md new file mode 100644 index 0000000..85e0f8d --- /dev/null +++ b/node_modules/unpipe/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2015-06-14 +================== + + * Initial release diff --git a/node_modules/unpipe/LICENSE b/node_modules/unpipe/LICENSE new file mode 100644 index 0000000..aed0138 --- /dev/null +++ b/node_modules/unpipe/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/unpipe/README.md b/node_modules/unpipe/README.md new file mode 100644 index 0000000..e536ad2 --- /dev/null +++ b/node_modules/unpipe/README.md @@ -0,0 +1,43 @@ +# unpipe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Unpipe a stream from all destinations. + +## Installation + +```sh +$ npm install unpipe +``` + +## API + +```js +var unpipe = require('unpipe') +``` + +### unpipe(stream) + +Unpipes all destinations from a given stream. With stream 2+, this is +equivalent to `stream.unpipe()`. When used with streams 1 style streams +(typically Node.js 0.8 and below), this module attempts to undo the +actions done in `stream.pipe(dest)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/unpipe.svg +[npm-url]: https://npmjs.org/package/unpipe +[node-image]: https://img.shields.io/node/v/unpipe.svg +[node-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/unpipe.svg +[travis-url]: https://travis-ci.org/stream-utils/unpipe +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/unpipe.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/unpipe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/unpipe.svg +[downloads-url]: https://npmjs.org/package/unpipe diff --git a/node_modules/unpipe/index.js b/node_modules/unpipe/index.js new file mode 100644 index 0000000..15c3d97 --- /dev/null +++ b/node_modules/unpipe/index.js @@ -0,0 +1,69 @@ +/*! + * unpipe + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = unpipe + +/** + * Determine if there are Node.js pipe-like data listeners. + * @private + */ + +function hasPipeDataListeners(stream) { + var listeners = stream.listeners('data') + + for (var i = 0; i < listeners.length; i++) { + if (listeners[i].name === 'ondata') { + return true + } + } + + return false +} + +/** + * Unpipe a stream from all destinations. + * + * @param {object} stream + * @public + */ + +function unpipe(stream) { + if (!stream) { + throw new TypeError('argument stream is required') + } + + if (typeof stream.unpipe === 'function') { + // new-style + stream.unpipe() + return + } + + // Node.js 0.8 hack + if (!hasPipeDataListeners(stream)) { + return + } + + var listener + var listeners = stream.listeners('close') + + for (var i = 0; i < listeners.length; i++) { + listener = listeners[i] + + if (listener.name !== 'cleanup' && listener.name !== 'onclose') { + continue + } + + // invoke the listener + listener.call(stream) + } +} diff --git a/node_modules/unpipe/package.json b/node_modules/unpipe/package.json new file mode 100644 index 0000000..a2b7358 --- /dev/null +++ b/node_modules/unpipe/package.json @@ -0,0 +1,27 @@ +{ + "name": "unpipe", + "description": "Unpipe a stream from all destinations", + "version": "1.0.0", + "author": "Douglas Christopher Wilson ", + "license": "MIT", + "repository": "stream-utils/unpipe", + "devDependencies": { + "istanbul": "0.3.15", + "mocha": "2.2.5", + "readable-stream": "1.1.13" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + } +} diff --git a/node_modules/utils-merge/.npmignore b/node_modules/utils-merge/.npmignore new file mode 100644 index 0000000..3e53844 --- /dev/null +++ b/node_modules/utils-merge/.npmignore @@ -0,0 +1,9 @@ +CONTRIBUTING.md +Makefile +docs/ +examples/ +reports/ +test/ + +.jshintrc +.travis.yml diff --git a/node_modules/utils-merge/LICENSE b/node_modules/utils-merge/LICENSE new file mode 100644 index 0000000..76f6d08 --- /dev/null +++ b/node_modules/utils-merge/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2013-2017 Jared Hanson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/utils-merge/README.md b/node_modules/utils-merge/README.md new file mode 100644 index 0000000..0cb7117 --- /dev/null +++ b/node_modules/utils-merge/README.md @@ -0,0 +1,34 @@ +# utils-merge + +[![Version](https://img.shields.io/npm/v/utils-merge.svg?label=version)](https://www.npmjs.com/package/utils-merge) +[![Build](https://img.shields.io/travis/jaredhanson/utils-merge.svg)](https://travis-ci.org/jaredhanson/utils-merge) +[![Quality](https://img.shields.io/codeclimate/github/jaredhanson/utils-merge.svg?label=quality)](https://codeclimate.com/github/jaredhanson/utils-merge) +[![Coverage](https://img.shields.io/coveralls/jaredhanson/utils-merge.svg)](https://coveralls.io/r/jaredhanson/utils-merge) +[![Dependencies](https://img.shields.io/david/jaredhanson/utils-merge.svg)](https://david-dm.org/jaredhanson/utils-merge) + + +Merges the properties from a source object into a destination object. + +## Install + +```bash +$ npm install utils-merge +``` + +## Usage + +```javascript +var a = { foo: 'bar' } + , b = { bar: 'baz' }; + +merge(a, b); +// => { foo: 'bar', bar: 'baz' } +``` + +## License + +[The MIT License](http://opensource.org/licenses/MIT) + +Copyright (c) 2013-2017 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)> + + Sponsor diff --git a/node_modules/utils-merge/index.js b/node_modules/utils-merge/index.js new file mode 100644 index 0000000..4265c69 --- /dev/null +++ b/node_modules/utils-merge/index.js @@ -0,0 +1,23 @@ +/** + * Merge object b with object a. + * + * var a = { foo: 'bar' } + * , b = { bar: 'baz' }; + * + * merge(a, b); + * // => { foo: 'bar', bar: 'baz' } + * + * @param {Object} a + * @param {Object} b + * @return {Object} + * @api public + */ + +exports = module.exports = function(a, b){ + if (a && b) { + for (var key in b) { + a[key] = b[key]; + } + } + return a; +}; diff --git a/node_modules/utils-merge/package.json b/node_modules/utils-merge/package.json new file mode 100644 index 0000000..e36b078 --- /dev/null +++ b/node_modules/utils-merge/package.json @@ -0,0 +1,40 @@ +{ + "name": "utils-merge", + "version": "1.0.1", + "description": "merge() utility function", + "keywords": [ + "util" + ], + "author": { + "name": "Jared Hanson", + "email": "jaredhanson@gmail.com", + "url": "http://www.jaredhanson.net/" + }, + "repository": { + "type": "git", + "url": "git://github.com/jaredhanson/utils-merge.git" + }, + "bugs": { + "url": "http://github.com/jaredhanson/utils-merge/issues" + }, + "license": "MIT", + "licenses": [ + { + "type": "MIT", + "url": "http://opensource.org/licenses/MIT" + } + ], + "main": "./index", + "dependencies": {}, + "devDependencies": { + "make-node": "0.3.x", + "mocha": "1.x.x", + "chai": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + }, + "scripts": { + "test": "node_modules/.bin/mocha --reporter spec --require test/bootstrap/node test/*.test.js" + } +} diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 0000000..688292d --- /dev/null +++ b/package-lock.json @@ -0,0 +1,332 @@ +{ + "name": "Semillas_website", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "dependencies": { + "connect": "^3.7.0", + "serve-static": "^2.2.0" + } + }, + "node_modules/connect": { + "version": "3.7.0", + "resolved": "https://registry.npmjs.org/connect/-/connect-3.7.0.tgz", + "integrity": "sha512-ZqRXc+tZukToSNmh5C2iWMSoV3X1YUcPbqEM4DkEG5tNQXrQUZCNVGGv3IuicnkMtPfGf3Xtp8WCXs295iQ1pQ==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "finalhandler": "1.1.2", + "parseurl": "~1.3.3", + "utils-merge": "1.0.1" + }, + "engines": { + "node": ">= 0.10.0" + } + }, + "node_modules/debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + } + }, + "node_modules/depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow==", + "license": "MIT" + }, + "node_modules/encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow==", + "license": "MIT" + }, + "node_modules/etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/finalhandler": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.1.2.tgz", + "integrity": "sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA==", + "license": "MIT", + "dependencies": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "~2.3.0", + "parseurl": "~1.3.3", + "statuses": "~1.5.0", + "unpipe": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/fresh": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-2.0.0.tgz", + "integrity": "sha512-Rx/WycZ60HOaqLKAi6cHRKKI7zxWbJ31MhntmtwMoaTeF7XFH9hhBp8vITaMidfljRQ6eYWCKkaTK+ykVJHP2A==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "license": "MIT", + "dependencies": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/http-errors/node_modules/statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "license": "ISC" + }, + "node_modules/mime-db": { + "version": "1.54.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.54.0.tgz", + "integrity": "sha512-aU5EJuIN2WDemCcAp2vFBfp/m4EAhWJnUNSSw0ixs7/kXbd6Pg64EmwJkNdFhB8aWt1sH2CTXrLxo/iAGV3oPQ==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-3.0.1.tgz", + "integrity": "sha512-xRc4oEhT6eaBpU1XF7AjpOFD+xQmXNB5OVKwp4tqCuBpHLS/ZbBDrc07mYTDqVMg6PfxUjjNp85O6Cd2Z/5HWA==", + "license": "MIT", + "dependencies": { + "mime-db": "^1.54.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A==", + "license": "MIT" + }, + "node_modules/on-finished": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.3.0.tgz", + "integrity": "sha512-ikqdkGAAyf/X/gPhXGvfgAytDZtDbr+bkNUJ0N9h5MI/dmdgCs3l6hoHrcUv41sRKew3jIwrp4qQDXiK99Utww==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/send": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/send/-/send-1.2.0.tgz", + "integrity": "sha512-uaW0WwXKpL9blXE2o0bRhoL2EGXIrZxQ2ZQ4mgcfoBxdFmQold+qWsD2jLrfZ0trjKL6vOw0j//eAwcALFjKSw==", + "license": "MIT", + "dependencies": { + "debug": "^4.3.5", + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "etag": "^1.8.1", + "fresh": "^2.0.0", + "http-errors": "^2.0.0", + "mime-types": "^3.0.1", + "ms": "^2.1.3", + "on-finished": "^2.4.1", + "range-parser": "^1.2.1", + "statuses": "^2.0.1" + }, + "engines": { + "node": ">= 18" + } + }, + "node_modules/send/node_modules/debug": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.1.tgz", + "integrity": "sha512-KcKCqiftBJcZr++7ykoDIEwSa3XWowTfNPo92BYxjXiyYEVrUQh2aLyhxBCwww+heortUFxEJYcRzosstTEBYQ==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/send/node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, + "node_modules/send/node_modules/on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "license": "MIT", + "dependencies": { + "ee-first": "1.1.1" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/send/node_modules/statuses": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.2.tgz", + "integrity": "sha512-DvEy55V3DB7uknRo+4iOGT5fP1slR8wQohVdknigZPMpMstaKJQWhwiYBACJE3Ul2pTnATihhBYnRhZQHGBiRw==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/serve-static": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-2.2.0.tgz", + "integrity": "sha512-61g9pCh0Vnh7IutZjtLGGpTA355+OPn2TyDv/6ivP2h/AdAVX9azsoxmg2/M6nZeQZNYBEwIcsne1mJd9oQItQ==", + "license": "MIT", + "dependencies": { + "encodeurl": "^2.0.0", + "escape-html": "^1.0.3", + "parseurl": "^1.3.3", + "send": "^1.2.0" + }, + "engines": { + "node": ">= 18" + } + }, + "node_modules/serve-static/node_modules/encodeurl": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz", + "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==", + "license": "ISC" + }, + "node_modules/statuses": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-1.5.0.tgz", + "integrity": "sha512-OpZ3zP+jT1PI7I8nemJX4AKmAX070ZkYPVWV/AaKTJl+tXCTGyVdC1a4SL8RUQYEwk/f34ZX8UTykN68FwrqAA==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==", + "license": "MIT", + "engines": { + "node": ">=0.6" + } + }, + "node_modules/unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==", + "license": "MIT", + "engines": { + "node": ">= 0.4.0" + } + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 0000000..152f9e0 --- /dev/null +++ b/package.json @@ -0,0 +1,6 @@ +{ + "dependencies": { + "connect": "^3.7.0", + "serve-static": "^2.2.0" + } +} diff --git a/server.js b/server.js new file mode 100644 index 0000000..3fadba9 --- /dev/null +++ b/server.js @@ -0,0 +1,7 @@ +var connect = require('connect'); +var serveStatic = require('serve-static'); + +connect() + .use(serveStatic(__dirname)) + .listen(8080, () => console.log('Server running on 8080...')); + diff --git a/styles/main.css b/styles/main.css index 29eb341..9a053f1 100644 --- a/styles/main.css +++ b/styles/main.css @@ -1,6 +1,7 @@ @import url('https://fonts.googleapis.com/css2?family=Inter:wght@400;600&display=swap'); - - +@import url('https://fonts.googleapis.com/css2?family=Playfair+Display:wght@600&display=swap'); +@import url('https://fonts.googleapis.com/css2?family=Bebas+Neue&display=swap'); +@import url('https://fonts.googleapis.com/css2?family=IBM+Plex+Sans:wght@400;600&display=swap'); html { font-family: 'Proxima Nova', 'Inter', 'Segoe UI', Roboto, 'Helvetica Neue', sans-serif; margin: 0; @@ -16,8 +17,6 @@ main { } header{ - background: radial-gradient(circle, white 40%,rgb(152, 181, 138) 90%); - color: white; text-align: center; padding: 3rem; width: 100%; @@ -27,8 +26,8 @@ header{ } header h1 { - color: #4e402b; - text-shadow: 1px 1px 4px rgba(0, 0, 0, 0.2); + color: #1e6623; + background: transparent; font-size: 1.5rem; } @@ -46,9 +45,19 @@ h1 { font-weight: normal; font-size: 1.5rem } +p{ + font-family: 'IBM Plex Sans', sans-serif; + font-size: 1.25rem; + line-height: 1.8; + color: #333; + max-width: 800px; + margin: 0 auto; + text-align: center; + font-weight: 500; +} .semillas-highlight { - color: #5cad5f; /* green */ + color: #4e402b; /* green */ font-weight: 900; display: inline-block; font-size: 3.5rem; @@ -65,21 +74,49 @@ h1 { } } +@font-face { + font-family: 'Realce'; + src: url('fonts/Realce-Black.otf') format('opentype'); + font-weight: 600; + font-style: normal; +} h2 { - color: white; - font-size: 2rem; + position: relative; + font-family: 'Bebas Neue', sans-serif; + font-size: 2.5rem; + text-align: center; + text-transform: uppercase; + margin-bottom: 2rem; + font-weight: 700; +} + +h2::after { + content: ''; + position: absolute; + bottom: -10px; /* space between text and underline */ + left: 50%; + transform: translateX(-50%); + height: 6px; + width: 320px; /* or whatever fixed length you want */ + max-width: 100%; + background: linear-gradient(to right, transparent, #4e402b, transparent); + border-radius: 3px; } nav { - position: relative; + display: flex; + justify-content: center; /* centers buttons horizontally */ + gap: 1.5rem; /* space between buttons */ + margin-top: 1rem; /* optional: adds space below header title */ + flex-wrap: wrap; /* allows buttons to wrap on smaller screens */ z-index: 3; } .nav-button { font-size: 1rem; padding: 0.5em 1em; - background-color: #5cad5f; /* earthy green */ + background-color: #4e402b; /* earthy green */ color: white; border: none; border-radius: 6px; @@ -89,7 +126,7 @@ nav { } .nav-button:hover { - background-color: #388E3C; + background-color: #766e68; transform: translateY(-2px); } @@ -99,28 +136,41 @@ nav { } body { - background-color: rgb(152, 181, 138); - height: 100vh; - display: block; - align-items: center; - justify-content: center; + margin: 0; + padding: 0; + height: 100%; + background-image: linear-gradient(90deg, rgb(214, 241, 214), #98b58a, #e1e2e2); + background-size: 400% 400%; + background-position: 0% 50%; + animation: gradientShift 15s ease infinite; + background-attachment: fixed; + font-family: 'Proxima Nova', 'Inter', sans-serif; + overflow-x: hidden; +} + +@keyframes gradientShift { + 0% { background-position: 0% 50%; } + 50% { background-position: 100% 50%; } + 100% { background-position: 0% 50%; } } .wrapper { - background-color: #E1E2E2; - overflow: hidden; width: 90%; max-width: 960px; - display: flex; - align-items: center; - padding: 0 20px; - margin: 2rem auto; + margin: 0 auto 2rem auto; border-radius: 16px; - aspect-ratio:16/9; + overflow: hidden; + background-color: #e1e2e2; + display: flex; flex-direction: column; - overflow-x: auto; - -ms-overflow-style: none; - scrollbar-width: none; + align-items: center; + min-height: 50vh; /* fills taller screens better */ +} + +.inner-wrapper { + padding: 0 20px; + width: 100%; + box-sizing: border-box; } .wrapper:before, .wrapper:after { @@ -151,10 +201,8 @@ body { } .wrapper .logo { + flex: 0 0 300px; - /* aspect-ratio: 16/9; */ - /* height: 100%; */ - /* width: 300px; */ display: flex; align-items: center; justify-content: center; @@ -184,6 +232,27 @@ body { } } +@media (max-width: 600px) { + .wrapper { + width: 100%; + min-height: auto; + padding: 0; + border-radius: 0; + } + + .wrapper .logo { + flex: 0 0 100vw; + height: 200px; /* or any fixed height for better UX */ + } + + .wrapper .logo img { + width: 100%; + height: 100%; + object-fit: cover; + aspect-ratio: auto; + } +} + .coordinator-grid { display: flex; flex-wrap: wrap; @@ -258,6 +327,12 @@ main section { .coordinator h2{ color: green; + font-family: 'JetBrains Mono', 'Courier New', monospace;; + font-size: 2rem; +} + +.coordinator h2::after { + content: none; } .coordinator-content { @@ -294,9 +369,9 @@ main section { padding: 0.5em 0; border-top-left-radius: 16px; border-top-right-radius: 16px; - border-top: 3px solid #5cad5f;/* + border-top: 3px solid #4e402b;/* border-bottom: 3px solid #5cad5f;*/ - color: #5cad5f; + color: #4e402b; position: relative; flex-shrink: 0; } From 4c345f89d0e4972830dcaa497afab27d860564c2 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 20:26:18 -0400 Subject: [PATCH 41/48] stying changes --- index.html | 28 +++++++++++++++++-------- styles/main.css | 55 +++++++++++++++++++++++++++++++++++-------------- 2 files changed, 59 insertions(+), 24 deletions(-) diff --git a/index.html b/index.html index 35e9ce4..68f1b11 100644 --- a/index.html +++ b/index.html @@ -74,28 +74,38 @@

WHY JOIN?

+

Meet the Program Coordinator

+
Lauren
-

Lauren Gonzalez

-

Program Coordinator

-

Bachelor of Arts in Public Management, Leadership, and Policity

-

Minors in Civic Engagement and Latinx Studies

-

Alumni of the Morrill Scholarship Program, Alpha Psi Lambda National Inc., Multicultural Greek Council, Sphinx Senior Honorary, Latine Student Success Center, and Founder of Teal Week

-

Hometown: San Antonio, Texas

+

Lauren Gonzalez

+

๐ŸŽ“ Education: Bachelor of Arts in Public Management, Leadership, and Policy +
Minors in Civic Engagement and Latinx Studies

+ +

๐ŸŒŸ Involvement: + Proud alumna of the Morrill Scholarship Program, Alpha Psi Lambda National Inc., Multicultural Greek Council, + Sphinx Senior Honorary, and the Latine Student Success Center

+ +

๐ŸŒˆ Legacy: Founder of Teal Weekโ€”an initiative rooted in community and healing

+

๐Ÿ“ Hometown: San Antonio, Texas

-

Meet the Coordinators

+

Meet The Program Coordinator

Katelyn Vazquez

-

Katelyn brings a strong background in mentorship and cultural preservation...

+

๐ŸŽ“ Education: Bachelor of Science in Social Work +

๐ŸŒŸ Involvement: + Proud alumna of the Morrill Scholarship Program, The PrEvailing Pi Epsilon Chapter of Sigma Lambda Gamma National Sorority, Inc., Greek Programming Board, + National Association of Social Workers, SWIM Ohio Network, and the Latine Student Success Center

+

๐Ÿ“ Hometown: Akron, Ohio

Katelyn
@@ -104,7 +114,7 @@

Katelyn Vazquez

-

© 2025 Semillas Program

+

© 2025 Semillas Program

diff --git a/styles/main.css b/styles/main.css index 9a053f1..81e1eed 100644 --- a/styles/main.css +++ b/styles/main.css @@ -29,13 +29,14 @@ header h1 { color: #1e6623; background: transparent; font-size: 1.5rem; + font-weight: 600; } -footer{ - background-color: rgb(152, 181, 138); +.footer { + background-color: #4e402b; color: white; text-align: center; - padding: 0.5rem; + padding: 1rem; font-size: 1rem; margin-top: auto; } @@ -116,7 +117,7 @@ nav { .nav-button { font-size: 1rem; padding: 0.5em 1em; - background-color: #4e402b; /* earthy green */ + background-color: #1e6623; /* earthy green */ color: white; border: none; border-radius: 6px; @@ -251,16 +252,14 @@ body { object-fit: cover; aspect-ratio: auto; } -} -.coordinator-grid { - display: flex; - flex-wrap: wrap; - gap: 1rem; - justify-content: center; - padding-top: 1rem; + .wrapper .track { + animation-duration: 10s; /* twice as fast */ + } } + + .profile img { border-radius: 100px; width: 100px; @@ -318,11 +317,36 @@ main section { margin-bottom: 3em; } +.coordinator-grid { + display: flex; + flex-wrap: wrap; + gap: 1rem; + justify-content: center; + padding-top: 0.5rem; +} + .coordinator { - margin: 3em 0; + position: relative; + background-color: #ffffff; padding: 2em; - background-color: #f9f9f9; - border-radius: 16px; /* โ† adds rounded corners */ + border-radius: 16px; + box-shadow: 0 6px 20px rgba(0, 0, 0, 0.08); + z-index: 2; + top: -4px; /* ๐Ÿ‘ˆ lifts the white card up slightly */ + left: -4px; +} + +.coordinator::before { + content: ''; + position: absolute; + top: 30px; + left: 30px; + width: 100%; + height: 100%; + background-color: #d6e8d1; + border-radius: 16px; + z-index: -1; + box-shadow: 0 4px 16px rgba(0, 0, 0, 0.04); } .coordinator h2{ @@ -340,7 +364,6 @@ main section { align-items: center; gap: 2em; flex-wrap: wrap; - color: green; } .coordinator-photo { @@ -359,6 +382,8 @@ main section { flex-direction: row-reverse; } + + .scrolling-banner { font-family: Arial, 'Inter', sans-serif; font-style: italic; From d5b059640b56cab1b444a1ea4c2b378efc53d40a Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 20:42:38 -0400 Subject: [PATCH 42/48] speed of image carousel --- index.html | 4 ++-- styles/main.css | 55 ++++++++++++++++++++++++++++++++++++++++++++----- 2 files changed, 52 insertions(+), 7 deletions(-) diff --git a/index.html b/index.html index 68f1b11..d337216 100644 --- a/index.html +++ b/index.html @@ -74,7 +74,7 @@

WHY JOIN?

-

Meet the Program Coordinator

+

Meet the Program Coordinator

@@ -95,7 +95,7 @@

Lauren Gonzalez

-

Meet The Program Coordinator

+

Meet The Program Coordinator

diff --git a/styles/main.css b/styles/main.css index 81e1eed..cf99e00 100644 --- a/styles/main.css +++ b/styles/main.css @@ -254,11 +254,44 @@ body { } .wrapper .track { - animation-duration: 10s; /* twice as fast */ + animation-duration: 6; /* twice as fast */ + } + + .coordinator-content { + flex-direction: column; + align-items: center; + text-align: center; } -} + .coordinator-photo { + max-width: 140px; + margin-bottom: 1rem; + } + .coordinator-text { + flex: none; + width: 100%; + min-width: unset; + padding: 0 1rem; + } + + .coordinator-text p { + font-size: 1rem; + line-height: 1.6; + margin-bottom: 0.75rem; + } + + .coordinator h2 { + font-size: 1.5rem; + } +} + +@media (max-width: 1000px) { + .coordinator-grid { + padding-left: 1rem; + padding-right: 1rem; + } +} .profile img { border-radius: 100px; @@ -323,6 +356,8 @@ main section { gap: 1rem; justify-content: center; padding-top: 0.5rem; + max-width: 600px; /* โœจ adjust this to your liking */ + margin: 0 auto; /* centers it */ } .coordinator { @@ -349,8 +384,18 @@ main section { box-shadow: 0 4px 16px rgba(0, 0, 0, 0.04); } +.meetcoordinators{ + font-family: 'JetBrains Mono', 'Courier New', monospace; + color:#1e6623; + font-weight: 600; +} + +.meetcoordinators::after { + content: none; +} + .coordinator h2{ - color: green; + color: #4e402b; font-family: 'JetBrains Mono', 'Courier New', monospace;; font-size: 2rem; } @@ -408,8 +453,8 @@ main section { } .scrolling-content span { - word-spacing: 7rem; /* ๐Ÿ‘ˆ This adds space between words */ - padding-right: 7rem; /* space between looped sections */ + word-spacing: 7rem; + padding-right: 7rem; } @keyframes scroll-left { From bb78fb52847abe1feb27b0b43cdc0be23432f808 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Thu, 3 Jul 2025 20:55:09 -0400 Subject: [PATCH 43/48] image carousel pace --- styles/main.css | 59 ++++++++++++++++++++++++++++++++++++++++--------- 1 file changed, 49 insertions(+), 10 deletions(-) diff --git a/styles/main.css b/styles/main.css index cf99e00..9031326 100644 --- a/styles/main.css +++ b/styles/main.css @@ -12,6 +12,11 @@ html { overflow-x: hidden; } +html, body { + overflow-x: hidden; + -webkit-overflow-scrolling: touch; +} + main { flex: 1; /* Pushes the footer to the bottom when content is short */ } @@ -30,15 +35,18 @@ header h1 { background: transparent; font-size: 1.5rem; font-weight: 600; + width: 100% } .footer { + width: 100vw; /* full viewport width */ + max-width: 100%; background-color: #4e402b; color: white; text-align: center; padding: 1rem; - font-size: 1rem; - margin-top: auto; + font-size: 1rem; + box-sizing: border-box; } h1 { @@ -236,25 +244,52 @@ body { @media (max-width: 600px) { .wrapper { width: 100%; - min-height: auto; padding: 0; border-radius: 0; + overflow-x: scroll; } .wrapper .logo { flex: 0 0 100vw; - height: 200px; /* or any fixed height for better UX */ + height: 180; /* or any fixed height for better UX */ } .wrapper .logo img { width: 100%; height: 100%; object-fit: cover; - aspect-ratio: auto; } .wrapper .track { - animation-duration: 6; /* twice as fast */ + animation-duration: 10s; /* twice as fast */ + } + + .scrolling-banner { + font-size: 1rem; + padding: 0.5em 1em; + white-space: nowrap; + overflow-x: auto; + } + + .scrolling-content { + animation-duration: 12s; /* slightly faster for smaller screens */ + } + + .scrolling-content span { + word-spacing: 4rem; + padding-right: 4rem; + } + + .coordinator { + padding: 1.25rem; + border-radius: 12px; + } + + /* Slightly reduce the offset โ€œshadow cardโ€ behind */ + .coordinator::before { + top: 16px; + left: 16px; + border-radius: 12px; } .coordinator-content { @@ -264,8 +299,9 @@ body { } .coordinator-photo { - max-width: 140px; + max-width: 120px; margin-bottom: 1rem; + border-radius: 10px; } .coordinator-text { @@ -273,6 +309,9 @@ body { width: 100%; min-width: unset; padding: 0 1rem; + font-size: 0.95rem; + line-height: 1.5; + margin-bottom: 0.5rem; } .coordinator-text p { @@ -282,7 +321,8 @@ body { } .coordinator h2 { - font-size: 1.5rem; + font-size: 1.2rem; + margin-bottom: 0.5rem } } @@ -428,14 +468,13 @@ main section { } - .scrolling-banner { font-family: Arial, 'Inter', sans-serif; font-style: italic; font-weight: 100; font-size: 1.2rem; overflow: hidden; - background-color: white; + background-color: rgb(214, 241, 214); padding: 0.5em 0; border-top-left-radius: 16px; border-top-right-radius: 16px; From 95554a2fa502166c81c6fa7f859a038c1dbc05ae Mon Sep 17 00:00:00 2001 From: Ingrid Date: Fri, 4 Jul 2025 00:30:12 -0400 Subject: [PATCH 44/48] coordinators wrappers --- index.html | 17 ++++++++++ styles/main.css | 84 +++++++++++++++++++++++++++++++++++-------------- 2 files changed, 77 insertions(+), 24 deletions(-) diff --git a/index.html b/index.html index d337216..80eeb04 100644 --- a/index.html +++ b/index.html @@ -118,3 +118,20 @@

Katelyn Vazquez

+ + + diff --git a/styles/main.css b/styles/main.css index 9031326..13cdd2e 100644 --- a/styles/main.css +++ b/styles/main.css @@ -231,7 +231,6 @@ body { display: none; } - @keyframes scroll { 0% { transform: translateX(0%); @@ -243,25 +242,30 @@ body { @media (max-width: 600px) { .wrapper { - width: 100%; - padding: 0; - border-radius: 0; - overflow-x: scroll; + height: 160px; /* or whatever height you want */ + display: flex; + align-items: stretch; } .wrapper .logo { - flex: 0 0 100vw; - height: 180; /* or any fixed height for better UX */ + width: auto; /* let height drive the aspect */ + height: 100%; /* fill the 160px wrapper */ + object-fit: cover; /* crop/zoom to cover */ + object-position: center; /* center the crop */ } .wrapper .logo img { width: 100%; height: 100%; object-fit: cover; + display: block; + align-items: center; + justify-content: center; + overflow: hidden; } .wrapper .track { - animation-duration: 10s; /* twice as fast */ + animation-duration: 20s; /* twice as fast */ } .scrolling-banner { @@ -281,48 +285,56 @@ body { } .coordinator { - padding: 1.25rem; - border-radius: 12px; + /* cancel the desktop โ€œleft:-4pxโ€ */ + left: initial !important; + /* slide out by half the extra viewport width */ + margin-left: calc((100vw - 100%) / -2); } /* Slightly reduce the offset โ€œshadow cardโ€ behind */ .coordinator::before { - top: 16px; - left: 16px; - border-radius: 12px; + /* align its left edge with the white card */ + left: 20px !important; + /* drop its width by 24px so it doesnโ€™t reach the white cardโ€™s right */ + width: calc(100% - 24px); + /* cancel any right rule you had before */ + right: auto !important; } .coordinator-content { - flex-direction: column; + display: flex; + flex-direction: column !important; align-items: center; text-align: center; } .coordinator-photo { max-width: 120px; - margin-bottom: 1rem; + margin-bottom: 0; border-radius: 10px; + align-items: center; + + } + + /* 2) For Lauren (DOM order is imgโ†’text), reverse the column so text sits on top */ + .coordinator-content.lauren { + flex-direction: column-reverse !important; } .coordinator-text { - flex: none; - width: 100%; - min-width: unset; - padding: 0 1rem; - font-size: 0.95rem; - line-height: 1.5; - margin-bottom: 0.5rem; + padding: 0 0; + margin: 0; } .coordinator-text p { font-size: 1rem; line-height: 1.6; - margin-bottom: 0.75rem; + margin-bottom: 0.5rem; } .coordinator h2 { font-size: 1.2rem; - margin-bottom: 0.5rem + margin-bottom: 2rem } } @@ -333,6 +345,17 @@ body { } } +@keyframes fadeUp { + 0% { + opacity: 0; + transform: translateY(40px); + } + 100% { + opacity: 1; + transform: translateY(0); + } +} + .profile img { border-radius: 100px; width: 100px; @@ -409,6 +432,14 @@ main section { z-index: 2; top: -4px; /* ๐Ÿ‘ˆ lifts the white card up slightly */ left: -4px; + opacity: 0; + transform: translateY(40px); + transition: opacity 0.6s ease-out, transform 0.6s ease-out; +} + +.coordinator.visible { + opacity: 1; + transform: translateY(0); } .coordinator::before { @@ -428,6 +459,8 @@ main section { font-family: 'JetBrains Mono', 'Courier New', monospace; color:#1e6623; font-weight: 600; + margin-bottom: 2rem; + margin-top: 5rem; } .meetcoordinators::after { @@ -452,6 +485,7 @@ main section { } .coordinator-photo { + margin-left:20px; max-width: 200px; width: 100%; border-radius: 12px; @@ -504,3 +538,5 @@ main section { transform: translateX(-50%); } } + + From 7df968b32ba2f3adf9e6299f17c3bf816e699ca5 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Fri, 4 Jul 2025 11:26:54 -0400 Subject: [PATCH 45/48] image careousel ios fix --- index.html | 30 +++++++----- styles/main.css | 116 +++++++++++++++++++++++++++-------------------- styles/styles.js | 6 +++ 3 files changed, 92 insertions(+), 60 deletions(-) create mode 100644 styles/styles.js diff --git a/index.html b/index.html index 80eeb04..c63edeb 100644 --- a/index.html +++ b/index.html @@ -6,6 +6,12 @@ Semillas + +

Semillas

@@ -20,20 +26,20 @@

Growing Latino Leaders at The Ohio State University

- - - - - - + + + + + + - - - - - - + + + + + +
diff --git a/styles/main.css b/styles/main.css index 13cdd2e..b4830cf 100644 --- a/styles/main.css +++ b/styles/main.css @@ -10,6 +10,12 @@ html { background-color: rgb(152, 181, 138); color: #333; overflow-x: hidden; + + + -webkit-user-select: none; /* Safari, Chrome */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ + user-select: none; /* standard */ } html, body { @@ -17,6 +23,21 @@ html, body { -webkit-overflow-scrolling: touch; } +/* Disable text selection everywhere */ +* { + user-select: none; + -webkit-user-select: none; + -ms-user-select: none; + -moz-user-select: none; +} + +/* Prevent image dragging and iOS callout menu */ +img { + -webkit-user-drag: none; + -webkit-user-drag: none; /* disables drag in Safari/Chromium */ + -webkit-touch-callout: none; +} + main { flex: 1; /* Pushes the footer to the bottom when content is short */ } @@ -164,28 +185,22 @@ body { } .wrapper { - width: 90%; - max-width: 960px; - margin: 0 auto 2rem auto; - border-radius: 16px; - overflow: hidden; - background-color: #e1e2e2; - display: flex; - flex-direction: column; - align-items: center; - min-height: 50vh; /* fills taller screens better */ + margin: 0 400px; /* keeps wrapper off the screen edges */ + overflow: hidden; + border-bottom-left-radius: 20px; /* bottom-left corner */ + border-bottom-right-radius: 20px; /* bottom-right corner */ + } .inner-wrapper { - padding: 0 20px; - width: 100%; + height: 300px; /* adjust for desired carousel height */ box-sizing: border-box; } .wrapper:before, .wrapper:after { content: ""; position: absolute; - height: 400px; + height: 600px; width: 600px; z-index: 2; pointer-events: none; @@ -205,26 +220,32 @@ body { .wrapper .track { display: flex; flex-wrap: nowrap; - width: fit-content; - animation: scroll 20s linear infinite; + gap: 0; /* zero space between logos */ + align-items: center; /* vertical centering */ + height: 100%; + animation: scroll 45s linear infinite; +} + +.track:hover { + animation-play-state: paused; } .wrapper .logo { - - flex: 0 0 300px; + flex: 0 0 400px; /* keep intrinsic width flexible or set a fixed width */ + width: 300px; /* match inner-wrapper height for square boxes */ + height: 100%; /* fill the 240px height */ + margin: 0; display: flex; align-items: center; justify-content: center; - overflow: hidden; /* Crop any excess */ + overflow: hidden; } + .wrapper .logo img { width: 100%; height: 100%; - object-fit: cover; - object-position: center; - display: block; - + object-fit: cover; /* fill box, cropping if needed */ } .wrapper::-webkit-scrollbar { @@ -232,40 +253,23 @@ body { } @keyframes scroll { - 0% { + from { transform: translateX(0%); } - 100% { - transform: translateX(-50%); + to { + transform: translateX(-500%); } } @media (max-width: 600px) { - .wrapper { - height: 160px; /* or whatever height you want */ - display: flex; - align-items: stretch; - } - - .wrapper .logo { - width: auto; /* let height drive the aspect */ - height: 100%; /* fill the 160px wrapper */ - object-fit: cover; /* crop/zoom to cover */ - object-position: center; /* center the crop */ - } - - .wrapper .logo img { - width: 100%; - height: 100%; - object-fit: cover; - display: block; - align-items: center; - justify-content: center; - overflow: hidden; + .wrapper { margin: 0 20px; } + .inner-wrapper { height: 250px; } + .logo { + width: 160px; } .wrapper .track { - animation-duration: 20s; /* twice as fast */ + animation: scroll 20s linear infinite; } .scrolling-banner { @@ -338,7 +342,23 @@ body { } } -@media (max-width: 1000px) { +@media (min-width: 601px) and (max-width: 1000px) { .wrapper { + margin: 0 40px; /* keeps wrapper off the screen edges */ + } + + @keyframes scroll { + from { + transform: translateX(0%); + } + to { + transform: translateX(-570%); + } + } + + .wrapper .track { + animation: scroll 35s linear infinite; + } + .coordinator-grid { padding-left: 1rem; padding-right: 1rem; diff --git a/styles/styles.js b/styles/styles.js new file mode 100644 index 0000000..917d235 --- /dev/null +++ b/styles/styles.js @@ -0,0 +1,6 @@ +const track = document.querySelector('.track'); +const totalWidth = track.scrollWidth / 2; // half = one set +document.documentElement.style.setProperty( + '--scroll-distance', + `-${totalWidth}px` +); From 1356aeed2b5a3a4b02f059769ec10295c6b95493 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Fri, 4 Jul 2025 11:31:07 -0400 Subject: [PATCH 46/48] semillas header font --- styles/main.css | 4 +++- 1 file changed, 3 insertions(+), 1 deletion(-) diff --git a/styles/main.css b/styles/main.css index b4830cf..df43b2d 100644 --- a/styles/main.css +++ b/styles/main.css @@ -87,6 +87,8 @@ p{ } .semillas-highlight { + font-family:'Trebuchet MS', 'Lucida Sans Unicode', 'Lucida Grande', 'Lucida Sans', Arial, sans-serif; + font-weight: 10000; color: #4e402b; /* green */ font-weight: 900; display: inline-block; @@ -100,7 +102,7 @@ p{ transform: scale(1); } 50% { - transform: scale(1.08); /* slightly bigger */ + transform: scale(1.2); /* slightly bigger */ } } From 7ce7b80b2dfd106eb6a2f28fae287aa3058bd64d Mon Sep 17 00:00:00 2001 From: Ingrid Date: Fri, 4 Jul 2025 11:39:13 -0400 Subject: [PATCH 47/48] program coordinator font --- styles/main.css | 13 ++++++++----- 1 file changed, 8 insertions(+), 5 deletions(-) diff --git a/styles/main.css b/styles/main.css index df43b2d..f2acb2d 100644 --- a/styles/main.css +++ b/styles/main.css @@ -478,11 +478,11 @@ main section { } .meetcoordinators{ - font-family: 'JetBrains Mono', 'Courier New', monospace; + font-family: 'Segoe UI', Tahoma, Geneva, Verdana, sans-serif; color:#1e6623; - font-weight: 600; + font-weight: 700; margin-bottom: 2rem; - margin-top: 5rem; + margin-top: 3rem; } .meetcoordinators::after { @@ -491,8 +491,11 @@ main section { .coordinator h2{ color: #4e402b; - font-family: 'JetBrains Mono', 'Courier New', monospace;; + font-family:'Segoe UI', Tahoma, Geneva, Verdana, sans-serif; font-size: 2rem; + margin-top: 2rem; + margin-bottom: 1rem; + font-weight: 600; } .coordinator h2::after { @@ -502,7 +505,7 @@ main section { .coordinator-content { display: flex; align-items: center; - gap: 2em; + gap:2em; flex-wrap: wrap; } From 546099c18eb842032393b035a1bcd7d50191a049 Mon Sep 17 00:00:00 2001 From: Ingrid Date: Fri, 4 Jul 2025 11:51:59 -0400 Subject: [PATCH 48/48] coordinator h2 font --- index.html | 4 ++-- styles/main.css | 10 ++++++++-- 2 files changed, 10 insertions(+), 4 deletions(-) diff --git a/index.html b/index.html index c63edeb..2054978 100644 --- a/index.html +++ b/index.html @@ -80,7 +80,7 @@

WHY JOIN?

-

Meet the Program Coordinator

+

Meet The Coordinator

@@ -101,7 +101,7 @@

Lauren Gonzalez

-

Meet The Program Coordinator

+

Meet The Coordinator

diff --git a/styles/main.css b/styles/main.css index f2acb2d..5dce21a 100644 --- a/styles/main.css +++ b/styles/main.css @@ -322,6 +322,11 @@ body { } + + .coordinator h2{ + font-size: 1.5rem; + } + /* 2) For Lauren (DOM order is imgโ†’text), reverse the column so text sits on top */ .coordinator-content.lauren { flex-direction: column-reverse !important; @@ -490,11 +495,12 @@ main section { } .coordinator h2{ + text-transform: none; color: #4e402b; - font-family:'Segoe UI', Tahoma, Geneva, Verdana, sans-serif; + font-family:monospace; font-size: 2rem; margin-top: 2rem; - margin-bottom: 1rem; + margin-bottom: 1.5rem; font-weight: 600; }