From ba40c6d7ae1ae9782c32049aadaaf9634f7cef38 Mon Sep 17 00:00:00 2001 From: Thomas Green Date: Tue, 20 Mar 2018 11:00:33 +0000 Subject: [PATCH] Run dos2unix on *.py and tidyup some files. --- .gitignore | 1 + ldsc_mod/ldscore/allele_info.py | 126 +- mtag.py | 2706 +++++++++++++++---------------- mtag.pyc | Bin 63314 -> 0 bytes 4 files changed, 1417 insertions(+), 1416 deletions(-) create mode 100644 .gitignore mode change 100644 => 100755 mtag.py delete mode 100644 mtag.pyc diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..0d20b64 --- /dev/null +++ b/.gitignore @@ -0,0 +1 @@ +*.pyc diff --git a/ldsc_mod/ldscore/allele_info.py b/ldsc_mod/ldscore/allele_info.py index 670b6e4..7359765 100755 --- a/ldsc_mod/ldscore/allele_info.py +++ b/ldsc_mod/ldscore/allele_info.py @@ -1,63 +1,63 @@ -import itertools as it -''' -Contains useful objects related to allele relationships for ../munge_sumstats/py and sumstats.py - -''' - -_N_CHR = 22 -# complementary bases -COMPLEMENT = {'A': 'T', 'T': 'A', 'C': 'G', 'G': 'C'} -# bases -BASES = COMPLEMENT.keys() -# true iff strand ambiguous -STRAND_AMBIGUOUS = {''.join(x): x[0] == COMPLEMENT[x[1]] - for x in it.product(BASES, BASES) - if x[0] != x[1]} -# SNPS we want to keep (pairs of alleles) -VALID_SNPS = {x for x in map(lambda y: ''.join(y), it.product(BASES, BASES)) - if x[0] != x[1] and not STRAND_AMBIGUOUS[x]} - -VALID_andSA_SNPS = {x for x in map(lambda y: ''.join(y), it.product(BASES, BASES)) - if x[0] != x[1]} - -# T iff SNP 1 has the same alleles as SNP 2 (allowing for strand or ref allele flip). -MATCH_ALLELES = {x for x in map(lambda y: ''.join(y), it.product(VALID_SNPS, VALID_SNPS)) - # strand and ref match - if ((x[0] == x[2]) and (x[1] == x[3])) or - # ref match, strand flip - ((x[0] == COMPLEMENT[x[2]]) and (x[1] == COMPLEMENT[x[3]])) or - # ref flip, strand match - ((x[0] == x[3]) and (x[1] == x[2])) or - ((x[0] == COMPLEMENT[x[3]]) and (x[1] == COMPLEMENT[x[2]]))} # strand and ref flip -# T iff SNP 1 has the same alleles as SNP 2 w/ ref allele flip. -FLIP_ALLELES = {''.join(x): - ((x[0] == x[3]) and (x[1] == x[2])) or # strand match - # strand flip - ((x[0] == COMPLEMENT[x[3]]) and (x[1] == COMPLEMENT[x[2]])) - for x in MATCH_ALLELES} - - -__version__ = '1.0.0' -MASTHEAD = "*********************************************************************\n" -MASTHEAD += "* LD Score Regression (LDSC)\n" -MASTHEAD += "* Version {V}\n".format(V=__version__) -MASTHEAD += "* (C) 2014-2015 Brendan Bulik-Sullivan and Hilary Finucane\n" -MASTHEAD += "* Broad Institute of MIT and Harvard / MIT Department of Mathematics\n" -MASTHEAD += "* GNU General Public License v3\n" -MASTHEAD += "*********************************************************************\n" - - -def sec_to_str(t): - '''Convert seconds to days:hours:minutes:seconds''' - [d, h, m, s, n] = reduce(lambda ll, b : divmod(ll[0], b) + ll[1:], [(t, 1), 60, 60, 24]) - f = '' - if d > 0: - f += '{D}d:'.format(D=d) - if h > 0: - f += '{H}h:'.format(H=h) - if m > 0: - f += '{M}m:'.format(M=m) - - f += '{S}s'.format(S=s) - return f - +import itertools as it +''' +Contains useful objects related to allele relationships for ../munge_sumstats/py and sumstats.py + +''' + +_N_CHR = 22 +# complementary bases +COMPLEMENT = {'A': 'T', 'T': 'A', 'C': 'G', 'G': 'C'} +# bases +BASES = COMPLEMENT.keys() +# true iff strand ambiguous +STRAND_AMBIGUOUS = {''.join(x): x[0] == COMPLEMENT[x[1]] + for x in it.product(BASES, BASES) + if x[0] != x[1]} +# SNPS we want to keep (pairs of alleles) +VALID_SNPS = {x for x in map(lambda y: ''.join(y), it.product(BASES, BASES)) + if x[0] != x[1] and not STRAND_AMBIGUOUS[x]} + +VALID_andSA_SNPS = {x for x in map(lambda y: ''.join(y), it.product(BASES, BASES)) + if x[0] != x[1]} + +# T iff SNP 1 has the same alleles as SNP 2 (allowing for strand or ref allele flip). +MATCH_ALLELES = {x for x in map(lambda y: ''.join(y), it.product(VALID_SNPS, VALID_SNPS)) + # strand and ref match + if ((x[0] == x[2]) and (x[1] == x[3])) or + # ref match, strand flip + ((x[0] == COMPLEMENT[x[2]]) and (x[1] == COMPLEMENT[x[3]])) or + # ref flip, strand match + ((x[0] == x[3]) and (x[1] == x[2])) or + ((x[0] == COMPLEMENT[x[3]]) and (x[1] == COMPLEMENT[x[2]]))} # strand and ref flip +# T iff SNP 1 has the same alleles as SNP 2 w/ ref allele flip. +FLIP_ALLELES = {''.join(x): + ((x[0] == x[3]) and (x[1] == x[2])) or # strand match + # strand flip + ((x[0] == COMPLEMENT[x[3]]) and (x[1] == COMPLEMENT[x[2]])) + for x in MATCH_ALLELES} + + +__version__ = '1.0.0' +MASTHEAD = "*********************************************************************\n" +MASTHEAD += "* LD Score Regression (LDSC)\n" +MASTHEAD += "* Version {V}\n".format(V=__version__) +MASTHEAD += "* (C) 2014-2015 Brendan Bulik-Sullivan and Hilary Finucane\n" +MASTHEAD += "* Broad Institute of MIT and Harvard / MIT Department of Mathematics\n" +MASTHEAD += "* GNU General Public License v3\n" +MASTHEAD += "*********************************************************************\n" + + +def sec_to_str(t): + '''Convert seconds to days:hours:minutes:seconds''' + [d, h, m, s, n] = reduce(lambda ll, b : divmod(ll[0], b) + ll[1:], [(t, 1), 60, 60, 24]) + f = '' + if d > 0: + f += '{D}d:'.format(D=d) + if h > 0: + f += '{H}h:'.format(H=h) + if m > 0: + f += '{M}m:'.format(M=m) + + f += '{S}s'.format(S=s) + return f + diff --git a/mtag.py b/mtag.py old mode 100644 new mode 100755 index e7bb8d9..c96ff55 --- a/mtag.py +++ b/mtag.py @@ -1,1353 +1,1353 @@ -#!/usr/bin/env python -''' -''' - -from __future__ import division -import numpy as np -import pandas as pd -import scipy.optimize -import argparse -import itertools -import time -import os, re -import joblib -import sys, gzip, bz2 -import logging -from argparse import Namespace - -from ldsc_mod.ldscore import sumstats as sumstats_sig -from ldsc_mod.ldscore import allele_info - -import ldsc_mod.munge_sumstats as munge_sumstats - -__version__ = '1.0.7' - -borderline = "<><><<>><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><>" - -header ="\n" -header += borderline +"\n" -header += "<>\n" -header += "<> MTAG: Multi-trait Analysis of GWAS \n" -header += "<> Version: {}\n".format(str(__version__)) -header += "<> (C) 2017 Omeed Maghzian, Raymond Walters, and Patrick Turley\n" -header += "<> Harvard University Department of Economics / Broad Institute of MIT and Harvard\n" -header += "<> GNU General Public License v3\n" -header += borderline + "\n" -header += "<> Note: It is recommended to run your own QC on the input before using this program. \n" -header += "<> Software-related correspondence: maghzian@nber.org \n" -header += "<> All other correspondence: paturley@broadinstitute.org \n" -header += borderline +"\n" -header += "\n\n" - -pd.set_option('display.max_rows', 500) -pd.set_option('display.width', 800) -pd.set_option('precision', 12) -pd.set_option('max_colwidth', 800) -pd.set_option('colheader_justify', 'left') - -np.set_printoptions(linewidth=800) -np.set_printoptions(precision=3) - -## General helper functions -def safely_create_folder(folder_path): - try: - os.makedirs(folder_path) - except OSError: - if not os.path.isdir(folder_path): - raise - -class DisableLogger(): - ''' - For disabling the logging module when calling munge_sumstats - ''' - def __enter__(self): - logging.disable(logging.CRITICAL) - def __exit__(self, a, b, c): - logging.disable(logging.NOTSET) - -## Read / Write functions -def _read_SNPlist(file_path, SNP_index): - - # TODO Add more possible ways of reading SNPlists - snplist = pd.read_csv(file_path, header=0, index_col=False) - if SNP_index not in snplist.columns: - raise ValueError("SNPlist read from {} does include --snp_name {} in its columns.".format(file_path, SNP_index)) - return pd.read_csv(file_path, header=0, index_col=False) - -def _read_GWAS_sumstats(GWAS_file_name, chunksize): - ''' - read GWAS summary statistics from file that is in one of the acceptable formats. - ''' - # TODO read more file types - (openfunc, compression) = munge_sumstats.get_compression(GWAS_file_name) - dat_gen = pd.read_csv(GWAS_file_name, index_col=False, header=0,delim_whitespace=True, compression=compression, na_values=['.','NA'], - iterator=True, chunksize=chunksize) - dat_gen = list(dat_gen) - dat_gen_unfiltered = pd.concat(dat_gen, axis=0).reset_index(drop=True) - - return dat_gen_unfiltered, dat_gen - -def _read_matrix(file_path): - ''' - For reading 2-dimensional matrices. These files must be in .npy form or whitespace delimited .csv files - ''' - ext = file_path[-4:] - if ext == '.npy': - return np.load(file_path) - if ext == '.txt': - return np.loadtxt(file_path) - else: - raise ValueError('{} is not one of the acceptable file paths for reading in matrix-valued objects.'.format(ext)) - -## LDSC related functions -def sec_to_str(t): - '''Convert seconds to days:hours:minutes:seconds''' - [d, h, m, s, n] = reduce(lambda ll, b : divmod(ll[0], b) + ll[1:], [(t, 1), 60, 60, 24]) - f = '' - if d > 0: - f += '{D}d:'.format(D=d) - if h > 0: - f += '{H}h:'.format(H=h) - if m > 0: - f += '{M}m:'.format(M=m) - - f += '{S}s'.format(S=s) - return f - -class Logger_to_Logging(object): - """ - Logger class that write uses logging module and is needed to use munge_sumstats or ldsc from the LD score package. - """ - def __init__(self): - logging.info('created Logger instance to pass through ldsc.') - super(Logger_to_Logging, self).__init__() - - def log(self,x): - logging.info(x) - -def _perform_munge(args, GWAS_df, GWAS_dat_gen,p): - - original_cols = GWAS_df.columns - merge_alleles = None - out=None - zz= args.z_name if args.z_name is not None else 'z' - ignore_list = "" - if args.info_min is None: - ignore_list += "info" - - a1_munge = None if args.a1_name == "a1" else args.a1_name - a2_munge = None if args.a2_name == "a2" else args.a2_name - eaf_munge = None if args.eaf_name == "freq" else args.eaf_name - # sumstats is set to null because generator passed manually - argnames = Namespace(sumstats=None,N=None,N_cas=None,N_con=None,out=out,maf_min=args.maf_min_list[p], info_min =args.info_min_list[p],daner=False, no_alleles=False, merge_alleles=merge_alleles,n_min=args.n_min_list[p],chunksize=args.chunksize, snp=args.snp_name,N_col=args.n_name, N_cas_col=None, N_con_col = None, a1=a1_munge, a2=a2_munge, p=None,frq=eaf_munge,signed_sumstats=zz+',0', info=None,info_list=None, nstudy=None,nstudy_min=None,ignore=ignore_list,a1_inc=False, keep_maf=True, daner_n=False, keep_str_ambig=True, input_datgen=GWAS_dat_gen, cnames=list(original_cols)) - - logging.info(borderline) - logging.info('Munging Trait {} {}'.format(p+1,borderline[:-17])) - logging.info(borderline) - - - munged_results = munge_sumstats.munge_sumstats(argnames, write_out=False, new_log=False) - GWAS_df = GWAS_df.merge(munged_results, how='inner',left_on =args.snp_name,right_on='SNP',suffixes=('','_ss')) - GWAS_df = GWAS_df[original_cols] - - logging.info(borderline) - logging.info('Munging of Trait {} complete. SNPs remaining:\t {}'.format(p+1, len(GWAS_df))) - logging.info(borderline+'\n') - - return GWAS_df, munged_results - -def _quick_mode(ndarray,axis=0): - ''' - From stackoverflow: Efficient calculation of the mode of an array. Scipy.stats.mode is way too slow - ''' - if ndarray.size == 1: - return (ndarray[0],1) - elif ndarray.size == 0: - raise Exception('Attempted to find mode on an empty array!') - try: - axis = [i for i in range(ndarray.ndim)][axis] - except IndexError: - raise Exception('Axis %i out of range for array with %i dimension(s)' % (axis,ndarray.ndim)) - srt = np.sort(ndarray,axis=axis) - dif = np.diff(srt,axis=axis) - shape = [i for i in dif.shape] - shape[axis] += 2 - indices = np.indices(shape)[axis] - index = tuple([slice(None) if i != axis else slice(1,-1) for i in range(dif.ndim)]) - indices[index][dif == 0] = 0 - indices.sort(axis=axis) - bins = np.diff(indices,axis=axis) - location = np.argmax(bins,axis=axis) - mesh = np.indices(bins.shape) - index = tuple([slice(None) if i != axis else 0 for i in range(dif.ndim)]) - index = [mesh[i][index].ravel() if i != axis else location.ravel() for i in range(bins.ndim)] - counts = bins[tuple(index)].reshape(location.shape) - index[axis] = indices[tuple(index)] - modals = srt[tuple(index)].reshape(location.shape) - return (modals, counts) - - -def load_and_merge_data(args): - ''' - TODO Add description - Parses file names from MTAG command line arguments and returns the relevant used for method. - ''' - - GWAS_input_files = args.sumstats.split(',') - P = len(GWAS_input_files) # of phenotypes/traits - if args.n_min is not None: - args.n_min_list = [float(x) for x in args.n_min.split(',')] - if len(args.n_min_list) == 1: - args.n_min_list = args.n_min_list * P - else: - args.n_min_list = [None]*P - - if args.maf_min is not None: - args.maf_min_list = [float(x) for x in args.maf_min.split(',')] - if len(args.maf_min_list) == 1: - args.maf_min_list = args.maf_min_list * P - else: - args.maf_min_list = [None]*P - - if args.info_min is not None: - args.info_min_list = [float(x) for x in args.info_min.split(',')] - if len(args.info_min_list) == 1: - args.info_min_list = args.info_min_list * P - else: - args.info_min_list = [None]*P - - - - GWAS_d = dict() - sumstats_format = dict() - for p, GWAS_input in enumerate(GWAS_input_files): - GWAS_d[p], gwas_dat_gen = _read_GWAS_sumstats(GWAS_input, args.chunksize) - # add suffix - logging.info('Read in Trait {} summary statistics ({} SNPs) from {} ...'.format(p+1,len(GWAS_d[p]), GWAS_input)) - - # perform munge sumstats - GWAS_d[p], sumstats_format[p] = _perform_munge(args, GWAS_d[p], gwas_dat_gen, p) - GWAS_d[p] = GWAS_d[p].add_suffix(p) - - # convert Alleles to uppercase - for col in [col+str(p) for col in [args.a1_name, args.a2_name]]: - GWAS_d[p][col] = GWAS_d[p][col].str.upper() - - GWAS_d[p] =GWAS_d[p].rename(columns={x+str(p):x for x in GWAS_d[p].columns}) - GWAS_d[p] = GWAS_d[p].rename(columns={args.snp_name+str(p):args.snp_name}) - - # Drop SNPs that are missing or duplicated - missing_snps = GWAS_d[p][args.snp_name].isin(['NA','.']) - M0 = len(GWAS_d[p]) - GWAS_d[p] = GWAS_d[p][np.logical_not(missing_snps)] - if M0-len(GWAS_d[p]) > 0: - logging.info('Trait {}: Dropped {} SNPs for missing values in the "snp_name" column'.format(p+1, M0-len(GWAS_d[p]))) - - # drop snps that are duplicated - - M0 = len(GWAS_d[p]) - GWAS_d[p] = GWAS_d[p].drop_duplicates(subset=args.snp_name, keep='first') - if M0-len(GWAS_d[p]) > 0: - logging.info('Trait {}: Dropped {} SNPs for duplicate values in the "snp_name" column'.format(p+1, M0-len(GWAS_d[p]))) - - ## Merge summary statistics of GWA studies by snp index - - for p in range(P): - - if p == 0: - GWAS_all = GWAS_d[p] - - else: - GWAS_all = GWAS_all.merge(GWAS_d[p], how = 'inner', on=args.snp_name) - - M_0 = len(GWAS_all) - logging.info('Trait {} summary statistics: \t {} SNPs remaining merging with previous traits.'.format(p+1, M_0)) - if True: - snps_to_flip = np.logical_and(GWAS_all[args.a1_name+str(0)] == GWAS_all[args.a2_name+str(p)], GWAS_all[args.a2_name+str(0)] == GWAS_all[args.a1_name+str(p)]) - GWAS_all['flip_snps'+str(p)]= snps_to_flip - - logging.debug('Columns after merging :{}'.format(GWAS_all.columns)) - logging.debug(GWAS_all.head(15)) - snps_to_keep = np.logical_or(np.logical_and(GWAS_all[args.a1_name+str(0)]==GWAS_all[args.a1_name+str(p)], GWAS_all[args.a2_name+str(0)]==GWAS_all[args.a2_name+str(p)]), snps_to_flip) - - GWAS_all = GWAS_all[snps_to_keep] - if len(GWAS_all) < M_0: - logging.info('Dropped {} SNPs due to inconsistent allele pairs from phenotype {}. {} SNPs remain.'.format(M_0 - len(GWAS_all),p+1, len(GWAS_all))) - - if np.sum(snps_to_flip) > 0: - zz= args.z_name if args.z_name is not None else 'z' - freq_name = args.eaf_name if args.eaf_name is not None else 'freq' - - GWAS_all.loc[snps_to_flip, zz+str(p)] = -1*GWAS_all.loc[snps_to_flip, zz+str(p)] - GWAS_all.loc[snps_to_flip, freq_name + str(p)] = 1. - GWAS_all.loc[snps_to_flip, freq_name + str(p)] - store_allele = GWAS_all.loc[snps_to_flip, args.a1_name+str(p)] - GWAS_all.loc[snps_to_flip, args.a1_name+str(p)] = GWAS_all.loc[snps_to_flip, args.a2_name+str(p)] - GWAS_all.loc[snps_to_flip, args.a2_name+str(p)] = store_allele - logging.info('Flipped the signs of of {} SNPs to make them consistent with the effect allele orderings of the first trait.'.format(np.sum(snps_to_flip))) - # tag strand ambiguous SNPs - # logging.info(GWAS_all.head(15)) - STRAND_AMBIGUOUS_SET = [x for x in allele_info.STRAND_AMBIGUOUS.keys() if allele_info.STRAND_AMBIGUOUS[x]] - - GWAS_all['strand_ambig'] = (GWAS_all[args.a1_name+str(0)].str.upper() + GWAS_all[args.a2_name+str(0)].str.upper()).isin(STRAND_AMBIGUOUS_SET) - if args.drop_ambig_snps: - M_0 = len(GWAS_all) - GWAS_all = GWAS_all[np.logical_not(GWAS_all['strand_ambig'])] - logging.info('Dropped {} SNPs due to strand ambiguity, {} SNPs remain.'.format(M_0-len(GWAS_all),len(GWAS_all))) - - logging.info('... Merge of GWAS summary statistics complete. Number of SNPs:\t {}'.format(len(GWAS_all))) - - GWAS_orig_cols = GWAS_all.columns - ## Parses include files - if args.include is not None: - for j, include_file in enumerate(args.include.split(',')): - if j == 0: - snps_include = _read_SNPlist(include_file, args.snp_name) - else: - snps_include = snps_include.merge(_read_SNPlist(include_file,args.snp_name),how='outer', on=args.snp_name) - GWAS_all = GWAS_all.merge(snps_include, how="left", on = args.snp_name, indicator="included_merge", suffixes=('','_incl')) - GWAS_all = GWAS_all.loc[GWAS_all['included_merge']=='both'] - GWAS_all = GWAS_all.loc[:,GWAS_orig_cols] - logging.info('(--include) Number of SNPs remaining after restricting to SNPs in the union of {include_path}: \t {M} remain'.format(include_path=args.include,M=len(GWAS_all))) - ## Parses exclude files - if args.exclude is not None: - for exclude_file in args.exclude.split(','): - snps_exclude = _read_SNPlist(exclude_file, args.snp_name) - GWAS_all = GWAS_all.merge(snps_exclude, how="left", on = args.snp_name, indicator="excluded_merge", suffixes=('','_incl')) - GWAS_all = GWAS_all.loc[GWAS_all['excluded_merge']=='left_only'] - GWAS_all = GWAS_all.loc[:,GWAS_orig_cols] - logging.info('(-exclude) Number of SNPs remaining after excluding to SNPs in {exclude_path}: \t {M} remain'.format(exclude_path=exclude_file,M=len(GWAS_all))) - - - ## Parse chromosomes - if args.only_chr is not None: - chr_toInclude = args.only_chr.split(',') - chr_toInclude = [int(c) for c in chr_toInclude] - GWAS_all = GWAS_all[GWAS_all[args.chr_name+str(0)].isin(chr_toInclude)] - - ## add information to Namespace - args.P = P - - return GWAS_all, args - -def ldsc_matrix_formatter(result_rg, output_var): - ''' Key Arguments: - result_rg - matrix w/ RG objects obtained from estimate_rg (w/ None's on the diagonal) - output_var - interested variable in the form of '.[VAR_NAME]' - ''' - output_mat = np.empty_like(result_rg, dtype=float) - (nrow, ncol) = result_rg.shape - for i in range(nrow): - for j in range(ncol): - if result_rg[i, j] is None: - output_mat[i, j] = None - else: - exec('output_mat[i, j] = result_rg[i, j]{}'.format(output_var)) - return(output_mat) - -def estimate_sigma(data_df, args): - sigma_hat = np.empty((args.P,args.P)) - - args.munge_out = args.out+'_ldsc_temp/' - # Creates data files for munging - # Munge data - ignore_list = "" - if args.info_min is None: - ignore_list += "info" - - gwas_ss_df = dict() - - for p in range(args.P): - logging.info('Preparing phenotype {} to estimate sigma'.format(p)) - - ld_ss_name = {args.snp_name : 'SNP', - args.a1_name + str(p): 'A1', - args.a2_name + str(p): 'A2', - args.z_name + str(p): 'Z', - args.n_name + str(p): 'N', - args.eaf_name + str(p): 'FRQ'} - - # single_colnames = [col for col in data_df.columns if col[-1] == str(p) or col in args.snp_name] - gwas_ss_df[p] = data_df[ld_ss_name.keys()].copy() - - # gwas_filtered_df= gwas_filtered_df.rename(columns={args.snp_name:args.snp_name+str(p)}) - gwas_ss_df[p] = gwas_ss_df[p].rename(columns=ld_ss_name) - ## remove phenotype index from names - - - - # run ldsc - h2_files = None - rg_files = args.sumstats - rg_out = '{}_rg_misc'.format(args.out) - rg_mat = True - - args_ldsc_rg = Namespace(out=rg_out, bfile=None,l2=None,extract=None,keep=None, ld_wind_snps=None,ld_wind_kb=None, ld_wind_cm=None,print_snps=None, annot=None,thin_annot=False,cts_bin=None, cts_break=None,cts_names=None, per_allele=False, pq_exp=None, no_print_annot=False,maf=None,h2=h2_files, rg=rg_files,ref_ld=None,ref_ld_chr=args.ld_ref_panel, w_ld=None,w_ld_chr=args.ld_ref_panel,overlap_annot=False,no_intercept=False, intercept_h2=None, intercept_gencov=None,M=None,two_step=None, chisq_max=None,print_cov=False,print_delete_vals=False,chunk_size=50, pickle=False,invert_anyway=False,yes_really=False,n_blocks=200,not_M_5_50=False,return_silly_things=False,no_check_alleles=False,print_coefficients=False,samp_prev=None,pop_prev=None, frqfile=None, h2_cts=None, frqfile_chr=None,print_all_cts=False, sumstats_frames=[ gwas_ss_df[i] for i in range(args.P)], rg_mat=rg_mat) - - if args.no_overlap: - sigma_hat = np.zeros((args.P, args.P)) - for t in range(args.P): - args_ldsc_rg.sumstats_frames = [gwas_ss_df[t]] - rg_results_t = sumstats_sig.estimate_rg(args_ldsc_rg, Logger_to_Logging()) - sigma_hat[t,t] = ldsc_matrix_formatter(rg_results_t, '.gencov.intercept')[0] - else: - rg_results = sumstats_sig.estimate_rg(args_ldsc_rg, Logger_to_Logging()) - - sigma_hat = ldsc_matrix_formatter(rg_results, '.gencov.intercept') - - # if args.no_overlap: - # T = sigma_hat.shape[0] - # sigma_hat = sigma_hat * np.eye(T) - - # logging.info(type(sigma_hat)) - logging.info(sigma_hat) - - return sigma_hat - -def _posDef_adjustment(mat, scaling_factor=0.99,max_it=1000): - ''' - Checks whether the provided is pos semidefinite. If it is not, then it performs the the adjustment procedure descried in 1.2.2 of the Supplementary Note - - scaling_factor: the multiplicative factor that all off-diagonal elements of the matrix are scaled by in the second step of the procedure. - max_it: max number of iterations set so that - ''' - logging.info('Checking for positive definiteness ..') - assert mat.ndim == 2 - assert mat.shape[0] == mat.shape[1] - is_pos_semidef = lambda m: np.all(np.linalg.eigvals(m) >= 0) - if is_pos_semidef(mat): - return mat - else: - logging.info('matrix is not positive definite, performing adjustment..') - P = mat.shape[0] - for i in range(P): - for j in range(i,P): - if np.abs(mat[i,j]) > np.sqrt(mat[i,i] * mat[j,j]): - mat[i,j] = scaling_factor*np.sign(mat[i,j])*np.sqrt(mat[i,i] * mat[j,j]) - mat[j,i] = mat[i,j] - n=0 - while not is_pos_semidef(mat) and n < max_it: - dg = np.diag(mat) - mat = scaling_factor * mat - mat[np.diag_indices(P)] = dg - n += 1 - if n == max_it: - logging.info('Warning: max number of iterations reached in adjustment procedure. Sigma matrix used is still non-positive-definite.') - else: - logging.info('Completed in {} iterations'.format(n)) - return mat - -def extract_gwas_sumstats(DATA, args): - ''' - - Output: - ------- - All matrices are of the shape MxP, where M is the number of SNPs used in MTAG and P is the number of summary statistics results used. Columns are ordered according to the initial ordering of GWAS input files. - results_template = pd.Dataframe of snp_name chr bpos a1 a2 - Zs: matriix of Z scores - Ns: matrix of sample sizes - Fs: matrix of allele frequencies - ''' - n_cols = [args.n_name +str(p) for p in range(args.P)] - Ns = DATA.filter(items=n_cols).as_matrix() - - # Apply sample-size specific filters - - N_passFilter = np.ones(len(Ns), dtype=bool) - - N_nearMode = np.ones_like(Ns, dtype=bool) - if args.homogNs_frac is not None or args.homogNs_dist is not None: - N_modes, _ = _quick_mode(Ns) - assert len(N_modes) == Ns.shape[1] - if args.homogNs_frac is not None: - logging.info('--homogNs_frac {} is on, filtering SNPs ...'.format(args.homogNs_frac)) - assert args.homogNs_frac >= 0. - homogNs_frac_list = [float(x) for x in args.homogNs_frac.split(',')] - if len(homogNs_frac_list) == 1: - homogNs_frac_list = homogNs_frac_list*args.P - for p in range(args.P): - N_nearMode[:,p] = np.abs((Ns[:,p] - N_modes[p])) / N_modes[p] <= homogNs_frac_list[p] - elif args.homogNs_dist is not None: - logging.info('--homogNs_dist {} is on, filtering SNPs ...'.format(args.homogNs_dist)) - homogNs_dist_list = [float(x) for x in args.homogNs_dist.split(',')] - if len(homogNs_dist_list) == 1: - homogNs_dist_list = homogNs_dist_list*args.P - - assert np.all(np.array(homogNs_dist_list) >=0) - for p in range(args.P): - N_nearMode[:,p] = np.abs(Ns[:,p] - N_modes[p]) <= homogNs_dist_list[p] - else: - raise ValueError('Cannot specify both --homogNs_frac and --homogNs_dist at the same time.') - - # report restrictions - mode_restrictions = 'Sample size restrictions close to mode:\n' - for p in range(Ns.shape[1]): - mode_restrictions +="Phenotype {}: \t {} SNPs pass modal sample size filter \n".format(p+1,np.sum(N_nearMode[:,p])) - - mode_restrictions+="Intersection of SNPs that pass modal sample size filter for all traits:\t {}".format(np.sum(np.all(N_nearMode, axis=1))) - logging.info(mode_restrictions) - N_passFilter = np.logical_and(N_passFilter, np.all(N_nearMode,axis=1)) - - if args.n_max is not None: - n_max_restrictions = "--n_max used, removing SNPs with sample size greater than {}".format(args.n_max) - N_passMax = Ns <= args.n_max - for p in range(Ns.shape[1]): - n_max_restrictions += "Phenotype {}: \t {} SNPs pass modal sample size filter".format(p+1,np.sum(N_passMax[:,p])) - n_max_restrictions += "Intersection of SNPs that pass maximum sample size filter for all traits:\t {}".format(np.sum(np.all(N_passMax, axis=1))) - logging.info(n_max_restrictions) - N_passFilter = np.logical_and(N_passFilter, np.all(N_passMax,axis=1)) - - Ns = Ns[N_passFilter] - DATA = DATA[N_passFilter].reset_index() - - if args.z_name is not None: - z_cols = [args.z_name +str(p) for p in range(args.P)] - Zs = DATA.filter(items=z_cols).as_matrix() - else: - Zs = DATA.filter(regex='^[zZ].').as_matrix() - args.z_name = 'z' - if args.eaf_name is not None: - f_cols = [args.eaf_name + str(p) for p in range(args.P)] - - Fs =DATA.filter(items=f_cols).as_matrix() - else: - orig_case_cols = DATA.columns - DATA.columns = map(str.upper, DATA.columns) - - Fs = DATA.filter(regex='^/MAF|FREQ|FRQ/.').as_matrix() - - args.eaf_name = 'freq' - DATA.columns = orig_case_cols - assert Zs.shape[1] == Ns.shape[1] == Fs.shape[1] - - results_template = DATA[[args.snp_name]].copy() - # results_template = pd.DataFrame(index=np.arange(len(DATA))) - # results_template.loc[:,args.snp_name] = DATA[args.snp_name] - # args.chr args.bpos args.alelle_names - for col in [args.chr_name, args.bpos_name, args.a1_name, args.a2_name]: - results_template.loc[:,col] = DATA[col+str(0)] - # TODO: non-error form of integer conversion - # results_template[args.chr_name] = results_template[args.chr_name].astype(int) - # results_template[args.bpos_name] = results_template[args.bpos_name].astype(int) - - return Zs, Ns, Fs, results_template, DATA - -########################################### -## OMEGA ESTIMATION -########################################## - -def jointEffect_probability(Z_score, omega_hat, sigma_hat,N_mats, S=None): - ''' For each SNP m in each state s , computes the evaluates the multivariate normal distribution at the observed row of Z-scores - Calculate the distribution of (Z_m | s ) for all s in S, m in M. --> M x|S| matrix - The output is a M x n_S matrix of joint probabilities - ''' - - DTYPE = np.float64 - (M,P) = Z_score.shape - if S is None: # 2D dimensional form - assert omega_hat.ndim == 2 - omega_hat = omega_hat.reshape(1,P,P) - S = np.ones((1,P),dtype=bool) - - (n_S,_) = S.shape - jointProbs = np.empty((M,n_S)) - - xRinvs = np.zeros([M,n_S,P], dtype=DTYPE) - logSqrtDetSigmas = np.zeros([M,n_S], dtype=DTYPE) - Ls = np.zeros([M,n_S,P,P], dtype=DTYPE) - cov_s = np.zeros([M,n_S,P,P], dtype=DTYPE) - - Zs_rep = np.einsum('mp,s->msp',Z_score,np.ones(n_S)) # functionally equivalent to repmat - cov_s = np.einsum('mpq,spq->mspq',N_mats,omega_hat) + sigma_hat - - Ls = np.linalg.cholesky(cov_s) - Rs = np.transpose(Ls, axes=(0,1,3,2)) - - xRinvs = np.linalg.solve(Ls, Zs_rep) - - logSqrtDetSigmas = np.sum(np.log(np.diagonal(Rs,axis1=2,axis2=3)),axis=2).reshape(M,n_S) - - quadforms = np.sum(xRinvs**2,axis=2).reshape(M,n_S) - jointProbs = np.exp(-0.5 * quadforms - logSqrtDetSigmas - P * np.log(2 * np.pi) / 2) - - if n_S == 1: - jointProbs = jointProbs.flatten() - - return jointProbs - -def gmm_omega(Zs, Ns, sigma_LD): - logging.info('Using GMM estimator of Omega ..') - N_mats = np.sqrt(np.einsum('mp,mq->mpq', Ns,Ns)) - Z_outer = np.einsum('mp,mq->mpq',Zs, Zs) - return np.mean((Z_outer - sigma_LD) / N_mats, axis=0) - - -def numerical_omega(args, Zs,N_mats,sigma_LD,omega_start): - M,P = Zs.shape - solver_options = dict() - solver_options['fatol'] = 1.0e-8 - solver_options['xatol'] = args.tol - solver_options['disp'] = False - solver_options['maxiter'] = P*250 if args.perfect_gencov else P*(P+1)*500 - if args.perfect_gencov: - x_start = np.log(np.diag(omega_start)) - else: - x_start = flatten_out_omega(omega_start) - - opt_results = scipy.optimize.minimize(_omega_neglogL,x_start,args=(Zs,N_mats,sigma_LD,args),method='Nelder-Mead',options=solver_options) - - if args.perfect_gencov: - return np.sqrt(np.outer(np.exp(opt_results.x), np.exp(opt_results.x))), opt_results - else: - return rebuild_omega(opt_results.x), opt_results - -def _omega_neglogL(x,Zs,N_mats,sigma_LD,args): - if args.perfect_gencov: - omega_it = np.sqrt(np.outer(np.exp(x),np.exp(x))) - else: - omega_it = rebuild_omega(x) - joint_prob = jointEffect_probability(Zs,omega_it,sigma_LD,N_mats) - return - np.sum(np.log(joint_prob)) - -def flatten_out_omega(omega_est): - # stacks the lower part of the cholesky decomposition ROW_WISE [(0,0) (1,0) (1,1) (2,0) (2,1) (2,2) ...] - P_c = len(omega_est) - x_chol = np.linalg.cholesky(omega_est) - - # transform components of cholesky decomposition for better optimization - lowTr_ind = np.tril_indices(P_c) - x_chol_trf = np.zeros((P_c,P_c)) - for i in range(P_c): - for j in range(i): # fill in lower triangular components not on diagonal - x_chol_trf[i,j] = x_chol[i,j]/np.sqrt(x_chol[i,i]*x_chol[j,j]) - x_chol_trf[np.diag_indices(P_c)] = np.log(np.diag(x_chol)) # replace with log transformation on the diagonal - return tuple(x_chol_trf[lowTr_ind]) - - -def rebuild_omega(chol_elems, s=None): - '''Rebuild state-dependent Omega given combination of causal states - cholX_elements are the elements (entered row-wise) of the lower triangular cholesky decomposition of Omega_s - - ''' - if s is None: - P = int((-1 + np.sqrt(1.+ 8.*len(chol_elems)))/2.) - s = np.ones(P,dtype=bool) - P_c = P - else: - P_c = int(np.sum(s)) - P = s.shape[1] if s.ndim == 2 else len(s) - cholL = np.zeros((P_c,P_c)) - - cholL[np.tril_indices(P_c)] = np.array(chol_elems) - cholL[np.diag_indices(P_c)] = np.exp(np.diag(cholL)) # exponentiate the diagnoal so cholL unique - for i in range(P_c): - for j in range(i): # multiply by exponentiated diags - cholL[i,j] = cholL[i,j]*np.sqrt(cholL[i,i]*cholL[j,j]) - - omega_c = np.dot(cholL, cholL.T) - - # Expand to include zeros of matrix - omega = np.zeros((P,P)) - s_caus_ind = np.argwhere(np.outer(s, s)) - omega[(s_caus_ind[:,0],s_caus_ind[:,1])] = omega_c.flatten() - return omega - - -def estimate_omega(args,Zs,Ns,sigma_LD, omega_in=None): - - - # start_time =time.time() - logging.info('Beginning estimation of Omega ...') - - M,P = Zs.shape - N_mats = np.sqrt(np.einsum('mp, mq -> mpq',Ns, Ns)) - - - if args.perfect_gencov and args.equal_h2: - logging.info('--perfect_gencov and --equal_h2 option used') - return np.ones((P,P)) - - if args.numerical_omega: - if omega_in is None: # omega_in serves as starting point - omega_in = np.zeros((P,P)) - omega_in[np.diag_indices(P)] = np.diag(gmm_omega(Zs,Ns,sigma_LD)) - - omega_hat = omega_in - - omega_hat, opt_results = numerical_omega(args, Zs,N_mats, sigma_LD,omega_hat) - numerical_msg = "\n Numerical optimization of Omega complete:" - numerical_msg += "\nSuccessful termination? {}".format("Yes" if opt_results.success else "No") - numerical_msg += "\nTermination message:\t{}".format(opt_results.message) - numerical_msg += "\nCompleted in {} iterations".format(opt_results.nit) - logging.info(numerical_msg) - return omega_hat - - - if args.perfect_gencov: - omega_hat = _posDef_adjustment(gmm_omega(Zs,Ns,sigma_LD)) - return np.sqrt(np.outer(np.diag(omega_hat), np.diag(omega_hat))) - - # else: gmm_omega (default) - return _posDef_adjustment(gmm_omega(Zs,Ns,sigma_LD)) - -######################## -## MTAG CALCULATION #### -######################## - -def mtag_analysis(Zs, Ns, omega_hat, sigma_LD): - logging.info('Beginning MTAG calculations...') - M,P = Zs.shape - - W_N = np.einsum('mp,pq->mpq',np.sqrt(Ns),np.eye(P)) - W_N_inv = np.linalg.inv(W_N) - Sigma_N = np.einsum('mpq,mqr->mpr',np.einsum('mpq,qr->mpr',W_N_inv,sigma_LD),W_N_inv) - - mtag_betas = np.zeros((M,P)) - mtag_se =np.zeros((M,P)) - - for p in range(P): - # Note that in the code, what I call "gamma should really be omega", but avoid the latter term due to possible confusion with big Omega - gamma_k = omega_hat[:,p] - tau_k_2 = omega_hat[p,p] - om_min_gam = omega_hat - np.outer(gamma_k,gamma_k)/tau_k_2 - - xx = om_min_gam + Sigma_N - inv_xx = np.linalg.inv(xx) - yy = gamma_k/tau_k_2 - W_inv_Z = np.einsum('mqp,mp->mq',W_N_inv,Zs) - - beta_denom = np.einsum('mp,p->m',np.einsum('q,mqp->mp',yy,inv_xx),yy) - mtag_betas[:,p] = np.einsum('mp,mp->m',np.einsum('q,mqp->mp',yy,inv_xx), W_inv_Z) / beta_denom - - var_denom = np.einsum('mq,q->m',np.einsum('p,mpq->mq',yy,inv_xx),yy) - - mtag_var_p = 1. / var_denom - - mtag_se[:,p] = np.sqrt(mtag_var_p) - - - - logging.info(' ... Completed MTAG calculations.') - return mtag_betas, mtag_se - - -################# -## SAVING RESULTS ## -######################### - -def save_mtag_results(args,results_template,Zs,Ns, Fs,mtag_betas,mtag_se): - ''' - Output will be of the form: - - snp_name z n maf mtag_beta mtag_se mtag_zscore mtag_pval - - ''' - p_values = lambda z: 2*(scipy.stats.norm.cdf(-1.*np.abs(z))) - - M,P = mtag_betas.shape - - if args.std_betas: - logging.info('Outputting standardized betas..') - - for p in range(P): - logging.info('Writing Phenotype {} to file ...'.format(p+1)) - out_df = results_template.copy() - out_df[args.z_name] = Zs[:,p] - out_df[args.n_name] = Ns[:,p] - out_df[args.eaf_name] = Fs[:,p] - - if args.std_betas: - weights = np.ones(M,dtype=float) - else: - weights = np.sqrt( 2*Fs[:,p]*(1. - Fs[:,p])) - out_df['mtag_beta'] = mtag_betas[:,p] / weights - out_df['mtag_se'] = mtag_se[:,p] / weights - - out_df['mtag_z'] = mtag_betas[:,p]/mtag_se[:,p] - out_df['mtag_pval'] = p_values(out_df['mtag_z']) - - if P == 1: - out_path = args.out +'_trait.txt' - else: - out_path = args.out +'_trait_' + str(p+1) + '.txt' - - - out_df.to_csv(out_path,sep='\t', index=False) - - if not args.equal_h2: - omega_out = "\nEstimated Omega:\n" - omega_out += str(args.omega_hat) - omega_out += '\n' - np.savetxt(args.out +'_omega_hat.txt',args.omega_hat, delimiter ='\t') - else: - omega_out = "Omega hat not computed because --equal_h2 was used.\n" - - - sigma_out = "\nEstimated Sigma:\n" - sigma_out += str(args.sigma_hat) - sigma_out += '\n' - np.savetxt( args.out +'_sigma_hat.txt',args.sigma_hat, delimiter ='\t') - - summary_df = pd.DataFrame(index=np.arange(1,P+1)) - input_phenotypes = [ '...'+f[-16:] if len(f) > 20 else f for f in args.sumstats.split(',')] - - - for p in range(P): - - summary_df.loc[p+1,'Trait'] = input_phenotypes[p] - summary_df.loc[p+1, 'N (max)'] = np.max(Ns[:,p]) - summary_df.loc[p+1, 'N (mean)'] = np.mean(Ns[:,p]) - summary_df.loc[p+1, '# SNPs used'] = int(len(Zs[:,p])) - summary_df.loc[p+1, 'GWAS mean chi^2'] = np.mean(np.square(Zs[:,p])) / args.sigma_hat[p,p] - Z_mtag = mtag_betas[:,p]/mtag_se[:,p] - summary_df.loc[p+1, 'MTAG mean chi^2'] = np.mean(np.square(Z_mtag)) - summary_df.loc[p+1, 'GWAS equiv. (max) N'] = int(summary_df.loc[p+1, 'N (max)']*(summary_df.loc[p+1, 'MTAG mean chi^2'] - 1) / (summary_df.loc[p+1, 'GWAS mean chi^2'] - 1)) - - summary_df['N (max)'] = summary_df['N (max)'].astype(int) - summary_df['N (mean)'] = summary_df['N (mean)'].astype(int) - summary_df['# SNPs used'] = summary_df['# SNPs used'].astype(int) - summary_df['GWAS equiv. (max) N'] = summary_df['GWAS equiv. (max) N'].astype(int) - - final_summary = "\nSummary of MTAG results:\n" - final_summary +="------------------------\n" - final_summary += str(summary_df.round(3))+'\n' - final_summary += omega_out - final_summary += sigma_out - - logging.info(final_summary) - logging.info(' ') - logging.info('MTAG results saved to file.') -''' -Functions for maxFDR parallelization -''' -create_S = lambda P: np.asarray(list(itertools.product([False,True], repeat=P))) - -# def _FDR_par(func_args): -# ''' -# FDR methods for parallelization -# ''' -# probs, t,omega_hat, sigma_hat,S,Ns, coords = func_args -# if coords[0] % 1000 == 0: -# logging.info('Calculating for {}: {}'.format(coords, probs)) -# return -1.*compute_fdr(probs, t, omega_hat, sigma_hat, S, Ns) , coords - - - -def MTAG_var_Z_jt_c(t, Omega, Omega_c, sigma_LD, Ns): - - ''' - Omega: full Omega matrix - Omega_c: conditional Omega - Sigma_LD - N_mean: vector of length of "sample sizes" (1/c**2). - - This formula only works with constant N, etc. - ''' - - - T = Ns.shape[1] - W_N = np.einsum('mp,pq->mpq',np.sqrt(Ns),np.eye(T)) - W_N_inv = np.linalg.inv(W_N) - Sigma_j = np.einsum('mpq,mqr->mpr',np.einsum('mpq,qr->mpr',W_N_inv,sigma_LD),W_N_inv) - - gamma_k = Omega[:,t] - tau_k_2 = Omega[t,t] - - om_min_gam = Omega - np.outer(gamma_k, gamma_k) / tau_k_2 - xx = om_min_gam + Sigma_j - inv_xx = np.linalg.inv(xx) - - # num_L / R are the same due to symmetry - num_L = np.einsum('p,mpq->mq', gamma_k / tau_k_2, inv_xx) - num_R = np.einsum('mpq,q->mp', inv_xx, gamma_k / tau_k_2) - - - numer = np.einsum('mp,mp->m', num_L, np.einsum('mpq,mq->mp', Omega_c + Sigma_j, num_R)) - - denom = np.einsum('p,mp->m', gamma_k / tau_k_2, np.einsum('mpq,q->mp', inv_xx, gamma_k /tau_k_2)) - - return numer / denom - - -def simplex_walk(num_dims, samples_per_dim): - """ - A generator that returns lattice points on an n-simplex. - """ - max_ = samples_per_dim + num_dims - 1 - for c in itertools.combinations(range(max_), num_dims): - #print(c) - c = list(c) - yield np.array([(y - x - 1.) / (samples_per_dim - 1.) - for x, y in itertools.izip([-1] + c, c + [max_])]) - - - -def scale_omega(gen_corr_mat, priors, S=None): - assert gen_corr_mat.shape[0] == gen_corr_mat.shape[1] - T = gen_corr_mat.shape[1] - omega = np.zeros_like(gen_corr_mat) - if S is None: - S = create_S(T) - n_S = len(S) - for p1 in range(T): - for p2 in range(T): - # indices of states that are casual for both traits p1 and p2. - caus_state = np.arange(n_S)[np.logical_and(S[:, p1], S[:, p2])] - # print(np.sum(priors[caus_state])) - omega[p1,p2] = gen_corr_mat[p1,p2] / np.sum(priors[caus_state]) - - return omega - -def compute_fdr(prob, t, omega, sigma, S, Ns,N_counts, p_threshold): - - z_threshold = scipy.stats.norm.isf(p_threshold / 2.) # magnitude of z-score needed for statistical significance - n_S, T = S.shape - - omega_TT = scale_omega(omega, prob, S) - - if not is_pos_semidef(omega_TT): - return np.inf - - Omega_s = np.einsum('st,sr->str',S,S) * omega_TT - - - - Prob_signif_cond_t = np.zeros(n_S) - power_state_t = np.zeros_like(Prob_signif_cond_t) - - - for k in range(len(S)): - sd = np.sqrt(MTAG_var_Z_jt_c(t, omega, Omega_s[k,:,:], sigma, Ns)) #ZZZ generalize to take in Omega_s rather than one state at a time . - Prob_signif_cond_t[k] = np.sum(2*scipy.stats.norm.sf(z_threshold, loc=0, scale = sd)*N_counts) / float(np.sum(N_counts)) # produces m FDR estimates: take average by weighting each unique sample size row with the counts of SNPs with that sample size (weighted average, denominator will be equal to M) - - power_state_t[k] = Prob_signif_cond_t[k] * float(prob[k]) - - FDR_val = np.sum(power_state_t[~S[:,t]]) / np.sum(power_state_t) - - return FDR_val - - -def is_pos_semidef(m): - if m.shape[0] == 2 and m.shape[1] == 2: - return np.sqrt(m[0, 0]*m[1,1]) >= np.abs(m[0, 1]) - else: - eigs = np.linalg.eigvals(m) - - return np.all(eigs >= 0) - - -def neglogL_single_SS(x, beta, se, transformed=True): - ''' - Returns the negative loglikelihood of betas from a spike-slab - distribution. Used in the numerical optimziation of the `ss_estimation`. - - Arguments: - ---------- - x: 2-tuple (pi_null, tau). If transformed, `x` consists of bijective transformations of pi_null and tau so that the image of the mapping is all real numbers. - betas: The Mx1 vector of betas - se: The Mx1 vector of standard errors. Must allign with the reported betas. - transformed: boolean, default True, - If True, will perform inverse transformation on pi_null, tau so that they return to their "correct" domain. - - ''' - if transformed: - prob_null = 1.0 / (1.0 + np.exp(-1 * x[0])) - tau = np.exp(-x[1]) - else: - prob_null, tau = x - - causal_pdf = scipy.stats.norm.pdf(beta, loc=0,scale=np.sqrt(tau**2 + se**2)) - noncausal_pdf = scipy.stats.norm.pdf(beta,loc=0, scale = se) - - return -1. * np.sum(np.log( (1.0-prob_null)*causal_pdf + prob_null * noncausal_pdf)) - - -def cback_print(x): - logging.info(x) - - -def _optim_ss(f_args): - beta_t, se_t, starting_params, solver_opts = f_args - start_pi, start_tau = starting_params - x_0 = ( 1.0/(1.0 + np.exp(-start_pi)), -np.log(start_tau) ) - # beta_t, se_t = f_args - optim_results = scipy.optimize.minimize(neglogL_single_SS, x_0, args=(beta_t, se_t,True), method='Nelder-Mead', options=solver_opts, callback=None) - - t_pi, t_tau = optim_results.x - pi_null = 1.0 / (1.0 + np.exp(-1 * t_pi)) - tau = np.exp(-t_tau) - return pi_null, tau - - -def ss_estimation(args, betas, se, max_iter=1000, tol=1.0e-10, - starting_params =(0.5, 1.0e-3), - callback=False): - ''' - Numerically fit the distribution of betas and standard errors to a spike slab distribution. - - Arguments: - ---------- - betas: The Mx1 vector of betas - se: The Mx1 vector of standard errors. Must allign with the reported betas. - max_iter: int, - Maximum number of iterations - tol: float, - Tolerance used in numerical optimization (for both fatol, xatol) - - starting_params: 2-tuple: (pi_0, tau_0) - Starting parameters for optimization. Default is 0.5, 1.0e-3 - callback: boolean ,default False - If True, the parameters values will be printed at each step of optimization. - ''' - M,T = betas.shape - - - solver_opts = dict() - solver_opts['maxiter'] = max_iter - solver_opts['fatol'] = tol - solver_opts['xatol'] = tol - solver_opts['disp'] = True - callback = cback_print if callback else None - arg_list_ss = [(betas[:,t], se[:,t], starting_params, solver_opts) for t in range(T)] - ss_results = joblib.Parallel(n_jobs = args.cores, - backend='multiprocessing', - verbose=0, - batch_size=1)(joblib.delayed(_optim_ss)(f_args) for f_args in arg_list_ss) - return ss_results - - - -def some_causal_for_allT(probs, S): - # probability of being causal is nonzero for all traits - n_S, T = S.shape - # print(probs) - if not np.all([np.sum(probs[S[:,t]]) > 0 for t in range(T)]): - return False - for p1 in range(T): - for p2 in range(T): - # indices of states that are casual for both traits p1 and p2. - caus_state = np.arange(n_S)[np.logical_and(S[:, p1], S[:, p2])] - # print(np.sum(priors[caus_state])) - if np.sum(probs[caus_state]) == 0: - return False - return True - -def _FDR_par(func_args): - ''' - FDR methods for parallelization - omega_hat, sigma_hat, S, Ns, - ''' - probs, omega_hat, sigma_hat, S, Ns, N_counts, p_sig, g, t = func_args - return compute_fdr(probs, t, omega_hat, sigma_hat, S, Ns, N_counts, p_sig) , (g,t) - -def fdr(args, Ns_f, Zs): - ''' - Ns: Mx T matrix of sample sizes - ''' - # M,T = Ns.shape - - # only use unique values - if not args.grid_file: - if args.intervals <= 0: - raise ValueError('spacing of grid points for the max FDR calculation must be a positive integer') - - Ns = np.round(Ns_f) # round to avoid decimals - Ns_unique, Ns_counts = np.unique(Ns, return_counts=True, axis=0) - M_eff, T = Ns_unique.shape - - logging.info('T='+str(T)) - S = create_S(T) - causal_prob = lambda x, SS: np.sum(np.einsum('s,st->st',x,SS),axis=0) - - if args.grid_file is not None: - prob_grid = np.loadtxt(args.grid_file) - # exclude rows that don't sum to 1 - prob_grid = prob_grid[(np.sum(prob_grid, axis=1) > 1.) & np.sum(prob_grid, axis=1) < 0] - else: - # automate the creation of the probability grid - # one_dim_interval = np.linspace(0., 1., args.intervals +1) - prob_grid = simplex_walk(len(S)-1, args.intervals+1) - # exclude probabilities that have at least one trait with zero pi_causal - # exclude probabilities that don't yield a valid NPD matrix - prob_grid = [x for x in prob_grid if some_causal_for_allT(x,S) and is_pos_semidef(scale_omega(args.omega_hat, x,S))] - - if args.fit_ss: - gwas_se = 1. / np.sqrt(Ns) - gwas_betas = gwas_se * Zs - - ss_params_list = ss_estimation(args, gwas_betas, gwas_se) - pi_causal_ss = np.array([1.- x[0] for x in ss_params_list]) - logging.info('Completed estimation of spike-slab parameters resulting in the following causal probabilities') - for t in range(T): - logging.info('Trait {}: \t {:.3f}'.format(t, pi_causal_ss[t])) - - - prob_grid = [p for p in prob_grid if np.all(np.abs(causal_prob(p,S)-pi_causal_ss) < (1. / args.intervals) ) ] - logging.info('{} probabilities remain after restricting to the grid points with causal probabilities within one unit for each trait'.format(len(prob_grid))) - - - - logging.info('Number of gridpoints to search: {}'.format(len(prob_grid))) - - FDR = -1.23 * np.ones((len(prob_grid), T)) - - # performing coarse grid search - logging.info('Performing grid search using {} cores.'.format(args.cores)) - - - N_vals = np.mean(Ns, axis=0, keepdims=True) if args.n_approx else Ns_unique - N_weights = np.ones(1) if args.n_approx else Ns_counts - - # # define parallelization function - # def _FDR_par(func_args): - # ''' - # FDR methods for parallelization - # omega_hat, sigma_hat, S, Ns, - # ''' - # probs, g, t = func_args - # return compute_fdr(probs, t, args.omega_hat, args.sigma_hat, S, Ns, args.p_sig) , (g,t) - - - if not args.n_approx: - assert np.sum(N_weights) == len(Ns) - - arg_list = [(probs, args.omega_hat, args.sigm_hat, S, N_vals,N_weights, args.p_sig, g, t) for t in range(T) for g, probs in enumerate(prob_grid)] - NN = len(arg_list) - K = 10 - start_fdr =time.time() - for k in range(K): - k0 = int(k*NN / K) - k1 = int((k+1) * NN / K) - sublist = arg_list[k0:k1] if k + 1 != K else arg_list[k0:] - grid_results = joblib.Parallel(n_jobs = args.cores, - backend='multiprocessing', - verbose=0, - batch_size='auto')(joblib.delayed(_FDR_par)(f_args) for f_args in sublist) - logging.info('Grid search: {} percent finished for . Time: \t{:.3f} min'.format((k+1)*100./K, (time.time()-start_fdr)/ 60.)) - for i in range(len(grid_results)): - FDR_gt, coord = grid_results[i] # coord = (g,t) - FDR[coord[0], coord[1]] = FDR_gt - - np.savetxt(args.out + '_fdr_mat.txt', FDR, delimiter='\t') - np.savetxt(args.out + '_prob_grid.txt', prob_grid, delimiter='\t') - - # save FDR file once more - np.savetxt(args.out+'_fdr_mat.txt', FDR, delimiter='\t') - logging.info('Saved calculations of fdr over grid points in {}'.format(args.out+'_fdr_mat.txt')) - - logging.info(borderline) - ind_max = np.argmax(FDR, axis=0) - logging.info('grid point indices for max FDR for each trait: {}'.format(ind_max)) - max_FDR = np.max(FDR, axis=0) - logging.info('Maximum FDR') - for t in range(T): - logging.info('Max FDR of Trait {}: {} at probs = {}'.format(t+1, max_FDR[t], prob_grid[ind_max[t]])) - - logging.info(borderline) - logging.info('Completed FDR calculations.') - -def mtag(args): - - #1. Administrative checks - if args.equal_h2 and not args.perfect_gencov: - raise ValueError("--equal_h2 option used without --perfect_gencov. To use --equal_h2, --perfect_gencov must be also be included.") - - ## Instantiate log file and masthead - logging.basicConfig(format='%(asctime)s %(message)s', filename=args.out + '.log', filemode='w', level=logging.INFO,datefmt='%Y/%m/%d/%I:%M:%S %p') - if args.stream_stdout: - logging.getLogger().addHandler(logging.StreamHandler()) # prints to console - - header_sub = header - header_sub += "Calling ./mtag.py \\\n" - defaults = vars(parser.parse_args('')) - opts = vars(args) - non_defaults = [x for x in opts.keys() if opts[x] != defaults[x]] - options = ['--'+x.replace('_','-')+' '+str(opts[x])+' \\' for x in non_defaults] - header_sub += '\n'.join(options).replace('True','').replace('False','') - header_sub = header_sub[0:-1] + '\n' - - if args.ld_ref_panel is None: - # mtag_path =-os.path.dirname(os.path.abspath(__file__)) - - mtag_path = os.path.dirname(os.path.abspath(__file__)) +"/" - - args.ld_ref_panel = mtag_path+'ld_ref_panel/eur_w_ld_chr/' - - start_time = time.time() # starting time of analysis - # take output directory from --out path - try : - args.outdir = re.search('.+/', args.out).group(0) - except AttributeError: - logging.info('Invalid path used for --out: must have at least one / (use ./[tag] for current directory) and must not end in /') - raise - ## TODO Check all input paths - if not os.path.isdir(args.outdir): - if args.make_full_path or args.outdir[0] != '/': - logging.info("Output folder provided does not exist, creating the directory") - safely_create_folder(args.outdir) - else: - raise ValueError('Could not find output directory:\n {} \n at the specified absolute path. To create this directory, use the --make_full_path option.'.format(args.outdir)) - - logging.info(header_sub) - logging.info("Beginning MTAG analysis...") - - # 2. Load Data and perform restrictions - DATA, args = load_and_merge_data(args) - - # 3. Extract core information from combined GWAS data - Zs , Ns ,Fs, res_temp, DATA = extract_gwas_sumstats(DATA,args) - - - if not args.drop_ambig_snps: - logging.info('Using {} SNPs to estimate Omega ({} SNPs excluded due to strand ambiguity)'.format(len(Zs)- np.sum(DATA['strand_ambig']), np.sum(DATA['strand_ambig']))) - not_SA = np.logical_not(np.array(DATA['strand_ambig'])) - - # 4. Estimate Sigma - if args.residcov_path is None: - logging.info('Estimating sigma..') - if args.verbose: - args.sigma_hat = estimate_sigma(DATA[not_SA], args) - else: - with DisableLogger(): - args.sigma_hat = estimate_sigma(DATA[not_SA], args) - - else: - args.sigma_hat = _read_matrix(args.residcov_path) - args.sigm_hat = _posDef_adjustment(args.sigma_hat) - logging.info('Sigma hat:\n{}'.format(args.sigm_hat)) - - - G_mean_c2_adj = np.mean(np.square(Zs),axis=0) / np.diag(args.sigma_hat) - low_c2 = G_mean_c2_adj < 1.1 - if np.any(low_c2): - low_c2_msg = 'Mean chi^2 of SNPs used to estimate Omega is low for some SNPs' - #low_c2_msg += 'Traits {}'.format(' '.join(np.arange(1,args.P+1)[low_c2])) if np.sum(low_c2) > 1 else 'Trait {}'.format(' '.join(np.arange(1,args.P+1)[low_c2])) - #low_c2_msg += '(= {})'.format(' '.join(G_mean_c2_adj[low_c2])) - low_c2_msg += 'MTAG may not perform well in this situation.' - logging.info(low_c2_msg) - - - #5. Estimate Omega - - if args.gencov_path is None: - not_SA = np.logical_not(np.array(DATA['strand_ambig'])) - args.omega_hat = estimate_omega(args, Zs[not_SA], Ns[not_SA], args.sigma_hat) - logging.info('Completed estimation of Omega ...') - else: - args.omega_hat = _read_matrix(args.gencov_path) - - - assert args.omega_hat.shape[0] == args.omega_hat.shape[1] == Zs.shape[1] == args.sigma_hat.shape[0] == args.sigma_hat.shape[1] - - #6. Perform MTAG - mtag_betas, mtag_se = mtag_analysis(Zs, Ns, args.omega_hat, args.sigma_hat) - - #7. Output GWAS_results - save_mtag_results(args, res_temp,Zs,Ns, Fs,mtag_betas,mtag_se) - - - - if args.fdr: - - logging.info('Beginning maxFDR calculations. Depending on the number of grid points specified, this might take some time...') - - fdr(args, Ns, Zs) - ### ZZZ use function fdr(args, Ns) - - - logging.info('MTAG complete. Time elapsed: {}'.format(sec_to_str(time.time()-start_time))) - - - - -parser = argparse.ArgumentParser(description="\n **mtag: Multitrait Analysis of GWAS**\n This program is the implementation of MTAG method described by Turley et. al. Requires the input of a comma-separated list of GWAS summary statistics with identical columns. It is recommended to pass the column names manually to the program using the options below. The implementation of MTAG makes use of the LD Score Regression (ldsc) for cleaning the data and estimating residual variance-covariance matrix, so the input must also be compatible ./munge_sumstats.py command in the ldsc distribution included with mtag. The default estimation method for the genetic covariance matrix Omega is GMM (as described in the paper). \n\n Note below: any list of passed to the options below must be comma-separated without whitespace.") - -# input_formatting = parser.add_argument_group(title="Options") - -in_opts = parser.add_argument_group(title='Input Files', description="Input files to be used by MTAG. The --sumstats option is required, while using the other two options take priority of their corresponding estimation routines, if used.") -in_opts.add_argument("--sumstats", metavar="{File1},{File2}...", type=str, nargs='?',required=False, help='Specify the list of summary statistics files to perform multitrait analysis. Multiple files paths must be separated by \",\". Please read the documentation to find the up-to-date set of acceptable file formats. A general guideline is that any files you pass into MTAG should also be parsable by ldsc and you should take the additional step of specifying the names of the main columns below to avoid reading errors.') -in_opts.add_argument("--gencov_path",metavar="FILE_PATH", default=None, action="store", help="If specified, will read in the genetic covariance matrix saved in the file path below and skip the estimation routine. The rows and columns of the matrix must correspond to the order of the GWAS input files specified. FIles can either be in whitespace-delimited .txt or .npy format. Use with caution as the genetic covariance matrix specified will be weakly nonoptimal.") -in_opts.add_argument("--residcov_path",metavar="FILE_PATH", default=None, action="store", help="If specified, will read in the residual covariance matrix saved in the file path below and skip the estimation routine. The rows and columns of the matrix must correspond to the order of the GWAS input files specified. FIles can either be in .txt or .npy format. Use with caution as the genetic covariance matrix specified will be weakly nonoptimal. File must either be in whitespace-delimited .txt or .npy") - -out_opts = parser.add_argument_group(title="Output formatting", description="Set the output directory and common name of prefix files.") - -out_opts.add_argument("--out", metavar='DIR/PREFIX', default='./mtag_results', type=str, help='Specify the directory and name prefix to output MTAG results. All mtag results will be prefixed with the corresponding tag. Default is ./mtag_results') -out_opts.add_argument("--make_full_path", default=False, action="store_true", help="option to make output path specified in -out if it does not exist.") - -input_formatting = parser.add_argument_group(title="Column names of input files", description="These options manually pass the names of the relevant summary statistics columns used by MTAG. It is recommended to pass these names because only narrow searches for these columns are performed in the default cases. Moreover, it is necessary that these input files be readable by ldsc's munge_sumstats command.") -input_formatting.add_argument("--snp_name", default="snpid", action="store",type=str, help="Name of the single column that provides the unique identifier for SNPs in the GWAS summary statistics across all GWAS results. Default is \"snpid\". This the index that will be used to merge the GWAS summary statistics. Any SNP lists passed to ---include or --exclude should also contain the same name.") -input_formatting.add_argument("--z_name", default="z", help="The common name of the column of Z scores across all input files. Default is the lowercase letter z.") -input_formatting.add_argument("--n_name", default="n", help="the common name of the column of sample sizes in the GWAS summary statistics files. Default is the lowercase letter n.") -input_formatting.add_argument('--eaf_name',default="freq", help="The common name of the column of minor allele frequencies (MAF) in the GWAS input files. The default is \"freq\".") -input_formatting.add_argument('--chr_name',default='chr', type=str, help="Name of the column containing the chromosome of each SNP in the GWAS input. Default is \"chr\".") -input_formatting.add_argument('--bpos_name',default='bpos', type=str, help="Name of the column containing the base pair of each SNP in the GWAS input. Default is \"bpos\".") -input_formatting.add_argument('--a1_name',default='a1', type=str, help="Name of the column containing the effect allele of each SNP in the GWAS input. Default is \"a1\".") -input_formatting.add_argument('--a2_name',default='a2', type=str, help="Name of the column containing the non-effect allele of each SNP in the GWAS input. Default is \"a2\".") - - -filter_opts = parser.add_argument_group(title="Filter Options", description="The input summary statistics files can be filtered using the options below. Note that there is some default filtering according to sample size and allele frequency, following the recommendations we make in the corresponding paper. All of these column-based options allow a list of values to be passed of the same length as the number of traits ") -filter_opts.add_argument("--include",default=None, metavar="SNPLIST1,SNPLIST2,..", type=str, help="Restricts MTAG analysis to the union of snps in the list of snplists provided. The header line must match the SNP index that will be used to merge the GWAS input files.") -filter_opts.add_argument("--exclude", "--excludeSNPs",default=None, metavar="SNPLIST1,SNPLIST2,..", type=str, help="Similar to the --include option, except that the union of SNPs found in the specified files will be excluded from MTAG. Both -exclude and -include may be simultaneously specified, but -exclude will take precedent (i.e., SNPs found in both the -include and -exclude SNP lists will be excluded).") -filter_opts.add_argument('--only_chr', metavar="CHR_A,CHR_B,..", default=None, type=str, action="store", help="Restrict MTAG to SNPs on one of the listed, comma-separated chromosome. Can be specified simultaneously with --include and --exclude, but will take precedent over both. Not generally recommended. Multiple chromosome numbers should be separated by commas without whitespace. If this option is specified, the GWAS summary statistics must also list the chromosome of each SNPs in a column named \`chr\`.") - -filter_opts.add_argument("--homogNs_frac", default=None, type=str, action="store", metavar="FRAC", help="Restricts to SNPs within FRAC of the mode of sample sizes for the SNPs as given by (N-Mode)/Mode < FRAC. This filter is not applied by default.") -filter_opts.add_argument("--homogNs_dist", default=None, type=str, action="store", metavar="D", help="Restricts to SNPs within DIST (in sample size) of the mode of sample sizes for the SNPs. This filter is not applied by default.") - -filter_opts.add_argument('--maf_min', default='0.01', type=str, action='store', help="set the threshold below SNPs with low minor allele frequencies will be dropped. Default is 0.01. Set to 0 to skip MAF filtering.") -filter_opts.add_argument('--n_min', default=None, type=str, action='store', help="set the minimum threshold for SNP sample size in input data. Default is 2/3*(90th percentile). Any SNP that does not pass this threshold for all of the GWAS input statistics will not be included in MTAG.") -filter_opts.add_argument('--n_max', default=None, type=str, action='store', help="set the maximum threshold for SNP sample size in input data. Not used by default. Any SNP that does not pass this threshold for any of the GWAS input statistics will not be included in MTAG.") -filter_opts.add_argument("--info_min", default=None,type=str, help="Minimim info score for filtering SNPs for MTAG.") -filter_opts.add_argument("--drop_ambig_snps", default=False, action="store_true", help="Drop strand ambiguous SNPs when performing MTAG (they are already not used to estimate Omega or Sigma.") -filter_opts.add_argument("--no_allele_flipping", default=False, action="store_true", help="Prevents flipping the effect sizes of summary statistics when the effect and non-effect alleles are reversed (reletive the first summary statistics file.") - -special_cases = parser.add_argument_group(title="Special Cases",description="These options deal with notable special cases of MTAG that yield improvements in runtime. However, they should be used with caution as they will yield non-optimal results if the assumptions implicit in each option are violated.") - -special_cases.add_argument('--no_overlap', default=False, action='store_true', help='Imposes the assumption that there is no sample overlap between the input GWAS summary statistics. MTAG is performed with the off-diagonal terms on the residual covariance matrix set to 0.') -special_cases.add_argument('--perfect_gencov', default=False, action='store_true', help='Imposes the assumption that all traits used are perfectly genetically correlated with each other. The off-diagonal terms of the genetic covariance matrix are set to the square root of the product of the heritabilities') -special_cases.add_argument('--equal_h2', default=False, action='store_true', help='Imposes the assumption that all traits passed to MTAG have equal heritability. The diagonal terms of the genetic covariance matrix are set equal to each other. Can only be used in conjunction with --perfect_gencov') - -fdr_opts = parser.add_argument_group(title='Max FDR calculation', description="These options are used for the calculation of an upper bound on the false disovery under the model described in Supplementary Note 1.1.4 of Turley et al. (2017). Note that there is one of three ways to define the space of grid points over which the upper bound is searched. ") - -fdr_opts.add_argument('--fdr', default=False, action='store_true', help='Perform max FDR calculations') -# fdr_opts.add_argument(title='--skip-mtag', default=False, action='store_true',) # XXX make option to skip mtag calculations if already done. -# make mutually exclusive group -fdr_opts.add_argument('--grid_file',default=None, action='store', help='Pre-set list of grid points. Users can define a list of grid points over which the search is conducted. The list of grid points should be passed in text file as a white-space delimited matrix of dimnesions, G x S, where G is the number of grid points and S = 2^T is the number of possible causal states for SNPs. States are ordered according to a tree-like recursive structure from right to left. For example, for 3 traits, with the triple TFT denoting the state for which SNPs are causal for State 1, not causal for state 2, and causal for state 3, then the column ordering of probabilities should be: \nFFF FFT FTF FTT TFF TFT TTF TTT\n There should be no headers, or row names in the file. Any rows for which (i) the probabilities do not sum to 1, the prior of a SNP being is causal is 0 for any of the traits, and (iii) the resulting genetic correlation matrix is non positive definite will excluded in the search.') -# XXX rounding to 1e-6 & restandardize. - -fdr_opts.add_argument('--fit_ss', default=False, action='store_true', help='This estimates the prior probability that a SNP is null for each trait and then proceeds to restrict the grid search to the set of probability vectors that sum to the prior null for each trait. This is useful for restrict the search space of larger-dimensional traits.') - -fdr_opts.add_argument('--intervals', default=10, action='store',type=int, help='Number of intervals that you would like to partition the [0,1] interval. For example example, with two traits and --intervals set 10, then maxFDR will calculated over the set of feasible points in {0., 0.1, 0.2,..,0.9,1.0}^2.') - -fdr_opts.add_argument('--cores', default=1, action='store', type=int, help='Number of threads/cores use to compute the FDR grid points for each trait.') - -fdr_opts.add_argument('--p_sig', default=5.0e-8, action='store', help='P-value threshold used for statistical signifiance. Default is p=5.0e-8 (genome-wide significance).' ) -fdr_opts.add_argument('--n_approx', default=False, action='store_true', help='Speed up FDR calculation by replacing the sample size of a SNP for each trait by the mean across SNPs (for each trait). Recommended.') - -# fdr_opts.add_argument('--binned_n', default=False, action='store_true', help='When --n_approx is off, this options allows for a sped-up version of the max_FDR calculation by weighting the power calculations of unique rows.') - -# wc = parser.add_argument_group(title='Winner\'s curse adjustment', description='Options related to the winner\'s curse adjustment of estimates of effect sizes from MTAG that could be used when replicating analyses.') -# GWAS or MTAG results? -# maybe both? - -misc = parser.add_argument_group(title="Miscellaneous") - -misc.add_argument('--ld_ref_panel', default=None, action='store',metavar="FOLDER_PATH", type=str, help='Specify folder of the ld reference panel (split by chromosome) that will be used in the estimation of the error VCV (sigma). This option is passed to --ref-ld-chr and --w-ld-chr when running LD score regression. The default is to use the reference panel of LD scores computed from 1000 Genomes European subjects (eur_w_ld_chr) that is included with the distribution of MTAG') -misc.add_argument('--time_limit', default=100.,type=float, action="store", help="Set time limit (hours) on the numerical estimation of the variance covariance matrix for MTAG, after which the optimization routine will complete its current iteration and perform MTAG using the last iteration of the genetic VCV.") - -misc.add_argument('--std_betas', default=False, action='store_true', help="Results files will have standardized effect sizes, i.e., the weights 1/sqrt(2*MAF*(1-MAF)) are not applied when outputting MTAG results, where MAF is the minor allele frequency.") -misc.add_argument("--tol", default=1e-6,type=float, help="Set the relative (x) tolerance when numerically estimating the genetic variance-covariance matrix. Not recommended to change unless you are facing strong runtime constraints for a large number of traits.") -misc.add_argument('--numerical_omega', default=False, action='store_true', help='Option to use the MLE estimator of the genetic VCV matrix, implemented through a numerical routine.') -misc.add_argument('--verbose', default=False, action='store_true', help='When used, will include output from running ldsc scripts as well additional information (such as optimization routine information.') -misc.add_argument('--chunksize', default=1e7, type=int, - help='Chunksize for reading in data.') -misc.add_argument('--stream_stdout', default=False, action='store_true', help='Will streat mtag processing on console in addition to writing to log file.') - -if __name__ == '__main__': - start_t = time.time() - args = parser.parse_args() - try: - mtag(args) - except Exception as e: - logging.error(e,exc_info=True) - logging.info('Analysis terminated from error at {T}'.format(T=time.ctime())) - time_elapsed = round(time.time() - start_t, 2) - logging.info('Total time elapsed: {T}'.format(T=sec_to_str(time_elapsed))) +#!/usr/bin/env python +''' +''' + +from __future__ import division +import numpy as np +import pandas as pd +import scipy.optimize +import argparse +import itertools +import time +import os, re +import joblib +import sys, gzip, bz2 +import logging +from argparse import Namespace + +from ldsc_mod.ldscore import sumstats as sumstats_sig +from ldsc_mod.ldscore import allele_info + +import ldsc_mod.munge_sumstats as munge_sumstats + +__version__ = '1.0.7' + +borderline = "<><><<>><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><><>" + +header ="\n" +header += borderline +"\n" +header += "<>\n" +header += "<> MTAG: Multi-trait Analysis of GWAS \n" +header += "<> Version: {}\n".format(str(__version__)) +header += "<> (C) 2017 Omeed Maghzian, Raymond Walters, and Patrick Turley\n" +header += "<> Harvard University Department of Economics / Broad Institute of MIT and Harvard\n" +header += "<> GNU General Public License v3\n" +header += borderline + "\n" +header += "<> Note: It is recommended to run your own QC on the input before using this program. \n" +header += "<> Software-related correspondence: maghzian@nber.org \n" +header += "<> All other correspondence: paturley@broadinstitute.org \n" +header += borderline +"\n" +header += "\n\n" + +pd.set_option('display.max_rows', 500) +pd.set_option('display.width', 800) +pd.set_option('precision', 12) +pd.set_option('max_colwidth', 800) +pd.set_option('colheader_justify', 'left') + +np.set_printoptions(linewidth=800) +np.set_printoptions(precision=3) + +## General helper functions +def safely_create_folder(folder_path): + try: + os.makedirs(folder_path) + except OSError: + if not os.path.isdir(folder_path): + raise + +class DisableLogger(): + ''' + For disabling the logging module when calling munge_sumstats + ''' + def __enter__(self): + logging.disable(logging.CRITICAL) + def __exit__(self, a, b, c): + logging.disable(logging.NOTSET) + +## Read / Write functions +def _read_SNPlist(file_path, SNP_index): + + # TODO Add more possible ways of reading SNPlists + snplist = pd.read_csv(file_path, header=0, index_col=False) + if SNP_index not in snplist.columns: + raise ValueError("SNPlist read from {} does include --snp_name {} in its columns.".format(file_path, SNP_index)) + return pd.read_csv(file_path, header=0, index_col=False) + +def _read_GWAS_sumstats(GWAS_file_name, chunksize): + ''' + read GWAS summary statistics from file that is in one of the acceptable formats. + ''' + # TODO read more file types + (openfunc, compression) = munge_sumstats.get_compression(GWAS_file_name) + dat_gen = pd.read_csv(GWAS_file_name, index_col=False, header=0,delim_whitespace=True, compression=compression, na_values=['.','NA'], + iterator=True, chunksize=chunksize) + dat_gen = list(dat_gen) + dat_gen_unfiltered = pd.concat(dat_gen, axis=0).reset_index(drop=True) + + return dat_gen_unfiltered, dat_gen + +def _read_matrix(file_path): + ''' + For reading 2-dimensional matrices. These files must be in .npy form or whitespace delimited .csv files + ''' + ext = file_path[-4:] + if ext == '.npy': + return np.load(file_path) + if ext == '.txt': + return np.loadtxt(file_path) + else: + raise ValueError('{} is not one of the acceptable file paths for reading in matrix-valued objects.'.format(ext)) + +## LDSC related functions +def sec_to_str(t): + '''Convert seconds to days:hours:minutes:seconds''' + [d, h, m, s, n] = reduce(lambda ll, b : divmod(ll[0], b) + ll[1:], [(t, 1), 60, 60, 24]) + f = '' + if d > 0: + f += '{D}d:'.format(D=d) + if h > 0: + f += '{H}h:'.format(H=h) + if m > 0: + f += '{M}m:'.format(M=m) + + f += '{S}s'.format(S=s) + return f + +class Logger_to_Logging(object): + """ + Logger class that write uses logging module and is needed to use munge_sumstats or ldsc from the LD score package. + """ + def __init__(self): + logging.info('created Logger instance to pass through ldsc.') + super(Logger_to_Logging, self).__init__() + + def log(self,x): + logging.info(x) + +def _perform_munge(args, GWAS_df, GWAS_dat_gen,p): + + original_cols = GWAS_df.columns + merge_alleles = None + out=None + zz= args.z_name if args.z_name is not None else 'z' + ignore_list = "" + if args.info_min is None: + ignore_list += "info" + + a1_munge = None if args.a1_name == "a1" else args.a1_name + a2_munge = None if args.a2_name == "a2" else args.a2_name + eaf_munge = None if args.eaf_name == "freq" else args.eaf_name + # sumstats is set to null because generator passed manually + argnames = Namespace(sumstats=None,N=None,N_cas=None,N_con=None,out=out,maf_min=args.maf_min_list[p], info_min =args.info_min_list[p],daner=False, no_alleles=False, merge_alleles=merge_alleles,n_min=args.n_min_list[p],chunksize=args.chunksize, snp=args.snp_name,N_col=args.n_name, N_cas_col=None, N_con_col = None, a1=a1_munge, a2=a2_munge, p=None,frq=eaf_munge,signed_sumstats=zz+',0', info=None,info_list=None, nstudy=None,nstudy_min=None,ignore=ignore_list,a1_inc=False, keep_maf=True, daner_n=False, keep_str_ambig=True, input_datgen=GWAS_dat_gen, cnames=list(original_cols)) + + logging.info(borderline) + logging.info('Munging Trait {} {}'.format(p+1,borderline[:-17])) + logging.info(borderline) + + + munged_results = munge_sumstats.munge_sumstats(argnames, write_out=False, new_log=False) + GWAS_df = GWAS_df.merge(munged_results, how='inner',left_on =args.snp_name,right_on='SNP',suffixes=('','_ss')) + GWAS_df = GWAS_df[original_cols] + + logging.info(borderline) + logging.info('Munging of Trait {} complete. SNPs remaining:\t {}'.format(p+1, len(GWAS_df))) + logging.info(borderline+'\n') + + return GWAS_df, munged_results + +def _quick_mode(ndarray,axis=0): + ''' + From stackoverflow: Efficient calculation of the mode of an array. Scipy.stats.mode is way too slow + ''' + if ndarray.size == 1: + return (ndarray[0],1) + elif ndarray.size == 0: + raise Exception('Attempted to find mode on an empty array!') + try: + axis = [i for i in range(ndarray.ndim)][axis] + except IndexError: + raise Exception('Axis %i out of range for array with %i dimension(s)' % (axis,ndarray.ndim)) + srt = np.sort(ndarray,axis=axis) + dif = np.diff(srt,axis=axis) + shape = [i for i in dif.shape] + shape[axis] += 2 + indices = np.indices(shape)[axis] + index = tuple([slice(None) if i != axis else slice(1,-1) for i in range(dif.ndim)]) + indices[index][dif == 0] = 0 + indices.sort(axis=axis) + bins = np.diff(indices,axis=axis) + location = np.argmax(bins,axis=axis) + mesh = np.indices(bins.shape) + index = tuple([slice(None) if i != axis else 0 for i in range(dif.ndim)]) + index = [mesh[i][index].ravel() if i != axis else location.ravel() for i in range(bins.ndim)] + counts = bins[tuple(index)].reshape(location.shape) + index[axis] = indices[tuple(index)] + modals = srt[tuple(index)].reshape(location.shape) + return (modals, counts) + + +def load_and_merge_data(args): + ''' + TODO Add description + Parses file names from MTAG command line arguments and returns the relevant used for method. + ''' + + GWAS_input_files = args.sumstats.split(',') + P = len(GWAS_input_files) # of phenotypes/traits + if args.n_min is not None: + args.n_min_list = [float(x) for x in args.n_min.split(',')] + if len(args.n_min_list) == 1: + args.n_min_list = args.n_min_list * P + else: + args.n_min_list = [None]*P + + if args.maf_min is not None: + args.maf_min_list = [float(x) for x in args.maf_min.split(',')] + if len(args.maf_min_list) == 1: + args.maf_min_list = args.maf_min_list * P + else: + args.maf_min_list = [None]*P + + if args.info_min is not None: + args.info_min_list = [float(x) for x in args.info_min.split(',')] + if len(args.info_min_list) == 1: + args.info_min_list = args.info_min_list * P + else: + args.info_min_list = [None]*P + + + + GWAS_d = dict() + sumstats_format = dict() + for p, GWAS_input in enumerate(GWAS_input_files): + GWAS_d[p], gwas_dat_gen = _read_GWAS_sumstats(GWAS_input, args.chunksize) + # add suffix + logging.info('Read in Trait {} summary statistics ({} SNPs) from {} ...'.format(p+1,len(GWAS_d[p]), GWAS_input)) + + # perform munge sumstats + GWAS_d[p], sumstats_format[p] = _perform_munge(args, GWAS_d[p], gwas_dat_gen, p) + GWAS_d[p] = GWAS_d[p].add_suffix(p) + + # convert Alleles to uppercase + for col in [col+str(p) for col in [args.a1_name, args.a2_name]]: + GWAS_d[p][col] = GWAS_d[p][col].str.upper() + + GWAS_d[p] =GWAS_d[p].rename(columns={x+str(p):x for x in GWAS_d[p].columns}) + GWAS_d[p] = GWAS_d[p].rename(columns={args.snp_name+str(p):args.snp_name}) + + # Drop SNPs that are missing or duplicated + missing_snps = GWAS_d[p][args.snp_name].isin(['NA','.']) + M0 = len(GWAS_d[p]) + GWAS_d[p] = GWAS_d[p][np.logical_not(missing_snps)] + if M0-len(GWAS_d[p]) > 0: + logging.info('Trait {}: Dropped {} SNPs for missing values in the "snp_name" column'.format(p+1, M0-len(GWAS_d[p]))) + + # drop snps that are duplicated + + M0 = len(GWAS_d[p]) + GWAS_d[p] = GWAS_d[p].drop_duplicates(subset=args.snp_name, keep='first') + if M0-len(GWAS_d[p]) > 0: + logging.info('Trait {}: Dropped {} SNPs for duplicate values in the "snp_name" column'.format(p+1, M0-len(GWAS_d[p]))) + + ## Merge summary statistics of GWA studies by snp index + + for p in range(P): + + if p == 0: + GWAS_all = GWAS_d[p] + + else: + GWAS_all = GWAS_all.merge(GWAS_d[p], how = 'inner', on=args.snp_name) + + M_0 = len(GWAS_all) + logging.info('Trait {} summary statistics: \t {} SNPs remaining merging with previous traits.'.format(p+1, M_0)) + if True: + snps_to_flip = np.logical_and(GWAS_all[args.a1_name+str(0)] == GWAS_all[args.a2_name+str(p)], GWAS_all[args.a2_name+str(0)] == GWAS_all[args.a1_name+str(p)]) + GWAS_all['flip_snps'+str(p)]= snps_to_flip + + logging.debug('Columns after merging :{}'.format(GWAS_all.columns)) + logging.debug(GWAS_all.head(15)) + snps_to_keep = np.logical_or(np.logical_and(GWAS_all[args.a1_name+str(0)]==GWAS_all[args.a1_name+str(p)], GWAS_all[args.a2_name+str(0)]==GWAS_all[args.a2_name+str(p)]), snps_to_flip) + + GWAS_all = GWAS_all[snps_to_keep] + if len(GWAS_all) < M_0: + logging.info('Dropped {} SNPs due to inconsistent allele pairs from phenotype {}. {} SNPs remain.'.format(M_0 - len(GWAS_all),p+1, len(GWAS_all))) + + if np.sum(snps_to_flip) > 0: + zz= args.z_name if args.z_name is not None else 'z' + freq_name = args.eaf_name if args.eaf_name is not None else 'freq' + + GWAS_all.loc[snps_to_flip, zz+str(p)] = -1*GWAS_all.loc[snps_to_flip, zz+str(p)] + GWAS_all.loc[snps_to_flip, freq_name + str(p)] = 1. - GWAS_all.loc[snps_to_flip, freq_name + str(p)] + store_allele = GWAS_all.loc[snps_to_flip, args.a1_name+str(p)] + GWAS_all.loc[snps_to_flip, args.a1_name+str(p)] = GWAS_all.loc[snps_to_flip, args.a2_name+str(p)] + GWAS_all.loc[snps_to_flip, args.a2_name+str(p)] = store_allele + logging.info('Flipped the signs of of {} SNPs to make them consistent with the effect allele orderings of the first trait.'.format(np.sum(snps_to_flip))) + # tag strand ambiguous SNPs + # logging.info(GWAS_all.head(15)) + STRAND_AMBIGUOUS_SET = [x for x in allele_info.STRAND_AMBIGUOUS.keys() if allele_info.STRAND_AMBIGUOUS[x]] + + GWAS_all['strand_ambig'] = (GWAS_all[args.a1_name+str(0)].str.upper() + GWAS_all[args.a2_name+str(0)].str.upper()).isin(STRAND_AMBIGUOUS_SET) + if args.drop_ambig_snps: + M_0 = len(GWAS_all) + GWAS_all = GWAS_all[np.logical_not(GWAS_all['strand_ambig'])] + logging.info('Dropped {} SNPs due to strand ambiguity, {} SNPs remain.'.format(M_0-len(GWAS_all),len(GWAS_all))) + + logging.info('... Merge of GWAS summary statistics complete. Number of SNPs:\t {}'.format(len(GWAS_all))) + + GWAS_orig_cols = GWAS_all.columns + ## Parses include files + if args.include is not None: + for j, include_file in enumerate(args.include.split(',')): + if j == 0: + snps_include = _read_SNPlist(include_file, args.snp_name) + else: + snps_include = snps_include.merge(_read_SNPlist(include_file,args.snp_name),how='outer', on=args.snp_name) + GWAS_all = GWAS_all.merge(snps_include, how="left", on = args.snp_name, indicator="included_merge", suffixes=('','_incl')) + GWAS_all = GWAS_all.loc[GWAS_all['included_merge']=='both'] + GWAS_all = GWAS_all.loc[:,GWAS_orig_cols] + logging.info('(--include) Number of SNPs remaining after restricting to SNPs in the union of {include_path}: \t {M} remain'.format(include_path=args.include,M=len(GWAS_all))) + ## Parses exclude files + if args.exclude is not None: + for exclude_file in args.exclude.split(','): + snps_exclude = _read_SNPlist(exclude_file, args.snp_name) + GWAS_all = GWAS_all.merge(snps_exclude, how="left", on = args.snp_name, indicator="excluded_merge", suffixes=('','_incl')) + GWAS_all = GWAS_all.loc[GWAS_all['excluded_merge']=='left_only'] + GWAS_all = GWAS_all.loc[:,GWAS_orig_cols] + logging.info('(-exclude) Number of SNPs remaining after excluding to SNPs in {exclude_path}: \t {M} remain'.format(exclude_path=exclude_file,M=len(GWAS_all))) + + + ## Parse chromosomes + if args.only_chr is not None: + chr_toInclude = args.only_chr.split(',') + chr_toInclude = [int(c) for c in chr_toInclude] + GWAS_all = GWAS_all[GWAS_all[args.chr_name+str(0)].isin(chr_toInclude)] + + ## add information to Namespace + args.P = P + + return GWAS_all, args + +def ldsc_matrix_formatter(result_rg, output_var): + ''' Key Arguments: + result_rg - matrix w/ RG objects obtained from estimate_rg (w/ None's on the diagonal) + output_var - interested variable in the form of '.[VAR_NAME]' + ''' + output_mat = np.empty_like(result_rg, dtype=float) + (nrow, ncol) = result_rg.shape + for i in range(nrow): + for j in range(ncol): + if result_rg[i, j] is None: + output_mat[i, j] = None + else: + exec('output_mat[i, j] = result_rg[i, j]{}'.format(output_var)) + return(output_mat) + +def estimate_sigma(data_df, args): + sigma_hat = np.empty((args.P,args.P)) + + args.munge_out = args.out+'_ldsc_temp/' + # Creates data files for munging + # Munge data + ignore_list = "" + if args.info_min is None: + ignore_list += "info" + + gwas_ss_df = dict() + + for p in range(args.P): + logging.info('Preparing phenotype {} to estimate sigma'.format(p)) + + ld_ss_name = {args.snp_name : 'SNP', + args.a1_name + str(p): 'A1', + args.a2_name + str(p): 'A2', + args.z_name + str(p): 'Z', + args.n_name + str(p): 'N', + args.eaf_name + str(p): 'FRQ'} + + # single_colnames = [col for col in data_df.columns if col[-1] == str(p) or col in args.snp_name] + gwas_ss_df[p] = data_df[ld_ss_name.keys()].copy() + + # gwas_filtered_df= gwas_filtered_df.rename(columns={args.snp_name:args.snp_name+str(p)}) + gwas_ss_df[p] = gwas_ss_df[p].rename(columns=ld_ss_name) + ## remove phenotype index from names + + + + # run ldsc + h2_files = None + rg_files = args.sumstats + rg_out = '{}_rg_misc'.format(args.out) + rg_mat = True + + args_ldsc_rg = Namespace(out=rg_out, bfile=None,l2=None,extract=None,keep=None, ld_wind_snps=None,ld_wind_kb=None, ld_wind_cm=None,print_snps=None, annot=None,thin_annot=False,cts_bin=None, cts_break=None,cts_names=None, per_allele=False, pq_exp=None, no_print_annot=False,maf=None,h2=h2_files, rg=rg_files,ref_ld=None,ref_ld_chr=args.ld_ref_panel, w_ld=None,w_ld_chr=args.ld_ref_panel,overlap_annot=False,no_intercept=False, intercept_h2=None, intercept_gencov=None,M=None,two_step=None, chisq_max=None,print_cov=False,print_delete_vals=False,chunk_size=50, pickle=False,invert_anyway=False,yes_really=False,n_blocks=200,not_M_5_50=False,return_silly_things=False,no_check_alleles=False,print_coefficients=False,samp_prev=None,pop_prev=None, frqfile=None, h2_cts=None, frqfile_chr=None,print_all_cts=False, sumstats_frames=[ gwas_ss_df[i] for i in range(args.P)], rg_mat=rg_mat) + + if args.no_overlap: + sigma_hat = np.zeros((args.P, args.P)) + for t in range(args.P): + args_ldsc_rg.sumstats_frames = [gwas_ss_df[t]] + rg_results_t = sumstats_sig.estimate_rg(args_ldsc_rg, Logger_to_Logging()) + sigma_hat[t,t] = ldsc_matrix_formatter(rg_results_t, '.gencov.intercept')[0] + else: + rg_results = sumstats_sig.estimate_rg(args_ldsc_rg, Logger_to_Logging()) + + sigma_hat = ldsc_matrix_formatter(rg_results, '.gencov.intercept') + + # if args.no_overlap: + # T = sigma_hat.shape[0] + # sigma_hat = sigma_hat * np.eye(T) + + # logging.info(type(sigma_hat)) + logging.info(sigma_hat) + + return sigma_hat + +def _posDef_adjustment(mat, scaling_factor=0.99,max_it=1000): + ''' + Checks whether the provided is pos semidefinite. If it is not, then it performs the the adjustment procedure descried in 1.2.2 of the Supplementary Note + + scaling_factor: the multiplicative factor that all off-diagonal elements of the matrix are scaled by in the second step of the procedure. + max_it: max number of iterations set so that + ''' + logging.info('Checking for positive definiteness ..') + assert mat.ndim == 2 + assert mat.shape[0] == mat.shape[1] + is_pos_semidef = lambda m: np.all(np.linalg.eigvals(m) >= 0) + if is_pos_semidef(mat): + return mat + else: + logging.info('matrix is not positive definite, performing adjustment..') + P = mat.shape[0] + for i in range(P): + for j in range(i,P): + if np.abs(mat[i,j]) > np.sqrt(mat[i,i] * mat[j,j]): + mat[i,j] = scaling_factor*np.sign(mat[i,j])*np.sqrt(mat[i,i] * mat[j,j]) + mat[j,i] = mat[i,j] + n=0 + while not is_pos_semidef(mat) and n < max_it: + dg = np.diag(mat) + mat = scaling_factor * mat + mat[np.diag_indices(P)] = dg + n += 1 + if n == max_it: + logging.info('Warning: max number of iterations reached in adjustment procedure. Sigma matrix used is still non-positive-definite.') + else: + logging.info('Completed in {} iterations'.format(n)) + return mat + +def extract_gwas_sumstats(DATA, args): + ''' + + Output: + ------- + All matrices are of the shape MxP, where M is the number of SNPs used in MTAG and P is the number of summary statistics results used. Columns are ordered according to the initial ordering of GWAS input files. + results_template = pd.Dataframe of snp_name chr bpos a1 a2 + Zs: matriix of Z scores + Ns: matrix of sample sizes + Fs: matrix of allele frequencies + ''' + n_cols = [args.n_name +str(p) for p in range(args.P)] + Ns = DATA.filter(items=n_cols).as_matrix() + + # Apply sample-size specific filters + + N_passFilter = np.ones(len(Ns), dtype=bool) + + N_nearMode = np.ones_like(Ns, dtype=bool) + if args.homogNs_frac is not None or args.homogNs_dist is not None: + N_modes, _ = _quick_mode(Ns) + assert len(N_modes) == Ns.shape[1] + if args.homogNs_frac is not None: + logging.info('--homogNs_frac {} is on, filtering SNPs ...'.format(args.homogNs_frac)) + assert args.homogNs_frac >= 0. + homogNs_frac_list = [float(x) for x in args.homogNs_frac.split(',')] + if len(homogNs_frac_list) == 1: + homogNs_frac_list = homogNs_frac_list*args.P + for p in range(args.P): + N_nearMode[:,p] = np.abs((Ns[:,p] - N_modes[p])) / N_modes[p] <= homogNs_frac_list[p] + elif args.homogNs_dist is not None: + logging.info('--homogNs_dist {} is on, filtering SNPs ...'.format(args.homogNs_dist)) + homogNs_dist_list = [float(x) for x in args.homogNs_dist.split(',')] + if len(homogNs_dist_list) == 1: + homogNs_dist_list = homogNs_dist_list*args.P + + assert np.all(np.array(homogNs_dist_list) >=0) + for p in range(args.P): + N_nearMode[:,p] = np.abs(Ns[:,p] - N_modes[p]) <= homogNs_dist_list[p] + else: + raise ValueError('Cannot specify both --homogNs_frac and --homogNs_dist at the same time.') + + # report restrictions + mode_restrictions = 'Sample size restrictions close to mode:\n' + for p in range(Ns.shape[1]): + mode_restrictions +="Phenotype {}: \t {} SNPs pass modal sample size filter \n".format(p+1,np.sum(N_nearMode[:,p])) + + mode_restrictions+="Intersection of SNPs that pass modal sample size filter for all traits:\t {}".format(np.sum(np.all(N_nearMode, axis=1))) + logging.info(mode_restrictions) + N_passFilter = np.logical_and(N_passFilter, np.all(N_nearMode,axis=1)) + + if args.n_max is not None: + n_max_restrictions = "--n_max used, removing SNPs with sample size greater than {}".format(args.n_max) + N_passMax = Ns <= args.n_max + for p in range(Ns.shape[1]): + n_max_restrictions += "Phenotype {}: \t {} SNPs pass modal sample size filter".format(p+1,np.sum(N_passMax[:,p])) + n_max_restrictions += "Intersection of SNPs that pass maximum sample size filter for all traits:\t {}".format(np.sum(np.all(N_passMax, axis=1))) + logging.info(n_max_restrictions) + N_passFilter = np.logical_and(N_passFilter, np.all(N_passMax,axis=1)) + + Ns = Ns[N_passFilter] + DATA = DATA[N_passFilter].reset_index() + + if args.z_name is not None: + z_cols = [args.z_name +str(p) for p in range(args.P)] + Zs = DATA.filter(items=z_cols).as_matrix() + else: + Zs = DATA.filter(regex='^[zZ].').as_matrix() + args.z_name = 'z' + if args.eaf_name is not None: + f_cols = [args.eaf_name + str(p) for p in range(args.P)] + + Fs =DATA.filter(items=f_cols).as_matrix() + else: + orig_case_cols = DATA.columns + DATA.columns = map(str.upper, DATA.columns) + + Fs = DATA.filter(regex='^/MAF|FREQ|FRQ/.').as_matrix() + + args.eaf_name = 'freq' + DATA.columns = orig_case_cols + assert Zs.shape[1] == Ns.shape[1] == Fs.shape[1] + + results_template = DATA[[args.snp_name]].copy() + # results_template = pd.DataFrame(index=np.arange(len(DATA))) + # results_template.loc[:,args.snp_name] = DATA[args.snp_name] + # args.chr args.bpos args.alelle_names + for col in [args.chr_name, args.bpos_name, args.a1_name, args.a2_name]: + results_template.loc[:,col] = DATA[col+str(0)] + # TODO: non-error form of integer conversion + # results_template[args.chr_name] = results_template[args.chr_name].astype(int) + # results_template[args.bpos_name] = results_template[args.bpos_name].astype(int) + + return Zs, Ns, Fs, results_template, DATA + +########################################### +## OMEGA ESTIMATION +########################################## + +def jointEffect_probability(Z_score, omega_hat, sigma_hat,N_mats, S=None): + ''' For each SNP m in each state s , computes the evaluates the multivariate normal distribution at the observed row of Z-scores + Calculate the distribution of (Z_m | s ) for all s in S, m in M. --> M x|S| matrix + The output is a M x n_S matrix of joint probabilities + ''' + + DTYPE = np.float64 + (M,P) = Z_score.shape + if S is None: # 2D dimensional form + assert omega_hat.ndim == 2 + omega_hat = omega_hat.reshape(1,P,P) + S = np.ones((1,P),dtype=bool) + + (n_S,_) = S.shape + jointProbs = np.empty((M,n_S)) + + xRinvs = np.zeros([M,n_S,P], dtype=DTYPE) + logSqrtDetSigmas = np.zeros([M,n_S], dtype=DTYPE) + Ls = np.zeros([M,n_S,P,P], dtype=DTYPE) + cov_s = np.zeros([M,n_S,P,P], dtype=DTYPE) + + Zs_rep = np.einsum('mp,s->msp',Z_score,np.ones(n_S)) # functionally equivalent to repmat + cov_s = np.einsum('mpq,spq->mspq',N_mats,omega_hat) + sigma_hat + + Ls = np.linalg.cholesky(cov_s) + Rs = np.transpose(Ls, axes=(0,1,3,2)) + + xRinvs = np.linalg.solve(Ls, Zs_rep) + + logSqrtDetSigmas = np.sum(np.log(np.diagonal(Rs,axis1=2,axis2=3)),axis=2).reshape(M,n_S) + + quadforms = np.sum(xRinvs**2,axis=2).reshape(M,n_S) + jointProbs = np.exp(-0.5 * quadforms - logSqrtDetSigmas - P * np.log(2 * np.pi) / 2) + + if n_S == 1: + jointProbs = jointProbs.flatten() + + return jointProbs + +def gmm_omega(Zs, Ns, sigma_LD): + logging.info('Using GMM estimator of Omega ..') + N_mats = np.sqrt(np.einsum('mp,mq->mpq', Ns,Ns)) + Z_outer = np.einsum('mp,mq->mpq',Zs, Zs) + return np.mean((Z_outer - sigma_LD) / N_mats, axis=0) + + +def numerical_omega(args, Zs,N_mats,sigma_LD,omega_start): + M,P = Zs.shape + solver_options = dict() + solver_options['fatol'] = 1.0e-8 + solver_options['xatol'] = args.tol + solver_options['disp'] = False + solver_options['maxiter'] = P*250 if args.perfect_gencov else P*(P+1)*500 + if args.perfect_gencov: + x_start = np.log(np.diag(omega_start)) + else: + x_start = flatten_out_omega(omega_start) + + opt_results = scipy.optimize.minimize(_omega_neglogL,x_start,args=(Zs,N_mats,sigma_LD,args),method='Nelder-Mead',options=solver_options) + + if args.perfect_gencov: + return np.sqrt(np.outer(np.exp(opt_results.x), np.exp(opt_results.x))), opt_results + else: + return rebuild_omega(opt_results.x), opt_results + +def _omega_neglogL(x,Zs,N_mats,sigma_LD,args): + if args.perfect_gencov: + omega_it = np.sqrt(np.outer(np.exp(x),np.exp(x))) + else: + omega_it = rebuild_omega(x) + joint_prob = jointEffect_probability(Zs,omega_it,sigma_LD,N_mats) + return - np.sum(np.log(joint_prob)) + +def flatten_out_omega(omega_est): + # stacks the lower part of the cholesky decomposition ROW_WISE [(0,0) (1,0) (1,1) (2,0) (2,1) (2,2) ...] + P_c = len(omega_est) + x_chol = np.linalg.cholesky(omega_est) + + # transform components of cholesky decomposition for better optimization + lowTr_ind = np.tril_indices(P_c) + x_chol_trf = np.zeros((P_c,P_c)) + for i in range(P_c): + for j in range(i): # fill in lower triangular components not on diagonal + x_chol_trf[i,j] = x_chol[i,j]/np.sqrt(x_chol[i,i]*x_chol[j,j]) + x_chol_trf[np.diag_indices(P_c)] = np.log(np.diag(x_chol)) # replace with log transformation on the diagonal + return tuple(x_chol_trf[lowTr_ind]) + + +def rebuild_omega(chol_elems, s=None): + '''Rebuild state-dependent Omega given combination of causal states + cholX_elements are the elements (entered row-wise) of the lower triangular cholesky decomposition of Omega_s + + ''' + if s is None: + P = int((-1 + np.sqrt(1.+ 8.*len(chol_elems)))/2.) + s = np.ones(P,dtype=bool) + P_c = P + else: + P_c = int(np.sum(s)) + P = s.shape[1] if s.ndim == 2 else len(s) + cholL = np.zeros((P_c,P_c)) + + cholL[np.tril_indices(P_c)] = np.array(chol_elems) + cholL[np.diag_indices(P_c)] = np.exp(np.diag(cholL)) # exponentiate the diagnoal so cholL unique + for i in range(P_c): + for j in range(i): # multiply by exponentiated diags + cholL[i,j] = cholL[i,j]*np.sqrt(cholL[i,i]*cholL[j,j]) + + omega_c = np.dot(cholL, cholL.T) + + # Expand to include zeros of matrix + omega = np.zeros((P,P)) + s_caus_ind = np.argwhere(np.outer(s, s)) + omega[(s_caus_ind[:,0],s_caus_ind[:,1])] = omega_c.flatten() + return omega + + +def estimate_omega(args,Zs,Ns,sigma_LD, omega_in=None): + + + # start_time =time.time() + logging.info('Beginning estimation of Omega ...') + + M,P = Zs.shape + N_mats = np.sqrt(np.einsum('mp, mq -> mpq',Ns, Ns)) + + + if args.perfect_gencov and args.equal_h2: + logging.info('--perfect_gencov and --equal_h2 option used') + return np.ones((P,P)) + + if args.numerical_omega: + if omega_in is None: # omega_in serves as starting point + omega_in = np.zeros((P,P)) + omega_in[np.diag_indices(P)] = np.diag(gmm_omega(Zs,Ns,sigma_LD)) + + omega_hat = omega_in + + omega_hat, opt_results = numerical_omega(args, Zs,N_mats, sigma_LD,omega_hat) + numerical_msg = "\n Numerical optimization of Omega complete:" + numerical_msg += "\nSuccessful termination? {}".format("Yes" if opt_results.success else "No") + numerical_msg += "\nTermination message:\t{}".format(opt_results.message) + numerical_msg += "\nCompleted in {} iterations".format(opt_results.nit) + logging.info(numerical_msg) + return omega_hat + + + if args.perfect_gencov: + omega_hat = _posDef_adjustment(gmm_omega(Zs,Ns,sigma_LD)) + return np.sqrt(np.outer(np.diag(omega_hat), np.diag(omega_hat))) + + # else: gmm_omega (default) + return _posDef_adjustment(gmm_omega(Zs,Ns,sigma_LD)) + +######################## +## MTAG CALCULATION #### +######################## + +def mtag_analysis(Zs, Ns, omega_hat, sigma_LD): + logging.info('Beginning MTAG calculations...') + M,P = Zs.shape + + W_N = np.einsum('mp,pq->mpq',np.sqrt(Ns),np.eye(P)) + W_N_inv = np.linalg.inv(W_N) + Sigma_N = np.einsum('mpq,mqr->mpr',np.einsum('mpq,qr->mpr',W_N_inv,sigma_LD),W_N_inv) + + mtag_betas = np.zeros((M,P)) + mtag_se =np.zeros((M,P)) + + for p in range(P): + # Note that in the code, what I call "gamma should really be omega", but avoid the latter term due to possible confusion with big Omega + gamma_k = omega_hat[:,p] + tau_k_2 = omega_hat[p,p] + om_min_gam = omega_hat - np.outer(gamma_k,gamma_k)/tau_k_2 + + xx = om_min_gam + Sigma_N + inv_xx = np.linalg.inv(xx) + yy = gamma_k/tau_k_2 + W_inv_Z = np.einsum('mqp,mp->mq',W_N_inv,Zs) + + beta_denom = np.einsum('mp,p->m',np.einsum('q,mqp->mp',yy,inv_xx),yy) + mtag_betas[:,p] = np.einsum('mp,mp->m',np.einsum('q,mqp->mp',yy,inv_xx), W_inv_Z) / beta_denom + + var_denom = np.einsum('mq,q->m',np.einsum('p,mpq->mq',yy,inv_xx),yy) + + mtag_var_p = 1. / var_denom + + mtag_se[:,p] = np.sqrt(mtag_var_p) + + + + logging.info(' ... Completed MTAG calculations.') + return mtag_betas, mtag_se + + +################# +## SAVING RESULTS ## +######################### + +def save_mtag_results(args,results_template,Zs,Ns, Fs,mtag_betas,mtag_se): + ''' + Output will be of the form: + + snp_name z n maf mtag_beta mtag_se mtag_zscore mtag_pval + + ''' + p_values = lambda z: 2*(scipy.stats.norm.cdf(-1.*np.abs(z))) + + M,P = mtag_betas.shape + + if args.std_betas: + logging.info('Outputting standardized betas..') + + for p in range(P): + logging.info('Writing Phenotype {} to file ...'.format(p+1)) + out_df = results_template.copy() + out_df[args.z_name] = Zs[:,p] + out_df[args.n_name] = Ns[:,p] + out_df[args.eaf_name] = Fs[:,p] + + if args.std_betas: + weights = np.ones(M,dtype=float) + else: + weights = np.sqrt( 2*Fs[:,p]*(1. - Fs[:,p])) + out_df['mtag_beta'] = mtag_betas[:,p] / weights + out_df['mtag_se'] = mtag_se[:,p] / weights + + out_df['mtag_z'] = mtag_betas[:,p]/mtag_se[:,p] + out_df['mtag_pval'] = p_values(out_df['mtag_z']) + + if P == 1: + out_path = args.out +'_trait.txt' + else: + out_path = args.out +'_trait_' + str(p+1) + '.txt' + + + out_df.to_csv(out_path,sep='\t', index=False) + + if not args.equal_h2: + omega_out = "\nEstimated Omega:\n" + omega_out += str(args.omega_hat) + omega_out += '\n' + np.savetxt(args.out +'_omega_hat.txt',args.omega_hat, delimiter ='\t') + else: + omega_out = "Omega hat not computed because --equal_h2 was used.\n" + + + sigma_out = "\nEstimated Sigma:\n" + sigma_out += str(args.sigma_hat) + sigma_out += '\n' + np.savetxt( args.out +'_sigma_hat.txt',args.sigma_hat, delimiter ='\t') + + summary_df = pd.DataFrame(index=np.arange(1,P+1)) + input_phenotypes = [ '...'+f[-16:] if len(f) > 20 else f for f in args.sumstats.split(',')] + + + for p in range(P): + + summary_df.loc[p+1,'Trait'] = input_phenotypes[p] + summary_df.loc[p+1, 'N (max)'] = np.max(Ns[:,p]) + summary_df.loc[p+1, 'N (mean)'] = np.mean(Ns[:,p]) + summary_df.loc[p+1, '# SNPs used'] = int(len(Zs[:,p])) + summary_df.loc[p+1, 'GWAS mean chi^2'] = np.mean(np.square(Zs[:,p])) / args.sigma_hat[p,p] + Z_mtag = mtag_betas[:,p]/mtag_se[:,p] + summary_df.loc[p+1, 'MTAG mean chi^2'] = np.mean(np.square(Z_mtag)) + summary_df.loc[p+1, 'GWAS equiv. (max) N'] = int(summary_df.loc[p+1, 'N (max)']*(summary_df.loc[p+1, 'MTAG mean chi^2'] - 1) / (summary_df.loc[p+1, 'GWAS mean chi^2'] - 1)) + + summary_df['N (max)'] = summary_df['N (max)'].astype(int) + summary_df['N (mean)'] = summary_df['N (mean)'].astype(int) + summary_df['# SNPs used'] = summary_df['# SNPs used'].astype(int) + summary_df['GWAS equiv. (max) N'] = summary_df['GWAS equiv. (max) N'].astype(int) + + final_summary = "\nSummary of MTAG results:\n" + final_summary +="------------------------\n" + final_summary += str(summary_df.round(3))+'\n' + final_summary += omega_out + final_summary += sigma_out + + logging.info(final_summary) + logging.info(' ') + logging.info('MTAG results saved to file.') +''' +Functions for maxFDR parallelization +''' +create_S = lambda P: np.asarray(list(itertools.product([False,True], repeat=P))) + +# def _FDR_par(func_args): +# ''' +# FDR methods for parallelization +# ''' +# probs, t,omega_hat, sigma_hat,S,Ns, coords = func_args +# if coords[0] % 1000 == 0: +# logging.info('Calculating for {}: {}'.format(coords, probs)) +# return -1.*compute_fdr(probs, t, omega_hat, sigma_hat, S, Ns) , coords + + + +def MTAG_var_Z_jt_c(t, Omega, Omega_c, sigma_LD, Ns): + + ''' + Omega: full Omega matrix + Omega_c: conditional Omega + Sigma_LD + N_mean: vector of length of "sample sizes" (1/c**2). + + This formula only works with constant N, etc. + ''' + + + T = Ns.shape[1] + W_N = np.einsum('mp,pq->mpq',np.sqrt(Ns),np.eye(T)) + W_N_inv = np.linalg.inv(W_N) + Sigma_j = np.einsum('mpq,mqr->mpr',np.einsum('mpq,qr->mpr',W_N_inv,sigma_LD),W_N_inv) + + gamma_k = Omega[:,t] + tau_k_2 = Omega[t,t] + + om_min_gam = Omega - np.outer(gamma_k, gamma_k) / tau_k_2 + xx = om_min_gam + Sigma_j + inv_xx = np.linalg.inv(xx) + + # num_L / R are the same due to symmetry + num_L = np.einsum('p,mpq->mq', gamma_k / tau_k_2, inv_xx) + num_R = np.einsum('mpq,q->mp', inv_xx, gamma_k / tau_k_2) + + + numer = np.einsum('mp,mp->m', num_L, np.einsum('mpq,mq->mp', Omega_c + Sigma_j, num_R)) + + denom = np.einsum('p,mp->m', gamma_k / tau_k_2, np.einsum('mpq,q->mp', inv_xx, gamma_k /tau_k_2)) + + return numer / denom + + +def simplex_walk(num_dims, samples_per_dim): + """ + A generator that returns lattice points on an n-simplex. + """ + max_ = samples_per_dim + num_dims - 1 + for c in itertools.combinations(range(max_), num_dims): + #print(c) + c = list(c) + yield np.array([(y - x - 1.) / (samples_per_dim - 1.) + for x, y in itertools.izip([-1] + c, c + [max_])]) + + + +def scale_omega(gen_corr_mat, priors, S=None): + assert gen_corr_mat.shape[0] == gen_corr_mat.shape[1] + T = gen_corr_mat.shape[1] + omega = np.zeros_like(gen_corr_mat) + if S is None: + S = create_S(T) + n_S = len(S) + for p1 in range(T): + for p2 in range(T): + # indices of states that are casual for both traits p1 and p2. + caus_state = np.arange(n_S)[np.logical_and(S[:, p1], S[:, p2])] + # print(np.sum(priors[caus_state])) + omega[p1,p2] = gen_corr_mat[p1,p2] / np.sum(priors[caus_state]) + + return omega + +def compute_fdr(prob, t, omega, sigma, S, Ns,N_counts, p_threshold): + + z_threshold = scipy.stats.norm.isf(p_threshold / 2.) # magnitude of z-score needed for statistical significance + n_S, T = S.shape + + omega_TT = scale_omega(omega, prob, S) + + if not is_pos_semidef(omega_TT): + return np.inf + + Omega_s = np.einsum('st,sr->str',S,S) * omega_TT + + + + Prob_signif_cond_t = np.zeros(n_S) + power_state_t = np.zeros_like(Prob_signif_cond_t) + + + for k in range(len(S)): + sd = np.sqrt(MTAG_var_Z_jt_c(t, omega, Omega_s[k,:,:], sigma, Ns)) #ZZZ generalize to take in Omega_s rather than one state at a time . + Prob_signif_cond_t[k] = np.sum(2*scipy.stats.norm.sf(z_threshold, loc=0, scale = sd)*N_counts) / float(np.sum(N_counts)) # produces m FDR estimates: take average by weighting each unique sample size row with the counts of SNPs with that sample size (weighted average, denominator will be equal to M) + + power_state_t[k] = Prob_signif_cond_t[k] * float(prob[k]) + + FDR_val = np.sum(power_state_t[~S[:,t]]) / np.sum(power_state_t) + + return FDR_val + + +def is_pos_semidef(m): + if m.shape[0] == 2 and m.shape[1] == 2: + return np.sqrt(m[0, 0]*m[1,1]) >= np.abs(m[0, 1]) + else: + eigs = np.linalg.eigvals(m) + + return np.all(eigs >= 0) + + +def neglogL_single_SS(x, beta, se, transformed=True): + ''' + Returns the negative loglikelihood of betas from a spike-slab + distribution. Used in the numerical optimziation of the `ss_estimation`. + + Arguments: + ---------- + x: 2-tuple (pi_null, tau). If transformed, `x` consists of bijective transformations of pi_null and tau so that the image of the mapping is all real numbers. + betas: The Mx1 vector of betas + se: The Mx1 vector of standard errors. Must allign with the reported betas. + transformed: boolean, default True, + If True, will perform inverse transformation on pi_null, tau so that they return to their "correct" domain. + + ''' + if transformed: + prob_null = 1.0 / (1.0 + np.exp(-1 * x[0])) + tau = np.exp(-x[1]) + else: + prob_null, tau = x + + causal_pdf = scipy.stats.norm.pdf(beta, loc=0,scale=np.sqrt(tau**2 + se**2)) + noncausal_pdf = scipy.stats.norm.pdf(beta,loc=0, scale = se) + + return -1. * np.sum(np.log( (1.0-prob_null)*causal_pdf + prob_null * noncausal_pdf)) + + +def cback_print(x): + logging.info(x) + + +def _optim_ss(f_args): + beta_t, se_t, starting_params, solver_opts = f_args + start_pi, start_tau = starting_params + x_0 = ( 1.0/(1.0 + np.exp(-start_pi)), -np.log(start_tau) ) + # beta_t, se_t = f_args + optim_results = scipy.optimize.minimize(neglogL_single_SS, x_0, args=(beta_t, se_t,True), method='Nelder-Mead', options=solver_opts, callback=None) + + t_pi, t_tau = optim_results.x + pi_null = 1.0 / (1.0 + np.exp(-1 * t_pi)) + tau = np.exp(-t_tau) + return pi_null, tau + + +def ss_estimation(args, betas, se, max_iter=1000, tol=1.0e-10, + starting_params =(0.5, 1.0e-3), + callback=False): + ''' + Numerically fit the distribution of betas and standard errors to a spike slab distribution. + + Arguments: + ---------- + betas: The Mx1 vector of betas + se: The Mx1 vector of standard errors. Must allign with the reported betas. + max_iter: int, + Maximum number of iterations + tol: float, + Tolerance used in numerical optimization (for both fatol, xatol) + + starting_params: 2-tuple: (pi_0, tau_0) + Starting parameters for optimization. Default is 0.5, 1.0e-3 + callback: boolean ,default False + If True, the parameters values will be printed at each step of optimization. + ''' + M,T = betas.shape + + + solver_opts = dict() + solver_opts['maxiter'] = max_iter + solver_opts['fatol'] = tol + solver_opts['xatol'] = tol + solver_opts['disp'] = True + callback = cback_print if callback else None + arg_list_ss = [(betas[:,t], se[:,t], starting_params, solver_opts) for t in range(T)] + ss_results = joblib.Parallel(n_jobs = args.cores, + backend='multiprocessing', + verbose=0, + batch_size=1)(joblib.delayed(_optim_ss)(f_args) for f_args in arg_list_ss) + return ss_results + + + +def some_causal_for_allT(probs, S): + # probability of being causal is nonzero for all traits + n_S, T = S.shape + # print(probs) + if not np.all([np.sum(probs[S[:,t]]) > 0 for t in range(T)]): + return False + for p1 in range(T): + for p2 in range(T): + # indices of states that are casual for both traits p1 and p2. + caus_state = np.arange(n_S)[np.logical_and(S[:, p1], S[:, p2])] + # print(np.sum(priors[caus_state])) + if np.sum(probs[caus_state]) == 0: + return False + return True + +def _FDR_par(func_args): + ''' + FDR methods for parallelization + omega_hat, sigma_hat, S, Ns, + ''' + probs, omega_hat, sigma_hat, S, Ns, N_counts, p_sig, g, t = func_args + return compute_fdr(probs, t, omega_hat, sigma_hat, S, Ns, N_counts, p_sig) , (g,t) + +def fdr(args, Ns_f, Zs): + ''' + Ns: Mx T matrix of sample sizes + ''' + # M,T = Ns.shape + + # only use unique values + if not args.grid_file: + if args.intervals <= 0: + raise ValueError('spacing of grid points for the max FDR calculation must be a positive integer') + + Ns = np.round(Ns_f) # round to avoid decimals + Ns_unique, Ns_counts = np.unique(Ns, return_counts=True, axis=0) + M_eff, T = Ns_unique.shape + + logging.info('T='+str(T)) + S = create_S(T) + causal_prob = lambda x, SS: np.sum(np.einsum('s,st->st',x,SS),axis=0) + + if args.grid_file is not None: + prob_grid = np.loadtxt(args.grid_file) + # exclude rows that don't sum to 1 + prob_grid = prob_grid[(np.sum(prob_grid, axis=1) > 1.) & np.sum(prob_grid, axis=1) < 0] + else: + # automate the creation of the probability grid + # one_dim_interval = np.linspace(0., 1., args.intervals +1) + prob_grid = simplex_walk(len(S)-1, args.intervals+1) + # exclude probabilities that have at least one trait with zero pi_causal + # exclude probabilities that don't yield a valid NPD matrix + prob_grid = [x for x in prob_grid if some_causal_for_allT(x,S) and is_pos_semidef(scale_omega(args.omega_hat, x,S))] + + if args.fit_ss: + gwas_se = 1. / np.sqrt(Ns) + gwas_betas = gwas_se * Zs + + ss_params_list = ss_estimation(args, gwas_betas, gwas_se) + pi_causal_ss = np.array([1.- x[0] for x in ss_params_list]) + logging.info('Completed estimation of spike-slab parameters resulting in the following causal probabilities') + for t in range(T): + logging.info('Trait {}: \t {:.3f}'.format(t, pi_causal_ss[t])) + + + prob_grid = [p for p in prob_grid if np.all(np.abs(causal_prob(p,S)-pi_causal_ss) < (1. / args.intervals) ) ] + logging.info('{} probabilities remain after restricting to the grid points with causal probabilities within one unit for each trait'.format(len(prob_grid))) + + + + logging.info('Number of gridpoints to search: {}'.format(len(prob_grid))) + + FDR = -1.23 * np.ones((len(prob_grid), T)) + + # performing coarse grid search + logging.info('Performing grid search using {} cores.'.format(args.cores)) + + + N_vals = np.mean(Ns, axis=0, keepdims=True) if args.n_approx else Ns_unique + N_weights = np.ones(1) if args.n_approx else Ns_counts + + # # define parallelization function + # def _FDR_par(func_args): + # ''' + # FDR methods for parallelization + # omega_hat, sigma_hat, S, Ns, + # ''' + # probs, g, t = func_args + # return compute_fdr(probs, t, args.omega_hat, args.sigma_hat, S, Ns, args.p_sig) , (g,t) + + + if not args.n_approx: + assert np.sum(N_weights) == len(Ns) + + arg_list = [(probs, args.omega_hat, args.sigm_hat, S, N_vals,N_weights, args.p_sig, g, t) for t in range(T) for g, probs in enumerate(prob_grid)] + NN = len(arg_list) + K = 10 + start_fdr =time.time() + for k in range(K): + k0 = int(k*NN / K) + k1 = int((k+1) * NN / K) + sublist = arg_list[k0:k1] if k + 1 != K else arg_list[k0:] + grid_results = joblib.Parallel(n_jobs = args.cores, + backend='multiprocessing', + verbose=0, + batch_size='auto')(joblib.delayed(_FDR_par)(f_args) for f_args in sublist) + logging.info('Grid search: {} percent finished for . Time: \t{:.3f} min'.format((k+1)*100./K, (time.time()-start_fdr)/ 60.)) + for i in range(len(grid_results)): + FDR_gt, coord = grid_results[i] # coord = (g,t) + FDR[coord[0], coord[1]] = FDR_gt + + np.savetxt(args.out + '_fdr_mat.txt', FDR, delimiter='\t') + np.savetxt(args.out + '_prob_grid.txt', prob_grid, delimiter='\t') + + # save FDR file once more + np.savetxt(args.out+'_fdr_mat.txt', FDR, delimiter='\t') + logging.info('Saved calculations of fdr over grid points in {}'.format(args.out+'_fdr_mat.txt')) + + logging.info(borderline) + ind_max = np.argmax(FDR, axis=0) + logging.info('grid point indices for max FDR for each trait: {}'.format(ind_max)) + max_FDR = np.max(FDR, axis=0) + logging.info('Maximum FDR') + for t in range(T): + logging.info('Max FDR of Trait {}: {} at probs = {}'.format(t+1, max_FDR[t], prob_grid[ind_max[t]])) + + logging.info(borderline) + logging.info('Completed FDR calculations.') + +def mtag(args): + + #1. Administrative checks + if args.equal_h2 and not args.perfect_gencov: + raise ValueError("--equal_h2 option used without --perfect_gencov. To use --equal_h2, --perfect_gencov must be also be included.") + + ## Instantiate log file and masthead + logging.basicConfig(format='%(asctime)s %(message)s', filename=args.out + '.log', filemode='w', level=logging.INFO,datefmt='%Y/%m/%d/%I:%M:%S %p') + if args.stream_stdout: + logging.getLogger().addHandler(logging.StreamHandler()) # prints to console + + header_sub = header + header_sub += "Calling ./mtag.py \\\n" + defaults = vars(parser.parse_args('')) + opts = vars(args) + non_defaults = [x for x in opts.keys() if opts[x] != defaults[x]] + options = ['--'+x.replace('_','-')+' '+str(opts[x])+' \\' for x in non_defaults] + header_sub += '\n'.join(options).replace('True','').replace('False','') + header_sub = header_sub[0:-1] + '\n' + + if args.ld_ref_panel is None: + # mtag_path =-os.path.dirname(os.path.abspath(__file__)) + + mtag_path = os.path.dirname(os.path.abspath(__file__)) +"/" + + args.ld_ref_panel = mtag_path+'ld_ref_panel/eur_w_ld_chr/' + + start_time = time.time() # starting time of analysis + # take output directory from --out path + try : + args.outdir = re.search('.+/', args.out).group(0) + except AttributeError: + logging.info('Invalid path used for --out: must have at least one / (use ./[tag] for current directory) and must not end in /') + raise + ## TODO Check all input paths + if not os.path.isdir(args.outdir): + if args.make_full_path or args.outdir[0] != '/': + logging.info("Output folder provided does not exist, creating the directory") + safely_create_folder(args.outdir) + else: + raise ValueError('Could not find output directory:\n {} \n at the specified absolute path. To create this directory, use the --make_full_path option.'.format(args.outdir)) + + logging.info(header_sub) + logging.info("Beginning MTAG analysis...") + + # 2. Load Data and perform restrictions + DATA, args = load_and_merge_data(args) + + # 3. Extract core information from combined GWAS data + Zs , Ns ,Fs, res_temp, DATA = extract_gwas_sumstats(DATA,args) + + + if not args.drop_ambig_snps: + logging.info('Using {} SNPs to estimate Omega ({} SNPs excluded due to strand ambiguity)'.format(len(Zs)- np.sum(DATA['strand_ambig']), np.sum(DATA['strand_ambig']))) + not_SA = np.logical_not(np.array(DATA['strand_ambig'])) + + # 4. Estimate Sigma + if args.residcov_path is None: + logging.info('Estimating sigma..') + if args.verbose: + args.sigma_hat = estimate_sigma(DATA[not_SA], args) + else: + with DisableLogger(): + args.sigma_hat = estimate_sigma(DATA[not_SA], args) + + else: + args.sigma_hat = _read_matrix(args.residcov_path) + args.sigm_hat = _posDef_adjustment(args.sigma_hat) + logging.info('Sigma hat:\n{}'.format(args.sigm_hat)) + + + G_mean_c2_adj = np.mean(np.square(Zs),axis=0) / np.diag(args.sigma_hat) + low_c2 = G_mean_c2_adj < 1.1 + if np.any(low_c2): + low_c2_msg = 'Mean chi^2 of SNPs used to estimate Omega is low for some SNPs' + #low_c2_msg += 'Traits {}'.format(' '.join(np.arange(1,args.P+1)[low_c2])) if np.sum(low_c2) > 1 else 'Trait {}'.format(' '.join(np.arange(1,args.P+1)[low_c2])) + #low_c2_msg += '(= {})'.format(' '.join(G_mean_c2_adj[low_c2])) + low_c2_msg += 'MTAG may not perform well in this situation.' + logging.info(low_c2_msg) + + + #5. Estimate Omega + + if args.gencov_path is None: + not_SA = np.logical_not(np.array(DATA['strand_ambig'])) + args.omega_hat = estimate_omega(args, Zs[not_SA], Ns[not_SA], args.sigma_hat) + logging.info('Completed estimation of Omega ...') + else: + args.omega_hat = _read_matrix(args.gencov_path) + + + assert args.omega_hat.shape[0] == args.omega_hat.shape[1] == Zs.shape[1] == args.sigma_hat.shape[0] == args.sigma_hat.shape[1] + + #6. Perform MTAG + mtag_betas, mtag_se = mtag_analysis(Zs, Ns, args.omega_hat, args.sigma_hat) + + #7. Output GWAS_results + save_mtag_results(args, res_temp,Zs,Ns, Fs,mtag_betas,mtag_se) + + + + if args.fdr: + + logging.info('Beginning maxFDR calculations. Depending on the number of grid points specified, this might take some time...') + + fdr(args, Ns, Zs) + ### ZZZ use function fdr(args, Ns) + + + logging.info('MTAG complete. Time elapsed: {}'.format(sec_to_str(time.time()-start_time))) + + + + +parser = argparse.ArgumentParser(description="\n **mtag: Multitrait Analysis of GWAS**\n This program is the implementation of MTAG method described by Turley et. al. Requires the input of a comma-separated list of GWAS summary statistics with identical columns. It is recommended to pass the column names manually to the program using the options below. The implementation of MTAG makes use of the LD Score Regression (ldsc) for cleaning the data and estimating residual variance-covariance matrix, so the input must also be compatible ./munge_sumstats.py command in the ldsc distribution included with mtag. The default estimation method for the genetic covariance matrix Omega is GMM (as described in the paper). \n\n Note below: any list of passed to the options below must be comma-separated without whitespace.") + +# input_formatting = parser.add_argument_group(title="Options") + +in_opts = parser.add_argument_group(title='Input Files', description="Input files to be used by MTAG. The --sumstats option is required, while using the other two options take priority of their corresponding estimation routines, if used.") +in_opts.add_argument("--sumstats", metavar="{File1},{File2}...", type=str, nargs='?',required=False, help='Specify the list of summary statistics files to perform multitrait analysis. Multiple files paths must be separated by \",\". Please read the documentation to find the up-to-date set of acceptable file formats. A general guideline is that any files you pass into MTAG should also be parsable by ldsc and you should take the additional step of specifying the names of the main columns below to avoid reading errors.') +in_opts.add_argument("--gencov_path",metavar="FILE_PATH", default=None, action="store", help="If specified, will read in the genetic covariance matrix saved in the file path below and skip the estimation routine. The rows and columns of the matrix must correspond to the order of the GWAS input files specified. FIles can either be in whitespace-delimited .txt or .npy format. Use with caution as the genetic covariance matrix specified will be weakly nonoptimal.") +in_opts.add_argument("--residcov_path",metavar="FILE_PATH", default=None, action="store", help="If specified, will read in the residual covariance matrix saved in the file path below and skip the estimation routine. The rows and columns of the matrix must correspond to the order of the GWAS input files specified. FIles can either be in .txt or .npy format. Use with caution as the genetic covariance matrix specified will be weakly nonoptimal. File must either be in whitespace-delimited .txt or .npy") + +out_opts = parser.add_argument_group(title="Output formatting", description="Set the output directory and common name of prefix files.") + +out_opts.add_argument("--out", metavar='DIR/PREFIX', default='./mtag_results', type=str, help='Specify the directory and name prefix to output MTAG results. All mtag results will be prefixed with the corresponding tag. Default is ./mtag_results') +out_opts.add_argument("--make_full_path", default=False, action="store_true", help="option to make output path specified in -out if it does not exist.") + +input_formatting = parser.add_argument_group(title="Column names of input files", description="These options manually pass the names of the relevant summary statistics columns used by MTAG. It is recommended to pass these names because only narrow searches for these columns are performed in the default cases. Moreover, it is necessary that these input files be readable by ldsc's munge_sumstats command.") +input_formatting.add_argument("--snp_name", default="snpid", action="store",type=str, help="Name of the single column that provides the unique identifier for SNPs in the GWAS summary statistics across all GWAS results. Default is \"snpid\". This the index that will be used to merge the GWAS summary statistics. Any SNP lists passed to ---include or --exclude should also contain the same name.") +input_formatting.add_argument("--z_name", default="z", help="The common name of the column of Z scores across all input files. Default is the lowercase letter z.") +input_formatting.add_argument("--n_name", default="n", help="the common name of the column of sample sizes in the GWAS summary statistics files. Default is the lowercase letter n.") +input_formatting.add_argument('--eaf_name',default="freq", help="The common name of the column of minor allele frequencies (MAF) in the GWAS input files. The default is \"freq\".") +input_formatting.add_argument('--chr_name',default='chr', type=str, help="Name of the column containing the chromosome of each SNP in the GWAS input. Default is \"chr\".") +input_formatting.add_argument('--bpos_name',default='bpos', type=str, help="Name of the column containing the base pair of each SNP in the GWAS input. Default is \"bpos\".") +input_formatting.add_argument('--a1_name',default='a1', type=str, help="Name of the column containing the effect allele of each SNP in the GWAS input. Default is \"a1\".") +input_formatting.add_argument('--a2_name',default='a2', type=str, help="Name of the column containing the non-effect allele of each SNP in the GWAS input. Default is \"a2\".") + + +filter_opts = parser.add_argument_group(title="Filter Options", description="The input summary statistics files can be filtered using the options below. Note that there is some default filtering according to sample size and allele frequency, following the recommendations we make in the corresponding paper. All of these column-based options allow a list of values to be passed of the same length as the number of traits ") +filter_opts.add_argument("--include",default=None, metavar="SNPLIST1,SNPLIST2,..", type=str, help="Restricts MTAG analysis to the union of snps in the list of snplists provided. The header line must match the SNP index that will be used to merge the GWAS input files.") +filter_opts.add_argument("--exclude", "--excludeSNPs",default=None, metavar="SNPLIST1,SNPLIST2,..", type=str, help="Similar to the --include option, except that the union of SNPs found in the specified files will be excluded from MTAG. Both -exclude and -include may be simultaneously specified, but -exclude will take precedent (i.e., SNPs found in both the -include and -exclude SNP lists will be excluded).") +filter_opts.add_argument('--only_chr', metavar="CHR_A,CHR_B,..", default=None, type=str, action="store", help="Restrict MTAG to SNPs on one of the listed, comma-separated chromosome. Can be specified simultaneously with --include and --exclude, but will take precedent over both. Not generally recommended. Multiple chromosome numbers should be separated by commas without whitespace. If this option is specified, the GWAS summary statistics must also list the chromosome of each SNPs in a column named \`chr\`.") + +filter_opts.add_argument("--homogNs_frac", default=None, type=str, action="store", metavar="FRAC", help="Restricts to SNPs within FRAC of the mode of sample sizes for the SNPs as given by (N-Mode)/Mode < FRAC. This filter is not applied by default.") +filter_opts.add_argument("--homogNs_dist", default=None, type=str, action="store", metavar="D", help="Restricts to SNPs within DIST (in sample size) of the mode of sample sizes for the SNPs. This filter is not applied by default.") + +filter_opts.add_argument('--maf_min', default='0.01', type=str, action='store', help="set the threshold below SNPs with low minor allele frequencies will be dropped. Default is 0.01. Set to 0 to skip MAF filtering.") +filter_opts.add_argument('--n_min', default=None, type=str, action='store', help="set the minimum threshold for SNP sample size in input data. Default is 2/3*(90th percentile). Any SNP that does not pass this threshold for all of the GWAS input statistics will not be included in MTAG.") +filter_opts.add_argument('--n_max', default=None, type=str, action='store', help="set the maximum threshold for SNP sample size in input data. Not used by default. Any SNP that does not pass this threshold for any of the GWAS input statistics will not be included in MTAG.") +filter_opts.add_argument("--info_min", default=None,type=str, help="Minimim info score for filtering SNPs for MTAG.") +filter_opts.add_argument("--drop_ambig_snps", default=False, action="store_true", help="Drop strand ambiguous SNPs when performing MTAG (they are already not used to estimate Omega or Sigma.") +filter_opts.add_argument("--no_allele_flipping", default=False, action="store_true", help="Prevents flipping the effect sizes of summary statistics when the effect and non-effect alleles are reversed (reletive the first summary statistics file.") + +special_cases = parser.add_argument_group(title="Special Cases",description="These options deal with notable special cases of MTAG that yield improvements in runtime. However, they should be used with caution as they will yield non-optimal results if the assumptions implicit in each option are violated.") + +special_cases.add_argument('--no_overlap', default=False, action='store_true', help='Imposes the assumption that there is no sample overlap between the input GWAS summary statistics. MTAG is performed with the off-diagonal terms on the residual covariance matrix set to 0.') +special_cases.add_argument('--perfect_gencov', default=False, action='store_true', help='Imposes the assumption that all traits used are perfectly genetically correlated with each other. The off-diagonal terms of the genetic covariance matrix are set to the square root of the product of the heritabilities') +special_cases.add_argument('--equal_h2', default=False, action='store_true', help='Imposes the assumption that all traits passed to MTAG have equal heritability. The diagonal terms of the genetic covariance matrix are set equal to each other. Can only be used in conjunction with --perfect_gencov') + +fdr_opts = parser.add_argument_group(title='Max FDR calculation', description="These options are used for the calculation of an upper bound on the false disovery under the model described in Supplementary Note 1.1.4 of Turley et al. (2017). Note that there is one of three ways to define the space of grid points over which the upper bound is searched. ") + +fdr_opts.add_argument('--fdr', default=False, action='store_true', help='Perform max FDR calculations') +# fdr_opts.add_argument(title='--skip-mtag', default=False, action='store_true',) # XXX make option to skip mtag calculations if already done. +# make mutually exclusive group +fdr_opts.add_argument('--grid_file',default=None, action='store', help='Pre-set list of grid points. Users can define a list of grid points over which the search is conducted. The list of grid points should be passed in text file as a white-space delimited matrix of dimnesions, G x S, where G is the number of grid points and S = 2^T is the number of possible causal states for SNPs. States are ordered according to a tree-like recursive structure from right to left. For example, for 3 traits, with the triple TFT denoting the state for which SNPs are causal for State 1, not causal for state 2, and causal for state 3, then the column ordering of probabilities should be: \nFFF FFT FTF FTT TFF TFT TTF TTT\n There should be no headers, or row names in the file. Any rows for which (i) the probabilities do not sum to 1, the prior of a SNP being is causal is 0 for any of the traits, and (iii) the resulting genetic correlation matrix is non positive definite will excluded in the search.') +# XXX rounding to 1e-6 & restandardize. + +fdr_opts.add_argument('--fit_ss', default=False, action='store_true', help='This estimates the prior probability that a SNP is null for each trait and then proceeds to restrict the grid search to the set of probability vectors that sum to the prior null for each trait. This is useful for restrict the search space of larger-dimensional traits.') + +fdr_opts.add_argument('--intervals', default=10, action='store',type=int, help='Number of intervals that you would like to partition the [0,1] interval. For example example, with two traits and --intervals set 10, then maxFDR will calculated over the set of feasible points in {0., 0.1, 0.2,..,0.9,1.0}^2.') + +fdr_opts.add_argument('--cores', default=1, action='store', type=int, help='Number of threads/cores use to compute the FDR grid points for each trait.') + +fdr_opts.add_argument('--p_sig', default=5.0e-8, action='store', help='P-value threshold used for statistical signifiance. Default is p=5.0e-8 (genome-wide significance).' ) +fdr_opts.add_argument('--n_approx', default=False, action='store_true', help='Speed up FDR calculation by replacing the sample size of a SNP for each trait by the mean across SNPs (for each trait). Recommended.') + +# fdr_opts.add_argument('--binned_n', default=False, action='store_true', help='When --n_approx is off, this options allows for a sped-up version of the max_FDR calculation by weighting the power calculations of unique rows.') + +# wc = parser.add_argument_group(title='Winner\'s curse adjustment', description='Options related to the winner\'s curse adjustment of estimates of effect sizes from MTAG that could be used when replicating analyses.') +# GWAS or MTAG results? +# maybe both? + +misc = parser.add_argument_group(title="Miscellaneous") + +misc.add_argument('--ld_ref_panel', default=None, action='store',metavar="FOLDER_PATH", type=str, help='Specify folder of the ld reference panel (split by chromosome) that will be used in the estimation of the error VCV (sigma). This option is passed to --ref-ld-chr and --w-ld-chr when running LD score regression. The default is to use the reference panel of LD scores computed from 1000 Genomes European subjects (eur_w_ld_chr) that is included with the distribution of MTAG') +misc.add_argument('--time_limit', default=100.,type=float, action="store", help="Set time limit (hours) on the numerical estimation of the variance covariance matrix for MTAG, after which the optimization routine will complete its current iteration and perform MTAG using the last iteration of the genetic VCV.") + +misc.add_argument('--std_betas', default=False, action='store_true', help="Results files will have standardized effect sizes, i.e., the weights 1/sqrt(2*MAF*(1-MAF)) are not applied when outputting MTAG results, where MAF is the minor allele frequency.") +misc.add_argument("--tol", default=1e-6,type=float, help="Set the relative (x) tolerance when numerically estimating the genetic variance-covariance matrix. Not recommended to change unless you are facing strong runtime constraints for a large number of traits.") +misc.add_argument('--numerical_omega', default=False, action='store_true', help='Option to use the MLE estimator of the genetic VCV matrix, implemented through a numerical routine.') +misc.add_argument('--verbose', default=False, action='store_true', help='When used, will include output from running ldsc scripts as well additional information (such as optimization routine information.') +misc.add_argument('--chunksize', default=1e7, type=int, + help='Chunksize for reading in data.') +misc.add_argument('--stream_stdout', default=False, action='store_true', help='Will streat mtag processing on console in addition to writing to log file.') + +if __name__ == '__main__': + start_t = time.time() + args = parser.parse_args() + try: + mtag(args) + except Exception as e: + logging.error(e,exc_info=True) + logging.info('Analysis terminated from error at {T}'.format(T=time.ctime())) + time_elapsed = round(time.time() - start_t, 2) + logging.info('Total time elapsed: {T}'.format(T=sec_to_str(time_elapsed))) diff --git a/mtag.pyc b/mtag.pyc deleted file mode 100644 index e769bfd3754269dbf2e48ea7e63347ff8f647b16..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 63314 zcmdSC3v^ufecyR!0KT9XMN%Rm>TyYl5=a5yL$+kov_y*3gO&)%1KN~nQKKPd01gSv z0CNW-Ad87(Id;;V;<)ozVp=5q2IX~<;-Zv!YHx}=klJlF3_bti!Eyept za(<+Eza=?;OYweda{kuh{kG)%ZN>ZT$@$xh_dAmFcNFhilk;1P_dApGcNXv4lJndA zKAg;NNfx#z=eI{&Hze~rl7+jH^LNMhMt|>2&hPB?Wmj@}G&w(-)M@-ZNquv2ez!Y+ zZ_?n$?>nD3@2~onq<9sxzo zcNTB!(r%0JjmhN)lKS?fz9V^?nQ6rLT}l1!!S9_(eb?YO{ah1Ik9SA>aB?|K>i0T6 zDU}-WP5%3mxB0H$pL`yW*pt+$^|z9Gs?WER92hFKIlI%mP0TE5td+lKLZ#-k;QY-=BQGl$<}1)DJlD(WL&UU&fRAxL+ocIzN+1 z{b2HW;E|U@4nHWMtRHsv!%6*!1CJ#2$NchGQvZNoK9JNu=$8*B^~e44xHCTCj8FLe zLw^5IQva|Md^o8e^~=$u{t>@?B&i?s%dw>XQNMiD8J~2QaTv9*nm*3U@ ze=MoLkknt)yqtd_X}pkJele+^N$OJ$e~Iw&`7=r5Omdl!my`O(lX@koPYX)xXOsFT zlKLmzfOARx6(Dv)DNp(-Cq19kKkY8Pn$#~ObrQWsqTwP@^&Jwu9*KI5skt#1-I$k> z#!GI@j5F6=L!)RCHOxllNHnKt4G;~u@blr~S!H72;adn`k6{2Zo)U@j8HwU6WGZ_7r zqpuA_f6HL>w>tW>1JU0W(Y^8goX6m8kHN>2#>YJdpLaGE15^I(1DU@-W@a!FeKDzj z$2+9^PH;gl-5+x?f4oQ<1KIdW`yG;gkCT4yVAAh% z(mz%7qgVC!5BBB^q;*h z`o|)=H)DU!Gxp=2u}adYc*g#l>$3g%$QIH6?RC*#9*q7A*G2!u!RWtqUGz_^YtvtL zoBoR1!~{>fP5<3>+5Y>;7STVc=sG~wn~k@r+Fwx&|qMs=eQO4gKtmtR2YscS;=-!0)zkv1MDL|4se}O_-2a)vaPWp?ECayO?zZC6`M8AAp!@dy>i|Ai*8NXVT zK{0=KF#6Z7%l-ETqyMMtqW}J2^#AO_{}&e?fR!U!ejKjkqy@Apq9tG6c&=+mdkkd)3XeSKuO@oI8qB8lOsb)&EzqD(5dIdA@&A@`XG@p7%(Y0g|p&n|c7 z8>=JPbQJP@t@B2$Q%^t9YQCX5x~u7_#$v70U1+qrYR5A(?N)oCIg_Oa)2BP_T0K48 z%4qO%x1s1Wr_Z|hyquA2Pn7%I)F;yC8m&gBHlMz{d~v=xlfKxTX|%FN`o?1;*(;H1 zs@-iIP1DoelumaVGwlVct<#xqJMApD($)5ICv9JCr5`_;wp(fUQX_4)7MHu}#l~#A z(@2-IW^0aMaxZq;bDi44BxCkO6h7Ua?Ov^Q8WWwye635NGwn_XSYT)xtr_ZF$VcpW z>tdrb+3w7d_d}8Q#Qc2Prn=5`nHFnZkKpl(8jNN!7RsKL$viTWZRJnBnJv!ORwox~ zE7eZ>YS#RHfHb>pAm(bbPQz1RqANIEr2B^5rbM=`9?Cn@o_E6Todoc4sZpypI@Qa| z%)#txcbL%m#%$L`%r{$&C{=(qqgA0_0rbg~+E4JZdS}v2lFOy!Emow~bZdVy+%0=e zA44Q4DRwBiJe()UKALWHGph)w*+_VacSfIK({>~w*;gIXkhFckI1!G&&Z z&X38()$R^bXSLbJ{AzWk(_oIPQR)X2j=W3%he~&rZYymobv5*-npy4QeB;IT++3qG zqj>#Ohn`N!!Ee$41tQPzEKB%AsyPplDEnnNsZ5V)XtQT|jHLW~w%tjYYDx`2Y^3uP zuJ?s@eR;l-UcJ<4r8D3chb_0}8r1^*xPaa)X)HZU>Xas-fXd(u_*h@B3+ZWg8hP+j(?1 z@|b$*?DR8d$5cw?E(K~TYJOhybLOU-y_u3|_DZu`tqSh*RtMZhWDCkrt#$<`)oM%^ zpMu|NwcehoRx5Y&UfIo~-weOKKQOIm>3)RYOnu%sw6V0MJfl(5R4T~R{u(ba?X1jD z(Ln21V#qVs%E?=-*s@mUl}$`&0D(X2*!3>L%v>eugSCfk-m6yL3lscgbs1C`^dmll48k zr-7-lRm95RpG#0x;mTAmIHfeNKNh!Ya0FMA3le)%ybD?_m zQnMS3R#zMqq#TNtiD~f+wrbTkG{>3O^`yaL>V(0Ae4Sbsa-q4MxwPE6k~QCKn0VAy zXs^&iz0+PCGhw`)uZ1;uv@0HIuF-`+^y^fn8YH=*MON9P$6h@i&p)!-=Tcl+Cmjn?dPYo;=;(u6b_l za?#TUS~33J1Rm)MZw92g6$KqRLvW_CNjB^%9fH=~TG~@K%nHfq*D(7cFM(Pf08l|1 zK&F`g2m2TUkegNnScZsWjsW$TQ<&}=ib(>R0g$J?%(Ep*?NLI3oao$qD*+;cw8t2L*JQyd~h?Sd1NSex+=4g>tbjo9 z*#wW1?G_SAH_Z?WTJ=mKLA|z`9leB1kR4rUwva%wqj{|9sir`KKb=yTRX z$QYFeb_N$WWfayF&k?+mh7t)9R=~6AIiH`esHB@-v!Wx%=4%TV>$N9UU&e3ZI-AGz zwu=YN%<-v(&(EB?RzGSqc`Cl2zji6UpO5b|*B0XYj6wf1)7Jv4PDiuV4baT;Or!EJ zuVaD|7uWT(?&l>x7yOLeEx+G9qbNR#*{F8g)vVi@)7K6jN%^tTMnHD7_$}XEvM>`| zxRUD)v@xU9`llIrIwe29?~x&AW&;gHsp-soEdyjk+pcy%AxMhgoSbDYcyo!x!WBr* zA##!kyfnz83nR_fvzZ{6qKq$|N;3pW;gFdtwYf&nMWb7_TkvOe`w%Zotbm_2gro&H zff{Hi%MkJEZTeZ4JSC`|GQ@`rQ&00gNVcpYs0#8IqdT4U^4ujiXwoFf{IrphR2Sy2 zvgO4_r}9bFF4(I=z{CR^!p&sgEGSn#MRBYA8t4-6P;b$x3+}Wy-RQIy9G!L#H7-+u zAkF`u<2yckO#jNww#wL+dA&xNgFJraUIHrj>2bdvYJBC>Jo**+?fo%}9@k|`>9g{~ z7KFs|Jk761;eN)0{$EanVi^HpS)O27-~p7JBv-a1or(Oj1;T{YgCm541mjx%R+`O8 z=M%|Wn}xrhAVRFYxqjk6+IoUTd6JVSIr)ThBtLBCP%x#;}$cTW*kAiZ&3iK zmuT`S`VN0!+}-Mzk)(d7Utl)3x%};Z?(h?XBsJdc=T0ZPRVK-|Xvt`@llCh59zS>c zd9R=Mxi|N_ArB-l-u2Y)d;GrF^aXAtNP-AYdJXpYj^y&z1dQP|+c7nG2AHDs$d!S@>2V%$En%U zNQ=5k16O5&HuK(T&Rz0{h7^g?f!XrxY;y(SM}gHW%OrRdjX;aqYllRb`9`-fnUYm1 z(S;iLyES)o3oXoqNJj#58fZSp_n4Iw5AkL?Fa_7^-o9z^ymFCm;F0wgYa zI)DO)gm5G}Zper*i%9BNA@RHPmP>cv8bG2(wj#A_Mf%gw@(7|mvlrVPG<{M|njfir zKoNpJL!^gfzR?;J3avb@I1Q;KocgR=9q%DiRTh*&O>Z;OP2>wfWL9YqQh8l*>g=0u zT7nB8ir%UV2!w_KgNzA%9Y#At0iTT#eN#f2psxzam6%+0nV%&j(}X1DEwDZtOZW48 zN9neq-!I=*+QZ-7r30lA-XAR8SvC)9LaIIqOi!j{{~Wy#Mq)jeER2CWc`t*hOU591 zWQcGd5q}5T1<8aCX!Sq>1IAD&nZr+AxK+vtSoPP+$;(A;zGoiDiEG@=1LpMY<9kV^=SGGh;61R zTMmh)iC0FFvPP-aN^6}C){u01rn$H}Y3tjhW8uHA)>dJ0+i6CDA>Iqm zd1074JJIbn78a!jfDxWWACs3$p{-Ogt5N!%OjPv*Dx-8?GX-<28J!yJyd{0NAidh` zUQ%>VK{1x?uN+Z*!W%XxPK`;cWo&9ilm_9M73ssI%o5^qp-#}E90oE;PD>wY1!mXV}Ra6(%|Kh79*VPf1gPR*!Xq2>T0#eJo__02X2I>5O>jSTplO2(0=?9Y5RxzS;;ILk(S_MxW z_5MLo@20*`c%yp%hU;ZLN4;LfdA+xnR3aREUc=^O>Gslf^@a=q*BkY|Q4%sHU#M$5 zCO4}0kP5F_6Rp%E1O5Gi>op>Be@Bv~FI-m$~*?7M(VeR2MU9n zsLVV8;(`)TKvcEz$zn2)59sU;>EcgaxZ464Lw{GEe5U~6newR%`y3PP0N0LQzAL$m z&t<;_o0DTp)$+NbzMZ0?U&N3B%xp-$&`WoDS8|GGpzz9DvL*v8s9H0cKl{yi{JIR0 zZuBxz7KCe)+E2NXmj=g6l1?DQG1-xT@Ll!IRsmic%I5)y>CFRl zXid?(aw$h*>5Z$D{|EKEL$Y4nO1I13r0Or1@~Y7ee$%R#zFgwx+{(7$?)_R5bm7#6 z;b8!b-l;DrvB!q<0e}#;whuwr@UYE;kbseUbBTA9>}3+EGk`H;30D!|c;{eS=tVBx zrAg-_n>4O_ltca8F36!`a_=0?!*&cn(?AvB^;`Z zM~c{o9s5Y4*qzBWur!(q#%#jsdc=!|<4I?W z{7(oXf;GpBnhLIRB4K@lQY^)LuLGQ3-h5duZ5ih0Tn=dWx$8yodA}){6>}|6|3m>N zPi|RRl9a4gP4r1Lc}`t8XY=lkmCxQ(Hht=+a2>KtDx2l?Oh)_qfJO5yij;m@q1Pkev1jyJ=t|7+TNI zx6{$>;@k&D>=BIsHpl1|>aPBPC1pBS0t6Iyuo#Cw*s}7IdB^~N^n=N@o$gfV`=Yh*13dVR~ey#0rY_BTe<9Tan*3!}el zqbByF%p+XhJxTX)@|O2?2&Nw%A(}DN57~|kVsOE$=E}pVY8YNvq{s5ajPvx^A-K@& zTX|S=Is4M7m(mmUI;P8Prqi^<;E0!N9T^~OakmO03<`2?!fyieJW`D`BuFxI%W}QT z>{W*bY`N2tA)|pVXuk1A4M7Vl1#TG_Ca^zWYS+U6Va9*lI;`x&G^Zlp4UC#S&C(5= z0LD;!NzJss=j1UtIa!hBVn$511R^OUwx@LQL0%Ba=)dp-OV~f?`g2_NeT=2dcO=WL zX_7tA$XQ(l%welNRFNq&ED;hao%sDJ;O*6Q4AH48P1%$GT6L)GElK4de=3taXeOc0 z@F+TeG(Cm?z#_wz_c(^HiF*P{!0=1ZU}>257J9C|xkHP^pKSRe&H$E6n^a`U@OZUb+0;Pc>Gd;sG?iL#ovIM9=vcXFQ5PqS zH=6BbKuD_2Y|^^T+4&~g($->TE9uGb+euNY;_q1GK8i-vw%BRfuzvXJ%eG3PmZg!n zPDuU_%`%oMh9v-M5#P6VcXd%tLX+znI$3#D{gk*l+i5IW@P-oU-|sz@&GYA38mTGM zq)4G`uUI7dqQfWyYJKk$jsB0&)r)fS*DLo^VyR;C}VBTQ83epilo>v~B&TwAEplv4V!B+^u{`VY7O` zFojM9ZCI^aLE=j)H9fvvkBfRB`~{o~Yq_tD7APKuw>7`Pt)n!7F z;lOGh%pjs1@qQ#!?q5+_wQHHB(lMs$G^~sl7O#MtqiP(BTcMYdA_hYSKr~-vaoSuX z=c;NCOJ$WGQr_>5hxF1*c`%|m2VfoxmaF_?rcA| z!F=v&Et9FqUSH~~Y-UnWEd-5;UWibgIpn4}KN!;kbEbMI5D*wy{t!aXYXU@aD&M1~ zZQ&t&8U0cX8J=^6SqoYVi>+6k>y*{R785fJmt9Sj z{+Q_DPY`x)>2Pw6gwytT%YK@cr7tvA(-Q?tdep3J7|g2dmYB$0=F+PN)5>#&#~gpV z7%j!4%3c5&X|ie>$}mPk87Lot2nV-SZ`S7IB)H#2L+sexfum@LvRTD=OTt^!;hQ>5 z`=aIqNDEP<@{!3;fAU17I(6dAGZ!9l34xr%bJzlx7fAh|ZjPsyFQgxZILY2eYa-+` z*QV?s71&W|*A@kAhF2Puuk#tYbECw!_4zQ5aH-N-?3HG$&~N|Xr*MYwUWjCSeeVQm+)~snIzNzVjxOWW!x7k?s7yyR;pko)HET0T%5# znUd=NCZy-EgKr8D!4t^_mMR^9$Ulh!Oz~p6tRS$W~7C+)j&BFF}`PSrd^qImn{6Q^9;nErNM=D;lmeM#|S*w_( z+2kDEmc5Me|hajD_+q2hC& zb3N=QelbLi`H6JR`vE^6^>f^5Cj6X~B+u4-wd$~+NBn$D8}ZqKukgqHe8SHU`T1d& zbJS0a)Rd1?G0%_s`J~f4WewCCP}!PDvB5Oll8j17|DJOFxLjx6PL4<`8|oombc#W) zC6xvkhoTey#M91j)@4)-$^xjKu!ZGGVIL4f>Tu{Uik7p|%w{UG4_A}Q&L3q1lGvT!$Chnri ztJdiJk(|RpB$??}{;G-)v7fJ3uVTFmc0$Oi2)J@Fc(6QvCXAAcG`t&$Rer4{j!)Ux zc-Dfl>QmGRKj$i@Kyw#<$1D0u?<-s;lnov;cOYUC`CMXy&7ye=e2t>AC{*2*n~wT& z>4^Vy=A5U~m}Rith7s@i$ld%$kIGtTg)4)F`z1w1{q{?_60(ruPRlE zwd+NT9h+&t5rT(hsH<{LC8==t4BG~mK%Oi9isq9V%aV5EY2M)2C8SOAFO`x zkU5^v_fP{ls+y#^%srydGnX0|PYd_0ZR9OljGP-L_{<&2Y72`@M&k`vxd?0T56v_F zSq3pp-lZc|rrOMX9^4!Ad?x2{ts#Y#06i9%EtUYj3K00RiB_XE8RI*P- zJd@O5uwUoX&9tkG{HsDrVj(A$U(~~-R{aZ~xQF%j9eR92kFV&V;S1s7JN5R*^!QC4 zrmi#X#nsB+Rgj=CypjZm;oX$4BEjAwo^rvZ7dt5!_&JYAv9?*GcKNLQ=c0767Golz zUN~Y&tM%ECDg;x;1y$URE8nX$nqtca8REfg_%10704K!aoWPQ~(7c2xo^g$je2_In zlTdVX3pPWAcwBGDBU=mHetX>7RE{gvt>7Q(~rpayd4^7ZjYcj1dZjSViat zGurxqX$h`-2WhUbMdF72t|B zh6&bWWx78Yw|4$=Ngh88Dp2y5ORCr=SsE!{V-N5SG>+J`DOJ%XyhI-pKQRnjw<%eA zrF1SY1&iu8yhRx0x}A+mE%+77FIYuj-$+Mhel+OQ_#;n`2|}}rOt(4olfq*-{aiwM zjlxTsIJR!T(Uc25o;!=}j2#~feB$YY_F9 z(cZOAc{A*Pz(+sS@G7~L9-cfhc|=l!Qct5WnQthyHpWe{4SmF|%g~E}b*r9aG{g+nqv;Ng)`az0d0j)*P)qI!ubDB^OuK7_}j`uHaDB zSS*^=Yk4U3wE?`@)kgJ|6rEA7AdLNTsNghG?2l=?Ez$gaT3#AqaV)YCFrLk>nq3TN z3m4dQax&bVNFAF|W|$uDyU;qFPMI+6@r#Mo)4Lp*Q6`qpf;ckuQqXjg)nUM3{3%<0v)Y(YoeHgiDC{WGbu<; z=E`3ej8?lpuTysJ8c+=WFv-nloyaoue9V2gn%S?*1oOC3c<3+2j>&8(cRmA|hg+9` z)bv9y@KAO@3wc(U*|`}>*RysVcrF7N9ox*R^r@P!(;)0$rU=Wk6&Vc7^3~^Vc835w=MRz z_6U(G3R<={3T#T9Rf@v{3@0N9gNYC{3@R?I4=+R+1NQ?%9A<-sTblif8;+O?uOVu9Wyw62nkh6zVzMxZv${7=%nil)->qPWh#mM7I^ws=r6260Cf2t3kZ?A`z) zP>RfRF>pw|*um{hWUDG-FNSb`OJF-)k_b#Q!ix+|0fgi2l6+YybST+DbSp_#X0Qw5_E+S#LBhlk1c&)>0E0_+b+;1 z@ck9|ib`qj%c35C+)wS2kvLEMN!_g?_7#W_f*ho$l zXbJ*v;@ll$xiV*CytBFc&%NjFQ`Q5b5tdqCkjKWse@ z@W9p@1_Y?xh|?YI#`t~Rkct7q(cuXSTiQ5u4i6qw8f1&~dg2~HF81Vz^OBP@KS~~> zP6ob9O1N7L%nfn?#2Yk#8cnth1(d%vjJhPBuX|O5{Gz;^NWm0e(cMeUJmyjHwZqT{G9KFubc2rDoqaX{vMThM%Cnwc^ zJq$FiT^pF)W38a}AzvRK{nT*o@)Y>!jsbkMHCcm??phOtuM~q^WoH3HjdMy2^~{EM zt{GL+nws}-ko!^(6S7CEhY7bOtrr{xwgf&><-8oY@d1GlxvFSqdZ=>en!Iw+qG{-K z0Le%RoCPZD!|(7AYp?xV8*nP>qq$Z&DVMT;wIP;RcW-hTPdGGafE+GxtXnfNOcZUs z#ul&`_oQ zzCPjg9tyd-J+srwWZH8zpduUO;i@=lf>*I-DAiQ4`2Hs61{4;1F~_o95uu}>EF1@a zoD02GDeiQ{6YBlN`s68u@>%IAl(F#UNHI{Q7vU(<+TpZz#A9+k6Kjp`yt$&J=VN1U z=D4XM&Qa2-aBP4yKN0=xn&{BVVDD%wEu(R2=80^KfUD!QF=;_Mjk(53CbsysPq(Hn zOqx-u{662|w(}@&6BC!(3+=h7tV$1Nl4k?&0+wm~tNavyr?R!# zIT5J)uG!7D+k54tb#`gC$N^NdtLa6&1vubkO*`bC)DLpmNIw>0G|pIf8k5#NO!o&$ zQy(4#l2m5q+ib3u&j#-QN8^mHmk0bq23=Xa+1VQo(t&}`hk!G>UZB6HWgS9-Dz=+= zR4kLddv3`@lG?%@#(oywIKeqr8htjtA!`ZN$7%lpa%nN*b}Jcd&KzO^ZIJNQ(*D8h zgOqSnUCPe9hYoQR%EB_+Zw3Z9V8UYFx-R8V_U3t@>{SZ4HR!d2XHGo(*0YsoKF;Ig z2PZ3EC8qM1c#KWx?K|~=i_KMVzoR#)+syq(UEoiIyDYajg@RAITWorny&^z>=&{@R zj!^~Ml4h}E5Te!u2%aiGNyf0XodlT;$UYA%;urMzx*n$#dz^>YRP20_)LZ#=J^nrq zM|dLp4hUAf=Mv6h~DXSAL9G@@~tQ|?P)<^uTi22Y$ef!kal7UFzy3U(Il9j zegc@^cTa%%lLUAzo7dGl{qhzGbq%v<#4=D+3RlLHeE=}@ia^YS(PyipIevv8?828b zKng73&7UX3>7SJFz6^BqC!(;mk_(OrCuoeZh(a*^s$Ra&+La;+MdEu5jj~6dy|IGW z?Ke&o<#H$jD$hIF1$Jw)i_uYChzBuYI}+)Fcks1aBCGb|u$?q^>>kp-PAtq)8dwzO zGe7%g2Y~H!1*LTowNDqMG4z)YA6F^D%y##C`~yL-n8c(a6)I`xFAR#PA`81X7ED!J-Ab@o#)KVyTb z)q1Xi`KdINL7IF|&&$kCbY-Q2)iaEgH~>zgbUfAQS|1ve?#1AJv8!TuRfXqe5sfBS z!eF_yT&v5Y=jM%9JBxO)8yS`mgJ%IetM@WCp)%aK1w@XU7XR-Dx!+a3A2+Z)9F=x| zX|%kJ@4L!Rfz%(v4eXAx?Nu5N{hmxI!=q34!5UU-NOOfIOHc5jCG$XETIz%0;Accm zJ8>zojZC1pUEsUj;8E}*2q-_C(OUOU*em_HGiM4H16CO8f>VCyYH055J^9pO~m2AlyFx<_L~ zplO$0ASs@U!FP=`wmav|6PxnHB!K02_lq-yWiBGWp3IJapaaa~?p-l2*^kgVqpy<^ zWAJQ~0~$*+@TpK>%#Kfc&BdZZU=*H{dpc)1VKABj2Y~mGK;(aK>}ky2^DaS1MxHQc zPHUuOm-`~{4EG;f>%p@5!NhP~oXY5C^?@Kqgy7+&6buZ2tb><;5*rSV)2qst1PB6< z0F|F1Y)ms#=|M>4PbgMGSD=I(Z2(FEE=qlp^=;td{br0hW+rPGi&i2lxUe1m1&KIK1)@USoL`8+;lCOchnY0`ZKq9JUG^*L?RvDJ%oc~Bioo()M;b4S1H(C_|<)n}fh1nOu1z`Wm9{3gTzfnRL?KfG8K;lrwp z29SnjmI?<4O?>P*veVR5Lnk;-oRI^#P)6I^oidZ2AdJ6As3`~)hWo|sgvfL&ES)>& z94E*pb5)*WGU+qUCZ^=a74cnqSbi6k4S(G8O0sr70tz+fF)7V(W-~`(nt!w7T={b} zKx|&%8wT?bTmWQ>;6wwdI*o6Bmlv4)d^}>z%m?Hl1ubEa7z6PEj0&U0nEBiu1>%Bo zIUh(qPhEJ`E-2FuvSIzyg=aLZLKtKXw-S{D&WWJh?Sv1bE7t$0M2+1{aWBWQrHgol zyoAH5=S5GjjL8~FNvROqHhdK`Cts=9>vCLgCp1edJgmDwoS5$!k>601 z?a-cH&7xOx<#|Q?7@vKY>6kk-62=TK<6|bg!s*j6!RAsq2Ig!>MVsG@h-$Yp`$u<~ zuKWniS<*atNwlg9rwN?}S3Dayi%@>D^6WK;ZtKap8E`G+%q zR8Ig^6wTC;!6!5+GxJG(%%WGSrk79X%aGvkm_8sXJPTtnp?M+*Oe7LiBK7)X04fPu z1C;|XHmVY7MFizg$;TR~+>u8cj*l&EE}dKYk3c0kAz35_EwL$_aRG%8NWXyVo)0?K zYyz<$@wDAUgJ38Y(Zr}@85$xB(PNhQ!Cnl()tXonw8=pPA0u(@l=L^5>PnCT+%*uO z@zCHfXRe3n<_z5&t}~q9-{w@gR_|z|nc8xOOzj*YEvG5=h4%a_)t>*4JbuIo_5#Kz zRHr{n+Mc-D%o_W})GG<_E;TY+99nZ6pv09Exj2Z=jy4F|gC`DEddUJ@7EIsTJ(F|v zg@5Vs{3SUarUiktiFzD&8*;2A*54v#04IM*pM9~_=-5K7c}1^qxdc{zLJwwPaD{8> zdpXzfC?+a7YtoFPqK!%wSY_7@HMtgymf+K_Cx6~*3NoY8+*X$-0GUhsnPL;0?uyO0Z$H;+|WtW4{$OTL43pE&^@Cyk5M^Mqi1p|G2>28 z39OFn=DdV+qd9P!uWSw+(I#K4hIk%24xYJ(#GE z#S5h0D2DWsf>GPVN`|bPpMX?TvNlwaeqG>5vhtx4=)d4h4#PXq6%~cvh1e;8Ip2496Vgi+CE5M0d|9>$zSO8y0URsqdPlj z9_WbFv<`s)9_XW%uz@98l6f*)bDx5{HZe(wcVk zOA-^LdS6)TNF&*?azFvax6?17v0Nm6DHEtEyY%!D4wX|Mi&hazv*{=&qmUw*!u7F~ zGdLU*v4`A3m-v;$ISSl@<`Y#08|-UC2GpW`T+-8eF=(u;)kbLK^?_2m(iduk3j!te zm117t>ojA^d9FHTq{3gAk~jQreK_GB2rjUyUTk!+8oP)3%o<@OR=`}1(_pGs9NDcc zSFco$IA5F7W!bbvv{CR%*l4Mt%Bzs_>S|uE!p=L7s$mlo_qSQF!X}h|^%|m}#hYcE zjM{V|7h9g<;=11yJ{qSnQuN+Yegs_e5PZ~K~pwT8D`MJWjF8!u5%lVH@p^#v)eWyEKtRbBc&H)UEVlyODGL#=?WXD2v#ST@e? zjAS~Kp7P42Qj0FJ5tm3#`l1w&dX#0%_(TM`EMf-B;sAS<#pd5$SzS)_;`k}rN<#Ma z8p;ez03Tk2Tje~iOr!Fe<+wFkd+Ne?B5Hw~tNC9x?p{HK{J)pEjhhfI;C^5yEHkh2 zm;U)OMC1klELXn~1X-LP$rhu@IbxDx)fQYguLn=f)0*@T^wQ%``5w}zk)AWmXuQ=I zYXFV%ud8CuKox3O`Ystgxb%e|`Z2nDZDaSkr1uD;qN>z}TWZv4IJvHI4;KAdTa$-n z-OxJeC{w#@$J)ehmLsIySsV9|%U}9KPX7d`AHZ{SPr}aQNXNI_HtXrS;533c%56>R zJrVrSy5NVBW1RRVcU5Tp!z=*538Iho@ zujS?~F|jI7I-1xIBS#3+`58819w*A4WU(FTRX%T)2zoox1}J}QN7A;b7%!ikMEyFR zxsI`dtzV-0@J}ge&T%V^1i(RuLAgibXV(x*6Dpg&3a9AcQ>Ns-@vZ!_dTPUr2e==r z@inK0>XeheCb=KW{6TzHvtb(HKrt;@V=>bdY_U6_wWA}?I&O>*{15;47p{ZINTwUg4~w5sdDl44cG7K-UiM1S)X$zR$?k0!+f>hT&3PISnfA(`e69b%FEOD>)N?k(P-Y9 zuN`ri`N)B=?G)&AG`#u7WE7oF*%E`;92e}dGMq0r`_T4LvgK~r*Zmm@rxcB9YLR&` zFOHsa&B-BRa_m7;*{J3j&bsyBAqV(ctKTKxRt{6-`t8xj6=Ch(*Y##G`gOg1g@*x% zgNL|f&1SmF&!_}(xCR+D1@NiJX{548nLe$zSM|{NSAIbc>ks8I=~c$ahiO?_Mwg$V zrRX#&uaV0W#a%||?8Ntl?QK!T_4(_TK7UCMgSa&Ei}@9T1G4r)QMycpTo<8vzuM3h z9I=^N!M%GUEi(H`4*_gI6bT?6e8m)Mm-bnexs^wp4%M^F=l&~IEk3ip>`+DTlIOfx z{9%KqM%d*R7Q;UfBRx+Wl1-d1gh0QwydD2Uolqp7L-`_p#OD%Ca$1pgxjitX(2b}n zNAOMDhNYGeg_UySW$eQ0cMK$2gN{f2m&H$vH**FK;Bxef;V+3K(%l+nBhg z*i@$i4MRO7TB2sNHA7B<&_N;Ne3MVU8`M*cgAcyZ1Lx{!T54H1>q=c=AeLd7bN@M8 zLDBd)aAjFH;O_|n0yY1R-uS&4^QlquG!Sake7&FMS^5i;jdVd@Msw#9I!0HaJ1}Rq z=j+`H2}q?Rd6;-Y5K63RB~ZEz(rw`&>CTZg?M=Fg%J3q`%>c zpnH@-ZsL$-&|Zv4J%IpW8Dgj06MOYrhKH@rtEEL2=Xb+ktEsTb(H@F}_l`J4!1G1~ zQbsQk(bR?pL~fLByWA@y9Sw`zH!e_RS}6fPyE`0+fH zS)Dm57nwRF(Kkk#dN?{H=NC`;179_e^wIPUya&Q3ihE<`*sTEG-8v%jhI!VvO(8PUo3)&y!?2tPj%8otFvLnAkw11i z<6c`rtOi9w0X^(u$?wv_=Fe^ka<8kNPnMP*;WUO}7-{pMPt!I7@QDX!+eUQ5 za-8oge;024VCy=*uRa_NW~4QdHKo>C8Gy*OHoyGnvftBGNehQIzpzv0r#K4P2DdBQ z9sPu=z1dtemu&sDW|uom@?&1SxrEK#ob#iLO_Ur$UiEo?vHyTllGU4@Z#6RSRP}0Y z{>tYy*;)$8@a?4sAY@y@HBj_m?rCzcBMiF~#>23Ts7SW0bj>KjS-d8H~ zaUiY@bG>CDnBtE?6(99;j$~1bfjJ|#}osOJ>P02Y5 zsND(o;6NaMO*v_+1{tCqXI(9ZiqeKyTg7i0K-4cElo1lf_Xs{@o=8fmG>R}l`o$iL zukK^z8Ffz>P#|PjSysyit;t5 zuz>YqT7OV?kq$tD9{?fT!uEBDFcGGT0x~EtpAcwo0fz3b{EP-vrpCfc@YIDbo9>bh zii_k9&{8V8JhrtK@Y8#l)rmLM1)LewM2X3XA_4I3^$(JZRxz}PG+oYr`2GleO}q z;*Kk)<65)fv1$!{NeK+qhHpzY|H%a^y(*@tuk$B-;)i*Ye|SYivm$Vg*7y*&7ZoOI z>4n4fhj9UtpmLG(xRC4cOQ_qu@6GujSsTkrh1mejqpCgDKHJIdQY zx|_970((%a1f(3E;2RJZoR829e?hQze51G>(>KwDcdGrr zTAR&oXN%wovuKrp8yD~*#{Yq{lkg?hd9d@%OYJr{!_S5$FV45Ev2mKXiEO@h(IpJ- zm6}XHq3r_r?90)s=LHbX7;iRv&KQb)ofF}5>poJ@>$&8z?(p5d63KO~98Hf*`1-hX zY_VBwA!3cESPl34*evfPlGLN!%&)J!Zb^rYU@(|;p{e`r)w^CYH^-5AS@tiXxZ;c{ z_X78WxtpYL9XX)UXmBRy~nys49 z)3nj)z=d$0J|}#s9#CkAZW=d~4IDY%Q?I(nUY8p6qikqrcU7%5t|PE&oaL3C?JPIO zolf-@|4z?FMCiHm^Tn7t4xrS|b?wU1SmtxqN(aY#aDY~Gu0B7`pxH_Hilt((_onr> z?sLtjHYb+9_mr9Xz-3^App%s?K%~)~xwGKmL5nvemWybujMIKy+3iCuBoiFFP>u#W zXiCGxtJj-G-KrQ7L_?41D>H6pQv4hWE=o6@;wY=Ehk1aWaN?&y1(uIT&=i^@)4fGTFrsFuE za81*q4MJD?1vbNUr`0Xe9m*CAjdg88Qj)1)uEYo1r_X`LP&bWA#Fo!!4A}euSR`ON zUj~$fCR@u!Nw%ki|6jbYP{k|3I$3+&9LK(cWz8Gg%JMh1mBBkIjPt^gEMUCEIU#(4CCEuDP%jTB2zWglpwxENdb>O< ze_-UV5w|paZU^~7>wt5fu;)6v#m$$B7=bjuxmTSp#IfIds`7)P9DhoW@7Lo8^w8O^ zl^^2GMzMk2T$LXtFjNOQkeNb-Bjj=AG9mIVk6+ZM)b%06{aF>P!x<|N0u$kfd7fC~ zFl!Vz&yVA4T{^g_gL$Tzo3!*H(gQ7EJIEoY7PdhsVrH>X@}l|d@4JeN?G2ZO;lxQ@ zs6>}2P;yvKtt%dK#{R|eJhd6R|6k~fJhaOUr@ zVDuhB64V%D{AveR{C^w=&fPdkO}XQ(>Sb-QR?`LHY)WvW;w(~~Jn6fu91nwXkzJ`~ zAWXL}*19v7Ag&x!O`H3dd1+uDOKHGEya3o2?kUceCg`O)(5VMm*&~Mthjs^Ex3uIRmuD7x!J2V?EnACTxC0`CfR}YZ+Q3CZKY>$ zrqgZm55zVlhR104WJ*eDQJA}&<1ykIm_JX7q+g%X>Twdom#g)d@E8P7*-gxw7iGa2 zQto}l%z=j)6wAAsD7WXy(U%8^vV|p3tIK&y2Zhui-ipjnb@da4FK&9R+8^!8Vm~6uJyQK@QbFg zJ1cJr3K8_hv|#C5(A-`@k*1AC8i9Q4jW9tdZIA0s8i!C^nQebiVXrFe@9WJbPz_t< z1V#9OhQ6LDlvf)Ru~CmrJZ^gW1ZEkwac`u7--p%FIrC>z&7w%r3WPOp#)kKdbS#pMyGNRbb@~GQ^_s`S9xcoG0L>M_kidm0pi-9MmZDi~rM} zFn&D5yU4f4^#Hg=f&+;T_$9y|$I=6mP2fR*J`5mB2W-!(`AN!g{_;D?GZfhZ5E7f_(Qlop% z5%IfJEFIs1k1tK#B7{QbQx_h$t{8hc+NrMmQs3aE&V8+(2y_v$I`i?mmkqC1=Y(n zF+B0yWc1@SfZG!tKcohDgmyE8e0Lr!6R);BSf;CaLpc1Fvofj3Zqy`GJuTor+QB8f z*GJ>pt17vZrpQMZSi@x9As5)lilbuOYtE%DQLLJCf71ESW#wj56>T)U;=v2-qI;Bo zEaPcAg;I_VMLmWFN$DUExqwCm90D3`^Ukt0b!3;E6KJxBsM_f!$bv{zss%(RMS}X{ zf7;`}Cm#yIk(NN*0UVe9`fO6%F99n#>c;1TKAiK8WOhsP+EB9e?L$k;LtG53I=L{O zNyn2I_hxSPc}ORc!q9L5?aIp~)$D7$PhEJrq+4qD>6Tiqz1=~u4Om?L<1m5vU^t$^ zcpWQnS8@ea@{_~V^cE0sZ?dOF)BN$kHI9vaSf`lcBdU?-sM+vwrag>2Zp~bEn+)T< z{CR-+zMc*O=h_%wZrx!5qb8h~-K<_8xF>fPKFzyx$Xt0^BdI>$pU?KG3zNw;CK(rG zJY+SJX>yIhO=UfLYmZlk{%lD`0i9z@zr+>JfW?^Gx?h(k?H75 zsTojf-O(P(LRgNCL1#Iy)3RY3}rGKO&d>M5I)77|p{B zel$KxY(W}Xe1dEJQ}>a?Iq0-wo;JVFCd_D+Bh+D{%kie%A<9{){%Wy>*LF6u`)5Bo z1HCnCD~5hLrCocK(a1|r3-5ri)-ZAkpBf&HP!biLvb`l6&$==^x=MG@7WB}fn%mOe zpAcRoo?16LJ$fPpVZgzYnc0{gF$^v$Qqi7+;A}4 zo@bM|0)ov>#lH7WM>CIhR&KBC)ATv2M<*Yfy_PLgF$c)5NsDe;8t5C}@v2E4ocQpL zvJ!Y*DT<*K&i722NY3O1M64@9vCJ*QnlIFpxjIfo=8i3BA2SZPoVj$Arsg-q{D-e) z50n07PK80eu1>lQkq*6_Lg4{J1XHn1@phFD0z{R^ z^>{*$59#q?9@Y<_WN6Qbk0T&K(vly^4W(k>f`u2vV!c$Xd=*Kdm5=E09FO(VFe(1% zg7B9FS8C|S*y{P5mS%qxb+^Tg4lK}pDVeUR&}2-eXE~D>VEBw-A=S95HSFO%p1({T z_s%`pgyrrbNAAjRF(`KP-V$EdwhL%F6q_9)`?TGX2T*|RMU;{1rmi*M1Awp>_%N9~ zp#}jU+Sg9Fkp)6o3q6`cYorRrE;uLKM=5+8|FCZQ&<CgGz$IK2$uZJgtY3i{L7} zZBFXV-V2-cCh-Ccj<&zay=+++ZH_C(M=RKiL5m?|!&9UVpY4y5#GucuZ9WYwe5+3? z!7q{CaT0obxZg8MEo7*3nSCy8!09nn^v{&%b=C35_4si;{yAY|59!THlbVv)6Z^DE zl8gt&&V3<-l+RSTb1W1m7L%SXlJ(#vOi!Cg8;7989DdhVkdBOb%l_TI< zxm$_(O|Be@KZmW?;-dFnV+Ri_X;Y^z|%AF0cW)a0j&HR;cceBI< z&Ib6Xcb?F?|19sgfaCSFjYDVUq^?=9a)J~@}`YL&bB zRY`~VGNzQ0K&r8mDXnS&1mYn%P6`gig!xw97)Mx15N5E`V$oolOrPQGmCoj`od}ts z`&J6xVclc}+u+TF9DuQEc>=2&IYK^Ev9+B+<=n`zE{*i zDI8DB?!}$Rka;mwvlF4km&5#TQZA`+h$F}ZmgSVyC&iLg@9g2Csk%lZ`e8nN4>@)! zfKHP*92UP+;w%X+Lt!f;*NTz_o_#b-1aR!ys94=@xqp{7CelCjEUWu;7Yn>P41J8b zs)cWlJ>g{8ot)!Zh~X|*XN)ABe^KI}W&(-8TNg{8!$Mn1Ug1hj#Inn9=rn1!hCh3u ztoJ=A9R0G}?a|goM(~j3I12Fv9i?tShVzw{UMLGV?$c!qz0xSK4=BEcf{>ymmK#dQ z7bGWG0t2cgmMkKW1#>#}D*A{KnOG6Rk-Bq%{oy40r$tj}J}men61^#;JClmUuogJcQ~(!S|fM&h(ivlCWSoabwb_9F)^->DT<$x zTK)mI|ATqwxdzq{;Hby@1?|qa!agL`igXC%d?HsJbT$oZ+o3)DyzLOl+<<~8rdk*% zb@)TYU^Ir`ZQQyaR%)qRG%8rDVsI|gA7h6q_rwMmdOKsOKL#HvdVJLN9ZfEO#E_@T z@q7^VV64~CHJV3DVntQSa16ajH>$UhzK9urh{KkA0kNLQh!n<+TlW~IZE z?hL4b{*VlOV->*Ln-Zh3r;^U84S9EBV`UfL0=iFHfN?0GEV_HZPEOzxi_gA|wx4V-&)1z6@c`GgD6rQA?umhc9#PwsH?9C_ z%JzTJr`yU+pnJ(66kg;c!xy2Kf83CztP>LpwJSK7;(_K3cllXFans$p^F)f%B6OC> z$7p061w=#Q5|4qam0yxdKOHNg8Y?sN%epACzKll}vZVZ&Xe_%P=9Zh?)%}&fL2;Ic z^WCc&6&nNcGnJ-&Qy+$bqa&ZWX6-=kQ1tJg%AO?encgl?iRW&QXPnA%$-R;9VPY7N z$vv|&o;a*3=@Mow$T$#2ppnDnKUwaS6$e6bfeTcCOU zfrQDtPPV~aM5ouO&m0%0S?T-4^hGdkCiG1&Of#M-n$897m&9%G3J{>KXpw7fw3pev zk^8W2LJp~tGwo`NxXVaT8#_Uo*e?2KSbrfqNlda)@M0}%&YWzwW}9;sIV_Z%o_hAB zFnD%x7sM#utpk=Jku|z6w&&(h9!Z9;)$7kQy?E$2`LvVgAr-aF#j$fJHfAD9=x#*i z^lMmkepBg$Z*UWwugx@KzpK!cjt#9GQKO;9Aqt?bQc^7y5RY+K)e>U0S~)9uLHvJ+ z-o|Eg>|tGWAU$AF_!Q$4-8gB#5mz)?TvVef@=>eY&cn&pE|Bq(1+F9{*MksAW?51X;%<6~;#>fF;?hD?vj|&Nt!uXiy9T=NyPrG-AjInQ34_XW z-Y8g|IikBG9m!JV)8)o%m4mqY+ly~nRudqp*07rUl zW7pdx<=j!)I5bk)%5m8DmL4S6wxPM9Jwx{nZzbdkpep-)Eoc6RII53i)6(WGb%;AkDZ(d;!?>_S#xz_cPI&hoquz1sEGh8VF zHs(s(v&)_N#wyz9iD+beQX)aLEDhj?LGznYb5YMt;XV z!pt>8ruYSx2TgnZ(!3Nb#_^vsjR_WW{+jFTF=j`@1N`UJlerksIh9-8h_6omuKeDM|4E@3m3worSvL{?;?(P>)qz4@(6DeDxBJqB3PP zCXJ+ldM?+H?&7ook?WS2slV9!7MBX3dO%I<0cXK^48_DmF`{`hv^aFn8{iH7q%sD7 z0G4Pk){?93UZYJ`y^RhAC5Ib)!tD~yH6KB)2L>9Ff-h+!8&8|F<~HNJwSGHHqL_}F zD4$5}XVjy^*T((#$TcW;<%1whcfMt3JHC>qa*P=*H|f08m|x6(l*sA)>Ni74z9et3 z8hayEa5eTu3!Kv9=>pN{@`Fe&$^?s%+ll&1pHbdBzIQTxSxmFM_-ia;CcECA!NHk( zxs7u)FXmhowY)gdZBIyWK>uyL!QFw}B~sG@P;CNFRM{Yi6NXTHL{b<-9ZdpHZmb5U zD?p33t+tneM($%k`P&ZU#s)8O%*6^5C*k60uGf$FO=Zi|d3Mz{n3ZDpdU2t5exY8m z{sSH5h{Hyh9G%4iP)}=bw2?D36v~wEdhl7G6B7gE*}T%Tr(b-g`tpgh&xbS>#MHEo ztFpjDp8gCuqmgx(;?puV>4HDAeRlQrkmqaio!4`mLy{-+AZteRHrvDeN^{XOcRdit z65_yP-D6SD@v;pD8Zu_8(_9JA=r4x?Py6=A0?)3${;}Ve$@JONTE8=Fm~J2fv-&K) zYGvkVfJ2?D-Vsi$LAsx8*HG7;DboNpMl2Nb)Jr1wO0Ior`9gbjsLwE1ofT9%`crD$3 zSMHLEqxj-1D<3BUoz*RBAsd2@q#Z2V@B9F81RAnkDR0jxu^O&UG{RE zT(b^qV3|biK^||cL^}$6TWDoC-g*v=1&Q9FN)`q5Uf1YJ*g(eVv6k$m%+;Kt2on>z zcBvrkW&zly-Ic$DM@1u~xu3L;$;8B)9>?rE0sOOGQETvkvc%*ID-@Rt58ePZFq3N* zAIm5Aeh?TH0Ccf;Xn1c8Bd=im7yE>E2J?0LX3?}(H0?)dTD0R`nl|VWQ~>5X3}%ki z1~J9WH#SB8CB+CMUz?4KRlmxob*|rZJaK4XY!K{N-Gdh|r(;}lyMIkL)(o=>E>;~3 z;a=U@ytilvcSOh1kY0oj`|b=bjC?+Gs3l#aSK=^m_<%sf-$VM8tvr_d8JqQc*^ClX^#fFl3aBG6XF|j#+s9jNj6lhX`ye6 zcOMH{DoL+bj>b8rW_`2w7f4t96PG`AygE-lU#XrL*YjyX#&M#KeuIi*5(;)hP3!4J(Kfg%p#c@M+!tr#Xa}ilb8cHGrs$L`I`7B|#Ue0Y;BxqqL1k86$@2CKyFOAN-?)PycY-+xfg^q5P^`NKe{!n3l7;vF|H`z3jDjJv+Q z+A3c;O*6A^eYdur0!yW1GNf z%YJR3L41Qm7JxLkcb$h+aQ}m2CF~Vw6MbE6P3=bxK6YU2!-r5JArHxQ6@eXfaKWY< zC-$VmT&81s*H#CqDnQA+YEHkUHY`jBq!383unKPmHOi{pe&1><+0PC3Ek8_PZDqn@ z18}guZ)mZtsU3v6_uCz0lpL4cOm~8fZnkFIo~?uQ=!~z$)Yaj$OfL+9wWIy{E%10J z9}!s#Cnf|fRom06qO{p8p{EF2YifsfVq_ZWC(HI=+uo0oJNmheJg z%e91s8676xHu*`j2Y_2!dkpDmO9Fl~6bgX4&fMl3>&=W=dPJDsgnyaD^x zyOFox9HCCvF_Ne!X|1Zjgj`R@q%w%3alnwXO$^L8QXYsL$4yPsLci#mPr^-Q*}tT{ zXV+*b>N*z3OBR5%ux^A+pap-;yhqNUzuM$pRoUL)Wg60i8yR<&Stp2|>GQ~ZRuOoV zb2T(D?(uaUYqgjhbt)BQl&YSKYUoP%T=bS2MuY&dczGe`17-MY&PWH5-#edE8jaE$ z&Gx)(cavEth0Lj83W@{!vVRK2e#ym{`C0CWYl|BCM{5jdigTbZRIQ&p`N={rOxO6@VFN3)Y=iN+!4Km)q{lj!sfLXOu>Cg6%b5f!I%rfz^$z= z%F+n^W;|Vg6reH(ZhX!;UYn=|_u<=~D}4se5b0eJt)l4+UK>K469cD74fK3mr$q&v zRHp)slKIvTpUZ~=I0#N3+6@*Um*fj4S>te65eu5Y|*GlLLt6=$n+ zwIq}%Us0eBou^%VGTTj1PjenC6*wx_yW|(gW%81Fw;3GhY+rxo2{91bAyEKTRI!?` zt#xzqUVHWbR(9?%a$RK{-v`*fW)fSDgcd202RRlKXLmER4oX18U^$*p#9)mFEQH8v zSNeX6zfaY&e8xIBTi#c+AlStp&D2!ZTW3WMm(5b{JzEeAR@K6Nm8VS z5dnRAn=k9@6@UV!$?gJM-QFw6L{2k5hbpaSI%4|n9GPrE#H8eEE_mfzUu+`2RJcSE zm8Mw_W>m6TBO|8e3cL>-BJyVVWQi^u_xvl9<*IU`Dc@T)n+Dwh5EA-&tPEaeBgl~! z>QZrQL&GPOHCaL_CY`MjEm?L*C7zH+Lzha!R7_;VnxA+zEDnZXMQS5jsa_aNYmqb? zj%BRAL+Dt6f1~|S@dLbvDHoJMtykMQn#GpBcncS#t+$4Y31!eTOar=JZylTEW;oF; z1Xrl1rnMJ7q0e*np&e+=Xk@-2&2ly^6}bB9y`56vlq zCtgkjiyEPjxh~jTq?Qi*LplZFM9j>iNablTQY7FgU8;cQh|ApWty{`&+=naj?$)~P z4-5A%H@H(ak58F2%9-YeY}KBPb$@=jeY)T8xBHZ{Kji=6kTUmO?jhI1;ZP7JakN?@ zx;KF&36VxmQe3Ui$a-&aN_DjSW;xv})T&ZQ4W0cL+z9h!xifJ^VNGHiR9oLLutVkE zkw6SPQ#CYJqn|nJx)sI4Nu^hUX+-OE_V-g>A&u$nn&^WUhHc33m4+vuLxQVaZ9R`z z*bX*c8HAGL6f-BU2!zL3*)rYZLs<@wF&*`&E1XuGqE^aQ!TZ%hrpOucVZ;XIQ9L5{ zQc=5558LrvRnLz!fqACdi#p78^HDp(`Kuhr3aNSPwtYg*n*WrEztC&#RjPu`Wt{S? zXd$*ZP^HKS5MRx01cK;>Y=E!4|Li?l{u6%qjmm+wdKg6%{NsU9A`*{OX;31djMPyo z_jkMNz3(B-Ac$Z~6#%(O0_Vp^{{Eq&rtE$FPk;UGzyERfif#QjH*8tvBV=t0LdAGRJgmXf zMZ8C-WaHxI3eNl1nUTt@nD*%?+P8+LGN)3P6#hj2Noa`@I{*)d?O{3LjhsSxD z^!9)USLCmuUsRKOzIu8|ZLcjU@}i!pq(cSP(*!O)sBwy$-Vx|FyZ?@+tkjB-3p;cd zc$8JWpHa+EpM)}F_EX?AbMXIu@=Kae^=#Hftj~m6Tv>-HE%OU6PPEG`LRmXj)lqs( z`@`+AqXANFsf-;u|D7G0+Jqr#tI&s9 zSQQXwOyM`kD-7cs5AtQS!Yp=V2GSYUl4%9$)Mw{b4e1d|=6W5k6xGdNki_E2l1%iy zZnxWh!y~qAU!P%B(a-@ctw6kGyVLYQN$nsicQ5%oR6P55uusY1NhyLNmC@I@kFY0x+1G(1JDbujZ%#uNnNqMz5R{3XY zK1e_qG5Z9EvC0CSsW)b8P8hHkUgl6el6P^t_fq-8>HW^uB`ls>w^qJie=k_5WkP`N)BfyS|b(O9++;n{tA2P_F{jWDwYKC0H^h!X;* zpYZu)nv#6Z9ncao(=j#>@5Oc-@^a?6VQZ{Pn@mT$bXU+m<(wzjjW@67y70}#Zcnli z-KLQxA}W#zL7DBz{!?Xw{AXZoUiU^LQq;uq$K-ljOjfi;k}-l#UdoEjOu}`d4@Q9s z`Hn+_Gzxq6G|->2x8^9(9d;R~5V2CTFd-T#^Vr>edv@;!qT8One?PZ-)%!7D%eRxH z6ZlZ*qHXI5Xh_@F?lflQw^bM4z8|PC3u+D=sj092V*F6s3cad^e~@-26sn%d*D~I==D!cei2#K9$#7 z#%XkHqxx^^1i>oy$Gfbr%2fm>?xm$F%{)$P@UjvJ53;?@;FOq3&3?|cot?rt=mVuu z(U1=vR1|!Y?6A6Y5ZvH>W%v`>1L%^z@Kyc1t{?gBxNRopJA-fQrjUn&KkCQcNB`BC z9f|BYWM`zG=-w|>5iiRAT4#UI&-?oMoqm3=AG;3KzCsR<;q5pa6vI(46oD^-V!Wb{ zUeM(QojDSQf=LXn=|>?|!rACO&fI}lr+Y?+-?X#W;9cDp2A&Bhe=k4V4!10Maxq+K zkkX+gnn~R0%9rH*NbPf{SzA8o9jMd-tJLTW(J#)E!~X!8 CuT~rY